Molecule FYI-1001262

A

Molecule Summary:

ID: FYI-1001262
SMILES: O=C(NCCN(C)C)COC1=C(C2)C=CC=C1CC3=CC=CC(CC4=CC=CC(CC5=CC=CC2=C5OCC(NCCN(C)C)=O)=C4OCC(NCCN(C)C)=O)=C3OCC(NCCN(C)C)=O

Received at FYIcenter.com on: 2022-04-18

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001262
FYIcenter.com

 68 72  0  0  0  0  0  0  0  0999 V2000
   16.6947   14.4580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6947   13.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8871   12.3925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0796   13.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2721   12.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4646   13.0810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6570   12.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4646   14.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5022   12.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3097   13.0810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1515   12.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9829   12.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9233   14.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9684   12.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0765   11.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9248   10.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1172   11.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3097   10.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3097    8.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3097    7.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0809    6.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9248    7.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9248    8.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7322    8.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5398    8.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3473    8.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1549    8.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1549   10.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3473   11.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3473   12.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5398   13.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9498   13.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8638   15.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1423   16.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7322   15.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5398   14.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4238   15.1060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1549   14.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9623   15.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7699   14.4580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5775   15.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3850   14.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1924   15.1464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1924   16.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   14.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9623   16.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5398   10.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5601   11.0156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5210   12.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6482   13.2706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6666   14.3088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1172   15.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1172   16.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9248   17.2119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7322   16.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9248   18.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0627   12.6926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1172    8.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1141    6.9712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3097    6.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3097    4.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5022    4.1308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5022    2.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6947    2.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6947    0.6885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5022    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8871    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1172    4.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  6  1  0  0  0  0
  9  2  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 12  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 17 11  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 33 32  1  0  0  0  0
 34 33  2  0  0  0  0
 35 34  1  0  0  0  0
 35 13  1  0  0  0  0
 36 35  2  0  0  0  0
 36 31  1  0  0  0  0
 37 36  1  0  0  0  0
 38 37  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 41  1  0  0  0  0
 43 42  1  0  0  0  0
 44 43  1  0  0  0  0
 45 43  1  0  0  0  0
 46 39  2  0  0  0  0
 47 29  2  0  0  0  0
 47 25  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  1  0  0  0  0
 50 49  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  1  0  0  0  0
 56 54  1  0  0  0  0
 57 50  2  0  0  0  0
 58 23  2  0  0  0  0
 58 19  1  0  0  0  0
 59 58  1  0  0  0  0
 60 59  1  0  0  0  0
 61 60  1  0  0  0  0
 62 61  1  0  0  0  0
 63 62  1  0  0  0  0
 64 63  1  0  0  0  0
 65 64  1  0  0  0  0
 66 65  1  0  0  0  0
 67 65  1  0  0  0  0
 68 61  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="406" x2="406" y1="373" y2="388.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="406" x2="406" y1="388.5" y2="404" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="410" x2="410" y1="373" y2="388.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="410" x2="410" y1="388.5" y2="404" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="433.54988480381" x2="420.50069117712" y1="357.80896808933" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="420.50069117712" x2="407.45149755043" y1="365.34366266496" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="459.65046078475" x2="446.60017279428" y1="372.87835724059" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="446.60017279428" x2="433.54988480381" y1="365.34366266496" y2="357.80896808933" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="485.75103676568" x2="472.70074877521" y1="357.80896808933" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="472.70074877521" x2="459.65046078475" y1="365.34366266496" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="511.85161274661" x2="498.80132475615" y1="372.87835724059" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="498.80132475615" x2="485.75103676568" y1="365.34366266496" y2="357.80896808933" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="537.95" x2="524.90080637331" y1="357.80896808933" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="524.90080637331" x2="511.85161274661" y1="365.34366266496" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="511.85161274661" x2="511.85161274661" y1="403.0171355431" y2="387.94774639184" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="511.85161274661" x2="511.85161274661" y1="387.94774639184" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="381.35092156949" x2="394.40120955996" y1="357.80896808933" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="394.40120955996" x2="407.45149755043" y1="365.34366266496" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="355.25034558856" x2="368.30063357903" y1="372.87835724059" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="368.30063357903" x2="381.35092156949" y1="365.34366266496" y2="357.80896808933" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.90050315576" x2="342.57542437216" y1="353.68102793839" y2="363.27969258949" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="342.57542437216" x2="355.25034558856" y1="363.27969258949" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="306" x2="318.5" y1="371" y2="363.