Molecule FYI-1001220

A

Molecule Summary:

ID: FYI-1001220
SMILES: OC(=O)CN1N=NC(=N1)C1=CN(N=C1C1=CC=C(Cl)C=C1)C1=CC=CC=C1

Received at FYIcenter.com on: 2022-03-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001220
FYIcenter.com

 40 43  0  0  0  0  0  0  0  0999 V2000
    3.4013    5.9382   -0.5005 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8811    4.7023   -0.4398 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6427    4.0966   -1.4577 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5944    4.0702    0.8979 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0351    2.7314    0.6955 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7188    1.6442    0.6085 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9108    0.6543    0.4326 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6673    1.1547    0.4100 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7811    2.4567    0.5824 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5925    0.3910    0.2306 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8522    0.9090    0.2080 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7165   -0.1134    0.0231 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9817   -1.3012   -0.0726 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7042   -1.0104    0.0452 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4190   -1.9775    0.0012 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2988   -3.2177    0.6260 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3470   -4.1141    0.5822 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5164   -3.7834   -0.0810 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8312   -4.9158   -0.1329 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.6408   -2.5529   -0.7032 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5964   -1.6517   -0.6701 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1107   -0.0035   -0.0580 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8168   -0.7695   -0.9762 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1913   -0.6592   -1.0534 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8644    0.2134   -0.2181 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1642    0.9776    0.6973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7901    0.8676    0.7834 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5679    6.3016   -1.3809 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5192    3.9950    1.4698 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8784    4.6844    1.4439 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1136    1.9510    0.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6129   -3.4765    1.1439 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2550   -5.0751    1.0663 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5552   -2.2997   -1.2192 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6944   -0.6921   -1.1558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2916   -1.4506   -1.6294 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7410   -1.2547   -1.7673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9392    0.2984   -0.2809 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6927    1.6582    1.3483 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2438    1.4645    1.4987 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  5  9  1  0  0  0  0
  8 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  2  0  0  0  0
 10 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  2  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 18 20  1  0  0  0  0
 20 21  2  0  0  0  0
 15 21  1  0  0  0  0
 12 22  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 24 25  2  0  0  0  0
 25 26  1  0  0  0  0
 26 27  2  0  0  0  0
 22 27  1  0  0  0  0
  1 28  1  0  0  0  0
  4 29  1  0  0  0  0
  4 30  1  0  0  0  0
 11 31  1  0  0  0  0
 16 32  1  0  0  0  0
 17 33  1  0  0  0  0
 20 34  1  0  0  0  0
 21 35  1  0  0  0  0
 23 36  1  0  0  0  0
 24 37  1  0  0  0  0
 25 38  1  0  0  0  0
 26 39  1  0  0  0  0
 27 40  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="519.83783643716" x2="508.87953510501" y1="514.34604643852" y2="488.31112791409" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #ff0000" />
<line x1="508.87953510501" x2="497.92123377285" y1="488.31112791409" y2="462.27620938966" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="501" x2="496" y1="462" y2="449" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="496" x2="491" y1="449" y2="436" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #ff0000" />
<line x1="496" x2="491" y1="464" y2="451" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="491" x2="486" y1="451" y2="438" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #ff0000" />
<line x1="497.92123377285" x2="491.88173936315" y1="462.27620938966" y2="448.96067253449" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="491.88173936315" x2="485.84224495344" y1="448.96067253449" y2="435.64513567933" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="485.84224495344" x2="474.06028044926" y1="435.64513567933" y2="407.44257162034" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="474.06028044926" x2="462.27831594508" y1="407.44257162034" y2="379.24000756134" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="462.27831594508" x2="476.68083540067" y1="379.24000756134" y2="356.33753695711" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="476.68083540067" x2="491.08335485625" y1="356.33753695711" y2="333.43506635289" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="494" x2="477" y1="332" y2="311" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="477" x2="460" y1="311" y2="290" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="489" x2="472" y1="336" y2="315" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="472" x2="455" y1="315" y2="294" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="457.04141915313" x2="430.84640241623" y1="291.72948200571" y2="302.27068536328" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="430.84640241623" x2="404.65138567933" y1="302.27068536328" y2="312.81188872086" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="402" x2="404.5" y1="314" y2="341" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="404.5" x2="407" y1="341" y2="368" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="408" x2="410.5" y1="313" y2="340.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="410.5" x2="413" y1="340.5" y2="368" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="462.27831594508" x2="435.86211088833" y1="379.24000756134" y2="373.4532998029" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="435.86211088833" x2="409.44590583158" y1="373.4532998029" y2="367.66659204445" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="404.65138567933" x2="378.1130004078" y1="312.81188872086" y2="296.72412492354" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="378.1130004078" x2="351.57461513627" y1="296.72412492354" y2="280.63636112621" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="351" x2="324.5" y1="279" y2="289.