Collections:
Molecule FYI-1001198
Molecule Summary:
ID: FYI-1001198
SMILES: C[C@]12CC[C@@]3(CCCc4c3ccc(c4)O)C[C@H]1CC[C@@H]2O
Received at FYIcenter.com on: 2022-03-03
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1001198 FYIcenter.com 47 50 0 0 1 0 0 0 0 0999 V2000 4.4691 1.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6030 1.1694 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4691 0.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4691 -0.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6030 -0.8306 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7370 -1.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7370 -2.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6030 -2.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4691 -2.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4691 -1.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3630 -0.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2691 -1.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2691 -2.3515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3630 -2.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1332 -2.8548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7370 -0.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7370 0.6694 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9601 0.3246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 1.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4051 2.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3938 2.1412 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1709 2.7197 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0617 2.8855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7791 1.1324 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0060 1.9794 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1591 2.2063 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0796 0.5617 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6811 1.2520 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6811 -0.9133 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0796 -0.2230 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5250 -0.7480 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1264 -1.4383 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1264 -2.2230 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5250 -2.9133 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2045 -3.3056 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0016 -3.3056 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3558 -0.1760 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8048 -0.9978 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3558 -3.4853 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1308 -3.4748 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1264 -0.2230 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5250 -0.9133 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4635 1.6472 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6346 0.8356 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5338 2.8507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8155 2.4360 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8691 3.4748 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 6 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 5 4 1 1 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 5 10 1 0 0 0 0 10 11 2 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 9 14 2 0 0 0 0 13 15 1 0 0 0 0 5 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 6 0 0 0 2 17 1 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 2 21 1 0 0 0 0 21 23 1 6 0 0 0 1 24 1 0 0 0 0 1 25 1 0 0 0 0 1 26 1 0 0 0 0 3 27 1 0 0 0 0 3 28 1 0 0 0 0 4 29 1 0 0 0 0 4 30 1 0 0 0 0 6 31 1 0 0 0 0 6 32 1 0 0 0 0 7 33 1 0 0 0 0 7 34 1 0 0 0 0 8 35 1 0 0 0 0 8 36 1 0 0 0 0 11 37 1 0 0 0 0 12 38 1 0 0 0 0 14 39 1 0 0 0 0 15 40 1 0 0 0 0 16 41 1 0 0 0 0 16 42 1 0 0 0 0 19 43 1 0 0 0 0 19 44 1 0 0 0 0 20 45 1 0 0 0 0 20 46 1 0 0 0 0 23 47 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 241,374 297,419 308,400" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="240.45702432436" x2="271.31139351446" y1="373.69261001997" y2="355.88036594302" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="271.31139351446" x2="302.16576270456" y1="355.88036594302" y2="338.06812186607" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="302.16576270456" x2="302.16576270456" y1="338.06812186607" y2="302.44363371216" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="302.16576270456" x2="302.16576270456" y1="302.44363371216" y2="266.81914555825" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <polygon points=" 241,232 297,277 308,258" fill-opacity="1" style="fill:#000000" /> <line x1="240.45702432436" x2="209.60621758308" y1="231.19465740435" y2="213.38241332739" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="209.60621758308" x2="178.7554108418" y1="213.38241332739" y2="195.57016925044" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="178.7554108418" x2="178.7554108418" y1="195.57016925044" y2="159.94568109654" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="178.7554108418" x2="178.7554108418" y1="159.94568109654" y2="124.32119294263" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="178.7554108418" x2="209.60621758308" y1="124.32119294263" y2="106.50894886568" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="209.60621758308" x2="240.45702432436" y1="106.50894886568" y2="88.696704788724" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="240.45702432436" x2="271.31139351446" y1="88.696704788724" y2="106.50894886568" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="271.31139351446" x2="302.16576270456" y1="106.50894886568" y2="124.32119294263" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="302.16576270456" x2="302.16576270456" y1="124.32119294263" y2="159.94568109654" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="302.16576270456" x2="302.16576270456" y1="159.94568109654" y2="195.57016925044" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="240.45702432436" x2="271.31139351446" y1="231.19465740435" y2="213.38241332739" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="271.31139351446" x2="302.16576270456" y1="213.38241332739" y2="