Molecule FYI-1001279

A

Molecule Summary:

ID: FYI-1001279
SMILES: C4Cc1c([nH]c2ccc(Br)cc12)c3ccccc3N4

Received at FYIcenter.com on: 2022-04-27

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001279
FYIcenter.com

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.6703    1.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0468    1.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2693    0.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1703   -0.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0343   -1.3339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4817   -1.7631    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0561   -1.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5261   -2.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4909   -2.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9995   -1.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -1.4337    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    3.5498   -0.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5842   -0.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0713    0.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8238   -0.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8215   -0.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0533    0.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2843    1.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2938    1.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6703    1.8415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8083    2.4460    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1117    2.1105    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6603    1.5444    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4882    0.7907    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8267   -2.9424    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1675   -2.9070    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2619   -0.0404    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6789   -1.2382    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2744   -0.7595    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6451    0.8645    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4153    1.9880    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9393    2.4001    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 10 12  1  0  0  0  0
 12 13  2  0  0  0  0
  3 13  1  0  0  0  0
  7 13  1  0  0  0  0
  4 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  2  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 14 19  2  0  0  0  0
 19 20  1  0  0  0  0
  1 20  1  0  0  0  0
  1 21  1  0  0  0  0
  1 22  1  0  0  0  0
  2 23  1  0  0  0  0
  2 24  1  0  0  0  0
  8 25  1  0  0  0  0
  9 26  1  0  0  0  0
 12 27  1  0  0  0  0
 15 28  1  0  0  0  0
 16 29  1  0  0  0  0
 17 30  1  0  0  0  0
 18 31  1  0  0  0  0
 20 32  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="280.12429203019" x2="259.90260428248" y1="425.54855135969" y2="400.19279276922" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="259.90260428248" x2="239.68091653477" y1="400.19279276922" y2="374.83703417876" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="239.68091653477" x2="246.89715634851" y1="374.83703417876" y2="343.21855240612" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="246.89715634851" x2="254.11339616225" y1="343.21855240612" y2="311.60007063348" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="256" x2="285.5" y1="315" y2="301" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="285.5" x2="315" y1="301" y2="287" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="253" x2="282.5" y1="309" y2="295" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="282.5" x2="312" y1="295" y2="281" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="312.55683051889" x2="308.14600528443" y1="283.45511373298" y2="251.5155498293" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="308.14600528443" x2="303.73518004997" y1="251.5155498293" y2="219.57598592563" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #0000ff" />
<line x1="303.73518004997" x2="318.24549776981" y1="219.57598592563" y2="205.65594040627" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #0000ff" />
<line x1="318.24549776981" x2="332.75581548966" y1="205.65594040627" y2="191.73589488692" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #a4a4a4" />
<line x1="303.73518004997" x2="272.00967090032" y1="219.57598592563" y2="213.84839962852" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #0000ff" />
<line x1="272.00967090032" x2="240.28416175066" y1="213.84839962852" y2="208.12081333141" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="244" x2="226.5" y1="207" y2="178" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="226.5" x2="209" y1="178" y2="149" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="238" x2="220.5" y1="210" y2="181.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="220.5" x2="203" y1="181.5" y2="153" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="205.90567095264" x2="172.33150710913" y1="150.41684085231" y2="151.13359995291" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="172.33150710913" x2="138.75734326562" y1="151.13359995291" y2="151.85035905351" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="136" x2="120" y1="151" y2="180.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="120" x2="104" y1="180.5" y2="210" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="142" x2="126" y1="154" y2="183.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="126" x2="110" y1="183.5" y2="213" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="106.88264443892" x2="74.466322219461" y1="210.96839021072" y2="212.035420727" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="74.466322219461" x2="42.05" y1="212.035420727" y2="213.10245124328" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #db8802" />
