Molecule FYI-1001197

A

Molecule Summary:

ID: FYI-1001197
SMILES: COC=1C=CC=2NC=C(CN(C)C)C2C1

Received at FYIcenter.com on: 2022-03-03

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001197
FYIcenter.com

 31 32  0  0  0  0  0  0  0  0999 V2000
    4.2312   -1.6313   -0.0085 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8303   -1.7406   -0.2684 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0872   -0.6097   -0.1339 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7009    0.5827    0.2420 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9635    1.7368    0.3832 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5924    1.7190    0.1493 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3904    2.6845    0.2068 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6000    2.1363   -0.1212 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4514    0.8307   -0.3963 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5404   -0.1299   -0.7990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9514   -0.9214    0.3684 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1646   -1.6970    0.0778 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8622   -1.7974    0.8204 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0301    0.5168   -0.2309 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7288   -0.6468   -0.3761 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3854   -1.2999    1.0184 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7042   -2.6028   -0.1517 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6725   -0.9077   -0.6939 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7651    0.6021    0.4249 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4496    2.6557    0.6759 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2457    3.6137    0.4448 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5360    2.6741   -0.1541 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3958    0.4289   -1.1785 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1677   -0.7964   -1.5768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9720   -2.3749   -0.7538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4469   -2.2737    0.9586 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9752   -1.0181   -0.1871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9990   -1.1914    1.0955 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1933   -2.3719    1.6856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5863   -2.4788    0.0157 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2549   -1.5709   -0.6728 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
  9 14  1  0  0  0  0
  6 14  2  0  0  0  0
 14 15  1  0  0  0  0
  3 15  2  0  0  0  0
  1 16  1  0  0  0  0
  1 17  1  0  0  0  0
  1 18  1  0  0  0  0
  4 19  1  0  0  0  0
  5 20  1  0  0  0  0
  7 21  1  0  0  0  0
  8 22  1  0  0  0  0
 10 23  1  0  0  0  0
 10 24  1  0  0  0  0
 12 25  1  0  0  0  0
 12 26  1  0  0  0  0
 12 27  1  0  0  0  0
 13 28  1  0  0  0  0
 13 29  1  0  0  0  0
 13 30  1  0  0  0  0
 15 31  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="513.7170206831" x2="477.83120596318" y1="180.52892483005" y2="177.72906791743" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="477.83120596318" x2="441.94539124326" y1="177.72906791743" y2="174.92921100481" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #ff0000" />
<line x1="441.94539124326" x2="422.90995051346" y1="174.92921100481" y2="203.89863627911" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #ff0000" />
<line x1="422.90995051346" x2="403.87450978366" y1="203.89863627911" y2="232.8680615534" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="403.87450978366" x2="419.595206831" y1="232.8680615534" y2="263.41288664587" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="419.595206831" x2="435.31590387834" y1="263.41288664587" y2="293.95771173833" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="433" x2="414" y1="292" y2="322" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="414" x2="395" y1="322" y2="352" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="439" x2="420" y1="296" y2="326" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="420" x2="401" y1="326" y2="356" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="397.53704775089" x2="362.41459749571" y1="353.08515662128" y2="352.62918724301" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="362.41459749571" x2="327.29214724053" y1="352.62918724301" y2="352.17321786474" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="327.29214724053" x2="302.11648965845" y1="352.17321786474" y2="376.90571419716" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="302.11648965845" x2="276.94083207637" y1="376.90571419716" y2="401.63821052958" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #0000ff" />
<line x1="276.94083207637" x2="245.95540735996" y1="401.63821052958" y2="387.59537832924" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #0000ff" />
<line x1="245.95540735996" x2="214.96998264355" y1="387.59537832924" y2="373.55254612889" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="219" x2="223" y1="374" y2="341" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="223" x2="227" y1="341" y2="308" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="212" x2="215.5" y1="374" y2="340.5" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="215.5" x2="219" y1="340.5" y2="307" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="222.58313428518" x2="194.68703018782" y1="306.66337531252" y2="282.05639864041" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="194.68703018782" x2="166.79092609046" y1="282.05639864041" y2="257.4494219683" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="166.79092609046" x2="156.26264437878" y1="257.4494219683" y2="237.17415438973" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="156.26264437878" x2="145.73436266711" y1="237.17415438973" y2="216.89888681117" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #0000ff" />
<line x1="145.73436266711" x2="114.65671942476" y1="216.89888681117" y2="197.03091772217" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #0000ff" />
<line x1="114.65671942476" x2="83.579076182408" y1="197.03091772217" y2="177.16294863318" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="145.73436266711" x2="173.63559001591" y1="216.89888681117" y2="194.45904549869" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #0000ff" />
<line x1="173.63559001591" x2="201.53681736471" y1="194.45904549869" y2="172.01920418621" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="222.58313428518" x2="258.99152065211" y1="306.66337531252" y2="298.62243217555" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="258.99152065211" x2="295.39990701903" y1="298.62243217555" y2="290.58148903858" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="331" x2="315" y1="351" y2="320" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="315" x2="299" y1="320" y2="289" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="324" x2="308.5" y1="354" y2="323.5" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="308.5" x2="293" y1="323.5" y2="293" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="295.39990701903" x2="314.84008461268" y1="290.58148903858" y2="260.77441215365" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="314.84008461268" x2="334.28026220634" y1="260.77441215365" y2="230.96733526871" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="404" x2="369.5" y1="230" y2="229" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="369.5" x2="335" y1="229" y2="228" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="404" x2="369.5" y1="237" y2="236" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="369.5" x2="335" y1="236" y2="235" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #000000" />
<line x1="276.94083207637" x2="280.64750449408" y1="401.63821052958" y2="425.44083672542" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #0000ff" />
<line x1="280.64750449408" x2="284.35417691179" y1="425.44083672542" y2="449.24346292126" style="stroke-opacity:1; stroke-width: 2.9733953611476; stroke: #a4a4a4" />
<ellipse cx="441.94539124326" cy="174.92921100481" rx="19.327069847459" ry="19.327069847459" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="441.94539124326" y="191.28288549113"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.167442014345px">O</text>
<ellipse cx="276.94083207637" cy="401.63821052958" rx="19.327069847459" ry="19.327069847459" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.94083207637" y="417.99188501589"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.167442014345px">N</text>
<ellipse cx="145.73436266711" cy="216.89888681117" rx="19.327069847459" ry="19.327069847459" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.73436266711" y="233.25256129748"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.167442014345px">N</text>
<ellipse cx="284.35417691179" cy="449.24346292126" rx="19.327069847459" ry="19.327069847459" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="284.35417691179" y="465.59713740757"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:37.167442014345px">H</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 119👍, 0💬