Molecule FYI-1001615

A

Molecule Summary:

ID: FYI-1001615
SMILES: CN1N=C(C(=C1N2C=C(C=N2)C3=CC(C(=O)NC4(CC4)C#N)=C(Cl)C=C3)C(F)(F)F)C(F)(F)C(F)(F)F

Received at FYIcenter.com on: 2022-10-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001615
FYIcenter.com

 37 40  0  0  0  0  0  0  0  0999 V2000
    6.5887   10.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2572   10.2185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1246   11.0414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9920   10.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4246    8.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8246    8.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6475    7.7544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2148    6.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3475    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4801    6.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0475    7.7544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3475    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9226    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9226    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7101    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4977    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1354    0.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4877    0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1354    2.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7730    4.1046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3475    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3475    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.5599    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5599    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6017    7.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7343    6.9315    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7787    6.6217    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.4691    8.5772    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6605   10.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2279    9.3196    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.2911   10.3601    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3694   12.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7388   12.3116    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0783   13.3899    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   11.7294    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  2  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  7  1  0  0  0  0
 12  9  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 20 18  1  0  0  0  0
 21 18  1  0  0  0  0
 22 21  3  0  0  0  0
 23 14  2  0  0  0  0
 24 23  1  0  0  0  0
 25 23  1  0  0  0  0
 26 25  2  0  0  0  0
 26 12  1  0  0  0  0
 27  5  1  0  0  0  0
 28 27  1  0  0  0  0
 29 27  1  0  0  0  0
 30 27  1  0  0  0  0
 31  4  1  0  0  0  0
 32 31  1  0  0  0  0
 33 31  1  0  0  0  0
 34 31  1  0  0  0  0
 35 34  1  0  0  0  0
 36 34  1  0  0  0  0
 37 34  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="344.71051128089" x2="369.36681379249" y1="420.4960040777" y2="428.50675621177" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="369.36681379249" x2="394.02311630408" y1="428.50675621177" y2="436.51750834584" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="302.76424282482" x2="323.73737705285" y1="450.97241614949" y2="435.73421011359" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="323.73737705285" x2="344.71051128089" y1="435.73421011359" y2="420.4960040777" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="260" x2="281" y1="423" y2="438.5" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="281" x2="302" y1="438.5" y2="454" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="263" x2="284" y1="419" y2="434" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="284" x2="305" y1="434" y2="449" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="276.83947863688" x2="268.82872650281" y1="371.18339905451" y2="395.83970156611" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="268.82872650281" x2="260.81797436874" y1="395.83970156611" y2="420.4960040777" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="329" x2="303" y1="369" y2="369" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="303" x2="277" y1="369" y2="369" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="329" x2="303" y1="374" y2="374" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="303" x2="277" y1="374" y2="374" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="328.68900701275" x2="336.69975914682" y1="371.18339905451" y2="395.83970156611" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="336.69975914682" x2="344.71051128089" y1="395.83970156611" y2="420.4960040777" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="359.16541908453" x2="343.92721304864" y1="329.23713059844" y2="350.21026482647" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="343.92721304864" x2="328.68900701275" y1="350.21026482647" y2="371.18339905451" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="343.14021127865" x2="351.15281518159" y1="279.92452557525" y2="304.58082808684" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="351.15281518159" x2="359.16541908453" y1="304.58082808684" y2="329.23713059844" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="384" x2="363" y1="248" y2="263" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="363" x2="342" y1="263" y2="278" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="387" x2="366" y1="252" y2="267.5" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="366" x2="345" y1="267.5" y2="283" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="427.03645172854" x2="406.0633175005" y1="279.92452557525" y2="264.68631953935" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="406.0633175005" x2="385.09018327247" y1="264.68631953935" y2="249.44811350346" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="414" x2="422" y1="331" y2="306" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="422" x2="430" y1="306" y2="281" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="409" x2="417" y1="329" y2="304.5" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="417" x2="425" y1="304.5" y2="280" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="411.0149474604" x2="385.09018327247" y1="329.23713059844" y2="329.23713059844" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="385.09018327247" x2="359.16541908453" y1="329.23713059844" y2="329.23713059844" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="385.09018327247" x2="385.09018327247" y1="197.5985851276" y2="223.52334931553" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="385.09018327247" x2="385.09