Molecule FYI-1001469

A

Molecule Summary:

ID: FYI-1001469
SMILES: [H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]1(C)C2=CC(=O)[C@]2([H])[C@@]3(C)CC[C@H](O[C@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O)C(O)=O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O

Received at FYIcenter.com on: 2022-08-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001469
FYIcenter.com

 58 64  0  0  1  0  0  0  0  0999 V2000
    6.2212   20.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005   18.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   18.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   20.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142   19.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005   20.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935   20.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935   18.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866   19.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866   18.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866   16.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935   16.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0447   15.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005   16.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   16.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   14.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142   13.9360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005   13.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142   22.2977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005   12.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   13.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   11.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073   10.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005    9.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005    8.3616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073    7.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142    8.3616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2212    7.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2212    6.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4281    5.5744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142    5.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142    4.1808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073    6.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005    5.5744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005    4.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073    3.4840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073    2.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005    1.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6005    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935    2.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866    1.3936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935    3.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866    4.1808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142    1.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2212    2.0904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4281    8.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4281    9.7552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6349    7.6648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935   10.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6968    9.2452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935   11.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0142   20.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866   12.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866   13.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3935   14.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1866   15.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 54  2  0  0  0  0
  2  3  1  1  0  0  0
  4  3  1  0  0  0  0
  4  5  1  1  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  8  2  1  0  0  0  0
  8  9  1  6  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 12 13  1  1  0  0  0
 14 12  1  0  0  0  0
 14  2  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 16  1  6  0  0  0
 19 54  1  0  0  0  0
 20 18  1  0  0  0  0
 20 21  1  6  0  0  0
 22 20  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 24 25  1  6  0  0  0
 26 25  1  1  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 29 30  1  1  0  0  0
 31 29  1  0  0  0  0
 31 32  1  6  0  0  0
 33 31  1  0  0  0  0
 33 26  1  0  0  0  0
 33 34  1  1  0  0  0
 35 34  1  6  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 37  1  0  0  0  0
 38 39  1  1  0  0  0
 40 38  1  0  0  0  0
 40 41  1  6  0  0  0
 42 40  1  0  0  0  0
 42 35  1  0  0  0  0
 42 43  1  1  0  0  0
 37 44  1  6  0  0  0
 45 44  1  0  0  0  0
 46 44  2  0  0  0  0
 28 47  1  6  0  0  0
 48 47  1  0  0  0  0
 49 47  2  0  0  0  0
 50 24  1  0  0  0  0
 51 50  1  0  0  0  0
 52 50  1  0  0  0  0
 53 50  1  0  0  0  0
 53 20  1  0  0  0  0
 54  4  1  0  0  0  0
 53 55  1  6  0  0  0
 56 55  1  0  0  0  0
 57 56  1  0  0  0  0
 57 12  1  0  0  0  0
 57 18  1  0  0  0  0
 57 58  1  6  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="332" x2="318.5" y1="491" y2="498.5" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="318.5" x2="305" y1="498.5" y2="506" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="334" x2="320.5" y1="493" y2="501" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="320.5" x2="307" y1="501" y2="509" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 252,445 277,465 282,457" fill-opacity="1"  style="fill:#000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="491.45958349964" y2="475.96277799952" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="475.96277799952" y2="460.46597249941" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 279,492 308,481 304,472" fill-opacity="1"  style="fill:#000000" />
<line x1="251.81509729703" x2="265.23469034923" y1="506.95638899976" y2="499.2079862497" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="265.23469034923" x2="278.65428340143" y1="499.2079862497" y2="491.45958349964" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="491.45958349964" y2="499.2079862497" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="499.2079862497" y2="506.95638899976" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="460.46597249941" y2="475.96277799952" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="475.96277799952" y2="491.45958349964" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="460.46597249941" y2="452.71756974935" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="452.71756974935" y2="444.96916699929" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 225,461 196,472 201,481" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="198.13005309965" x2="211.55075814994" y1="444.96916699929" y2="452.71756974935" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="211.55075814994" x2="224.97146320024" y1="452.71756974935" y2="460.46597249941" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="198.13005309965" x2="198.13005309965" y1="413.97555599905" y2="429.47236149917" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="198.13005309965" x2="198.13005309965" y1="429.47236149917" y2="444.96916699929" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="211.55075814994" y1="398.47875049893" y2="406.22715324899" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="211.55075814994" x2="198.13005309965" y1="406.22715324899" y2="413.97555599905" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 225,399 198,376 193,384" fill-opacity="1"  style="fill:#000000" />
