Molecule FYI-1001192

A

Molecule Summary:

ID: FYI-1001192
SMILES: CC2CC(C)C1CC(C)(C)C1(C)C2C

Received at FYIcenter.com on: 2022-03-01

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001192
FYIcenter.com

 14 15  0  0  0  0  0  0  0  0999 V2000
    0.0000    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0373    2.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7373    1.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7373    4.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2121    3.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  2  5  1  0  0  0  0
  4  6  1  0  0  0  0
  5  7  1  0  0  0  0
  5  6  1  0  0  0  0
  6  8  1  0  0  0  0
  8  9  1  0  0  0  0
  5 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 12  1  0  0  0  0
 12  9  1  0  0  0  0
  8 13  1  0  0  0  0
 12 14  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="42.05" x2="94.446524497586" y1="419.11136335907" y2="388.85932842975" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="94.446524497586" x2="146.84304899517" y1="388.85932842975" y2="358.60729350043" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="146.84304899517" x2="146.84304899517" y1="358.60729350043" y2="298.10322364178" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="146.84304899517" x2="146.84304899517" y1="298.10322364178" y2="237.59915378314" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="146.84304899517" x2="199.23957349276" y1="358.60729350043" y2="388.85932842975" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="199.23957349276" x2="251.63609799034" y1="388.85932842975" y2="419.11136335907" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="146.84304899517" x2="199.23957349276" y1="358.60729350043" y2="328.3552585711" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="199.23957349276" x2="251.63609799034" y1="328.3552585711" y2="298.10322364178" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="251.63609799034" x2="304.03694420721" y1="419.11136335907" y2="388.85932842975" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="304.03694420721" x2="356.43779042407" y1="388.85932842975" y2="358.60729350043" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="251.63609799034" x2="251.63609799034" y1="298.10322364178" y2="237.59915378314" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="251.63609799034" x2="251.63609799034" y1="237.59915378314" y2="177.09508392449" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="251.63609799034" x2="304.03694420721" y1="298.10322364178" y2="328.3552585711" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="304.03694420721" x2="356.43779042407" y1="328.3552585711" y2="358.60729350043" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="356.43779042407" x2="416.94186028271" y1="358.60729350043" y2="358.6116152197" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="416.94186028271" x2="477.44593014136" y1="358.6116152197" y2="358.61593693898" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="477.44593014136" x2="507.69796507068" y1="358.61593693898" y2="306.21509072212" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="507.69796507068" x2="537.95" y1="306.21509072212" y2="253.81424450526" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="251.63609799034" x2="304.03694420721" y1="298.10322364178" y2="267.85118871246" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="304.03694420721" x2="356.43779042407" y1="267.85118871246" y2="237.59915378314" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="356.43779042407" x2="356.43346870479" y1="237.59915378314" y2="177.09508392449" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="356.43346870479" x2="356.42914698552" y1="177.09508392449" y2="116.59101406585" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="356.43779042407" x2="408.83431492165" y1="237.59915378314" y2="267.85118871246" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="408.83431492165" x2="461.23083941924" y1="267.85118871246" y2="298.10322364178" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="461.23083941924" x2="499.59041970962" y1="298.10322364178" y2="275.95873407352" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="499.59041970962" x2="537.95" y1="275.95873407352" y2="253.81424450526" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="477.44593014136" x2="507.69796507068" y1="358.61593693898" y2="411.01246143656" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="507.69796507068" x2="537.95" y1="411.01246143656" y2="463.40898593415" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="461.23083941924" x2="476.89275007408" y1="298.10322364178" y2="356.54583340596" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
<line x1="476.89275007408" x2="492.55466072891" y1="356.54583340596" y2="414.98844317013" style="stroke-opacity:1; stroke-width: 5.0040889387965; stroke: #000000" />
</g></svg>

✍: FYIcenter.com

2022-04-21, 111👍, 0💬