Molecule FYI-1001278

A

Molecule Summary:

ID: FYI-1001278
SMILES: [O-]C(=O)[C@@](C)(O)CNC(=O)Nc(s1)ncc1Cc2cc(Cl)c(C)cc2

Received at FYIcenter.com on: 2022-04-26

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001278
FYIcenter.com

 25 26  0  0  1  0  0  0  0  0999 V2000
   16.5256    5.5551    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
   15.3131    4.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3131    3.4551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1007    5.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8007    6.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4007    6.7675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8883    4.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6758    5.5551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4634    4.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4634    3.4551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2509    5.5551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0385    4.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7596    5.4245    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.8922    3.4628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5228    3.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8228    4.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4304    4.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6075    3.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    3.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3923    2.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.5579    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    1.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1389    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3540    0.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770    2.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  4  6  1  6  0  0  0
  7  4  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 12  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 16 13  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 20  2  0  0  0  0
 23 22  1  0  0  0  0
 24 22  1  0  0  0  0
 25 24  2  0  0  0  0
 25 18  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="501.56531502638" x2="519.75765751319" y1="334.15225256572" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="519.75765751319" x2="537.95" y1="344.6550482282" y2="355.15784389069" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #ff0000" />
<line x1="500" x2="500" y1="293" y2="314" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #ff0000" />
<line x1="500" x2="500" y1="314" y2="335" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="504" x2="504" y1="293" y2="314" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #ff0000" />
<line x1="504" x2="504" y1="314" y2="335" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="465.18363085153" x2="483.37447293896" y1="355.15784389069" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="483.37447293896" x2="501.56531502638" y1="344.6550482282" y2="334.15225256572" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="486.1892221765" x2="475.68642651401" y1="391.53952806555" y2="373.34868597812" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="475.68642651401" x2="465.18363085153" y1="373.34868597812" y2="355.15784389069" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<polygon points=" 466,356 439,389 450,395" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="428.80194667667" x2="446.9927887641" y1="334.15225256572" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="446.9927887641" x2="465.18363085153" y1="344.6550482282" y2="355.15784389069" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="392.41726170305" x2="410.60960418986" y1="355.15784389069" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="410.60960418986" x2="428.80194667667" y1="344.6550482282" y2="334.15225256572" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="356.0355775282" x2="374.22641961563" y1="334.15225256572" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="374.22641961563" x2="392.41726170305" y1="344.6550482282" y2="355.15784389069" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="354" x2="354" y1="293" y2="314" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #ff0000" />
<line x1="354" x2="354" y1="314" y2="335" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="359" x2="359" y1="293" y2="314" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #ff0000" />
<line x1="359" x2="359" y1="314" y2="335" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="319.65089255458" x2="337.84323504139" y1="355.15784389069" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="337.84323504139" x2="356.0355775282" y1="344.6550482282" y2="334.15225256572" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="283.26920837973" x2="301.46005046715" y1="334.15225256572" y2="344.6550482282" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="301.46005046715" x2="319.65089255458" y1="344.6550482282" y2="355.15784389069" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="244.891993029" x2="264.08060070436" y1="351.2388007092" y2="342.69552663746" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #c8aa1a" />
<line x1="264.08060070436" x2="283.26920837973" y1="342.69552663746" y2="334.15225256572" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="277" x2="279.5" y1="293" y2="314" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="279.5" x2="282" y1="314" y2="335" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="282" x2="284" y1="293" y2="313.5" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="284" x2="286" y1="313.5" y2="334" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="237.78610156363" x2="258.33257067822" y1="283.63680622791" y2="288.00446882413" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="258.33257067822" x2="278.87903979281" y1="288.00446882413" y2="292.37213142034" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #0000ff" />
<line x1="219" x2="229.5" y1="322" y2="303.5" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="229.5" x2="240" y1="303.5" y2="285" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="215" x2="225.5" y1="319" y2="301" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="225.5" x2="236" y1="301" y2="283" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="216.78051023866" x2="230.83625163383" y1="320.02149120153" y2="335.63014595537" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="230.83625163383" x2="244.891993029" y1="335.63014595537" y2="351.2388007092" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #c8aa1a" />
<line x1="174.99738829452" x2="195.88894926659" y1="324.41165978845" y2="322.21657549499" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="195.88894926659" x2="216.78051023866" y1="322.21657549499" y2="320.02149120153" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="150.30381529264" x2="162.65060179358" y1="290.42461302464" y2="307.41813640655" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="162.65060179358" x2="174.99738829452" y1="307.41813640655" y2="324.41165978845" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="109" x2="130" y1="298" y2="295.5" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="130" x2="151" y1="295.5" y2="293" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="109" x2="130" y1="293" y2="291" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="130" x2="151" y1="291" y2="289" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="83.830121145374" x2="96.176907646318" y1="260.82773484775" y2="277.82125822966" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="96.176907646318" x2="108.52369414726" y1="277.82125822966" y2="294.81478161156" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="42.05" x2="62.940060572687" y1="265.21790343467" y2="263.02281914121" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #00bc00" />
<line x1="62.940060572687" x2="83.830121145374" y1="263.02281914121" y2="260.82773484775" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="99" x2="90.5" y1="222" y2="241" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="90.5" x2="82" y1="241" y2="260" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="103" x2="94.5" y1="224" y2="243" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="94.5" x2="86" y1="243" y2="262" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="76.226097085734" x2="88.572883586678" y1="188.46047193445" y2="205.45399531636" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="88.572883586678" x2="100.91967008762" y1="205.45399531636" y2="222.44751869826" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="142.69679043424" x2="121.80823026093" y1="218.05735011134" y2="220.2524344048" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="121.80823026093" x2="100.91967008762" y1="220.2524344048" y2="222.44751869826" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="170" x2="157.5" y1="251" y2="234" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="157.5" x2="145" y1="234" y2="217" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="166" x2="153.5" y1="254" y2="237" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="153.5" x2="141" y1="237" y2="220" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="167.39336423488" x2="158.84858976376" y1="252.04439687515" y2="271.2345049499" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<line x1="158.84858976376" x2="150.30381529264" y1="271.2345049499" y2="290.42461302464" style="stroke-opacity:1; stroke-width: 1.7688885069897; stroke: #000000" />
<ellipse cx="537.95" cy="355.15784389069" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="364.88673067913"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">O<tspan baseline-shift='super' font-size='11.055553168685'>-</tspan></text>
<ellipse cx="501.56531502638" cy="292.14106991577" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="501.56531502638" y="301.86995670421"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">O</text>
<ellipse cx="444.17803952655" cy="391.53952806555" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="444.17803952655" y="401.26841485399"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">O</text>
<ellipse cx="392.41726170305" cy="355.15784389069" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="392.41726170305" y="364.88673067913"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">N</text>
<ellipse cx="356.0355775282" cy="292.14106991577" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="356.0355775282" y="301.86995670421"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">O</text>
<ellipse cx="319.65089255458" cy="355.15784389069" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="319.65089255458" y="364.88673067913"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">N</text>
<ellipse cx="244.891993029" cy="351.2388007092" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="244.891993029" y="360.96768749765"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">S</text>
<ellipse cx="278.87903979281" cy="292.37213142034" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="278.87903979281" y="302.10101820878"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">N</text>
<ellipse cx="42.05" cy="265.21790343467" rx="11.497775295433" ry="11.497775295433" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="274.94679022311"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:22.111106337371px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 139👍, 0💬