Molecule FYI-1001273

A

Molecule Summary:

ID: FYI-1001273
SMILES: FC=1C=C2C(=CNC2=C(C1F)F)C1=NC=2C=CC=C(C2C=C1)C(=O)N

Received at FYIcenter.com on: 2022-04-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001273
FYIcenter.com

 25 28  0  0  0  0  0  0  0  0999 V2000
    7.2331    3.2451    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.8636    2.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9269    3.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5575    3.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2922    3.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7249    2.3719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1249    2.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0617    1.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4310    1.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3679    0.5821    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6291    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    5.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.6262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    8.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    8.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   10.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   10.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   10.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    8.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    8.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   10.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   12.2262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.1262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  8  4  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 10  2  1  0  0  0  0
 11 10  1  0  0  0  0
 12  9  1  0  0  0  0
 13  5  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 20 15  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 22 13  1  0  0  0  0
 23 19  1  0  0  0  0
 24 23  2  0  0  0  0
 25 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="381.14132723168" x2="408.91508563577" y1="161.8655273102" y2="167.76909873877" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="408.91508563577" x2="436.68884403985" y1="167.76909873877" y2="173.67267016735" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #00bc00" />
<line x1="343.14836703146" x2="362.14484713157" y1="204.0605486578" y2="182.963037984" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="362.14484713157" x2="381.14132723168" y1="182.963037984" y2="161.8655273102" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="287" x2="315" y1="196" y2="201.5" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="315" x2="343" y1="201.5" y2="207" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="289" x2="316.5" y1="190" y2="196" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="316.5" x2="344" y1="196" y2="202" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="264.63553148157" y1="225.63464445208" y2="208.94605314816" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="264.63553148157" x2="287.60490626687" y1="208.94605314816" y2="192.25746184424" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="194" x2="217" y1="195" y2="212" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="217" x2="240" y1="212" y2="229" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="198" x2="221" y1="190" y2="207" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="221" x2="244" y1="207" y2="224" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="213.27385164646" x2="204.49860136428" y1="138.2552976395" y2="165.25637974187" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #0000ff" />
<line x1="204.49860136428" x2="195.7233510821" y1="165.25637974187" y2="192.25746184424" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="270.05846174609" x2="241.66615669628" y1="138.2552976395" y2="138.2552976395" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="213.27385164646" y1="138.2552976395" y2="138.2552976395" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #0000ff" />
<line x1="270.05846174609" x2="278.83168400648" y1="138.2552976395" y2="165.25637974187" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="278.83168400648" x2="287.60490626687" y1="165.25637974187" y2="192.25746184424" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="306" x2="287" y1="95" y2="116" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="287" x2="268" y1="116" y2="137" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="311" x2="292" y1="99" y2="120" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="292" x2="273" y1="120" y2="141" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="363.5948827109" x2="335.8251803504" y1="107.85930706188" y2="101.95573563331" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="335.8251803504" x2="308.05547798989" y1="101.95573563331" y2="96.052164204741" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="363.5948827109" x2="372.36810497129" y1="107.85930706188" y2="134.86241718604" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="372.36810497129" x2="381.14132723168" y1="134.86241718604" y2="161.8655273102" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="401.59595499828" x2="382.59541885459" y1="65.660229670707" y2="86.759768366295" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #00bc00" />
<line x1="382.59541885459" x2="363.5948827109" y1="86.759768366295" y2="107.85930706188" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="290.50903346911" x2="299.2822557295" y1="42.05" y2="69.05108210237" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #00bc00" />
<line x1="299.2822557295" x2="308.05547798989" y1="69.05108210237" y2="96.052164204741" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="241.66615669628" y1="282.4192545517" y2="254.02694950189" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="241.66615669628" y1="254.02694950189" y2="225.63464445208" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="293" x2="268.5" y1="309" y2="294.5" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #0000ff" />