<line x1="106.88264443892" x2="124.73027036926" y1="210.96839021072" y2="239.41496971917" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="124.73027036926" x2="142.57789629959" y1="239.41496971917" y2="267.86154922761" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="143" x2="176.5" y1="272" y2="270.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="176.5" x2="210" y1="270.5" y2="269" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="143" x2="176.5" y1="265" y2="263.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="176.5" x2="210" y1="263.5" y2="262" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="254.11339616225" x2="231.89386404364" y1="311.60007063348" y2="288.23891316006" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="231.89386404364" x2="209.67433192502" y1="288.23891316006" y2="264.87775568665" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="240.28416175066" x2="224.97924683784" y1="208.12081333141" y2="236.49928450903" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="224.97924683784" x2="209.67433192502" y1="236.49928450903" y2="264.87775568665" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="312.55683051889" x2="341.77854769722" y1="283.45511373298" y2="297.52759218323" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="341.77854769722" x2="371.00026487554" y1="297.52759218323" y2="311.60007063348" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="371.00026487554" x2="395.40575008829" y1="311.60007063348" y2="288.24215641391" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="395.40575008829" x2="419.81123530104" y1="288.24215641391" y2="264.88424219435" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="419" x2="451.5" y1="269" y2="278.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="451.5" x2="484" y1="278.5" y2="288" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="421" x2="453.5" y1="262" y2="271.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="453.5" x2="486" y1="271.5" y2="281" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="484.5271226014" x2="492.04498502309" y1="284.29835973369" y2="317.23360256897" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="492.04498502309" x2="499.56284744477" y1="317.23360256897" y2="350.16884540425" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="498" x2="473" y1="348" y2="371" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="473" x2="448" y1="371" y2="394" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="502" x2="477.5" y1="353" y2="376" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="477.5" x2="453" y1="376" y2="399" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="449.68160324914" x2="417.55717387608" y1="395.74304848857" y2="385.29004133366" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="417.55717387608" x2="385.43274450302" y1="385.29004133366" y2="374.83703417876" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="368" x2="375.5" y1="313" y2="344.5" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="375.5" x2="383" y1="344.5" y2="376" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="375" x2="382" y1="311" y2="343" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="382" x2="389" y1="343" y2="375" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="385.43274450302" x2="365.21105675531" y1="374.83703417876" y2="400.19279276922" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="365.21105675531" x2="344.9893690076" y1="400.19279276922" y2="425.54855135969" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #0000ff" />
<line x1="280.12429203019" x2="312.55683051889" y1="425.54855135969" y2="425.54855135969" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #000000" />
<line x1="312.55683051889" x2="344.9893690076" y1="425.54855135969" y2="425.54855135969" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #0000ff" />
<line x1="344.9893690076" x2="353.71372186106" y1="425.54855135969" y2="443.66536735949" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #0000ff" />
<line x1="353.71372186106" x2="362.43807471452" y1="443.66536735949" y2="461.78218335928" style="stroke-opacity:1; stroke-width: 2.7911760781696; stroke: #a4a4a4" />
<ellipse cx="303.73518004997" cy="219.57598592563" rx="18.142644508102" ry="18.142644508102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="303.73518004997" y="234.92745435556"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.88970097712px">N</text>
<ellipse cx="332.75581548966" cy="191.73589488692" rx="18.142644508102" ry="18.142644508102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.75581548966" y="207.08736331685"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:34.88970097712px">H</text>
<ellipse cx="42.05" cy="213.10245124328" rx="18.142644508102" ry="18.142644508102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="228.45391967321"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:34.88970097712px">Br</text>
<ellipse cx="344.9893690076" cy="425.54855135969" rx="18.142644508102" ry="18.142644508102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="344.9893690076" y="440.90001978963"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.88970097712px">N</text>
<ellipse cx="362.43807471452" cy="461.78218335928" rx="18.142644508102" ry="18.142644508102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="362.43807471452" y="477.13365178921"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:34.88970097712px">H</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 139👍, 0💬