<line x1="251.81509729703" x2="238.39328024864" y1="413.97555599905" y2="406.22715324899" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="224.97146320024" y1="406.22715324899" y2="398.47875049893" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="251.81509729703" x2="251.81509729703" y1="413.97555599905" y2="429.47236149917" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="251.81509729703" x2="251.81509729703" y1="429.47236149917" y2="444.96916699929" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278" x2="264.5" y1="398" y2="405.5" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="264.5" x2="251" y1="405.5" y2="413" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="280" x2="266.5" y1="400" y2="408" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="266.5" x2="253" y1="408" y2="416" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="367.4829155025" y2="382.98083300071" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="382.98083300071" y2="398.47875049893" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="305" x2="291.5" y1="351" y2="359" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="291.5" x2="278" y1="359" y2="367" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="307" x2="293.5" y1="354" y2="361.5" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="293.5" x2="280" y1="361.5" y2="369" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 252,352 277,372 282,364" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="305.49569350202" x2="305.49569350202" y1="537.95" y2="522.45319449988" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="305.49569350202" x2="305.49569350202" y1="522.45319449988" y2="506.95638899976" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="251.81509729703" x2="251.81509729703" y1="320.99249900214" y2="336.48930450226" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="251.81509729703" x2="251.81509729703" y1="336.48930450226" y2="351.98611000238" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 252,321 277,341 282,333" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="278.65428340143" x2="265.23469034923" y1="305.49569350202" y2="313.24409625208" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="265.23469034923" x2="251.81509729703" y1="313.24409625208" y2="320.99249900214" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="274.50208250178" y2="289.9988880019" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="289.9988880019" y2="305.49569350202" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="251.81509729703" x2="265.23469034923" y1="259.00527700166" y2="266.75367975172" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="265.23469034923" x2="278.65428340143" y1="266.75367975172" y2="274.50208250178" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 252,260 257,229 248,229" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 279,213 250,224 255,233" fill-opacity="1"  style="fill:#000000" />
<line x1="305.49569350202" x2="292.07498845172" y1="228.01166600143" y2="220.26326325137" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="292.07498845172" x2="278.65428340143" y1="220.26326325137" y2="212.51486050131" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="332.33932759881" x2="318.91751055042" y1="212.51486050131" y2="220.26326325137" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="318.91751055042" x2="305.49569350202" y1="220.26326325137" y2="228.01166600143" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="332.33932759881" x2="332.33932759881" y1="181.52124950107" y2="197.01805500119" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="332.33932759881" x2="332.33932759881" y1="197.01805500119" y2="212.51486050131" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 333,182 362,171 357,162" fill-opacity="1"  style="fill:#000000" />
<line x1="305.49569350202" x2="318.91751055042" y1="166.02444400095" y2="173.77284675101" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="318.91751055042" x2="332.33932759881" y1="173.77284675101" y2="181.52124950107" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 306,167 311,136 301,136" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="278.65428340143" x2="292.07498845172" y1="181.52124950107" y2="173.77284675101" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="292.07498845172" x2="305.49569350202" y1="173.77284675101" y2="166.02444400095" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="181.52124950107" y2="197.01805500119" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="197.01805500119" y2="212.51486050131" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 279,182 255,162 250,171" fill-opacity="1"  style="fill:#000000" />
<polygon points=" 252,136 248,167 257,167" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="278.65428340143" x2="265.23469034923" y1="119.53402750059" y2="127.28243025065" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="265.23469034923" x2="251.81509729703" y1="127.28243025065" y2="135.03083300071" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="88.540416500357" y2="104.03722200048" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="278.65428340143" x2="278.65428340143" y1="104.03722200048" y2="119.53402750059" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="251.81509729703" x2="265.23469034923" y1="73.043611000238" y2="80.792013750297" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="265.23469034923" x2="278.65428340143" y1="80.792013750297" y2="88.540416500357" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 252,74 257,43 248,43" fill-opacity="1"  style="fill:#000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="88.540416500357" y2="80.792013750297" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="80.792013750297" y2="73.043611000238" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 225,89 201,69 196,78" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="224.97146320024" x2="224.97146320024" y1="119.53402750059" y2="104.03722200048" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="104.03722200048" y2="88.540416500357" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="119.53402750059" y2="127.28243025065" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="127.28243025065" y2="135.03083300071" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 225,120 196,131 201,140" fill-opacity="1"  style="fill:#000000" />
