Molecule FYI-1000288

A

Molecule Summary:

ID: FYI-1000288
SMILES: CC(C)(CC(c1ccccc1)c2ccccc2)Oc3ccc(C(=O)CCCCCl)cc3

Received at FYIcenter.com on: 2021-03-07

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000288
FYIcenter.com

  4  3  0  0  0  0  0  0  0  0999 V2000
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="372.65454457977" x2="455.30227228989" y1="242.28191240756" y2="290" style="stroke-opacity:1; stroke-width: 8.0367194469526; stroke: #000000" />
<line x1="455.30227228989" x2="537.95" y1="290" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 8.0367194469526; stroke: #000000" />
<line x1="207.34545542023" x2="290" y1="337.71808759244" y2="290" style="stroke-opacity:1; stroke-width: 8.0367194469526; stroke: #000000" />
<line x1="290" x2="372.65454457977" y1="290" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 8.0367194469526; stroke: #000000" />
<line x1="42.05" x2="124.69772771011" y1="242.28191240756" y2="290" style="stroke-opacity:1; stroke-width: 8.0367194469526; stroke: #000000" />
<line x1="124.69772771011" x2="207.34545542023" y1="290" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 8.0367194469526; stroke: #000000" />
</g></svg>

✍: FYIcenter.com

2022-05-31, 125👍, 0💬