Molecule FYI-1001280

A

Molecule Summary:

ID: FYI-1001280
SMILES: Cc1cc2N(CCCn2n1)C(=O)CCC(=O)Nc1ccc(nn1)-c1cccnc1

Received at FYIcenter.com on: 2022-04-27

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001280
FYIcenter.com

 29 32  0  0  0  0  0  0  0  0999 V2000
   16.9327    7.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2327    6.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8404    6.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3369    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3369    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8021    5.1368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
  9  4  1  0  0  0  0
 10  9  1  0  0  0  0
 10  2  2  0  0  0  0
 11  5  1  0  0  0  0
 12 11  2  0  0  0  0
 13 11  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 23 18  1  0  0  0  0
 24 21  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  2  0  0  0  0
 29 24  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="517.44943009679" x2="527.6997150484" y1="366.19476102453" y2="383.9482545607" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="527.6997150484" x2="537.95" y1="383.9482545607" y2="401.70174809688" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="476.67379655932" x2="497.06161332806" y1="361.90721326191" y2="364.05098714322" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="497.06161332806" x2="517.44943009679" y1="364.05098714322" y2="366.19476102453" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="467" x2="471" y1="323" y2="343" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="471" x2="475" y1="343" y2="363" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="471" x2="475" y1="322" y2="342" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="475" x2="479" y1="342" y2="362" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="432.64150106008" x2="450.39499459625" y1="301.30167132235" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="450.39499459625" x2="468.14848813243" y1="311.55195627396" y2="321.80224122556" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="432.64150106008" x2="432.64150106008" y1="260.30053151594" y2="280.80110141915" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="432.64150106008" x2="432.64150106008" y1="280.80110141915" y2="301.30167132235" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="468.14848813243" x2="450.39499459625" y1="239.79996161274" y2="250.05024656434" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="450.39499459625" x2="432.64150106008" y1="250.05024656434" y2="260.30053151594" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="503.65547520478" x2="485.90198166861" y1="260.30053151594" y2="250.05024656434" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="485.90198166861" x2="468.14848813243" y1="250.05024656434" y2="239.79996161274" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="503.65547520478" x2="503.65547520478" y1="301.30167132235" y2="280.80110141915" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="503.65547520478" x2="503.65547520478" y1="280.80110141915" y2="260.30053151594" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="503.65547520478" x2="485.90198166861" y1="301.30167132235" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="485.90198166861" x2="468.14848813243" y1="311.55195627396" y2="321.80224122556" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="534.12517938663" x2="518.89032729571" y1="328.73729115853" y2="315.01948124044" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="518.89032729571" x2="503.65547520478" y1="315.01948124044" y2="301.30167132235" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="533" x2="524.5" y1="328" y2="347" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="524.5" x2="516" y1="347" y2="366" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="537" x2="528.5" y1="330" y2="349" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="528.5" x2="520" y1="349" y2="368" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="397.12865668204" x2="414.88507887106" y1="321.80224122556" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="414.88507887106" x2="432.64150106008" y1="311.55195627396" y2="301.30167132235" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="400" x2="400" y1="363" y2="342.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #ff0000" />
<line x1="400" x2="400" y1="342.5" y2="322" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="395" x2="395" y1="363" y2="342.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #ff0000" />
<line x1="395" x2="395" y1="342.5" y2="322" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="361.62166960969" x2="379.37516314587" y1="301.30167132235" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="379.37516314587" x2="397.12865668204" y1="311.55195627396" y2="321.80224122556" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="326.11468253734" x2="343.86817607351" y1="321.80224122556" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="343.86817607351" x2="361.62166960969" y1="311.55195627396" y2="301.30167132235" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="290.60769546499" x2="308.36118900116" y1="301.30167132235" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="308.36118900116" x2="326.11468253734" y1="311.55195627396" y2="321.80224122556" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="289" x2="289" y1="261" y2="281.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #ff0000" />
<line x1="289" x2="289" y1="281.5" y2="302" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="293" x2="293" y1="261" y2="281.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #ff0000" />
