Molecule FYI-1000171

A

Molecule Summary:

ID: FYI-1000171
SMILES: C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O

Received at FYIcenter.com on: 2020-10-05

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000171
FYIcenter.com

 22 24  0  0  0  0  0  0  0  0999 V2000
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 16 11  1  0  0  0  0
 17 16  1  0  0  0  0
 17  7  1  0  0  0  0
 18 14  1  0  0  0  0
 19 12  1  0  0  0  0
 20  8  1  0  0  0  0
 21  4  1  0  0  0  0
 22  3  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="105" x2="135.5" y1="223" y2="240.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="135.5" x2="166" y1="240.5" y2="258" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="108" x2="139" y1="216" y2="234" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="139" x2="170" y1="234" y2="252" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="105.94519693878" x2="105.94519693878" y1="148.31428571429" y2="183.73571428571" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="105.94519693878" x2="105.94519693878" y1="183.73571428571" y2="219.15714285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="166" x2="135.5" y1="110" y2="128" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="135.5" x2="105" y1="128" y2="146" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="170" x2="139" y1="117" y2="134.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="139" x2="108" y1="134.5" y2="152" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="228.65008571429" x2="197.97512857143" y1="148.31428571429" y2="130.60357142857" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="197.97512857143" x2="167.30017142857" y1="130.60357142857" y2="112.89285714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="233" x2="233" y1="220" y2="184.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="233" x2="233" y1="184.5" y2="149" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="225" x2="225" y1="220" y2="184.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="225" x2="225" y1="184.5" y2="149" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="228.65008571429" x2="197.97512857143" y1="219.15714285714" y2="236.86785714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="197.97512857143" x2="167.30017142857" y1="236.86785714286" y2="254.57857142857" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="290" x2="259.32504285714" y1="254.57857142857" y2="236.86785714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="259.32504285714" x2="228.65008571429" y1="236.86785714286" y2="219.15714285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="350" x2="319.5" y1="216" y2="234" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="319.5" x2="289" y1="234" y2="252" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="354" x2="323" y1="223" y2="240.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="323" x2="292" y1="240.5" y2="258" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="412.70488877551" x2="382.02740153061" y1="254.57857142857" y2="236.86785714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="382.02740153061" x2="351.34991428571" y1="236.86785714286" y2="219.15714285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="473" x2="442" y1="216" y2="234" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="442" x2="411" y1="234" y2="252" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="476" x2="445.5" y1="223" y2="240.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="445.5" x2="415" y1="240.5" y2="258" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="412.70488877551" x2="412.70488877551" y1="325.42142857143" y2="290" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="412.70488877551" x2="412.70488877551" y1="290" y2="254.57857142857" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="476" x2="445.5" y1="358" y2="340.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="445.5" x2="415" y1="340.5" y2="323" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="473" x2="442" y1="365" y2="347" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="442" x2="411" y1="347" y2="329" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="474.05480306122" x2="474.05480306122" y1="431.68571428571" y2="396.26428571429" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="474.05480306122" x2="474.05480306122" y1="396.26428571429" y2="360.84285714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="415" x2="445.5" y1="471" y2="453" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="445.5" x2="476" y1="453" y2="435" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="411" x2="442" y1="464" y2="446.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="442" x2="473" y1="446.5" y2="429" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="351.34991428571" x2="382.02740153061" y1="431.68571428571" y2="449.39642857143" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="382.02740153061" x2="412.70488877551" y1="449.39642857143" y2="467.10714285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="348" x2="348" y1="361" y2="396.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="348" x2="348" y1="396.5" y2="432" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="356" x2="356" y1="361" y2="396.5" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="356" x2="356" y1="396.5" y2="432" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="351.34991428571" x2="382.02740153061" y1="360.84285714286" y2="343.13214285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="382.02740153061" x2="412.70488877551" y1="343.13214285714" y2="325.42142857143" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="290" x2="320.67495714286" y1="325.42142857143" y2="343.13214285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="320.67495714286" x2="351.34991428571" y1="343.13214285714" y2="360.84285714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="290" x2="290" y1="325.42142857143" y2="290" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="290" x2="290" y1="290" y2="254.57857142857" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="412.70488877551" x2="412.70488877551" y1="537.95" y2="502.52857142857" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="412.70488877551" x2="412.70488877551" y1="502.52857142857" y2="467.10714285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="535.40471734694" x2="504.72976020408" y1="325.42142857143" y2="343.13214285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="504.72976020408" x2="474.05480306122" y1="343.13214285714" y2="360.84285714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="351.34991428571" x2="351.34991428571" y1="148.31428571429" y2="183.73571428571" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="351.34991428571" x2="351.34991428571" y1="183.73571428571" y2="219.15714285714" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="167.30017142857" x2="167.30017142857" y1="42.05" y2="77.471428571429" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="167.30017142857" x2="167.30017142857" y1="77.471428571429" y2="112.89285714286" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<line x1="44.595282653061" x2="75.270239795918" y1="112.89285714286" y2="130.60357142857" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #ff0000" />
<line x1="75.270239795918" x2="105.94519693878" y1="130.60357142857" y2="148.31428571429" style="stroke-opacity:1; stroke-width: 2.9828696882035; stroke: #000000" />
<ellipse cx="474.05480306122" cy="219.15714285714" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="474.05480306122" y="235.56292614226"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
<ellipse cx="290" cy="325.42142857143" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="341.82721185655"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
<ellipse cx="412.70488877551" cy="537.95" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="412.70488877551" y="554.35578328512"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
<ellipse cx="535.40471734694" cy="325.42142857143" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="535.40471734694" y="341.82721185655"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
<ellipse cx="351.34991428571" cy="148.31428571429" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="351.34991428571" y="164.7200689994"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
<ellipse cx="167.30017142857" cy="42.05" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="167.30017142857" y="58.455783285119"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
<ellipse cx="44.595282653061" cy="112.89285714286" rx="19.388652973323" ry="19.388652973323" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="44.595282653061" y="129.29864042798"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.285871102544px">O</text>
</g></svg>

✍: FYIcenter.com

2020-10-10, 112👍, 0💬