Collections:
Molecule FYI-1000216
Molecule Summary:
ID: FYI-1000216
SMILES: C1[C@@H]2CC[C@@H]3[C@]([C@H]1O)(C2)CC[C@H]1[C@@]3(C)CCC[C@@]1(C)C(=O)O
Received at FYIcenter.com on: 2021-01-05
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000216 FYIcenter.com 22 25 0 0 1 0 0 0 0 0999 V2000 7.0157 4.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1432 5.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6103 6.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3975 6.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3403 4.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9567 3.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2824 3.6412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7863 2.3687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8707 5.3474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7411 2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5559 2.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3706 2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3706 4.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2533 5.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1853 4.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 4.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1853 2.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1853 0.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3706 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 6 0 0 0 6 5 1 0 0 0 0 7 6 1 0 0 0 0 7 1 1 0 0 0 0 7 8 1 6 0 0 0 6 9 1 6 0 0 0 9 2 1 0 0 0 0 10 6 1 0 0 0 0 11 10 1 0 0 0 0 12 11 1 6 0 0 0 13 12 1 0 0 0 0 13 5 1 0 0 0 0 13 14 1 6 0 0 0 15 13 1 0 0 0 0 16 15 1 0 0 0 0 17 16 1 0 0 0 0 18 17 1 0 0 0 0 18 12 1 0 0 0 0 18 19 1 1 0 0 0 20 18 1 0 0 0 0 21 20 2 0 0 0 0 22 20 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 477,460 550,395 527,376" fill-opacity="1" style="fill:#000000" /> <line x1="367.9259311259" x2="422.1019299571" y1="534.43698918141" y2="496.80112176975" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="422.1019299571" x2="476.27792878829" y1="496.80112176975" y2="459.16525435808" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="282.19998503357" x2="325.06295807974" y1="489.61606040737" y2="512.02652479439" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="325.06295807974" x2="367.9259311259" y1="512.02652479439" y2="534.43698918141" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <polygon points=" 279,393 268,491 298,489" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="392.41098037259" x2="335.28391108514" y1="326.99264007868" y2="359.97394486651" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="335.28391108514" x2="278.15684179768" y1="359.97394486651" y2="392.95524965435" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="486.11718645324" x2="439.26408341292" y1="302.93876519806" y2="314.96570263837" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="439.26408341292" x2="392.41098037259" y1="314.96570263837" y2="326.99264007868" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="486.11718645324" x2="512.03359322662" y1="302.93876519806" y2="343.78016662628" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="512.03359322662" x2="537.95" y1="343.78016662628" y2="384.62156805451" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <polygon points=" 487,303 536,219 508,208" fill-opacity="1" style="fill:none;stroke:#000000;" /> <polygon points=" 393,327 372,423 402,425" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="386.3321286543" x2="431.3050287213" y1="423.54035591602" y2="441.35280513705" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="431.3050287213" x2="476.27792878829" y1="441.35280513705" y2="459.16525435808" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="377.17144048349" x2="384.79121042804" y1="239.04720626595" y2="283.01992317231" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="384.79121042804" x2="392.41098037259" y1="283.01992317231" y2="326.99264007868" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="293.39638168679" x2="335.28391108514" y1="190.67792451217" y2="214.86256538906" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="335.28391108514" x2="377.17144048349" y1="214.86256538906" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <polygon points=" 210,240 301,204 286,178" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="209.61425445786" x2="209.61425445786" y1="335.78576977351" y2="287.41648801973" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="209.61425445786" x2="209.61425445786" y1="287.41648801973" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="209.61425445786" x2="243.88554812777" y1="335.78576977351" y2="364.37050971393" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="243.88554812777" x2="278.15684179768" y1="364.37050971393" y2="392.95524965435" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <polygon points=" 210,336 187,431 217,434" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="125.83212722893" x2="167.72319084339" y1="384.16211995952" y2="359.97394486651" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="167.72319084339" x2="209.61425445786" y1="359.97394486651" y2="335.78576977351" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="42.05" x2="83.941063614465" y1="335.78576977351" y2="359.97394486651" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="83.941063614465" x2="125.83212722893" y1="359.97394486651" y2="384.16211995952" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="42.05" x2="42.05" y1="239.04720626595" y2="287.41648801973" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="42.05" x2="42.05" y1="287.41648801973" y2="335.78576977351" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="125.83212722893" x2="83.941063614465" y1="190.67792451217" y2="214.86256538906" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="83.941063614465" x2="42.05" y1="214.86256538906" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="125.83212722893" x2="167.72319084339" y1="190.67792451217" y2="214.86256538906" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="167.72319084339" x2="209.61425445786" y1="214.86256538906" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <polygon points=" 126,191 50,130 35,156" fill-opacity="1" style="fill:#000000" /> <line x1="125.83212722893" x2="125.83212722893" y1="93.932292572373" y2="142.30510854227" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="125.83212722893" x2="125.83212722893" y1="142.30510854227" y2="190.67792451217" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="208" x2="166" y1="42" y2="66" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #ff0000" /> <line x1="166" x2="124" y1="66" y2="90" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="213" x2="171" y1="51" y2="75" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #ff0000" /> <line x1="171" x2="129" y1="75" y2="99" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <line x1="42.05" x2="83.941063614465" y1="45.563010818593" y2="69.747651695483" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #ff0000" /> <line x1="83.941063614465" x2="125.83212722893" y1="69.747651695483" y2="93.932292572373" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" /> <ellipse cx="521.73501646308" cy="212.99296506407" rx="27.166030853102" ry="27.166030853102" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="521.73501646308" y="235.97960655516" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:52.242367025196px">O</text> <ellipse cx="209.61425445786" cy="45.563010818593" rx="27.166030853102" ry="27.166030853102" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.61425445786" y="68.549652309679" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:52.242367025196px">O</text> <ellipse cx="42.05" cy="45.563010818593" rx="27.166030853102" ry="27.166030853102" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="68.549652309679" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:52.242367025196px">O</text> </g></svg>
✍: FYIcenter.com
2021-08-01, 240👍, 0💬
Popular Posts:
Where to find FAQ (Frequently Asked Questions) on JSME JavaScript API? Here is a list of tutorials t...
What Is Tanimoto coefficient? Tanimoto coefficient is a metric (or score) to measure the similarity ...
How to generate the molecule structure in SDF format from a SMILES string? To help you to generate t...
How to generate the molecule structure in SDF format from a SMILES string? To help you to generate t...
What is chemwriter.com? chemwriter.com is a Website that offers ChemWriter as commercial software an...