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="318.5" x2="331" y1="363.5" y2="356" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="304" x2="317" y1="368" y2="360.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="317" x2="330" y1="360.5" y2="353" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.01855144106" x2="303.67079224964" y1="407.34643862824" y2="388.34171735005" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.67079224964" x2="304.32303305822" y1="388.34171735005" y2="369.33699607185" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="282.1183921084" x2="293.22071258331" y1="356.23746171161" y2="362.78722889173" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="293.22071258331" x2="304.32303305822" y1="362.78722889173" y2="369.33699607185" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="283" x2="282" y1="328" y2="342.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="282" x2="281" y1="342.5" y2="357" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="287" x2="285.5" y1="328" y2="342.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="285.5" x2="284" y1="342.5" y2="357" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.05138235424" x2="293.7678944697" y1="312.60298936311" y2="320.13768393874" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="293.7678944697" x2="284.48440658516" y1="320.13768393874" y2="327.67237851437" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="330" x2="317" y1="327" y2="319.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="317" x2="304" y1="319.5" y2="312" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329" x2="316" y1="330" y2="322.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="316" x2="303" y1="322.5" y2="315" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.14976960763" x2="329.52513638169" y1="327.67237851437" y2="340.67670322638" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.52513638169" x2="329.90050315576" y1="340.67670322638" y2="353.68102793839" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="355.25034558856" x2="342.20005759809" y1="312.60298936311" y2="320.13768393874" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="342.20005759809" x2="329.14976960763" y1="320.13768393874" y2="327.67237851437" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="355.25034558856" x2="355.25034558856" y1="282.46639978814" y2="297.53469457563" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="355.25034558856" x2="355.25034558856" y1="297.53469457563" y2="312.60298936311" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="354" x2="354" y1="243" y2="263" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="354" x2="354" y1="263" y2="283" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="357" x2="357" y1="243" y2="263" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="357" x2="357" y1="263" y2="283" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="328.35526150858" x2="341.80280354857" y1="224.57674493534" y2="233.43014785717" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="341.80280354857" x2="355.25034558856" y1="233.43014785717" y2="242.28355077901" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="304" x2="317" y1="244" y2="235" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="317" x2="330" y1="235" y2="226" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303" x2="315.5" y1="241" y2="232.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="315.5" x2="328" y1="232.5" y2="224" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.05138235424" x2="303.05138235424" y1="282.46639978814" y2="262.37497528358" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.05138235424" x2="303.05138235424" y1="262.37497528358" y2="242.28355077901" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="276.94861764576" x2="290" y1="267.39701063689" y2="274.93170521252" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="290" x2="303.05138235424" y1="274.93170521252" y2="282.46639978814" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="250.85023039237" x2="263.89942401907" y1="282.46639978814" y2="274.93170521252" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="263.89942401907" x2="276.94861764576" y1="274.93170521252" y2="267.39701063689" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="224" x2="237.5" y1="269" y2="276.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="237.5" x2="251" y1="276.5" y2="284" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="226" x2="239" y1="266" y2="274" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="239" x2="252" y1="274" y2="282" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="198.65126715805" x2="211.70046078475" y1="282.46639978814" y2="274.93170521252" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="211.70046078475" x2="224.74965441144" y1="274.93170521252" y2="267.39701063689" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="201" x2="201" y1="313" y2="298" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="201" x2="201" y1="298" y2="283" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="198" x2="198" y1="313" y2="298" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="198" x2="198" y1="298" y2="283" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="224.74965441144" x2="211.70046078475" y1="327.67237851437" y2="320.13768393874" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="211.70046078475" x2="198.65126715805" y1="320.13768393874" y2="312.60298936311" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="224.74965441144" x2="224.74965441144" y1="357.80896808933" y2="342.74067330185" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="224.74965441144" x2="224.74965441144" y1="342.74067330185" y2="327.67237851437" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="250.85023039237" x2="237.79994240191" y1="372.87835724059" y2="365.34366266496" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="237.79994240191" x2="224.74965441144" y1="365.34366266496" y2="357.80896808933" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="217" x2="234.5" y1="395" y2="385" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="234.5" x2="252" y1="385" y2="375" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="216" x2="233.5" y1="392" y2="382" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="233.5" x2="251" y1="382" y2="372" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="214.1671567286" x2="215.1083095732" y1="425.11671757073" y2="409.04379683983" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="215.1083095732" x2="216.0494624178" y1="409.04379683983" y2="392.97087610893" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="243" x2="229" y1="437" y2="430.