Molecule FYI-1001291

A

Molecule Summary:

ID: FYI-1001291
SMILES: NC(=O)c1ccc(cc1)-c1nc(COC(=O)c2cc3c(ccc4ccccc34)o2)cs1

Received at FYIcenter.com on: 2022-05-03

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001291
FYIcenter.com

 31 35  0  0  0  0  0  0  0  0999 V2000
   19.8735    1.8777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0506    3.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6200    4.2893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6582    2.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8354    3.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4429    3.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8736    2.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6965    1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0888    1.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4813    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5444    3.4653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2655    2.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0531    3.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8407    2.8959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6282    3.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6282    4.9959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4158    2.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1369    3.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2000    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9000    1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    3.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    3.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2695    1.5036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4118    1.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7813    1.2125    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  2  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
  9  4  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 28 19  1  0  0  0  0
 28 23  2  0  0  0  0
 29 20  1  0  0  0  0
 29 17  1  0  0  0  0
 30 12  2  0  0  0  0
 31 30  1  0  0  0  0
 31 10  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="517.41631896747" x2="527.68315948373" y1="302.78458072307" y2="288.6537950034" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="527.68315948373" x2="537.95" y1="288.6537950034" y2="274.52300928372" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #0000ff" />
<line x1="534" x2="527" y1="334" y2="318.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="527" x2="520" y1="318.5" y2="303" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="530" x2="523" y1="336" y2="320" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="523" x2="516" y1="320" y2="304" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="482.67200317005" x2="500.04416106876" y1="299.13398218733" y2="300.9592814552" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="500.04416106876" x2="517.41631896747" y1="300.9592814552" y2="302.78458072307" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="464" x2="474.5" y1="329" y2="315" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="474.5" x2="485" y1="315" y2="301" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="461" x2="471.5" y1="327" y2="313" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="471.5" x2="482" y1="313" y2="299" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="427.3940063401" x2="444.76741188014" y1="323.74495509095" y2="325.57025435882" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="444.76741188014" x2="462.14081742018" y1="325.57025435882" y2="327.39555362669" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="412" x2="419" y1="293" y2="309" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="419" x2="426" y1="309" y2="325" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="415" x2="422.5" y1="292" y2="307.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="422.5" x2="430" y1="307.5" y2="323" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="433.72204317307" x2="423.4552026568" y1="263.56622311118" y2="277.69700883086" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="423.4552026568" x2="413.18836214054" y1="277.69700883086" y2="291.82779455053" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="469" x2="451.5" y1="266" y2="264" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="451.5" x2="434" y1="264" y2="262" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="469" x2="451.5" y1="270" y2="268" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="451.5" x2="434" y1="268" y2="266" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="468.46386368783" x2="475.56793342894" y1="267.21682164692" y2="283.17540191713" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="475.56793342894" x2="482.67200317005" y1="283.17540191713" y2="299.13398218733" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="378.44654162578" x2="395.81745188316" y1="288.17719601479" y2="290.00249528266" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="395.81745188316" x2="413.18836214054" y1="290.00249528266" y2="291.82779455053" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="357" x2="368.5" y1="316" y2="303" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #0000ff" />
<line x1="368.5" x2="380" y1="303" y2="290" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="354" x2="366" y1="313" y2="300" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #0000ff" />
<line x1="366" x2="378" y1="300" y2="287" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="323.15606838252" x2="339.11215337007" y1="299.92997735678" y2="307.03404709789" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="339.11215337007" x2="355.06823835761" y1="307.03404709789" y2="314.13811683901" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #0000ff" />
<line x1="292.90326137822" x2="308.02966488037" y1="317.39695599668" y2="308.66346667673" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="308.02966488037" x2="323.15606838252" y1="308.66346667673" y2="299.92997735678" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="262.65045437392" x2="277.77685787607" y1="299.92997735678" y2="308.66346667673" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="277.77685787607" x2="292.90326137822" y1="308.66346667673" y2="317.39695599668" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="232.39515208695" x2="247.52280323043" y1="317.39695599668" y2="308.66346667673" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="247.52280323043" x2="262.65045437392" y1="308.66346667673" y2="299.92997735678" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="235" x2="235" y1="353" y2="335.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="235" x2="235" y1="335.5" y2="318" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="231" x2="231" y1="353" y2="335.