Molecule FYI-1001198

A

Molecule Summary:

ID: FYI-1001198
SMILES: C[C@]12CC[C@@]3(CCCc4c3ccc(c4)O)C[C@H]1CC[C@@H]2O

Received at FYIcenter.com on: 2022-03-03

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001198
FYIcenter.com

 47 50  0  0  1  0  0  0  0  0999 V2000
    4.4691    1.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6030    1.1694    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.4691    0.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4691   -0.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6030   -0.8306    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    2.7370   -1.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7370   -2.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6030   -2.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4691   -2.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4691   -1.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3630   -0.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2691   -1.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2691   -2.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3630   -2.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1332   -2.8548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7370   -0.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7370    0.6694    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.9601    0.3246    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    1.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4051    2.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3938    2.1412    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.1709    2.7197    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0617    2.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7791    1.1324    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0060    1.9794    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1591    2.2063    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0796    0.5617    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6811    1.2520    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6811   -0.9133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0796   -0.2230    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5250   -0.7480    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1264   -1.4383    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1264   -2.2230    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5250   -2.9133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2045   -3.3056    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0016   -3.3056    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3558   -0.1760    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8048   -0.9978    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3558   -3.4853    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1308   -3.4748    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1264   -0.2230    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5250   -0.9133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4635    1.6472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6346    0.8356    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5338    2.8507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8155    2.4360    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8691    3.4748    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  5  4  1  1  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  5 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
 13 14  1  0  0  0  0
  9 14  2  0  0  0  0
 13 15  1  0  0  0  0
  5 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  6  0  0  0
  2 17  1  0  0  0  0
 17 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
  2 21  1  0  0  0  0
 21 23  1  6  0  0  0
  1 24  1  0  0  0  0
  1 25  1  0  0  0  0
  1 26  1  0  0  0  0
  3 27  1  0  0  0  0
  3 28  1  0  0  0  0
  4 29  1  0  0  0  0
  4 30  1  0  0  0  0
  6 31  1  0  0  0  0
  6 32  1  0  0  0  0
  7 33  1  0  0  0  0
  7 34  1  0  0  0  0
  8 35  1  0  0  0  0
  8 36  1  0  0  0  0
 11 37  1  0  0  0  0
 12 38  1  0  0  0  0
 14 39  1  0  0  0  0
 15 40  1  0  0  0  0
 16 41  1  0  0  0  0
 16 42  1  0  0  0  0
 19 43  1  0  0  0  0
 19 44  1  0  0  0  0
 20 45  1  0  0  0  0
 20 46  1  0  0  0  0
 23 47  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 241,374 297,419 308,400" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="240.45702432436" x2="271.31139351446" y1="373.69261001997" y2="355.88036594302" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="271.31139351446" x2="302.16576270456" y1="355.88036594302" y2="338.06812186607" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="302.16576270456" x2="302.16576270456" y1="338.06812186607" y2="302.44363371216" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="302.16576270456" x2="302.16576270456" y1="302.44363371216" y2="266.81914555825" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<polygon points=" 241,232 297,277 308,258" fill-opacity="1"  style="fill:#000000" />
<line x1="240.45702432436" x2="209.60621758308" y1="231.19465740435" y2="213.38241332739" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="209.60621758308" x2="178.7554108418" y1="213.38241332739" y2="195.57016925044" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="178.7554108418" x2="178.7554108418" y1="195.57016925044" y2="159.94568109654" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="178.7554108418" x2="178.7554108418" y1="159.94568109654" y2="124.32119294263" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="178.7554108418" x2="209.60621758308" y1="124.32119294263" y2="106.50894886568" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="209.60621758308" x2="240.45702432436" y1="106.50894886568" y2="88.696704788724" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="240.45702432436" x2="271.31139351446" y1="88.696704788724" y2="106.50894886568" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="271.31139351446" x2="302.16576270456" y1="106.50894886568" y2="124.32119294263" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="302