Molecule FYI-1001269

A

Molecule Summary:

ID: FYI-1001269
SMILES: OC(=O)CC1=C(C)C(=Cc2ccc(cc2)S(=O)C)c2c1cc(F)cc2

Received at FYIcenter.com on: 2022-04-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001269
FYIcenter.com

 42 44  0  0  0  0  0  0  0  0999 V2000
    7.1441    3.1574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8335    2.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5013    1.4626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8550    2.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5443    1.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1279    0.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1279    0.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5443   -0.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8550   -1.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8335   -1.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1441   -2.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1226   -2.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7905   -2.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4798   -1.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5013   -0.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7690   -2.3347    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.4368   -1.5904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0796   -3.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -0.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    1.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    1.2454    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -0.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7508    3.2852    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8344    2.6203    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2411    2.0880    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1279   -0.3746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7479    0.2454    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1279    0.8654    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4409   -1.9713    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7301   -3.1281    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3152   -3.4621    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8939   -0.7165    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3087   -0.3824    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4903   -3.4779    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.2723   -3.8746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6690   -3.0926    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    1.8654    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3291   -0.5646    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -1.3746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  6  7  1  0  0  0  0
  6  8  1  0  0  0  0
  8  9  2  3  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  2  0  0  0  0
 12 13  1  0  0  0  0
 13 14  2  0  0  0  0
 14 15  1  0  0  0  0
 10 15  2  0  0  0  0
 13 16  1  0  0  0  0
 16 17  2  0  0  0  0
 16 18  1  0  0  0  0
  8 19  1  0  0  0  0
 19 20  1  0  0  0  0
  5 20  1  0  0  0  0
 20 21  2  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 22 24  2  0  0  0  0
 24 25  1  0  0  0  0
 19 25  2  0  0  0  0
  1 26  1  0  0  0  0
  4 27  1  0  0  0  0
  4 28  1  0  0  0  0
  7 29  1  0  0  0  0
  7 30  1  0  0  0  0
  7 31  1  0  0  0  0
  9 32  1  0  0  0  0
 11 33  1  0  0  0  0
 12 34  1  0  0  0  0
 14 35  1  0  0  0  0
 15 36  1  0  0  0  0
 18 37  1  0  0  0  0
 18 38  1  0  0  0  0
 18 39  1  0  0  0  0
 21 40  1  0  0  0  0
 24 41  1  0  0  0  0
 25 42  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="336.312220556" x2="327.42846579767" y1="487.47334063906" y2="460.287220556" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #ff0000" />
<line x1="327.42846579767" x2="318.54471103934" y1="460.287220556" y2="433.10110047295" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="321" x2="340" y1="436" y2="414.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="340" x2="359" y1="414.5" y2="393" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #ff0000" />
<line x1="317" x2="336" y1="432" y2="410.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="336" x2="355" y1="410.5" y2="389" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #ff0000" />
<line x1="318.54471103934" x2="290.55773733995" y1="433.10110047295" y2="427.20338562695" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="290.55773733995" x2="262.57076364056" y1="427.20338562695" y2="421.30567078094" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="262.57076364056" x2="253.68414869074" y1="421.30567078094" y2="394.1166905064" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="253.68414869074" x2="244.79753374092" y1="394.1166905064" y2="366.92771023186" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="248" x2="264.5" y1="369" y2="346" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="264.5" x2="281" y1="346" y2="323" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="243" x2="259.5" y1="366" y2="343" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="259.5" x2="276" y1="343" y2="320" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="278.1816887761" x2="306.78360364517" y1="320.89578844157" y2="320.89578844157" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="306.78360364517" x2="335.38551851425" y1="320.89578844157" y2="320.89578844157" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="278.1816887761" x2="261.48961125851" y1="320.89578844157" y2="297.87982754643" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="261.48961125851" x2="244.79753374092" y1="297.87982754643" y2="274.86386665129" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<polygon points=" 254,248 237,273 253,278" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 254,248 271,224 255,218" fill-opacity="1"  style="fill:#000000" />