<polygon points=" 279,89 308,78 304,69" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="332.33932759881" x2="318.91751055042" y1="88.540416500357" y2="80.792013750297" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="318.91751055042" x2="305.49569350202" y1="80.792013750297" y2="73.043611000238" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="304" x2="304" y1="43" y2="58.5" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="304" x2="304" y1="58.5" y2="74" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="308" x2="308" y1="43" y2="58.5" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="308" x2="308" y1="58.5" y2="74" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 333,213 357,233 362,224" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="359.1807376994" x2="359.1807376994" y1="259.00527700166" y2="243.50847150155" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="359.1807376994" x2="359.1807376994" y1="243.50847150155" y2="228.01166600143" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="386" x2="372.5" y1="212" y2="219.5" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="372.5" x2="359" y1="219.5" y2="227" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="387" x2="374" y1="214" y2="222" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #ff0000" />
<line x1="374" x2="361" y1="222" y2="230" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="274.50208250178" y2="266.75367975172" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="266.75367975172" y2="259.00527700166" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="193.9800761962" x2="209.47576969822" y1="274.50208250178" y2="274.50208250178" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="209.47576969822" x2="224.97146320024" y1="274.50208250178" y2="274.50208250178" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="209.47688169632" x2="217.22417244828" y1="247.66289639739" y2="261.08248944958" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="217.22417244828" x2="224.97146320024" y1="261.08248944958" y2="274.50208250178" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="305.49569350202" y2="289.9988880019" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="289.9988880019" y2="274.50208250178" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="305.49569350202" y2="313.24409625208" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="313.24409625208" y2="320.99249900214" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="305.49569350202" x2="292.07498845172" y1="506.95638899976" y2="499.2079862497" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="292.07498845172" x2="278.65428340143" y1="499.2079862497" y2="491.45958349964" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 225,306 196,317 201,326" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="198.13005309965" x2="198.13005309965" y1="351.98611000238" y2="336.48930450226" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="198.13005309965" x2="198.13005309965" y1="336.48930450226" y2="320.99249900214" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="211.55075814994" y1="367.4829155025" y2="359.73451275244" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="211.55075814994" x2="198.13005309965" y1="359.73451275244" y2="351.98611000238" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="367.4829155025" y2="382.98083300071" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="224.97146320024" y1="382.98083300071" y2="398.47875049893" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="224.97146320024" x2="238.39328024864" y1="367.4829155025" y2="359.73451275244" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<line x1="238.39328024864" x2="251.81509729703" y1="359.73451275244" y2="351.98611000238" style="stroke-opacity:1; stroke-width: 1.3137130727578; stroke: #000000" />
<polygon points=" 225,368 196,388 202,395" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<ellipse cx="332.33932759881" cy="491.45958349964" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.33932759881" y="498.68500539981"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="305.49569350202" cy="351.98611000238" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.49569350202" y="359.21153190255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="305.49569350202" cy="537.95" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.49569350202" y="545.17542190017"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="251.81509729703" cy="228.01166600143" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="251.81509729703" y="235.23708790159"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="305.49569350202" cy="228.01166600143" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.49569350202" y="235.23708790159"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="359.1807376994" cy="166.02444400095" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="359.1807376994" y="173.24986590112"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="305.49569350202" cy="135.03083300071" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.49569350202" y="142.25625490088"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="251.81509729703" cy="166.02444400095" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="251.81509729703" y="173.24986590112"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="278.65428340143" cy="119.53402750059" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="278.65428340143" y="126.75944940076"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="251.81509729703" cy="42.05" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="251.81509729703" y="49.275421900168"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="198.13005309965" cy="73.043611000238" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.13005309965" y="80.269032900406"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="198.13005309965" cy="135.03083300071" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.13005309965" y="142.25625490088"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="332.33932759881" cy="88.540416500357" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.33932759881" y="95.765838400525"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="305.49569350202" cy="42.05" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.49569350202" y="49.275421900168"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="359.1807376994" cy="259.00527700166" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="359.1807376994" y="266.23069890183"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
<ellipse cx="386.0199238038" cy="212.51486050131" rx="8.5391349729259" ry="8.5391349729259" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="386.0199238038" y="219.74028240148"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:16.421413409473px">O</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 130👍, 0💬