Molecule FYI-1001263

A

Molecule Summary:

ID: FYI-1001263
SMILES: [H]N1C2=CC(F)=CC=C2C3=C1C4=CC=C(F)C=C4C(C5=CC=CC=C5)C3C6=CC=CC=C6

Received at FYIcenter.com on: 2022-04-19

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001263
FYIcenter.com

 31 36  0  0  0  0  0  0  0  0999 V2000
    2.4249    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5587    8.3693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1664    8.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3435    9.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9512    9.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1282   10.6346    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.3818    8.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2047    7.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5970    7.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6996    4.2000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 27  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  5  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
  9  3  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  2  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 15  1  0  0  0  0
 18 17  2  0  0  0  0
 18 12  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 25 20  1  0  0  0  0
 26 19  1  0  0  0  0
 26 10  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 31 30  1  0  0  0  0
  1 31  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="176.92495157317" x2="176.92495157317" y1="172.61626483366" y2="205.25783104207" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="176.92495157317" x2="176.92495157317" y1="205.25783104207" y2="237.89939725048" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="211.50169634965" x2="243.96373394392" y1="439.14864216802" y2="435.73293541835" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="243.96373394392" x2="276.42577153819" y1="435.73293541835" y2="432.31722866869" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #0000ff" />
<line x1="176" x2="195.5" y1="494" y2="468" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="195.5" x2="215" y1="468" y2="442" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="171" x2="190" y1="490" y2="464" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="190" x2="209" y1="464" y2="438" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="108.20512854268" x2="140.66716613695" y1="485.13594587479" y2="488.54698954357" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="140.66716613695" x2="173.12920373122" y1="488.54698954357" y2="491.95803321234" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="69.82797284336" x2="89.016550693021" y1="537.95" y2="511.54297293739" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #00bc00" />
<line x1="89.016550693021" x2="108.20512854268" y1="511.54297293739" y2="485.13594587479" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="79" x2="92.5" y1="427" y2="457" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="92.5" x2="106" y1="457" y2="487" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="85" x2="98.5" y1="425" y2="454.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="98.5" x2="112" y1="454.5" y2="484" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="120.02603859101" x2="100.8397922818" y1="372.68108720591" y2="399.08811426852" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="100.8397922818" x2="81.65354597258" y1="399.08811426852" y2="425.49514133113" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="186" x2="153.5" y1="377" y2="373.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="153.5" x2="121" y1="373.5" y2="370" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="185" x2="152.5" y1="383" y2="380" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="152.5" x2="120" y1="380" y2="377" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="184.95011377955" x2="198.2259050646" y1="379.50317454347" y2="409.32590835574" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="198.2259050646" x2="211.50169634965" y1="409.32590835574" y2="439.14864216802" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="233.46014424614" x2="209.20512901284" y1="335.82409587573" y2="357.6636352096" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="209.20512901284" x2="184.95011377955" y1="357.6636352096" y2="379.50317454347" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="292" x2="264" y1="366" y2="349.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="264" x2="236" y1="349.5" y2="333" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="289" x2="260.5" y1="372" y2="355.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="260.5" x2="232" y1="355.5" y2="339" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="290.00466308089" x2="283.21521730954" y1="368.46566208414" y2="400.39144537641" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="283.21521730954" x2="276.42577153819" y1="400.39144537641" y2="432.31722866869" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #0000ff" />
<line x1="346.53985575386" x2="318.27225941737" y1="335.82409587573" y2="352.14487897993" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="318.27225941737" x2="290.00466308089" y1="352.14487897993" y2="368.46566208414" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="405" x2="377" y1="366" y2="349.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="377" x2="349" y1="349.5" y2="333" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="402" x2="373.5" y1="372" y2="355.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="373.5" x2="345" y1="355.5" y2="339" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="459.61024109981" x2="431.34264476332" y1="335.82409587573" y2="352.14487897993" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="431.34264476332" x2="403.07504842683" y1="352.14487897993" y2="368.46566208414" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="457" x2="457" y1="271" y2="303.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="457" x2="457" y1="303.5" y2="336" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="464" x2="464" y1="271" y2="303.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="464" x2="464" y1="303.5" y2="336" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="516.15009685367" x2="487.88016897674" y1="237.89939725048" y2="254.22018035469" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #00bc00" />
