Molecule FYI-1001189

A

Molecule Summary:

ID: FYI-1001189
SMILES: CNC(=O)CN1CCN(C(=O)C(=O)Nc2cccc(C(=O)Nc3ccccc3-c3nc(C)no3)n2)CC1c1nccn1C

Received at FYIcenter.com on: 2022-02-28

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001189
FYIcenter.com

 43 47  0  0  0  0  0  0  0  0999 V2000
    8.4871   19.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   18.3625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746   17.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   18.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746   16.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   15.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498   16.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372   15.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372   14.1625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   13.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   14.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   12.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372   11.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   11.3624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    9.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    9.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    7.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    7.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    7.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    7.8624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    5.7624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    5.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    3.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    3.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    2.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4909    1.5701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1216    1.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5520    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4216    2.4915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3583    3.5318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    9.2624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498   13.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   14.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746   13.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4210   12.0701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7904   11.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4904   12.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5536   14.0318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8447   15.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 10  1  0  0  0  0
 13 12  2  0  0  0  0
 14 12  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 20  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 28 23  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 31  2  0  0  0  0
 34 33  1  0  0  0  0
 34 29  1  0  0  0  0
 35 19  2  0  0  0  0
 35 15  1  0  0  0  0
 36  9  1  0  0  0  0
 37 36  1  0  0  0  0
 37  6  1  0  0  0  0
 38 37  1  0  0  0  0
 39 38  2  0  0  0  0
 40 39  1  0  0  0  0
 41 40  2  0  0  0  0
 42 41  1  0  0  0  0
 42 38  1  0  0  0  0
 43 42  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="383.89541859583" x2="383.89541859583" y1="502.81982922201" y2="520.38491461101" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="383.89541859583" x2="383.89541859583" y1="520.38491461101" y2="537.95" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="353.47018140417" x2="368.6828" y1="485.25474383302" y2="494.03728652751" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="368.6828" x2="383.89541859583" y1="494.03728652751" y2="502.81982922201" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="324" x2="339.5" y1="505" y2="496" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="339.5" x2="355" y1="496" y2="487" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="323" x2="338" y1="502" y2="493" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="338" x2="353" y1="493" y2="484" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="353.47018140417" x2="353.47018140417" y1="450.12457305503" y2="467.68965844402" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="353.47018140417" x2="353.47018140417" y1="467.68965844402" y2="485.25474383302" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="323.04745351044" x2="338.25881745731" y1="432.55948766603" y2="441.34203036053" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="338.25881745731" x2="353.47018140417" y1="441.34203036053" y2="450.12457305503" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292.6247256167" x2="307.83608956357" y1="450.12457305503" y2="441.34203036053" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="307.83608956357" x2="323.04745351044" y1="441.34203036053" y2="432.55948766603" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="262.19697912713" x2="277.41085237192" y1="432.55948766603" y2="441.34203036053" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="277.41085237192" x2="292.6247256167" y1="441.34203036053" y2="450.12457305503" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="262.19697912713" x2="262.19697912713" y1="397.42931688805" y2="414.99440227704" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="262.19697912713" x2="262.19697912713" y1="414.99440227704" y2="432.55948766603" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="231.7742512334" x2="246.98561518027" y1="379.86423149905" y2="388.64677419355" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="246.98561518027" x2="262.19697912713" y1="388.64677419355" y2="397.42931688805" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="203" x2="218" y1="400" y2="391" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="218" x2="233" y1="391" y2="382" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="201" x2="216" y1="396" y2="387.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="216" x2="231" y1="387.5" y2="379" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="231.7742512334" x2="231.7742512334" y1="344.73155142315" y2="362.2978914611" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="231.7742512334" x2="231.7742512334" y1="362.2978914611" y2="379.86423149905" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="262" x2="246.5" y1="326" y2="335" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="246.5" x2="231" y1="335" y2="344" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="264" x2="248.5" y1="329" y2="338" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="248.5" x2="233" y1="338" y2="347" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="201.35152333966" x2="216.56288728653" y1="327.16646603416" y2="335.94900872865" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="216.56288728653" x2="231.7742512334" y1="335.94900872865" y2="344.73155142315" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="201.35152333966" x2="201.35152333966" y1="292.03629525617" y2="309.60138064516" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="201.35152333966" x2="201.35152333966" y1="309.60138064516" y2="327.16646603416" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="171" x2="186" y1="277" y2="285.