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="229" x2="215" y1="430.5" y2="424" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="242" x2="228" y1="440" y2="433.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="228" x2="214" y1="433.5" y2="427" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="276.94861764576" x2="259.54932802224" y1="418.08433596681" y2="428.13168976475" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="259.54932802224" x2="242.15003839873" y1="428.13168976475" y2="438.1790435627" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="276.94861764576" x2="289.98358454341" y1="418.08433596681" y2="412.71538729752" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="289.98358454341" x2="303.01855144106" y1="412.71538729752" y2="407.34643862824" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="251" x2="264" y1="405" y2="412.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="264" x2="277" y1="412.5" y2="420" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="252" x2="265" y1="402" y2="409.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="265" x2="278" y1="409.5" y2="417" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="250.85023039237" x2="250.85023039237" y1="403.0171355431" y2="387.94774639184" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="250.85023039237" x2="250.85023039237" y1="387.94774639184" y2="372.87835724059" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="226.4240309838" x2="238.63713068809" y1="417.2000900384" y2="410.10861279075" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="238.63713068809" x2="250.85023039237" y1="410.10861279075" y2="403.0171355431" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="198.65126715805" x2="212.53764907093" y1="403.0171355431" y2="410.10861279075" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="212.53764907093" x2="226.4240309838" y1="410.10861279075" y2="417.2000900384" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="172.54850244957" x2="185.59988480381" y1="418.08433596681" y2="410.55073575495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="185.59988480381" x2="198.65126715805" y1="410.55073575495" y2="403.0171355431" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="146.45011519619" x2="159.49930882288" y1="403.0171355431" y2="410.55073575495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="159.49930882288" x2="172.54850244957" y1="410.55073575495" y2="418.08433596681" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="120.3517279428" x2="133.40092156949" y1="418.08433596681" y2="410.55073575495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="133.40092156949" x2="146.45011519619" y1="410.55073575495" y2="403.0171355431" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="94.251151961866" x2="107.30143995233" y1="403.0171355431" y2="410.55073575495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="107.30143995233" x2="120.3517279428" y1="410.55073575495" y2="418.08433596681" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="68.148387253388" x2="81.199769607627" y1="418.08433596681" y2="410.55073575495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="81.199769607627" x2="94.251151961866" y1="410.55073575495" y2="403.0171355431" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="68.148387253388" x2="68.148387253388" y1="448.22311426932" y2="433.15372511807" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="68.148387253388" x2="68.148387253388" y1="433.15372511807" y2="418.08433596681" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="42.05" x2="55.099193626694" y1="403.0171355431" y2="410.55073575495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="55.099193626694" x2="68.148387253388" y1="410.55073575495" y2="418.08433596681" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="175" x2="175" y1="449" y2="434" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="175" x2="175" y1="434" y2="419" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="171" x2="171" y1="449" y2="434" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="171" x2="171" y1="434" y2="419" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="251" x2="237.5" y1="312" y2="319.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="237.5" x2="224" y1="319.5" y2="327" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="252" x2="239" y1="315" y2="322.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="239" x2="226" y1="322.5" y2="330" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="250.85023039237" x2="250.85023039237" y1="312.60298936311" y2="297.53469457563" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="250.85023039237" x2="250.85023039237" y1="297.53469457563" y2="282.46639978814" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="273.18181753983" x2="262.0160239661" y1="327.67237851437" y2="320.13768393874" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="262.0160239661" x2="250.85023039237" y1="320.13768393874" y2="312.60298936311" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="272.32602506951" x2="272.75392130467" y1="359.21631990113" y2="343.44434920775" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="272.75392130467" x2="273.18181753983" y1="343.44434920775" y2="327.67237851437" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="296.99736196319" x2="284.66169351635" y1="377.02818466699" y2="368.12225228406" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="284.66169351635" x2="272.32602506951" y1="368.12225228406" y2="359.21631990113" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="297.40008783158" x2="297.19872489738" y1="399.75155404511" y2="388.38986935605" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="297.19872489738" x2="296.99736196319" y1="388.38986935605" y2="377.02818466699" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.14976960763" x2="313.2749287196" y1="418.08433596681" y2="408.91794500596" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="313.2749287196" x2="297.40008783158" y1="408.91794500596" y2="399.75155404511" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="329.14976960763" x2="329.14976960763" y1="448.22311426932" y2="433.15372511807" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.14976960763" x2="329.14976960763" y1="433.15372511807" y2="418.08433596681" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.05138235424" x2="316.10057598093" y1="463.29250342058" y2="455.75780884495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="316.10057598093" x2="329.14976960763" y1="455.75780884495" y2="448.22311426932" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="276.94861764576" x2="290" y1="448.22311426932" y2="455.75780884495" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="290" x2="303.05138235424" y1="455.75780884495" y2="463.29250342058" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="303.05138235424" x2="303.05138235424" y1="493.42909299554" y2="478.36079820806" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="303.05138235424" x2="303.05138235424" y1="478.36079820806" y2="463.29250342058" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="328" x2="312.5" y1="363" y2="369.