195.57016925044" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="301" x2="332.5" y1="199" y2="218" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="332.5" x2="364" y1="218" y2="237" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="305" x2="336.5" y1="193" y2="212" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="336.5" x2="368" y1="212" y2="231" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="365.85522262611" x2="398.13457134237" y1="233.6598719846" y2="215.35600997112" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="398.13457134237" x2="430.41392005862" y1="215.35600997112" y2="197.05214795764" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="435" x2="435" y1="198" y2="160.5" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="435" x2="435" y1="160.5" y2="123" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="427" x2="427" y1="198" y2="160.5" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="427" x2="427" y1="160.5" y2="123" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="430.41392005862" x2="398.13457134237" y1="122.8320893378" y2="104.52822732432" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="398.13457134237" x2="365.85522262611" y1="104.52822732432" y2="86.224365310843" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="305" x2="336.5" y1="128" y2="109" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="336.5" x2="368" y1="109" y2="90" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="301" x2="332.5" y1="122" y2="102.5" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="332.5" x2="364" y1="102.5" y2="83" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="430.41392005862" x2="461.19704027241" y1="122.8320893378" y2="104.90228444994" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="461.19704027241" x2="491.9801604862" y1="104.90228444994" y2="86.972479562075" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #ff0000" /> <line x1="240.45702432436" x2="209.60621758308" y1="231.19465740435" y2="249.0069014813" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="209.60621758308" x2="178.7554108418" y1="249.0069014813" y2="266.81914555825" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="178.7554108418" x2="178.7554108418" y1="266.81914555825" y2="302.44363371216" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="178.7554108418" x2="178.7554108418" y1="302.44363371216" y2="338.06812186607" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <polygon points=" 179,339 128,304 120,324" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="240.45702432436" x2="209.60621758308" y1="373.69261001997" y2="355.88036594302" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="209.60621758308" x2="178.7554108418" y1="355.88036594302" y2="338.06812186607" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="178.7554108418" x2="152.50016307237" y1="338.06812186607" y2="361.82965546472" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="152.50016307237" x2="126.24491530294" y1="361.82965546472" y2="385.59118906338" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="126.24491530294" x2="140.67639545409" y1="385.59118906338" y2="417.93109940949" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="140.67639545409" x2="155.10787560524" y1="417.93109940949" y2="450.27100975561" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="155.10787560524" x2="190.329807043" y1="450.27100975561" y2="446.60168747575" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="190.329807043" x2="225.55173848077" y1="446.60168747575" y2="442.9323651959" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="240.45702432436" x2="233.00438140257" y1="373.69261001997" y2="408.31248760794" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <line x1="233.00438140257" x2="225.55173848077" y1="408.31248760794" y2="442.9323651959" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #000000" /> <polygon points=" 226,443 266,504 282,489" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="491.9801604862" x2="491.89466171463" y1="86.972479562075" y2="64.885296906654" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #ff0000" /> <line x1="491.89466171463" x2="491.80916294306" y1="64.885296906654" y2="42.798114251232" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #a4a4a4" /> <line x1="273.13892975676" x2="266.27765333831" y1="495.96297826181" y2="516.9564891309" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #ff0000" /> <line x1="266.27765333831" x2="259.41637691987" y1="516.9564891309" y2="537.95" style="stroke-opacity:1; stroke-width: 3.0251288766059; stroke: #a4a4a4" /> <ellipse cx="491.9801604862" cy="86.972479562075" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.9801604862" y="103.61068838341" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:37.814110957574px">O</text> <ellipse cx="123.40208114826" cy="313.50147483513" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.40208114826" y="330.13968365646" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:37.814110957574px">H</text> <ellipse cx="273.13892975676" cy="495.96297826181" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="273.13892975676" y="512.60118708314" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:37.814110957574px">O</text> <ellipse cx="491.80916294306" cy="42.798114251232" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.80916294306" y="59.436323072565" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:37.814110957574px">H</text> <ellipse cx="259.41637691987" cy="537.95" rx="19.663337697939" ry="19.663337697939" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.41637691987" y="554.58820882133" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:37.814110957574px">H</text> </g></svg>
✍: FYIcenter.com
2022-04-21, 121👍, 0💬
Popular Posts:
Where to find FAQ (Frequently Asked Questions) on molecule online tools? I want to use them to creat...
What is chemwriter.com? chemwriter.com is a Website that offers ChemWriter as commercial software an...
How to use "babel -o fpt ..." command to do similarity search? You can use the "fpt" output file for...
Molecule Summary: ID: FYI-1000039 SMILES: Received at FYIcenter.com on: 2020-04-21
Right/Left Hand Stereo Centers? In chemstry study, a stereo center a labeled as R (Rectus, Right in ...