<line x1="262.57076364056" x2="290.55773733995" y1="220.4859061022" y2="214.5881912562" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="290.55773733995" x2="318.54471103934" y1="214.5881912562" y2="208.6904764102" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="318.54471103934" x2="327.42846579767" y1="208.6904764102" y2="181.50435632714" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="327.42846579767" x2="336.312220556" y1="181.50435632714" y2="154.31823624409" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="337" x2="365" y1="158" y2="152" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="365" x2="393" y1="152" y2="146" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="336" x2="364" y1="152" y2="146" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="364" x2="392" y1="146" y2="140" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="392.28616795478" x2="411.38938689584" y1="142.52280655208" y2="163.81121178913" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="411.38938689584" x2="430.49260583689" y1="163.81121178913" y2="185.09961702619" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="428" x2="419" y1="185" y2="212" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="419" x2="410" y1="212" y2="239" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="434" x2="425" y1="187" y2="214" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="425" x2="416" y1="214" y2="241" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="412.71937593725" x2="384.73240223786" y1="239.47185719229" y2="245.3695720383" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="384.73240223786" x2="356.74542853847" y1="245.3695720383" y2="251.2672868843" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="317" x2="336" y1="211" y2="232.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="336" x2="355" y1="232.5" y2="254" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="321" x2="340" y1="207" y2="228.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="340" x2="359" y1="228.5" y2="250" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="430.49260583689" x2="458.47957953628" y1="185.09961702619" y2="179.20190218018" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="458.47957953628" x2="486.46655323567" y1="179.20190218018" y2="173.30418733418" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #c8aa1a" />
<line x1="485" x2="504" y1="176" y2="197" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #c8aa1a" />
<line x1="504" x2="523" y1="197" y2="218" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #ff0000" />
<line x1="489" x2="508" y1="172" y2="193" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #c8aa1a" />
<line x1="508" x2="527" y1="193" y2="214" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #ff0000" />
<line x1="486.46655323567" x2="495.350307994" y1="173.30418733418" y2="146.11806725112" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #c8aa1a" />
<line x1="495.350307994" x2="504.23406275234" y1="146.11806725112" y2="118.93194716807" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="244.79753374092" x2="217.7344018918" y1="274.86386665129" y2="283.57887011189" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="217.7344018918" x2="190.67127004268" y1="283.57887011189" y2="292.2938735725" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="190.67127004268" x2="190.67127004268" y1="292.2938735725" y2="320.89578844157" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="190.67127004268" x2="190.67127004268" y1="320.89578844157" y2="349.49770331065" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="244.79753374092" x2="217.7344018918" y1="366.92771023186" y2="358.21270677125" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="217.7344018918" x2="190.67127004268" y1="358.21270677125" y2="349.49770331065" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="190" x2="165" y1="347" y2="361.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="165" x2="140" y1="361.5" y2="376" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="193" x2="168" y1="353" y2="367" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="168" x2="143" y1="367" y2="381" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="141.13275348945" x2="116.36063502134" y1="378.09961817972" y2="363.79866074518" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="116.36063502134" x2="91.588516553236" y1="363.79866074518" y2="349.49770331065" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="91.588516553236" x2="66.819258276618" y1="349.49770331065" y2="363.79866074518" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="66.819258276618" x2="42.05" y1="363.79866074518" y2="378.09961817972" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #00bc00" />
<line x1="95" x2="95" y1="350" y2="321.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="95" x2="95" y1="321.5" y2="293" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="89" x2="89" y1="350" y2="321.5" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="89" x2="89" y1="321.5" y2="293" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="91.588516553236" x2="116.36063502134" y1="292.2938735725" y2="277.99291613796" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="116.36063502134" x2="141.13275348945" y1="277.99291613796" y2="263.69195870343" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="193" x2="168" y1="290" y2="276" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="168" x2="143" y1="276" y2="262" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="190" x2="165" y1="295" y2="281" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="165" x2="140" y1="281" y2="267" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #000000" />
<line x1="336.312220556" x2="353.66500230707" y1="487.47334063906" y2="491.12866535933" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #ff0000" />
<line x1="353.66500230707" x2="371.01778405814" y1="491.12866535933" y2="494.78399007959" style="stroke-opacity:1; stroke-width: 2.405872990463; stroke: #a4a4a4" />
<ellipse cx="336.312220556" cy="487.47334063906" rx="15.638174438009" ry="15.638174438009" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="336.312220556" y="500.70564208661"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.073412380787px">O</text>
<ellipse cx="356.74542853847" cy="390.52428999885" rx="15.638174438009" ry="15.638174438009" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="356.74542853847" y="403.75659144639"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.073412380787px">O</text>
<ellipse cx="486.46655323567" cy="173.30418733418" rx="15.638174438009" ry="15.638174438009" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="486.46655323567" y="186.53648878173"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:30.073412380787px">S</text>
<ellipse cx="524.6672707348" cy="215.88099780828" rx="15.638174438009" ry="15.638174438009" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="524.6672707348" y="229.11329925583"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.073412380787px">O</text>
<ellipse cx="42.05" cy="378.09961817972" rx="15.638174438009" ry="15.638174438009" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="391.33191962727"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:30.073412380787px">F</text>
<ellipse cx="371.01778405814" cy="494.78399007959" rx="15.638174438009" ry="15.638174438009" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="371.01778405814" y="508.01629152714"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:30.073412380787px">H</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 143👍, 0💬