Molecule FYI-1001277

A

Molecule Summary:

ID: FYI-1001277
SMILES: NC1=NC2=C(C(=O)N1)C(=O)C(CCC(O)=O)=NN2

Received at FYIcenter.com on: 2022-04-25

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001277
FYIcenter.com

 18 19  0  0  0  0  0  0  0  0999 V2000
    9.6995    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  6  1  0  0  0  0
  8  2  1  0  0  0  0
  9  5  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 14  2  0  0  0  0
 17 11  2  0  0  0  0
 18 17  1  0  0  0  0
 18  4  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="475.964417238" x2="506.957208619" y1="164.74045053869" y2="146.84622918707" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="506.957208619" x2="537.95" y1="146.84622918707" y2="128.95200783546" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="480" x2="480" y1="237" y2="201" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="480" x2="480" y1="201" y2="165" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="473" x2="473" y1="237" y2="201" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="473" x2="473" y1="201" y2="165" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="413.978834476" x2="444.971625857" y1="272.10577864838" y2="254.21155729677" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="444.971625857" x2="475.964417238" y1="254.21155729677" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="351" x2="382" y1="240" y2="258" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="382" x2="413" y1="258" y2="276" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="354" x2="385" y1="234" y2="251.5" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="385" x2="416" y1="251.5" y2="269" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="351.98302644466" x2="351.98302644466" y1="164.74045053869" y2="200.52889324192" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="351.98302644466" x2="351.98302644466" y1="200.52889324192" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="289" x2="320" y1="133" y2="151" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="320" x2="351" y1="151" y2="169" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="292" x2="323" y1="126" y2="144" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="323" x2="354" y1="144" y2="162" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="413.978834476" x2="382.98093046033" y1="128.95200783546" y2="146.84622918707" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="382.98093046033" x2="351.98302644466" y1="146.84622918707" y2="164.74045053869" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="413.978834476" x2="444.971625857" y1="128.95200783546" y2="146.84622918707" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="444.971625857" x2="475.964417238" y1="146.84622918707" y2="164.74045053869" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="289.99744368266" x2="320.99023506366" y1="272.10577864838" y2="254.21155729677" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="320.99023506366" x2="351.98302644466" y1="254.21155729677" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="227" x2="258" y1="240" y2="258" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="258" x2="289" y1="258" y2="276" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="230" x2="261" y1="234" y2="251.5" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="261" x2="292" y1="251.5" y2="269" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="289.99744368266" x2="289.99744368266" y1="343.68266405485" y2="307.89422135162" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="289.99744368266" x2="289.99744368266" y1="307.89422135162" y2="272.10577864838" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="228.01186092067" x2="259.00465230167" y1="379.47110675808" y2="361.57688540646" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="259.00465230167" x2="289.99744368266" y1="361.57688540646" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="166.02627815867" x2="197.01906953967" y1="343.68266405485" y2="361.57688540646" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="197.01906953967" x2="228.01186092067" y1="361.57688540646" y2="379.47110675808" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="104.035582762" x2="135.03093046033" y1="379.47110675808" y2="361.57688540646" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="135.03093046033" x2="166.02627815867" y1="361.57688540646" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="104.035582762" x2="104.035582762" y1="451.04799216454" y2="415.25954946131" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="104.035582762" x2="104.035582762" y1="415.25954946131" y2="379.47110675808" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="41" x2="72" y1="347" y2="365" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="72" x2="103" y1="365" y2="383" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="44" x2="75" y1="341" y2="359" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #ff0000" />
<line x1="75" x2="106" y1="359" y2="377" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="354" x2="323" y1="377" y2="359" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="323" x2="292" y1="359" y2="341" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="351" x2="320" y1="383" y2="365" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="320" x2="289" y1="365" y2="347" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<line x1="413.978834476" x2="382.98093046033" y1="343.68266405485" y2="361.57688540646" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="382.98093046033" x2="351.98302644466" y1="361.57688540646" y2="379.47110675808" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="413.978834476" x2="413.978834476" y1="343.68266405485" y2="307.89422135162" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #0000ff" />
<line x1="413.978834476" x2="413.978834476" y1="307.89422135162" y2="272.10577864838" style="stroke-opacity:1; stroke-width: 3.013796135017; stroke: #000000" />
<ellipse cx="537.95" cy="128.95200783546" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="145.52788657805"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">N</text>
<ellipse cx="475.964417238" cy="236.31733594515" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.964417238" y="252.89321468775"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">N</text>
<ellipse cx="289.99744368266" cy="128.95200783546" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="289.99744368266" y="145.52788657805"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">O</text>
<ellipse cx="413.978834476" cy="128.95200783546" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.978834476" y="145.52788657805"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">N</text>
<ellipse cx="228.01186092067" cy="236.31733594515" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.01186092067" y="252.89321468775"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">O</text>
<ellipse cx="104.035582762" cy="451.04799216454" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="104.035582762" y="467.62387090714"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">O</text>
<ellipse cx="42.05" cy="343.68266405485" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="360.25854279744"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">O</text>
<ellipse cx="351.98302644466" cy="379.47110675808" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="351.98302644466" y="396.04698550067"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">N</text>
<ellipse cx="413.978834476" cy="343.68266405485" rx="19.589674877611" ry="19.589674877611" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.978834476" y="360.25854279744"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.672451687713px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 137👍, 0💬