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="186" x2="201" y1="285.5" y2="294" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="172" x2="187.5" y1="273" y2="282" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="187.5" x2="203" y1="282" y2="291" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="170.92879544592" x2="170.92879544592" y1="239.34103908918" y2="256.90612447818" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="170.92879544592" x2="170.92879544592" y1="256.90612447818" y2="274.47120986717" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="201" x2="186" y1="221" y2="229.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="186" x2="171" y1="229.5" y2="238" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="203" x2="187.5" y1="224" y2="232.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="187.5" x2="172" y1="232.5" y2="241" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="231.7742512334" x2="216.56288728653" y1="239.34103908918" y2="230.55849639469" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="216.56288728653" x2="201.35152333966" y1="230.55849639469" y2="221.77595370019" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="262.19697912713" x2="246.98561518027" y1="221.77595370019" y2="230.55849639469" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="246.98561518027" x2="231.7742512334" y1="230.55849639469" y2="239.34103908918" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="294" x2="279" y1="238" y2="229.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="279" x2="264" y1="229.5" y2="221" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292" x2="277" y1="241" y2="232.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="277" x2="262" y1="232.5" y2="224" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="262.19697912713" x2="262.19697912713" y1="186.6457829222" y2="204.2108683112" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="262.19697912713" x2="262.19697912713" y1="204.2108683112" y2="221.77595370019" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292.6247256167" x2="277.41085237192" y1="169.08069753321" y2="177.8632402277" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="277.41085237192" x2="262.19697912713" y1="177.8632402277" y2="186.6457829222" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="324" x2="309" y1="186" y2="177" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="309" x2="294" y1="177" y2="168" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="323" x2="307.5" y1="189" y2="180" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="307.5" x2="292" y1="180" y2="171" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="353.47018140417" x2="338.25881745731" y1="169.08069753321" y2="177.8632402277" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="338.25881745731" x2="323.04745351044" y1="177.8632402277" y2="186.6457829222" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="352" x2="352" y1="134" y2="152" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="352" x2="352" y1="152" y2="170" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="356" x2="356" y1="134" y2="152" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="356" x2="356" y1="152" y2="170" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="323.04745351044" x2="338.25881745731" y1="116.38544136622" y2="125.16798406072" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="338.25881745731" x2="353.47018140417" y1="125.16798406072" y2="133.95052675522" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="294" x2="309" y1="136" y2="127" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="309" x2="324" y1="127" y2="118" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292" x2="307.5" y1="133" y2="124" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="307.5" x2="323" y1="124" y2="115" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292.6247256167" x2="292.6247256167" y1="133.95052675522" y2="151.51561214421" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292.6247256167" x2="292.6247256167" y1="151.51561214421" y2="169.08069753321" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="262.19697912713" x2="277.41085237192" y1="116.38544136622" y2="125.16798406072" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="277.41085237192" x2="292.6247256167" y1="125.16798406072" y2="133.95052675522" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="257" x2="259" y1="82" y2="99.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="259" x2="261" y1="99.5" y2="117" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="261" x2="263" y1="82" y2="99.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="263" x2="265" y1="99.5" y2="117" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="224.16605996205" x2="241.34596812144" y1="74.143920303605" y2="77.79620341556" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="241.34596812144" x2="258.52587628083" y1="77.79620341556" y2="81.448486527514" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="209.87309905123" x2="217.01957950664" y1="42.05" y2="58.096960151803" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="217.01957950664" x2="224.16605996205" y1="58.096960151803" y2="74.143920303605" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="209" x2="217.5" y1="106" y2="91" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="217.5" x2="226" y1="91" y2="76" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="205" x2="214" y1="104" y2="89" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="214" x2="223" y1="89" y2="74" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="230.10556812144" x2="218.35327134725" y1="130.67338368121" y2="117.62127058824" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="218.35327134725" x2="206.60097457306" y1="117.62127058824" y2="104.56915749526" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="230.10556812144" x2="246.15127362429" y1="130.67338368121" y2="123.52941252372" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #ff0000" />
