Molecule FYI-1001454

A

Molecule Summary:

ID: FYI-1001454
SMILES: O=C(COc1ccc(O)c(O)c1)Oc3ccc2ccc(=O)oc2c3

Received at FYIcenter.com on: 2022-07-29

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001454
FYIcenter.com

 24 26  0  0  0  0  0  0  0  0999 V2000
    6.0622    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3367    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    9.7999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12 10  2  0  0  0  0
 12  5  1  0  0  0  0
 13  2  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 20  1  0  0  0  0
 23 22  1  0  0  0  0
 23 17  1  0  0  0  0
 24 23  2  0  0  0  0
 24 14  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="271" x2="271" y1="317" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="271" x2="271" y1="290.5" y2="264" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="265" x2="265" y1="317" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="265" x2="265" y1="290.5" y2="264" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="312.54226120405" x2="290.00185915556" y1="342.05821492573" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="290.00185915556" x2="267.46145710708" y1="329.04412598319" y2="316.03003704065" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="357.62306530101" x2="335.08266325253" y1="316.03003704065" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="335.08266325253" x2="312.54226120405" y1="329.04412598319" y2="342.05821492573" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="402.70386939798" x2="380.16346734949" y1="342.05821492573" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="380.16346734949" x2="357.62306530101" y1="329.04412598319" y2="316.03003704065" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="447" x2="424.5" y1="314" y2="327" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="424.5" x2="402" y1="327" y2="340" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="450" x2="427.5" y1="319" y2="332" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="427.5" x2="405" y1="332" y2="345" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="492.87291421416" x2="470.33251216568" y1="342.05821492573" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="470.33251216568" x2="447.7921101172" y1="329.04412598319" y2="316.03003704065" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="496" x2="496" y1="395" y2="369" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="496" x2="496" y1="369" y2="343" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="491" x2="491" y1="395" y2="369" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="491" x2="491" y1="369" y2="343" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="537.95" x2="515.41145710708" y1="420.14274858098" y2="407.12865963844" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="515.41145710708" x2="492.87291421416" y1="407.12865963844" y2="394.1145706959" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="447.7921101172" x2="470.33251216568" y1="420.14274858098" y2="407.12865963844" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="470.33251216568" x2="492.87291421416" y1="407.12865963844" y2="394.1145706959" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="447.7921101172" x2="447.7921101172" y1="472.19538604002" y2="446.1690673105" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="447.7921101172" x2="447.7921101172" y1="446.1690673105" y2="420.14274858098" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="402" x2="424.5" y1="397" y2="410" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="424.5" x2="447" y1="410" y2="423" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="405" x2="427.5" y1="392" y2="405" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="427.5" x2="450" y1="405" y2="418" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="402.70386939798" x2="402.70386939798" y1="394.1145706959" y2="368.08639281082" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="402.70386939798" x2="402.70386939798" y1="368.08639281082" y2="342.05821492573" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="222.37693469899" x2="244.91919590303" y1="342.05821492573" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="244.91919590303" x2="267.46145710708" y1="329.04412598319" y2="316.03003704065" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="177.29613060202" x2="199.83653265051" y1="316.03003704065" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="199.83653265051" x2="222.37693469899" y1="329.04412598319" y2="342.05821492573" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="134" x2="156.5" y1="345" y2="332" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="156.5" x2="179" y1="332" y2="319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="131" x2="153.5" y1="340" y2="327" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="153.5" x2="176" y1="327" y2="314" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="87.130804096966" x2="109.67306530101" y1="316.03003704065" y2="329.04412598319" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="109.67306530101" x2="132.21532650506" y1="329.04412598319" y2="342.05821492573" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="85" x2="85" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="85" x2="85" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="90" x2="90" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="90" x2="90" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="42.05" x2="64.590402048483" y1="237.9455033854" y2="250.95959232794" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="64.590402048483" x2="87.130804096966" y1="250.95959232794" y2="263.97368127048" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="40" x2="40" y1="186" y2="212" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="40" x2="40" y1="212" y2="238" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="45" x2="45" y1="186" y2="212" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="45" x2="45" y1="212" y2="238" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="87.130804096966" x2="64.590402048483" y1="159.86096973014" y2="172.87505867269" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="64.590402048483" x2="42.05" y1="172.87505867269" y2="185.88914761523" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="85" x2="85" y1="108" y2="134" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="85" x2="85" y1="134" y2="160" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="90" x2="90" y1="108" y2="134" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="90" x2="90" y1="134" y2="160" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="132.21532650506" x2="109.67306530101" y1="185.88914761523" y2="172.87505867269" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="109.67306530101" x2="87.130804096966" y1="172.87505867269" y2="159.86096973014" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="132.21532650506" x2="132.21532650506" y1="237.9455033854" y2="211.91732550031" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="132.21532650506" x2="132.21532650506" y1="211.91732550031" y2="185.88914761523" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #ff0000" />
<line x1="132.21532650506" x2="109.67306530101" y1="237.9455033854" y2="250.95959232794" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="109.67306530101" x2="87.130804096966" y1="250.95959232794" y2="263.97368127048" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="179" x2="156.5" y1="262" y2="249" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="156.5" x2="134" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="176" x2="153.5" y1="267" y2="254" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="153.5" x2="131" y1="254" y2="241" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="177.29613060202" x2="177.29613060202" y1="263.97368127048" y2="290.00185915556" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<line x1="177.29613060202" x2="177.29613060202" y1="290.00185915556" y2="316.03003704065" style="stroke-opacity:1; stroke-width: 2.1918642517044; stroke: #000000" />
<ellipse cx="267.46145710708" cy="263.97368127048" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="267.46145710708" y="276.02893465485"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
<ellipse cx="357.62306530101" cy="316.03003704065" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.62306530101" y="328.08529042502"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
<ellipse cx="537.95" cy="420.14274858098" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="432.19800196536"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
<ellipse cx="447.7921101172" cy="472.19538604002" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="447.7921101172" y="484.2506394244"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
<ellipse cx="222.37693469899" cy="342.05821492573" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.37693469899" y="354.11346831011"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
<ellipse cx="87.130804096966" cy="107.80461395998" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="87.130804096966" y="119.85986734435"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
<ellipse cx="132.21532650506" cy="185.88914761523" rx="14.247117636079" ry="14.247117636079" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="132.21532650506" y="197.9444009996"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.398303146305px">O</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 134👍, 0💬