<line x1="268.5" x2="244" y1="294.5" y2="280" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="290" x2="265.5" y1="314" y2="300" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #0000ff" />
<line x1="265.5" x2="241" y1="300" y2="286" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="290.84162904255" x2="290.84162904255" y1="367.59616970113" y2="339.20386465132" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="290.84162904255" x2="290.84162904255" y1="339.20386465132" y2="310.81155960151" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #0000ff" />
<line x1="340.01710138882" x2="315.42936521568" y1="395.98847475094" y2="381.79232222604" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="315.42936521568" x2="290.84162904255" y1="381.79232222604" y2="367.59616970113" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="344" x2="344" y1="453" y2="424.5" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="344" x2="344" y1="424.5" y2="396" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="338" x2="338" y1="453" y2="424.5" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="338" x2="338" y1="424.5" y2="396" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="290.84162904255" x2="315.42936521568" y1="481.16538990038" y2="466.96923737547" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="315.42936521568" x2="340.01710138882" y1="466.96923737547" y2="452.77308485057" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241" x2="265.5" y1="456" y2="470" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="265.5" x2="290" y1="470" y2="484" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="244" x2="268.5" y1="451" y2="465" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="268.5" x2="293" y1="465" y2="479" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="241.66615669628" y1="395.98847475094" y2="424.38077980076" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="241.66615669628" y1="424.38077980076" y2="452.77308485057" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="241.66615669628" x2="266.25389286941" y1="395.98847475094" y2="381.79232222604" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="266.25389286941" x2="290.84162904255" y1="381.79232222604" y2="367.59616970113" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="192.48662830642" x2="217.07639250135" y1="367.59616970113" y2="381.79232222604" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="217.07639250135" x2="241.66615669628" y1="381.79232222604" y2="395.98847475094" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="190" x2="190" y1="311" y2="339.5" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="190" x2="190" y1="339.5" y2="368" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="196" x2="196" y1="311" y2="339.5" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="196" x2="196" y1="339.5" y2="368" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="192.48662830642" x2="217.07639250135" y1="310.81155960151" y2="296.61540707661" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="217.07639250135" x2="241.66615669628" y1="296.61540707661" y2="282.4192545517" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="192.48662830642" x2="217.07639250135" y1="481.16538990038" y2="466.96923737547" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="217.07639250135" x2="241.66615669628" y1="466.96923737547" y2="452.77308485057" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="196" x2="196" y1="538" y2="510" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #ff0000" />
<line x1="196" x2="196" y1="510" y2="482" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="190" x2="190" y1="538" y2="510" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #ff0000" />
<line x1="190" x2="190" y1="510" y2="482" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<line x1="143.31115596015" x2="167.89889213329" y1="452.77308485057" y2="466.96923737547" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #0000ff" />
<line x1="167.89889213329" x2="192.48662830642" y1="466.96923737547" y2="481.16538990038" style="stroke-opacity:1; stroke-width: 2.3909172396933; stroke: #000000" />
<ellipse cx="436.68884403985" cy="173.67267016735" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="436.68884403985" y="186.82271498566"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">F</text>
<ellipse cx="213.27385164646" cy="138.2552976395" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="213.27385164646" y="151.40534245781"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">N</text>
<ellipse cx="401.59595499828" cy="65.660229670707" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="401.59595499828" y="78.81027448902"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">F</text>
<ellipse cx="290.50903346911" cy="42.05" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.50903346911" y="55.200044818313"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">F</text>
<ellipse cx="290.84162904255" cy="310.81155960151" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.84162904255" y="323.96160441982"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">N</text>
<ellipse cx="192.48662830642" cy="537.95" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="192.48662830642" y="551.10004481831"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">O</text>
<ellipse cx="143.31115596015" cy="452.77308485057" rx="15.540962058007" ry="15.540962058007" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="143.31115596015" y="465.92312966888"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:29.886465496166px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 141👍, 0💬