Molecule FYI-1001283

A

Molecule Summary:

ID: FYI-1001283
SMILES: O=C1CCCN1c2cc(ccc2)OCc(n3Cc4c(OC(F)F)cccc4)nc(c35)ccc(c5)-c6ccc(=O)[nH]c6

Received at FYIcenter.com on: 2022-04-28

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001283
FYIcenter.com

 67 72  0  0  0  0  0  0  0  0999 V2000
   11.8411   -4.3047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8192   -4.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5624   -4.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4284   -4.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2205   -3.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2260   -3.1833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7260   -2.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7260   -2.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2260   -1.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7260   -0.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7260   -0.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2260   -1.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2260   -1.4512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7260   -0.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7260   -0.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1424    0.2196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4530    1.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4315    1.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7422    2.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0744    3.0711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3850    4.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7172    4.7659    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.3635    4.2279    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.7207    2.5330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3886    1.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0779    0.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0994    0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1424   -1.3899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -1.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -0.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3301   -1.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641   -1.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641   -0.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3301    0.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981    0.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981    1.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    1.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    1.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    1.9148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    0.4148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3291    0.1048    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1016   -5.1808    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.9268   -5.2675    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6806   -4.8323    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.0181   -4.0743    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.8371   -3.2230    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.2205   -2.6678    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4160   -2.8542    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4160   -0.0482    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0360   -0.0482    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.8460   -1.4512    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3086   -0.3731    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6183    0.0254    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4325    1.7897    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8392    1.2574    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7783    3.8938    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.9133    3.1224    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.9952    1.9166    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4920    0.3767    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9068    0.0427    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3301   -2.2052    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9272   -1.3952    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3301    1.0348    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350    1.7248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    2.5348    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.7052    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  2  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
  7 12  2  0  0  0  0
  9 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 23  1  0  0  0  0
 19 24  2  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  1  0  0  0  0
 18 27  2  0  0  0  0
 15 28  2  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 16 30  1  0  0  0  0
 29 31  2  0  0  0  0
 31 32  1  0  0  0  0
 32 33  2  0  0  0  0
 33 34  1  0  0  0  0
 30 34  2  0  0  0  0
 33 35  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  2  0  0  0  0
 37 38  1  0  0  0  0
 38 39  2  0  0  0  0
 38 40  1  0  0  0  0
 40 41  1  0  0  0  0
 40 42  1  0  0  0  0
 35 42  2  0  0  0  0
  3 43  1  0  0  0  0
  3 44  1  0  0  0  0
  4 45  1  0  0  0  0
  4 46  1  0  0  0  0
  5 47  1  0  0  0  0
  5 48  1  0  0  0  0
  8 49  1  0  0  0  0
 10 50  1  0  0  0  0
 11 51  1  0  0  0  0
 12 52  1  0  0  0  0
 14 53  1  0  0  0  0
 14 54  1  0  0  0  0
 17 55  1  0  0  0  0
 17 56  1  0  0  0  0
 21 57  1  0  0  0  0
 24 58  1  0  0  0  0
 25 59  1  0  0  0  0
 26 60  1  0  0  0  0
 27 61  1  0  0  0  0
 31 62  1  0  0  0  0
 32 63  1  0  0  0  0
 34 64  1  0  0  0  0
 36 65  1  0  0  0  0
 37 66  1  0  0  0  0
 42 67  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="417" x2="435.5" y1="138" y2="142" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="435.5" x2="454" y1="142" y2="146" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="418" x2="436.5" y1="134" y2="138" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="436.5" x2="455" y1="138" y2="142" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="454.18704611272" x2="468.34244820673" y1="143.49387391401" y2="130.74982178659" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="468.34244820673" x2="482.49785030074" y1="130.74982178659" y2="118.00576965917" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="482.49785030074" x2="498.99216974827" y1="118.00576965917" y2="127.52904878592" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="498.99216974827" x2="515.48648919581" y1="127.52904878592" y2="137.05232791268" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="515.48648919581" x2="511.52670973491" y1="137.05232791268" y2="155.68176654043" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="511.52670973491" x2="507.566930274" y1="155.68176654043" y2="174.31120516819" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="507.566930274" x2="488.62512809089" y1="174.31120516819" y2="176.30157050568" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="488.62512809089" x2="469.68332590777" y1="176.30157050568" y2="178.29193584317" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="454.18704611272" x2="461.93518601025" y1="143.49387391401" y2="160.89290487859" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="461.93518601025" x2="469.68332590777" y1="160.89290487859" y2="178.29193584317" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="469.68332590777" x2="460.16004678102" y1="178.29193584317" y2="194.78815994654" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="460.16004678102" x2="450.63676765427" y1="194.78815994654" y2="211.2843840499" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="450.63676765427" x2="431.59020940076" y1="211.2843840499" y2="211.2843840499" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="431.59020940076" x2="412.54365114725" y1="211.2843840499" y2="211.2843840499" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="411" x2="401.5" y1="211" y2="227.