Molecule FYI-1000286

A

Molecule Summary:

ID: FYI-1000286
SMILES: [R2]C([C@H](CC1=CC=CO1)N[R1])=O

Received at FYIcenter.com on: 2021-03-05

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000286
FYIcenter.com

 12 12  0  0  1  0  0  0  0  0999 V2000
    4.8498    3.7834    0.0000 R2  0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4250    3.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4250    2.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    1.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7837    0.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1531    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8532    1.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9163    2.2528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.4834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.7834    0.0000 R1  0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    5.8834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
  9  5  1  0  0  0  0
  3 10  1  6  0  0  0
 11 10  1  0  0  0  0
 12  2  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="349.91190808036" x2="401.00729170208" y1="419.94680456879" y2="390.44600571098" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="401.00729170208" x2="452.10267532379" y1="390.44600571098" y2="360.94520685318" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="247.72114083693" x2="298.81652445865" y1="360.94520685318" y2="390.44600571098" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="298.81652445865" x2="349.91190808036" y1="390.44600571098" y2="419.94680456879" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="247.72114083693" x2="247.72114083693" y1="242.94201142197" y2="301.94360913757" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="247.72114083693" x2="247.72114083693" y1="301.94360913757" y2="360.94520685318" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="349.91190808036" x2="298.81652445865" y1="183.94041370636" y2="213.44121256416" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="298.81652445865" x2="247.72114083693" y1="213.44121256416" y2="242.94201142197" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="357" x2="350.5" y1="66" y2="125" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="350.5" x2="344" y1="125" y2="184" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="369" x2="363" y1="68" y2="126.5" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="363" x2="357" y1="126.5" y2="185" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="477.667224734" x2="419.95523336846" y1="42.05" y2="54.318117925009" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="419.95523336846" x2="362.24324200292" y1="54.318117925009" y2="66.586235850019" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="543" x2="513.5" y1="142" y2="90.5" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="513.5" x2="484" y1="90.5" y2="39" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="532" x2="502.5" y1="148" y2="97" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="502.5" x2="473" y1="97" y2="46" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="457.70782710677" x2="497.19253917803" y1="231.93399904817" y2="188.0873831458" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" />
<line x1="497.19253917803" x2="536.67725124928" y1="188.0873831458" y2="144.24076724343" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="457.70782710677" x2="403.80986759357" y1="231.93399904817" y2="207.93720637726" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" />
<line x1="403.80986759357" x2="349.91190808036" y1="207.93720637726" y2="183.94041370636" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<polygon points=" 248,361 137,405 155,436" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="43.322748750722" x2="94.418132372438" y1="360.94520685318" y2="390.44600571098" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="94.418132372438" x2="145.51351599415" y1="390.44600571098" y2="419.94680456879" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #0000ff" />
<line x1="357" x2="357" y1="538" y2="479" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" />
<line x1="357" x2="357" y1="479" y2="420" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<line x1="344" x2="344" y1="538" y2="479" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" />
<line x1="344" x2="344" y1="479" y2="420" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" />
<ellipse cx="452.10267532379" cy="360.94520685318" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="452.10267532379" y="388.27200683711"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:62.106363599831px">R2</text>
<ellipse cx="457.70782710677" cy="231.93399904817" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.70782710677" y="259.2607990321"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:62.106363599831px">O</text>
<ellipse cx="145.51351599415" cy="419.94680456879" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.51351599415" y="447.27360455271"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:62.106363599831px">N</text>
<ellipse cx="43.322748750722" cy="360.94520685318" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="43.322748750722" y="388.27200683711"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:62.106363599831px">R1</text>
<ellipse cx="349.91190808036" cy="537.95" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="349.91190808036" y="565.27679998393"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:62.106363599831px">O</text>
</g></svg>

✍: FYIcenter.com

2021-08-13, 164👍, 0💬