Collections:
Molecule FYI-1000286
Molecule Summary:
ID: FYI-1000286
SMILES: [R2]C([C@H](CC1=CC=CO1)N[R1])=O
Received at FYIcenter.com on: 2021-03-05
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000286 FYIcenter.com 12 12 0 0 1 0 0 0 0 0999 V2000 4.8498 3.7834 0.0000 R2 0 0 0 0 0 0 0 0 0 0 0 0 3.6374 4.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4250 3.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4250 2.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6374 1.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7837 0.2911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1531 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8532 1.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9163 2.2528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 4.4834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.7834 0.0000 R1 0 0 0 0 0 0 0 0 0 0 0 0 3.6374 5.8834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 2 0 0 0 0 7 6 1 0 0 0 0 8 7 2 0 0 0 0 9 8 1 0 0 0 0 9 5 1 0 0 0 0 3 10 1 6 0 0 0 11 10 1 0 0 0 0 12 2 2 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="349.91190808036" x2="401.00729170208" y1="419.94680456879" y2="390.44600571098" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="401.00729170208" x2="452.10267532379" y1="390.44600571098" y2="360.94520685318" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="247.72114083693" x2="298.81652445865" y1="360.94520685318" y2="390.44600571098" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="298.81652445865" x2="349.91190808036" y1="390.44600571098" y2="419.94680456879" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="247.72114083693" x2="247.72114083693" y1="242.94201142197" y2="301.94360913757" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="247.72114083693" x2="247.72114083693" y1="301.94360913757" y2="360.94520685318" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="349.91190808036" x2="298.81652445865" y1="183.94041370636" y2="213.44121256416" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="298.81652445865" x2="247.72114083693" y1="213.44121256416" y2="242.94201142197" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="357" x2="350.5" y1="66" y2="125" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="350.5" x2="344" y1="125" y2="184" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="369" x2="363" y1="68" y2="126.5" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="363" x2="357" y1="126.5" y2="185" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="477.667224734" x2="419.95523336846" y1="42.05" y2="54.318117925009" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="419.95523336846" x2="362.24324200292" y1="54.318117925009" y2="66.586235850019" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="543" x2="513.5" y1="142" y2="90.5" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="513.5" x2="484" y1="90.5" y2="39" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="532" x2="502.5" y1="148" y2="97" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="502.5" x2="473" y1="97" y2="46" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="457.70782710677" x2="497.19253917803" y1="231.93399904817" y2="188.0873831458" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" /> <line x1="497.19253917803" x2="536.67725124928" y1="188.0873831458" y2="144.24076724343" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="457.70782710677" x2="403.80986759357" y1="231.93399904817" y2="207.93720637726" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" /> <line x1="403.80986759357" x2="349.91190808036" y1="207.93720637726" y2="183.94041370636" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <polygon points=" 248,361 137,405 155,436" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="43.322748750722" x2="94.418132372438" y1="360.94520685318" y2="390.44600571098" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="94.418132372438" x2="145.51351599415" y1="390.44600571098" y2="419.94680456879" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #0000ff" /> <line x1="357" x2="357" y1="538" y2="479" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" /> <line x1="357" x2="357" y1="479" y2="420" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <line x1="344" x2="344" y1="538" y2="479" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #ff0000" /> <line x1="344" x2="344" y1="479" y2="420" style="stroke-opacity:1; stroke-width: 4.9685090879865; stroke: #000000" /> <ellipse cx="452.10267532379" cy="360.94520685318" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="452.10267532379" y="388.27200683711" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:62.106363599831px">R2</text> <ellipse cx="457.70782710677" cy="231.93399904817" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.70782710677" y="259.2607990321" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:62.106363599831px">O</text> <ellipse cx="145.51351599415" cy="419.94680456879" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.51351599415" y="447.27360455271" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:62.106363599831px">N</text> <ellipse cx="43.322748750722" cy="360.94520685318" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="43.322748750722" y="388.27200683711" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:62.106363599831px">R1</text> <ellipse cx="349.91190808036" cy="537.95" rx="32.295309071912" ry="32.295309071912" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="349.91190808036" y="565.27679998393" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:62.106363599831px">O</text> </g></svg>
✍: FYIcenter.com
2021-08-13, 322👍, 0💬
Popular Posts:
How to use "babel -o fpt ..." command to do similarity search? You can use the "fpt" output file for...
What are the options for installing Open Babel on macOS computers? There are a number of options for...
What is chemdb.niaid.nih.gov's Molecule Compounds Against HIV? chemdb.niaid.nih.gov offers a searcha...
How to create and edit a molecule structure with JSME molecule editor? To help you to create and edi...
How to Install Open Babel binary package on macOS computers? The easiest option to install Open Babe...