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="324.5" x2="298" y1="289.5" y2="300" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="353" x2="326.5" y1="284" y2="295" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="326.5" x2="300" y1="295" y2="306" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="298.50205770407" x2="280.29509914701" y1="302.46027535173" y2="280.92285266431" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="280.29509914701" x2="262.08814058995" y1="280.92285266431" y2="259.38542997689" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="262.08814058995" x2="277.56710986882" y1="259.38542997689" y2="234.36376461293" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="277.56710986882" x2="293.04607914769" y1="234.36376461293" y2="209.34209924896" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="293" x2="320" y1="213" y2="219" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="320" x2="347" y1="219" y2="225" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="294" x2="321" y1="207" y2="213" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="321" x2="348" y1="213" y2="219" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="351.57461513627" x2="349.22159272412" y1="280.63636112621" y2="251.11509336981" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="349.22159272412" x2="346.86857031197" y1="251.11509336981" y2="221.5938256134" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="346.86857031197" x2="370.52940086998" y1="221.5938256134" y2="201.22132807721" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="370.52940086998" x2="394.19023142799" y1="201.22132807721" y2="180.84883054102" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="397" x2="394.5" y1="181" y2="155" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="394.5" x2="392" y1="155" y2="129" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="392" x2="389.5" y1="182" y2="155.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="389.5" x2="387" y1="155.5" y2="129" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="389.12607218106" x2="411.20698616869" y1="128.59782972541" y2="109.71466687623" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="411.20698616869" x2="433.28790015632" y1="109.71466687623" y2="90.831504027051" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="433" x2="457.5" y1="94" y2="101" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="457.5" x2="482" y1="101" y2="108" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="435" x2="459.5" y1="89" y2="96" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="459.5" x2="484" y1="96" y2="103" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="482.55601848705" x2="510.25300924353" y1="104.76426162237" y2="80.909627965065" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="510.25300924353" x2="537.95" y1="80.909627965065" y2="57.054994307755" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #00bc00" />
<line x1="482.55601848705" x2="485.17657343846" y1="104.76426162237" y2="130.68542615374" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="485.17657343846" x2="487.79712838986" y1="130.68542615374" y2="156.60659068511" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="486" x2="464" y1="155" y2="174" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="464" x2="442" y1="174" y2="193" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="490" x2="468" y1="159" y2="178" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="468" x2="446" y1="178" y2="197" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="394.19023142799" x2="418.99281502753" y1="180.84883054102" y2="187.71198812275" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="418.99281502753" x2="443.79539862706" y1="187.71198812275" y2="194.57514570448" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="262.08814058995" x2="232.71854482431" y1="259.38542997689" y2="261.70053439135" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #0000ff" />
<line x1="232.71854482431" x2="203.34894905866" y1="261.70053439135" y2="264.01563880582" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="206" x2="191" y1="263" y2="246.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="191" x2="176" y1="246.5" y2="230" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="202" x2="187" y1="266" y2="250" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="187" x2="172" y1="250" y2="234" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="173.60017331611" x2="144.64556896962" y1="231.74320966152" y2="234.0667402977" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="144.64556896962" x2="115.69096462312" y1="234.0667402977" y2="236.39027093387" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="114" x2="100" y1="235" y2="253.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="100" x2="86" y1="253.5" y2="272" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="118" x2="104" y1="239" y2="257" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="104" x2="90" y1="257" y2="275" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="87.332515462516" x2="102.08261656358" y1="273.1538762489" y2="289.25217282335" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="102.08261656358" x2="116.83271766465" y1="289.25217282335" y2="305.35046939781" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="118" x2="146.5" y1="309" y2="306.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="146.5" x2="175" y1="306.5" y2="304" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="117" x2="146" y1="303" y2="300.5" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="146" x2="175" y1="300.5" y2="298" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="203.34894905866" x2="189.03701148644" y1="264.01563880582" y2="282.36584313192" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="189.03701148644" x2="174.72507391423" y1="282.36584313192" y2="300.71604745803" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #000000" />
<line x1="519.83783643716" x2="523.34735777884" y1="514.34604643852" y2="522.00126886087" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #ff0000" />
<line x1="523.34735777884" x2="526.85687912051" y1="522.00126886087" y2="529.65649128322" style="stroke-opacity:1; stroke-width: 2.2057582420858; stroke: #a4a4a4" />
<ellipse cx="519.83783643716" cy="514.34604643852" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="519.83783643716" y="526.47771677"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">O</text>
<ellipse cx="487.87717749609" cy="436.75739694488" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="487.87717749609" y="448.88906727635"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">O</text>
<ellipse cx="462.27831594508" cy="379.24000756134" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="462.27831594508" y="391.37167789281"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">N</text>
<ellipse cx="491.08335485625" cy="333.43506635289" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.08335485625" y="345.56673668436"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">N</text>
<ellipse cx="457.04141915313" cy="291.72948200571" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.04141915313" y="303.86115233718"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">N</text>
<ellipse cx="409.44590583158" cy="367.66659204445" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="409.44590583158" y="379.79826237592"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">N</text>
<ellipse cx="262.08814058995" cy="259.38542997689" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.08814058995" y="271.51710030836"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">N</text>
<ellipse cx="293.04607914769" cy="209.34209924896" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="293.04607914769" y="221.47376958044"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">N</text>
<ellipse cx="537.95" cy="57.054994307755" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="69.186664639227"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">Cl</text>
<ellipse cx="526.85687912051" cy="529.65649128322" rx="14.337428573558" ry="14.337428573558" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="526.85687912051" y="541.78816161469"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:27.571978026073px">H</text>
</g></svg>

✍: FYIcenter.com

2022-07-01, 122👍, 0💬