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="312.5" x2="297" y1="369.5" y2="376" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329" x2="313.5" y1="366" y2="372.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="313.5" x2="298" y1="372.5" y2="379" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329" x2="316" y1="266" y2="274" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="316" x2="303" y1="274" y2="282" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="330" x2="317" y1="269" y2="276.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="317" x2="304" y1="276.5" y2="284" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.14976960763" x2="342.20005759809" y1="267.39701063689" y2="274.93170521252" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="342.20005759809" x2="355.25034558856" y1="274.93170521252" y2="282.46639978814" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="329.08191905371" x2="329.11584433067" y1="239.1514816613" y2="253.27424614909" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="329.11584433067" x2="329.14976960763" y1="253.27424614909" y2="267.39701063689" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="355.25034558856" x2="342.16613232114" y1="222.19103191067" y2="230.67125678598" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="342.16613232114" x2="329.08191905371" y1="230.67125678598" y2="239.1514816613" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="355.25034558856" x2="355.25034558856" y1="192.05225360816" y2="207.12164275941" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="355.25034558856" x2="355.25034558856" y1="207.12164275941" y2="222.19103191067" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="381.35092156949" x2="368.30063357903" y1="176.9828644569" y2="184.51755903253" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="368.30063357903" x2="355.25034558856" y1="184.51755903253" y2="192.05225360816" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="381.35092156949" x2="381.35092156949" y1="146.84627488193" y2="161.91456966942" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="381.35092156949" x2="381.35092156949" y1="161.91456966942" y2="176.9828644569" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="407.45149755043" x2="394.40120955996" y1="131.77688573068" y2="139.31158030631" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="394.40120955996" x2="381.35092156949" y1="139.31158030631" y2="146.84627488193" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="407.45149755043" x2="407.45149755043" y1="101.64029615571" y2="116.7085909432" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="407.45149755043" x2="407.45149755043" y1="116.7085909432" y2="131.77688573068" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="381.35092156949" x2="394.40120955996" y1="86.570907004458" y2="94.105601580086" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="394.40120955996" x2="407.45149755043" y1="94.105601580086" y2="101.64029615571" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="433.54988480381" x2="420.50069117712" y1="86.570907004458" y2="94.105601580086" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="420.50069117712" x2="407.45149755043" y1="94.105601580086" y2="101.64029615571" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #0000ff" />
<line x1="329" x2="342" y1="179" y2="186.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="342" x2="355" y1="186.5" y2="194" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<line x1="330" x2="343.5" y1="176" y2="183.5" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #ff0000" />
<line x1="343.5" x2="357" y1="183.5" y2="191" style="stroke-opacity:1; stroke-width: 1.3065545189482; stroke: #000000" />
<ellipse cx="407.45149755043" cy="403.0171355431" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="407.45149755043" y="410.20318539731"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="433.54988480381" cy="357.80896808933" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="433.54988480381" y="364.99501794355"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="511.85161274661" cy="372.87835724059" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="511.85161274661" y="380.0644070948"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="355.25034558856" cy="372.87835724059" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="355.25034558856" y="380.0644070948"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="226.4240309838" cy="417.2000900384" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="226.4240309838" y="424.38613989261"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="146.45011519619" cy="403.0171355431" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="146.45011519619" y="410.20318539731"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="68.148387253388" cy="418.08433596681" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="68.148387253388" y="425.27038582102"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="172.54850244957" cy="448.22311426932" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.54850244957" y="455.40916412354"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="273.18181753983" cy="327.67237851437" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="273.18181753983" y="334.85842836858"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="297.40008783158" cy="399.75155404511" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="297.40008783158" y="406.93760389932"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="303.05138235424" cy="463.29250342058" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="303.05138235424" y="470.47855327479"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="327.95691309529" cy="364.37733945359" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.95691309529" y="371.56338930781"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="329.08191905371" cy="239.1514816613" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="329.08191905371" y="246.33753151551"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
<ellipse cx="381.35092156949" cy="176.9828644569" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="381.35092156949" y="184.16891431112"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="407.45149755043" cy="101.64029615571" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="407.45149755043" y="108.82634600993"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">N</text>
<ellipse cx="329.14976960763" cy="176.9828644569" rx="8.492604373163" ry="8.492604373163" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="329.14976960763" y="184.16891431112"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.331931486852px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 122👍, 0💬