Molecule FYI-1000461


Molecule Summary:

ID: FYI-1000461
SMILES: [Cl-].C[N+]1=C2C=CC=CC2=C(C2=CC=CC=C12)NCC

Received at on: 2021-07-13

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 19 20  0  0  0  0  0  0  0  0999 V2000
    9.2641    4.1362    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0
    6.6779    5.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6053    4.1362    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
    4.2897    4.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0467    5.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7311    6.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6586    5.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9018    4.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2173    3.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4604    2.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7760    1.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0191    0.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3347    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4071    0.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1641    2.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8485    2.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3880    1.4364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0724    1.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
  9  4  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 16  3  1  0  0  0  0
 16 11  1  0  0  0  0
 17 10  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="342.09730842715" x2="370.8050263922" y1="338.17361697305" y2="362.2590872292" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #0000ff" />
<line x1="370.8050263922" x2="399.51274435725" y1="362.2590872292" y2="386.34455748535" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="274" x2="309" y1="368" y2="355" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="309" x2="344" y1="355" y2="342" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #0000ff" />
<line x1="271" x2="306" y1="361" y2="348" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="306" x2="341" y1="348" y2="335" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #0000ff" />
<line x1="258.66667404281" x2="265.17047365637" y1="437.6041336989" y2="400.70376938936" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="265.17047365637" x2="271.67427326993" y1="400.70376938936" y2="363.80340507982" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="190" x2="225.5" y1="467" y2="454.5" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="225.5" x2="261" y1="454.5" y2="442" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="187" x2="222.5" y1="460" y2="447" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="222.5" x2="258" y1="447" y2="434" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="130.83355587699" x2="159.53859738129" y1="415.06833421487" y2="439.15112801028" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="159.53859738129" x2="188.24363888559" y1="439.15112801028" y2="463.23392180568" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="140" x2="133.5" y1="341" y2="378" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="133.5" x2="127" y1="378" y2="415" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="148" x2="141.5" y1="342" y2="379" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="141.5" x2="135" y1="379" y2="416" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="214.26954318282" x2="179.06070206496" y1="315.62711164603" y2="328.44735862091" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="179.06070206496" x2="143.8518609471" y1="328.44735862091" y2="341.26760559579" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="214.26954318282" x2="242.97190822638" y1="315.62711164603" y2="339.71525836293" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="242.97190822638" x2="271.67427326993" y1="339.71525836293" y2="363.80340507982" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="224" x2="217.5" y1="242" y2="278.5" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="217.5" x2="211" y1="278.5" y2="315" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="232" x2="225.5" y1="243" y2="280" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="225.5" x2="219" y1="280" y2="317" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="297.70553048866" x2="262.49401291005" y1="216.19659492018" y2="229.01148897356" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="262.49401291005" x2="227.28249533144" y1="229.01148897356" y2="241.82638302695" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="307" x2="300.5" y1="142" y2="179" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="300.5" x2="294" y1="179" y2="216" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="315" x2="308.5" y1="144" y2="180.5" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="308.5" x2="302" y1="180.5" y2="217" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="381.1415177945" x2="345.93000021589" y1="116.76607819432" y2="129.58097224771" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="345.93000021589" x2="310.71848263728" y1="129.58097224771" y2="142.3958663011" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="442" x2="413" y1="162" y2="138" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="413" x2="384" y1="138" y2="114" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="437" x2="408" y1="168" y2="144" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="408" x2="379" y1="144" y2="120" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="425.53864865448" x2="432.04244826805" y1="238.7377473257" y2="201.83738301616" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="432.04244826805" x2="438.54624788161" y1="201.83738301616" y2="164.93701870662" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="357" x2="392" y1="269" y2="256" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="392" x2="427" y1="256" y2="243" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="354" x2="389.5" y1="261" y2="248.5" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="389.5" x2="425" y1="248.5" y2="236" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="355.11561349726" x2="348.60646096221" y1="264.36753543248" y2="301.27057620276" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="348.60646096221" x2="342.09730842715" y1="301.27057620276" y2="338.17361697305" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #0000ff" />
<line x1="355.11561349726" x2="326.41057199296" y1="264.36753543248" y2="240.28206517633" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="326.41057199296" x2="297.70553048866" y1="240.28206517633" y2="216.19659492018" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="169.87776524433" x2="198.58013028789" y1="193.65544251465" y2="217.7409127708" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #0000ff" />
<line x1="198.58013028789" x2="227.28249533144" y1="217.7409127708" y2="241.82638302695" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="99.45473008711" x2="134.66624766572" y1="219.29058354292" y2="206.47301302879" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="134.66624766572" x2="169.87776524433" y1="206.47301302879" y2="193.65544251465" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #0000ff" />
<line x1="42.05" x2="70.752365043555" y1="171.11964303062" y2="195.20511328677" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<line x1="70.752365043555" x2="99.45473008711" y1="195.20511328677" y2="219.29058354292" style="stroke-opacity:1; stroke-width: 3.1553762051693; stroke: #000000" />
<ellipse cx="537.95" cy="338.17361697305" rx="20.509945333601" ry="20.509945333601" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="355.52818610148"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:39.442202564617px">Cl<tspan baseline-shift='super' font-size='19.721101282308'>-</tspan></text>
<ellipse cx="342.09730842715" cy="338.17361697305" rx="20.509945333601" ry="20.509945333601" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="342.09730842715" y="355.52818610148"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:39.442202564617px">N<tspan baseline-shift='super' font-size='19.721101282308'>+</tspan></text>
<ellipse cx="169.87776524433" cy="193.65544251465" rx="20.509945333601" ry="20.509945333601" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="169.87776524433" y="211.01001164308"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:39.442202564617px">N</text>


2021-09-09, 220👍, 0💬