Molecule FYI-1001282

A

Molecule Summary:

ID: FYI-1001282
SMILES: OC1CN(Cc2cc3c(cc2)C[C@@](CN)(c2cc(-c4ncnc5[nH]ccc45)ccc2)C3)C1

Received at FYIcenter.com on: 2022-04-28

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001282
FYIcenter.com

 32 37  0  0  1  0  0  0  0  0999 V2000
   15.9506    4.3506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7382    5.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3759    6.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0236    6.0406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8111    6.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5987    6.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5987    4.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3863    3.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1738    4.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1738    6.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3863    6.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1334    3.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7028    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0028    1.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7028    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3048    2.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6692    3.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2710    3.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6355    5.0662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3980    6.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7624    7.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3643    7.5610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6018    6.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2191    6.1679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2474    4.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2374    5.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5086    2.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1442    1.3973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5422    1.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0952    2.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3859    4.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  6  1  0  0  0  0
 12  9  1  0  0  0  0
 13 12  1  0  0  0  0
 13 14  1  1  0  0  0
 15 14  1  0  0  0  0
 16 13  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 27 19  1  0  0  0  0
 27 23  2  0  0  0  0
 28 18  2  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 30 16  1  0  0  0  0
 31 13  1  0  0  0  0
 31  8  1  0  0  0  0
 32  4  1  0  0  0  0
 32  2  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="500.25679974421" x2="519.10339987211" y1="329.48707822903" y2="318.60566937921" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="519.10339987211" x2="537.95" y1="318.60566937921" y2="307.72426052938" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #ff0000" />
<line x1="488.99298709766" x2="494.62489342094" y1="371.53284202475" y2="350.50996012689" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="494.62489342094" x2="500.25679974421" y1="350.50996012689" y2="329.48707822903" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="446.9503322759" x2="467.97165968678" y1="360.26592040425" y2="365.8993812145" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="467.97165968678" x2="488.99298709766" y1="365.8993812145" y2="371.53284202475" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="409.25402304615" x2="428.10217766103" y1="382.0287381039" y2="371.14732925407" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="428.10217766103" x2="446.9503322759" y1="371.14732925407" y2="360.26592040425" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="371.56082279037" x2="390.40742291826" y1="360.26592040425" y2="371.14732925407" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="390.40742291826" x2="409.25402304615" y1="371.14732925407" y2="382.0287381039" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="370" x2="370" y1="317" y2="339" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="370" x2="370" y1="339" y2="361" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="374" x2="374" y1="317" y2="339" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="374" x2="374" y1="339" y2="361" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="333.86762253458" x2="352.71422266247" y1="294.97746730531" y2="305.85887615513" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="352.71422266247" x2="371.56082279037" y1="305.85887615513" y2="316.74028500495" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="298" x2="317" y1="319" y2="308" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="317" x2="336" y1="308" y2="297" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="296" x2="314.5" y1="315" y2="304" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="314.5" x2="333" y1="304" y2="293" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="296.17131330483" x2="296.17131330483" y1="360.26592040425" y2="338.5031027046" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="296.17131330483" x2="296.17131330483" y1="338.5031027046" y2="316.74028500495" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="336" x2="317" y1="381" y2="370" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="317" x2="298" y1="370" y2="359" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="333" x2="314.5" y1="385" y2="374" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="314.5" x2="296" y1="374" y2="363" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="333.86762253458" x2="352.71422266247" y1="382.0287381039" y2="371.14732925407" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="352.71422266247" x2="371.56082279037" y1="371.14732925407" y2="360.26592040425" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="263.82554825524" x2="279.99843078003" y1="287.61541697491" y2="302.17785098993" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="279.99843078003" x2="296.17131330483" y1="302.17785098993" y2="316.74028500495" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="281.52804596692" x2="272.67679711108" y1="247.85474903765" y2="267.73508300628" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="272.67679711108" x2="263.82554825524" y1="267.73508300628" y2="287.61541697491" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<polygon points=" 282,248 266,207 255,214" fill-opacity="1"  style="fill:#000000" />
