Molecule FYI-1001464

A

Molecule Summary:

ID: FYI-1001464
SMILES: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21

Received at FYIcenter.com on: 2022-07-31

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001464
FYIcenter.com

 20 22  0  0  0  0  0  0  0  0999 V2000
    7.7640    1.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7376    2.6114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1503    3.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5347    4.1580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3617    5.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9656    5.2106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0134    4.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6755    4.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3640    5.9619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0262    6.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3115    4.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6493    3.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2221    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0096    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0096    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7972    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.2221    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4345    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4345    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 13  8  1  0  0  0  0
 14  7  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 16  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20 14  1  0  0  0  0
 20  2  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="433.53134556575" x2="463.3503058104" y1="256.5379204893" y2="228.87752293578" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #0000ff" />
<line x1="463.3503058104" x2="493.16926605505" y1="228.87752293578" y2="201.21712538226" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="457.51085626911" x2="445.52110091743" y1="334.26941896024" y2="295.40366972477" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="445.52110091743" x2="433.53134556575" y1="295.40366972477" y2="256.5379204893" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #0000ff" />
<line x1="539" x2="499" y1="343" y2="337" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #ff0000" />
<line x1="499" x2="459" y1="337" y2="331" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="538" x2="497.5" y1="351" y2="345" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #ff0000" />
<line x1="497.5" x2="457" y1="345" y2="339" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="411.69006116208" x2="434.6004587156" y1="401.48990825688" y2="367.87966360856" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="434.6004587156" x2="457.51085626911" y1="367.87966360856" y2="334.26941896024" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="330.57110091743" x2="371.13058103976" y1="407.56177370031" y2="404.52584097859" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #0000ff" />
<line x1="371.13058103976" x2="411.69006116208" y1="404.52584097859" y2="401.48990825688" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="273" x2="300.5" y1="351" y2="381" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="300.5" x2="328" y1="381" y2="411" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #0000ff" />
<line x1="279" x2="306.5" y1="346" y2="375.5" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="306.5" x2="334" y1="375.5" y2="405" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #0000ff" />
<line x1="197.50718654434" x2="236.37584097859" y1="371.90917431193" y2="359.91941896024" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="236.37584097859" x2="275.24449541284" y1="359.91941896024" y2="347.92966360856" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="184" x2="193" y1="453" y2="413" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="193" x2="202" y1="413" y2="373" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="176" x2="185" y1="451" y2="411" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="185" x2="194" y1="411" y2="371" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="101.67629969419" x2="140.54204892966" y1="475.19480122324" y2="463.20504587156" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="140.54204892966" x2="179.40779816514" y1="463.20504587156" y2="451.21529051988" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="40" x2="69.5" y1="424" y2="451.5" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="69.5" x2="99" y1="451.5" y2="479" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="45" x2="75" y1="417" y2="445" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="75" x2="105" y1="445" y2="473" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="60.149388379205" x2="51.099694189602" y1="340.5620795107" y2="380.2122324159" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="51.099694189602" x2="42.05" y1="380.2122324159" y2="419.8623853211" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="137" x2="98" y1="313" y2="325" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="98" x2="59" y1="325" y2="337" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="140" x2="101" y1="321" y2="333" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="101" x2="62" y1="333" y2="345" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="137.88088685015" x2="167.69403669725" y1="316.57675840979" y2="344.24296636086" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="167.69403669725" x2="197.50718654434" y1="344.24296636086" y2="371.90917431193" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="287.37079510703" x2="281.30764525994" y1="267.49633027523" y2="307.7129969419" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="281.30764525994" x2="275.24449541284" y1="307.7129969419" y2="347.92966360856" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="215" x2="250.5" y1="231" y2="251.5" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="250.5" x2="286" y1="251.5" y2="272" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="220" x2="255" y1="224" y2="244" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="255" x2="290" y1="244" y2="264" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="216.91972477064" x2="216.91972477064" y1="145.47798165138" y2="186.15076452599" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="216.91972477064" x2="216.91972477064" y1="186.15076452599" y2="226.82354740061" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="146.4744648318" x2="181.69709480122" y1="104.80519877676" y2="125.14159021407" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #00bc00" />
<line x1="181.69709480122" x2="216.91972477064" y1="125.14159021407" y2="145.47798165138" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="286" x2="250.5" y1="102" y2="122" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="250.5" x2="215" y1="122" y2="142" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="290" x2="255" y1="109" y2="129.5" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="255" x2="220" y1="129.5" y2="150" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="357.81605504587" x2="322.59342507645" y1="145.47798165138" y2="125.14159021407" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="322.59342507645" x2="287.37079510703" y1="125.14159021407" y2="104.80519877676" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="363" x2="363" y1="227" y2="186.5" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="363" x2="363" y1="186.5" y2="146" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="354" x2="354" y1="227" y2="186.5" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="354" x2="354" y1="186.5" y2="146" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="357.81605504587" x2="322.59342507645" y1="226.82354740061" y2="247.15993883792" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="322.59342507645" x2="287.37079510703" y1="247.15993883792" y2="267.49633027523" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="357.81605504587" x2="395.67370030581" y1="226.82354740061" y2="241.68073394495" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #000000" />
<line x1="395.67370030581" x2="433.53134556575" y1="241.68073394495" y2="256.5379204893" style="stroke-opacity:1; stroke-width: 3.4250967958384; stroke: #0000ff" />
<ellipse cx="433.53134556575" cy="256.5379204893" rx="22.26312917295" ry="22.26312917295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="433.53134556575" y="275.37595286641"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:42.81370994798px">N</text>
<ellipse cx="537.95" cy="346.40152905199" rx="22.26312917295" ry="22.26312917295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="365.2395614291"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:42.81370994798px">O</text>
<ellipse cx="330.57110091743" cy="407.56177370031" rx="22.26312917295" ry="22.26312917295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.57110091743" y="426.39980607742"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:42.81370994798px">N</text>
<ellipse cx="146.4744648318" cy="104.80519877676" rx="22.26312917295" ry="22.26312917295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="146.4744648318" y="123.64323115387"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:42.81370994798px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 134👍, 0💬