.16576270456" x2="302.16576270456" y1="124.32119294263" y2="159.94568109654" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="302.16576270456" x2="302.16576270456" y1="159.94568109654" y2="195.57016925044" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="240.45702432436" x2="271.31139351446" y1="231.19465740435" y2="213.38241332739" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="271.31139351446" x2="302.16576270456" y1="213.38241332739" y2="195.57016925044" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="301" x2="332.5" y1="199" y2="218" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="332.5" x2="364" y1="218" y2="237" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="305" x2="336.5" y1="193" y2="212" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="336.5" x2="368" y1="212" y2="231" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="365.85522262611" x2="398.13457134237" y1="233.6598719846" y2="215.35600997112" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="398.13457134237" x2="430.41392005862" y1="215.35600997112" y2="197.05214795764" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="435" x2="435" y1="198" y2="160.5" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="435" x2="435" y1="160.5" y2="123" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="427" x2="427" y1="198" y2="160.5" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="427" x2="427" y1="160.5" y2="123" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="430.41392005862" x2="398.13457134237" y1="122.8320893378" y2="104.52822732432" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="398.13457134237" x2="365.85522262611" y1="104.52822732432" y2="86.224365310843" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="305" x2="336.5" y1="128" y2="109" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="336.5" x2="368" y1="109" y2="90" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="301" x2="332.5" y1="122" y2="102.5" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="332.5" x2="364" y1="102.5" y2="83" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="430.41392005862" x2="461.19704027241" y1="122.8320893378" y2="104.90228444994" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="461.19704027241" x2="491.9801604862" y1="104.90228444994" y2="86.972479562075" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #ff0000" />
<line x1="240.45702432436" x2="209.60621758308" y1="231.19465740435" y2="249.0069014813" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="209.60621758308" x2="178.7554108418" y1="249.0069014813" y2="266.81914555825" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="178.7554108418" x2="178.7554108418" y1="266.81914555825" y2="302.44363371216" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="178.7554108418" x2="178.7554108418" y1="302.44363371216" y2="338.06812186607" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<polygon points=" 179,339 128,304 120,324" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="240.45702432436" x2="209.60621758308" y1="373.69261001997" y2="355.88036594302" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="209.60621758308" x2="178.7554108418" y1="355.88036594302" y2="338.06812186607" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="178.7554108418" x2="152.50016307237" y1="338.06812186607" y2="361.82965546472" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="152.50016307237" x2="126.24491530294" y1="361.82965546472" y2="385.59118906338" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="126.24491530294" x2="140.67639545409" y1="385.59118906338" y2="417.93109940949" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="140.67639545409" x2="155.10787560524" y1="417.93109940949" y2="450.27100975561" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="155.10787560524" x2="190.329807043" y1="450.27100975561" y2="446.60168747575" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="190.329807043" x2="225.55173848077" y1="446.60168747575" y2="442.9323651959" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="240.45702432436" x2="233.00438140257" y1="373.69261001997" y2="408.31248760794" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<line x1="233.00438140257" x2="225.55173848077" y1="408.31248760794" y2="442.9323651959" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" />
<polygon points=" 226,443 266,504 282,489" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="491.9801604862" x2="491.89466171463" y1="86.972479562075" y2="64.885296906654" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #ff0000" />
<line x1="491.89466171463" x2="491.80916294306" y1="64.885296906654" y2="42.798114251232" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #a4a4a4" />
<line x1="273.13892975676" x2="266.27765333831" y1="495.96297826181" y2="516.9564891309" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #ff0000" />
<line x1="266.27765333831" x2="259.41637691987" y1="516.9564891309" y2="537.95" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #a4a4a4" />
<ellipse cx="491.9801604862" cy="86.972479562075" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.9801604862" y="103.61068838341"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.814110957574px">O</text>
<ellipse cx="123.40208114826" cy="313.50147483513" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.40208114826" y="330.13968365646"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:37.814110957574px">H</text>
<ellipse cx="273.13892975676" cy="495.96297826181" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="273.13892975676" y="512.60118708314"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.814110957574px">O</text>
<ellipse cx="491.80916294306" cy="42.798114251232" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.80916294306" y="59.436323072565"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:37.814110957574px">H</text>
<ellipse cx="259.41637691987" cy="537.95" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.41637691987" y="554.58820882133"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:37.814110957574px">H</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 121👍, 0💬