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="401.5" x2="392" y1="227.5" y2="244" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="415" x2="405.5" y1="213" y2="229.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="405.5" x2="396" y1="229.5" y2="246" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="393.49709289374" x2="403.02037202049" y1="244.27302294498" y2="260.76734239252" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="403.02037202049" x2="412.54365114725" y1="260.76734239252" y2="277.26166184005" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="413" x2="432" y1="280" y2="280" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="432" x2="451" y1="280" y2="280" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="413" x2="432" y1="276" y2="276" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="432" x2="451" y1="276" y2="276" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="450.63676765427" x2="460.16004678102" y1="277.26166184005" y2="260.76734239252" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="460.16004678102" x2="469.68332590777" y1="260.76734239252" y2="244.27302294498" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="449" x2="458.5" y1="213" y2="229.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="458.5" x2="468" y1="229.5" y2="246" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="453" x2="462.5" y1="211" y2="227.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="462.5" x2="472" y1="227.5" y2="244" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="393.49709289374" x2="374.45053464023" y1="244.27302294498" y2="244.27302294498" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="374.45053464023" x2="355.40397638672" y1="244.27302294498" y2="244.27302294498" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="355.40397638672" x2="345.88069725997" y1="244.27302294498" y2="260.76734239252" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="345.88069725997" x2="336.35741813321" y1="260.76734239252" y2="277.26166184005" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="336.35741813321" x2="317.31085987971" y1="277.26166184005" y2="277.26166184005" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="317.31085987971" x2="298.2643016262" y1="277.26166184005" y2="277.26166184005" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="298.2643016262" x2="287.14873022945" y1="277.26166184005" y2="292.59033192248" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="287.14873022945" x2="276.0331588327" y1="292.59033192248" y2="307.9190020049" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="276.0331588327" x2="281.94901982624" y1="307.9190020049" y2="326.02275562486" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="281.94901982624" x2="287.86488081978" y1="326.02275562486" y2="344.12650924482" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="287.86488081978" x2="306.50193807084" y1="344.12650924482" y2="348.05390955669" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="306.50193807084" x2="325.1389953219" y1="348.05390955669" y2="351.98130986857" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="325.1389953219" x2="331.05676097126" y1="351.98130986857" y2="370.08506348853" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="331.05676097126" x2="336.97452662063" y1="370.08506348853" y2="388.18881710849" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="336.97452662063" x2="324.25523501894" y1="388.18881710849" y2="402.36517041657" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="324.25523501894" x2="311.53594341724" y1="402.36517041657" y2="416.54152372466" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="311.53594341724" x2="317.45180441078" y1="416.54152372466" y2="434.64527734462" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="317.45180441078" x2="323.36766540432" y1="434.64527734462" y2="452.74903096458" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="323.36766540432" x2="310.64837380263" y1="452.74903096458" y2="466.92538427267" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="310.64837380263" x2="297.92908220094" y1="466.92538427267" y2="481.10173758075" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #00bc00" />
<line x1="323.36766540432" x2="342.00472265538" y1="452.74903096458" y2="456.67833593228" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="342.00472265538" x2="360.64177990644" y1="456.67833593228" y2="460.60764089998" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #00bc00" />
<line x1="337" x2="355.5" y1="391" y2="395" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="355.5" x2="374" y1="395" y2="399" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="338" x2="356.5" y1="387" y2="391" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="356.5" x2="375" y1="391" y2="395" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="374.24864112274" x2="386.96983738026" y1="396.04361773223" y2="381.86726442415" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="386.96983738026" x2="399.69103363778" y1="381.86726442415" y2="367.69091111606" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="402" x2="396" y1="368" y2="349.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="396" x2="390" y1="349.5" y2="331" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="398" x2="392" y1="369" y2="351" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="392" x2="386" y1="351" y2="333" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="387.85550233905" x2="369.21844508799" y1="331.48340387614" y2="327.55600356427" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="369.21844508799" x2="350.58138783693" y1="327.55600356427" y2="323.62860325239" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="327" x2="340" y1="354" y2="339.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="340" x2="353" y1="339.5" y2="325" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="324" x2="337" y1="351" y2="337" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="337" x2="350" y1="337" y2="323" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="300" x2="289" y1="277" y2="261.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="289" x2="278" y1="261.5" y2="246" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="297" x2="286" y1="279" y2="263.