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="231" x2="231" y1="335.5" y2="318" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="202.14234508265" x2="217.2687485848" y1="299.92997735678" y2="308.66346667673" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="217.2687485848" x2="232.39515208695" y1="308.66346667673" y2="317.39695599668" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="171" x2="187" y1="316" y2="309" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="187" x2="203" y1="309" y2="302" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="170" x2="186" y1="313" y2="306" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="186" x2="202" y1="306" y2="299" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="146.85187183938" x2="158.54102347347" y1="288.17719601479" y2="301.1576564269" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="158.54102347347" x2="170.23017510756" y1="301.1576564269" y2="314.13811683901" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="163" x2="154.5" y1="258" y2="273" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="154.5" x2="146" y1="273" y2="288" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="166" x2="157.5" y1="259" y2="274.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="157.5" x2="149" y1="274.5" y2="290" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="146.85187183938" x2="155.58536115933" y1="227.66908672353" y2="242.79673786701" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="155.58536115933" x2="164.31885047928" y1="242.79673786701" y2="257.92438901049" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="112" x2="129.5" y1="230" y2="230" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="129.5" x2="147" y1="230" y2="230" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="112" x2="129.5" y1="226" y2="226" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="129.5" x2="147" y1="226" y2="226" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="94.450935919692" x2="103.18442523964" y1="257.92438901049" y2="242.79673786701" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="103.18442523964" x2="111.91791455959" y1="242.79673786701" y2="227.66908672353" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="59.516978639897" x2="76.983957279795" y1="257.92438901049" y2="257.92438901049" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="76.983957279795" x2="94.450935919692" y1="257.92438901049" y2="257.92438901049" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="44" x2="53" y1="290" y2="274.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="53" x2="62" y1="274.5" y2="259" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="41" x2="49.5" y1="288" y2="273" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="49.5" x2="58" y1="273" y2="258" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="59.516978639897" x2="50.783489319949" y1="318.4300030191" y2="303.30359951694" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="50.783489319949" x2="42.05" y1="303.30359951694" y2="288.17719601479" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="95" x2="77.5" y1="317" y2="317" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="77.5" x2="60" y1="317" y2="317" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="95" x2="77.5" y1="321" y2="321" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="77.5" x2="60" y1="321" y2="321" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="111.91791455959" x2="103.18442523964" y1="288.17719601479" y2="303.30359951694" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="103.18442523964" x2="94.450935919692" y1="303.30359951694" y2="318.4300030191" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="111.91791455959" x2="129.38489319949" y1="288.17719601479" y2="288.17719601479" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="129.38489319949" x2="146.85187183938" y1="288.17719601479" y2="288.17719601479" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="114" x2="105.5" y1="288" y2="273" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="105.5" x2="97" y1="273" y2="258" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="111" x2="102" y1="290" y2="274.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="102" x2="93" y1="274.5" y2="259" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="198.49174654691" x2="181.4052985131" y1="265.18815684203" y2="261.55627292626" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="181.4052985131" x2="164.31885047928" y1="261.55627292626" y2="257.92438901049" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="198.49174654691" x2="200.31704581478" y1="265.18815684203" y2="282.5590670994" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #ff0000" />
<line x1="200.31704581478" x2="202.14234508265" y1="282.5590670994" y2="299.92997735678" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="325" x2="323.5" y1="265" y2="282.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="323.5" x2="322" y1="282.5" y2="300" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="329" x2="327" y1="266" y2="283.5" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="327" x2="325" y1="283.5" y2="301" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="360.97956298589" x2="343.89311495207" y1="257.92438901049" y2="261.55627292626" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #c8aa1a" />
<line x1="343.89311495207" x2="326.80666691826" y1="261.55627292626" y2="265.18815684203" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<line x1="360.97956298589" x2="369.71305230583" y1="257.92438901049" y2="273.05079251264" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #c8aa1a" />
<line x1="369.71305230583" x2="378.44654162578" y1="273.05079251264" y2="288.17719601479" style="stroke-opacity:1; stroke-width: 1.470908415071; stroke: #000000" />
<ellipse cx="537.95" cy="274.52300928372" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="282.61300556661"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">N</text>
<ellipse cx="531.62445844969" cy="334.69924598083" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="531.62445844969" y="342.78924226372"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">O</text>
<ellipse cx="355.06823835761" cy="314.13811683901" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="355.06823835761" y="322.2281131219"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">N</text>
<ellipse cx="262.65045437392" cy="299.92997735678" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.65045437392" y="308.01997363967"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">O</text>
<ellipse cx="232.39515208695" cy="352.33091327647" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="232.39515208695" y="360.42090955936"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">O</text>
<ellipse cx="198.49174654691" cy="265.18815684203" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.49174654691" y="273.27815312492"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">O</text>
<ellipse cx="360.97956298589" cy="257.92438901049" rx="9.5609046979617" ry="9.5609046979617" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.97956298589" y="266.01438529338"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.386355188388px">S</text>
</g></svg>

✍: FYIcenter.com

2022-05-15, 145👍, 0💬