<line x1="246.15127362429" x2="262.19697912713" y1="123.52941252372" y2="116.38544136622" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="234" x2="234" y1="275" y2="257.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="234" x2="234" y1="257.5" y2="240" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="230" x2="230" y1="275" y2="257.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="230" x2="230" y1="257.5" y2="240" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="231.7742512334" x2="216.56288728653" y1="274.47120986717" y2="283.25375256167" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="216.56288728653" x2="201.35152333966" y1="283.25375256167" y2="292.03629525617" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="292.6247256167" x2="277.41085237192" y1="379.86423149905" y2="388.64677419355" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="277.41085237192" x2="262.19697912713" y1="388.64677419355" y2="397.42931688805" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="323.04745351044" x2="307.83608956357" y1="397.42931688805" y2="388.64677419355" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="307.83608956357" x2="292.6247256167" y1="388.64677419355" y2="379.86423149905" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="323.04745351044" x2="323.04745351044" y1="397.42931688805" y2="414.99440227704" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="323.04745351044" x2="323.04745351044" y1="414.99440227704" y2="432.55948766603" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="353.47018140417" x2="338.25881745731" y1="379.86423149905" y2="388.64677419355" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="338.25881745731" x2="323.04745351044" y1="388.64677419355" y2="397.42931688805" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="356" x2="354" y1="345" y2="362.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="354" x2="352" y1="362.5" y2="380" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="359" x2="357.5" y1="346" y2="363.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="357.5" x2="356" y1="363.5" y2="381" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="391.50611916509" x2="374.32495635674" y1="337.62271043643" y2="341.27373889943" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="374.32495635674" x2="357.14379354839" y1="341.27373889943" y2="344.92476736243" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="411" x2="402.5" y1="368" y2="352.5" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="402.5" x2="394" y1="352.5" y2="337" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="408" x2="399" y1="369" y2="354" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="399" x2="390" y1="354" y2="339" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="385.56410170778" x2="397.31765313093" y1="394.14966451613" y2="381.09755142315" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="397.31765313093" x2="409.07120455408" y1="381.09755142315" y2="368.04543833017" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="385.56410170778" x2="369.51714155598" y1="394.14966451613" y2="387.00694800759" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<line x1="369.51714155598" x2="353.47018140417" y1="387.00694800759" y2="379.86423149905" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="392.86866793169" x2="389.21638481973" y1="428.51449943074" y2="411.33208197343" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #000000" />
<line x1="389.21638481973" x2="385.56410170778" y1="411.33208197343" y2="394.14966451613" style="stroke-opacity:1; stroke-width: 1.4791733069618; stroke: #0000ff" />
<ellipse cx="383.89541859583" cy="502.81982922201" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="383.89541859583" y="510.9552824103"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="323.04745351044" cy="502.81982922201" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="323.04745351044" y="510.9552824103"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">O</text>
<ellipse cx="323.04745351044" cy="432.55948766603" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="323.04745351044" y="440.69494085432"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="262.19697912713" cy="397.42931688805" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.19697912713" y="405.56477007634"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="201.35152333966" cy="397.42931688805" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="201.35152333966" y="405.56477007634"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">O</text>
<ellipse cx="262.19697912713" cy="327.16646603416" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.19697912713" y="335.30191922245"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">O</text>
<ellipse cx="201.35152333966" cy="327.16646603416" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="201.35152333966" y="335.30191922245"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="292.6247256167" cy="239.34103908918" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="292.6247256167" y="247.47649227747"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">O</text>
<ellipse cx="262.19697912713" cy="186.6457829222" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.19697912713" y="194.78123611049"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="258.52587628083" cy="81.448486527514" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="258.52587628083" y="89.583939715804"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="206.60097457306" cy="104.56915749526" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="206.60097457306" y="112.70461068355"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="230.10556812144" cy="130.67338368121" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="230.10556812144" y="138.8088368695"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">O</text>
<ellipse cx="231.7742512334" cy="274.47120986717" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="231.7742512334" y="282.60666305546"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="357.14379354839" cy="344.92476736243" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.14379354839" y="353.06022055072"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
<ellipse cx="385.56410170778" cy="394.14966451613" rx="9.6146264952516" ry="9.6146264952516" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="385.56410170778" y="402.28511770442"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.489666337022px">N</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 116👍, 0💬