<line x1="487.88016897674" x2="459.61024109981" y1="254.22018035469" y2="270.5409634589" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="403.07504842683" x2="431.34264476332" y1="237.89939725048" y2="254.22018035469" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="431.34264476332" x2="459.61024109981" y1="254.22018035469" y2="270.5409634589" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="349" x2="377" y1="274" y2="257.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="377" x2="405" y1="257.5" y2="241" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="345" x2="373.5" y1="268" y2="251.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="373.5" x2="402" y1="251.5" y2="235" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="346.53985575386" x2="346.53985575386" y1="270.5409634589" y2="303.18252966731" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="346.53985575386" x2="346.53985575386" y1="303.18252966731" y2="335.82409587573" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="290.00466308089" x2="318.27225941737" y1="237.89939725048" y2="254.22018035469" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="318.27225941737" x2="346.53985575386" y1="254.22018035469" y2="270.5409634589" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="290.00466308089" x2="290.00466308089" y1="172.61626483366" y2="205.25783104207" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="290.00466308089" x2="290.00466308089" y1="205.25783104207" y2="237.89939725048" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="232" x2="260.5" y1="143" y2="159.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="260.5" x2="289" y1="159.5" y2="176" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="236" x2="264" y1="137" y2="153.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="264" x2="292" y1="153.5" y2="170" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="233.46014424614" x2="233.46014424614" y1="74.691566208414" y2="107.33313241683" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="233.46014424614" x2="233.46014424614" y1="107.33313241683" y2="139.97469862524" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="289" x2="260.5" y1="40" y2="56" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="260.5" x2="232" y1="56" y2="72" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="292" x2="264" y1="46" y2="62" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="264" x2="236" y1="62" y2="78" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="346.53985575386" x2="318.27225941737" y1="74.691566208414" y2="58.370783104207" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="318.27225941737" x2="290.00466308089" y1="58.370783104207" y2="42.05" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="350" x2="350" y1="140" y2="107.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="350" x2="350" y1="107.5" y2="75" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="344" x2="344" y1="140" y2="107.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="344" x2="344" y1="107.5" y2="75" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="346.53985575386" x2="318.27225941737" y1="139.97469862524" y2="156.29548172945" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="318.27225941737" x2="290.00466308089" y1="156.29548172945" y2="172.61626483366" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="233.46014424614" x2="261.73240366351" y1="270.5409634589" y2="254.22018035469" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="261.73240366351" x2="290.00466308089" y1="254.22018035469" y2="237.89939725048" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="233.46014424614" x2="233.46014424614" y1="270.5409634589" y2="303.18252966731" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="233.46014424614" x2="233.46014424614" y1="303.18252966731" y2="335.82409587573" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="176.92495157317" x2="205.19254790965" y1="237.89939725048" y2="254.22018035469" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="205.19254790965" x2="233.46014424614" y1="254.22018035469" y2="270.5409634589" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="123" x2="151" y1="274" y2="257.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="151" x2="179" y1="257.5" y2="241" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="119" x2="147.5" y1="268" y2="251.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="147.5" x2="176" y1="251.5" y2="235" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="63.849903146334" x2="92.119831023264" y1="237.89939725048" y2="254.22018035469" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="92.119831023264" x2="120.38975890019" y1="254.22018035469" y2="270.5409634589" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="61" x2="61" y1="173" y2="205.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="61" x2="61" y1="205.5" y2="238" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="68" x2="68" y1="173" y2="205.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="68" x2="68" y1="205.5" y2="238" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="120.38975890019" x2="92.119831023264" y1="139.97469862524" y2="156.29548172945" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="92.119831023264" x2="63.849903146334" y1="156.29548172945" y2="172.61626483366" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="179" x2="151" y1="170" y2="153.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="151" x2="123" y1="153.5" y2="137" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="176" x2="147.5" y1="176" y2="159.5" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<line x1="147.5" x2="119" y1="159.5" y2="143" style="stroke-opacity:1; stroke-width: 2.7487729817104; stroke: #000000" />
<ellipse cx="276.42577153819" cy="432.31722866869" rx="17.867024381118" ry="17.867024381118" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.42577153819" y="447.43548006809"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.35966227138px">N</text>
<ellipse cx="69.82797284336" cy="537.95" rx="17.867024381118" ry="17.867024381118" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="69.82797284336" y="553.06825139941"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:34.35966227138px">F</text>
<ellipse cx="516.15009685367" cy="237.89939725048" rx="17.867024381118" ry="17.867024381118" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="516.15009685367" y="253.01764864989"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:34.35966227138px">F</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 125👍, 0💬