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="286" x2="275" y1="263.5" y2="248" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="276.0331588327" x2="258.01130541323" y1="246.60813098686" y2="252.4116172867" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="258.01130541323" x2="239.98945199376" y1="252.4116172867" y2="258.21510358654" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="239.98945199376" x2="239.98945199376" y1="258.21510358654" y2="277.26166184005" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="239.98945199376" x2="239.98945199376" y1="277.26166184005" y2="296.30822009356" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="276.0331588327" x2="258.01130541323" y1="307.9190020049" y2="302.11361104923" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="258.01130541323" x2="239.98945199376" y1="302.11361104923" y2="296.30822009356" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="241" x2="224.5" y1="257" y2="247.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="224.5" x2="208" y1="247.5" y2="238" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="239" x2="222.5" y1="260" y2="250.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="222.5" x2="206" y1="250.5" y2="241" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="206.99700378703" x2="190.5026843395" y1="239.16854533304" y2="248.69182445979" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="190.5026843395" x2="174.00836489196" y1="248.69182445979" y2="258.21510358654" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="173" x2="173" y1="259" y2="278" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="173" x2="173" y1="278" y2="297" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="177" x2="177" y1="259" y2="278" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="177" x2="177" y1="278" y2="297" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="174.00836489196" x2="190.5026843395" y1="296.30822009356" y2="305.83149922032" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="190.5026843395" x2="206.99700378703" y1="305.83149922032" y2="315.35477834707" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="239" x2="222.5" y1="295" y2="304.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="222.5" x2="206" y1="304.5" y2="314" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="241" x2="224.5" y1="299" y2="308.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="224.5" x2="208" y1="308.5" y2="318" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="174.00836489196" x2="157.51404544442" y1="296.30822009356" y2="305.83149922032" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="157.51404544442" x2="141.01972599688" y1="305.83149922032" y2="315.35477834707" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="141.01972599688" x2="141.01972599688" y1="315.35477834707" y2="334.40133660058" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="141.01972599688" x2="141.01972599688" y1="334.40133660058" y2="353.44789485409" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="141" x2="124.5" y1="352" y2="361.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="124.5" x2="108" y1="361.5" y2="371" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="143" x2="126.5" y1="356" y2="365.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="126.5" x2="110" y1="365.5" y2="375" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="108.0310871018" x2="91.534862998441" y1="372.4944531076" y2="362.97117398084" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="91.534862998441" x2="75.038638895077" y1="362.97117398084" y2="353.44789485409" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="75" x2="58.5" y1="352" y2="361.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="58.5" x2="42" y1="361.5" y2="371" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="77" x2="60.5" y1="356" y2="365.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="60.5" x2="44" y1="365.5" y2="375" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #ff0000" />
<line x1="75.038638895077" x2="75.038638895077" y1="353.44789485409" y2="334.40133660058" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="75.038638895077" x2="75.038638895077" y1="334.40133660058" y2="315.35477834707" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="75.038638895077" x2="64.812541768768" y1="315.35477834707" y2="309.45034528848" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="64.812541768768" x2="54.586444642459" y1="309.45034528848" y2="303.5459122299" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #a4a4a4" />
<line x1="75.038638895077" x2="91.534862998441" y1="315.35477834707" y2="305.83149922032" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #0000ff" />
<line x1="91.534862998441" x2="108.0310871018" y1="305.83149922032" y2="296.30822009356" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="143" x2="126.5" y1="314" y2="304.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="126.5" x2="110" y1="304.5" y2="295" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="141" x2="124.5" y1="318" y2="308.5" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<line x1="124.5" x2="108" y1="308.5" y2="299" style="stroke-opacity:1; stroke-width: 1.6039192064439; stroke: #000000" />
<ellipse cx="416.92816885721" cy="135.5743149922" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="416.92816885721" y="144.39587062764"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">O</text>
<ellipse cx="469.68332590777" cy="178.29193584317" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="469.68332590777" y="187.11349147861"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">N</text>
<ellipse cx="355.40397638672" cy="244.27302294498" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="355.40397638672" y="253.09457858042"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">O</text>
<ellipse cx="276.0331588327" cy="307.9190020049" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.0331588327" y="316.74055764034"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">N</text>
<ellipse cx="311.53594341724" cy="416.54152372466" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="311.53594341724" y="425.3630793601"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">O</text>
<ellipse cx="297.92908220094" cy="481.10173758075" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="297.92908220094" y="489.92329321619"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">F</text>
<ellipse cx="360.64177990644" cy="460.60764089998" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.64177990644" y="469.42919653542"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">F</text>
<ellipse cx="276.0331588327" cy="246.60813098686" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.0331588327" y="255.4296866223"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">N</text>
<ellipse cx="42.05" cy="372.4944531076" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="381.31600874304"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">O</text>
<ellipse cx="75.038638895077" cy="315.35477834707" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.038638895077" y="324.17633398251"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">N</text>
<ellipse cx="54.586444642459" cy="303.5459122299" rx="10.425474841886" ry="10.425474841886" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="54.586444642459" y="312.36746786534"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:20.048990080549px">H</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 138👍, 0💬