<line x1="293" x2="293" y1="281.5" y2="302" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="255.09777973979" x2="272.85273760239" y1="321.80224122556" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="272.85273760239" x2="290.60769546499" y1="311.55195627396" y2="301.30167132235" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="219.59079266744" x2="237.34428620362" y1="301.30167132235" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="237.34428620362" x2="255.09777973979" y1="311.55195627396" y2="321.80224122556" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="186" x2="203.5" y1="324" y2="314" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="203.5" x2="221" y1="314" y2="304" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="184" x2="201.5" y1="320" y2="310" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="201.5" x2="219" y1="310" y2="300" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="148.57096121705" x2="166.32738340607" y1="301.30167132235" y2="311.55195627396" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="166.32738340607" x2="184.08380559509" y1="311.55195627396" y2="321.80224122556" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="147" x2="147" y1="261" y2="281.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="147" x2="147" y1="281.5" y2="302" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="151" x2="151" y1="261" y2="281.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="151" x2="151" y1="281.5" y2="302" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="184.08380559509" x2="166.32738340607" y1="239.79996161274" y2="250.05024656434" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="166.32738340607" x2="148.57096121705" y1="250.05024656434" y2="260.30053151594" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="221" x2="203.5" y1="259" y2="248.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="203.5" x2="186" y1="248.5" y2="238" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="219" x2="201.5" y1="263" y2="252.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="201.5" x2="184" y1="252.5" y2="242" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="219.59079266744" x2="219.59079266744" y1="260.30053151594" y2="280.80110141915" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="219.59079266744" x2="219.59079266744" y1="280.80110141915" y2="301.30167132235" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="113.0639741447" x2="130.81746768088" y1="239.79996161274" y2="250.05024656434" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="130.81746768088" x2="148.57096121705" y1="250.05024656434" y2="260.30053151594" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="79" x2="97" y1="263" y2="252.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="97" x2="115" y1="252.5" y2="242" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="77" x2="94.5" y1="259" y2="248.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="94.5" x2="112" y1="248.5" y2="238" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="42.05" x2="59.803493536176" y1="239.79996161274" y2="250.05024656434" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="59.803493536176" x2="77.556987072351" y1="250.05024656434" y2="260.30053151594" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="40" x2="40" y1="199" y2="219.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="40" x2="40" y1="219.5" y2="240" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="45" x2="45" y1="199" y2="219.5" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="45" x2="45" y1="219.5" y2="240" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="77.556987072351" x2="59.803493536176" y1="178.29825190312" y2="188.54853685472" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="59.803493536176" x2="42.05" y1="188.54853685472" y2="198.79882180633" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="115" x2="97" y1="197" y2="187" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="97" x2="79" y1="187" y2="177" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="112" x2="94.5" y1="201" y2="191" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="94.5" x2="77" y1="191" y2="181" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #0000ff" />
<line x1="113.0639741447" x2="113.0639741447" y1="198.79882180633" y2="219.29939170953" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<line x1="113.0639741447" x2="113.0639741447" y1="219.29939170953" y2="239.79996161274" style="stroke-opacity:1; stroke-width: 1.7263490320776; stroke: #000000" />
<ellipse cx="432.64150106008" cy="301.30167132235" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="432.64150106008" y="310.79659099878"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
<ellipse cx="503.65547520478" cy="301.30167132235" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.65547520478" y="310.79659099878"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
<ellipse cx="534.12517938663" cy="328.73729115853" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="534.12517938663" y="338.23221083495"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
<ellipse cx="397.12865668204" cy="362.80338103197" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="397.12865668204" y="372.29830070839"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">O</text>
<ellipse cx="290.60769546499" cy="260.30053151594" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.60769546499" y="269.79545119237"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">O</text>
<ellipse cx="255.09777973979" cy="321.80224122556" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.09777973979" y="331.29716090198"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
<ellipse cx="184.08380559509" cy="239.79996161274" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="184.08380559509" y="249.29488128916"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
<ellipse cx="219.59079266744" cy="260.30053151594" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.59079266744" y="269.79545119237"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
<ellipse cx="77.556987072351" cy="178.29825190312" rx="11.221268708504" ry="11.221268708504" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="77.556987072351" y="187.79317157955"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.57936290097px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 135👍, 0💬