<line x1="281.52804596692" x2="270.6466371171" y1="172.46523955212" y2="191.31183968001" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="270.6466371171" x2="259.76522826728" y1="191.31183968001" y2="210.15843980791" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="238.06459004677" x2="259.79631800685" y1="250.1336269482" y2="248.99418799293" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="259.79631800685" x2="281.52804596692" y1="248.99418799293" y2="247.85474903765" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="221" x2="231" y1="290" y2="271" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="231" x2="241" y1="271" y2="252" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="217" x2="227" y1="288" y2="269" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="227" x2="237" y1="269" y2="250" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="174.83427770742" x2="196.56911464146" y1="291.19073702557" y2="290.05285255727" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="196.56911464146" x2="218.30395157549" y1="290.05285255727" y2="288.91496808897" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="155.0767482101" x2="164.95551295876" y1="329.97207816634" y2="310.58140759595" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="164.95551295876" x2="174.83427770742" y1="310.58140759595" y2="291.19073702557" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="181" x2="169" y1="366" y2="347.5" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="169" x2="157" y1="347.5" y2="329" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="177" x2="165.5" y1="368" y2="350" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="165.5" x2="154" y1="350" y2="332" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="159.02203616165" x2="168.90235539729" y1="405.25899151129" y2="385.86832094091" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="168.90235539729" x2="178.78267463293" y1="385.86832094091" y2="366.47765037052" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="116" x2="138" y1="410" y2="409" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="138" x2="160" y1="409" y2="408" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="116" x2="137.5" y1="406" y2="404.5" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="137.5" x2="159" y1="404.5" y2="403" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="91.849544844708" x2="103.70250805612" y1="371.03229721766" y2="389.28352883277" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="103.70250805612" x2="115.55547126754" y1="389.28352883277" y2="407.53476044788" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="48.86176193999" x2="70.355653392349" y1="364.22364425163" y2="367.62797073464" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="70.355653392349" x2="91.849544844708" y1="367.62797073464" y2="371.03229721766" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="42.05" x2="45.455880969995" y1="321.23275237295" y2="342.72819831229" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="45.455880969995" x2="48.86176193999" y1="342.72819831229" y2="364.22364425163" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="80" x2="61" y1="300" y2="310" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="61" x2="42" y1="310" y2="320" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="82" x2="63" y1="304" y2="314" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="63" x2="44" y1="314" y2="324" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="111.61018331599" x2="96.22076222838" y1="332.25095607689" y2="316.86308947626" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="96.22076222838" x2="80.831341140772" y1="316.86308947626" y2="301.47522287563" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="111.61018331599" x2="133.34346576304" y1="332.25095607689" y2="331.11151712161" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="133.34346576304" x2="155.0767482101" y1="331.11151712161" y2="329.97207816634" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="110" x2="100" y1="332" y2="351" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="100" x2="90" y1="351" y2="370" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="114" x2="104" y1="334" y2="353.5" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="104" x2="94" y1="353.5" y2="373" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="150" x2="161.5" y1="256" y2="274.5" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="161.5" x2="173" y1="274.5" y2="293" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="154" x2="165.5" y1="254" y2="272" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="165.5" x2="177" y1="272" y2="290" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="170.89209872983" x2="161.01177949419" y1="215.90693265457" y2="235.29760322496" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="161.01177949419" x2="151.13146025855" y1="235.29760322496" y2="254.68827379534" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="215" x2="193" y1="212" y2="213" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="193" x2="171" y1="213" y2="214" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="215" x2="193.5" y1="216" y2="217.5" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="193.5" x2="172" y1="217.5" y2="219" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="214.35555464998" x2="226.21007234838" y1="213.62805474402" y2="231.88084084611" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="226.21007234838" x2="238.06459004677" y1="231.88084084611" y2="250.1336269482" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="324.81739934548" x2="303.1727226562" y1="252.40317793688" y2="250.12896348727" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="303.1727226562" x2="281.52804596692" y1="250.12896348727" y2="247.85474903765" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="324.81739934548" x2="329.34251094003" y1="252.40317793688" y2="273.69032262109" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="329.34251094003" x2="333.86762253458" y1="273.69032262109" y2="294.97746730531" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="458.21414492245" x2="452.58223859917" y1="318.22326558249" y2="339.24459299337" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="452.58223859917" x2="446.9503322759" y1="339.24459299337" y2="360.26592040425" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #0000ff" />
<line x1="458.21414492245" x2="479.23547233333" y1="318.22326558249" y2="323.85517190576" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<line x1="479.23547233333" x2="500.25679974421" y1="323.85517190576" y2="329.48707822903" style="stroke-opacity:1; stroke-width: 1.8326611680966; stroke: #000000" />
<ellipse cx="537.95" cy="307.72426052938" rx="11.912297592628" ry="11.912297592628" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="317.80389695392"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.908264601208px">O</text>
<ellipse cx="446.9503322759" cy="360.26592040425" rx="11.912297592628" ry="11.912297592628" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="446.9503322759" y="370.34555682878"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.908264601208px">N</text>
<ellipse cx="281.52804596692" cy="172.46523955212" rx="11.912297592628" ry="11.912297592628" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="281.52804596692" y="182.54487597665"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.908264601208px">N</text>
<ellipse cx="178.78267463293" cy="366.47765037052" rx="11.912297592628" ry="11.912297592628" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="178.78267463293" y="376.55728679505"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.908264601208px">N</text>
<ellipse cx="115.55547126754" cy="407.53476044788" rx="11.912297592628" ry="11.912297592628" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="115.55547126754" y="417.61439687241"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.908264601208px">N</text>
<ellipse cx="48.86176193999" cy="364.22364425163" rx="11.912297592628" ry="11.912297592628" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="48.86176193999" y="374.30328067616"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.908264601208px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 139👍, 0💬