018327247" y1="223.52334931553" y2="249.44811350346" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="339" x2="361.5" y1="175" y2="187.5" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="361.5" x2="384" y1="187.5" y2="200" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="342" x2="364.5" y1="170" y2="183" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="364.5" x2="387" y1="183" y2="196" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="340.18478816123" x2="340.18478816123" y1="119.8242925638" y2="145.74905675173" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="340.18478816123" x2="340.18478816123" y1="145.74905675173" y2="171.67382093966" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="295.28309658773" x2="317.73394237448" y1="93.899528375865" y2="106.86191046983" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="317.73394237448" x2="340.18478816123" y1="106.86191046983" y2="119.8242925638" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="293" x2="293" y1="43" y2="68.5" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #ff0000" />
<line x1="293" x2="293" y1="68.5" y2="94" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="299" x2="299" y1="43" y2="68.5" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #ff0000" />
<line x1="299" x2="299" y1="68.5" y2="94" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="250.37770147649" x2="272.83039903211" y1="119.8242925638" y2="106.86191046983" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="272.83039903211" x2="295.28309658773" y1="106.86191046983" y2="93.899528375865" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="205.47600990299" x2="227.92685568974" y1="93.899528375865" y2="106.86191046983" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="227.92685568974" x2="250.37770147649" y1="106.86191046983" y2="119.8242925638" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="192.05809266686" x2="198.76705128492" y1="43.816587502521" y2="68.858057939193" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="198.76705128492" x2="205.47600990299" y1="68.858057939193" y2="93.899528375865" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="242.14103354021" x2="217.09956310353" y1="57.234504738646" y2="50.525546120583" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="217.09956310353" x2="192.05809266686" y1="50.525546120583" y2="43.816587502521" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="242.14103354021" x2="223.8085217216" y1="57.234504738646" y2="75.567016557256" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="223.8085217216" x2="205.47600990299" y1="75.567016557256" y2="93.899528375865" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="192.05809266686" x2="198.76705128492" y1="143.98246924921" y2="118.94099881254" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="198.76705128492" x2="205.47600990299" y1="118.94099881254" y2="93.899528375865" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="184" x2="191" y1="196" y2="171" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="191" x2="198" y1="171" y2="146" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="174" x2="180.5" y1="193" y2="168" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="180.5" x2="187" y1="168" y2="143" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="178.63647189299" x2="185.34728227993" y1="194.06541012256" y2="169.02393968588" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #0000ff" />
<line x1="185.34728227993" x2="192.05809266686" y1="169.02393968588" y2="143.98246924921" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="384" x2="361.5" y1="92" y2="105" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="361.5" x2="339" y1="105" y2="118" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="387" x2="364.5" y1="97" y2="110" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="364.5" x2="342" y1="110" y2="123" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="385.09018327247" x2="385.09018327247" y1="42.05" y2="67.974764187933" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="385.09018327247" x2="385.09018327247" y1="67.974764187933" y2="93.899528375865" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="429.99187484597" x2="407.54102905922" y1="119.8242925638" y2="106.86191046983" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="407.54102905922" x2="385.09018327247" y1="106.86191046983" y2="93.899528375865" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="433" x2="433" y1="172" y2="146" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="433" x2="433" y1="146" y2="120" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="428" x2="428" y1="172" y2="146" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="428" x2="428" y1="146" y2="120" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="429.99187484597" x2="407.54102905922" y1="171.67382093966" y2="184.63620303363" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="407.54102905922" x2="385.09018327247" y1="184.63620303363" y2="197.5985851276" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="246.3630665651" x2="261.60127260099" y1="329.23713059844" y2="350.21026482647" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="261.60127260099" x2="276.83947863688" y1="350.21026482647" y2="371.18339905451" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="288.30933502117" x2="267.33620079314" y1="298.76071852665" y2="313.99892456254" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="267.33620079314" x2="246.3630665651" y1="313.99892456254" y2="329.23713059844" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="215.88295095557" x2="231.12300876033" y1="287.28715860462" y2="308.26214460153" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="231.12300876033" x2="246.3630665651" y1="308.26214460153" y2="329.23713059844" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="204.41679810902" x2="225.38993233706" y1="359.70983913248" y2="344.47348486546" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="225.38993233706" x2="246.3630665651" y1="344.47348486546" y2="329.23713059844" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="211.50536934555" x2="236.16167185715" y1="436.51750834584" y2="428.50675621177" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="236.16167185715" x2="260.81797436874" y1="428.50675621177" y2="420.4960040777" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="195.48386507741" x2="203.49461721148" y1="387.20490332265" y2="411.86120583425" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="203.49461721148" x2="211.50536934555" y1="411.86120583425" y2="436.51750834584" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="160.78912351847" x2="186.14724643201" y1="425.74021351914" y2="431.12886093249" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="186.14724643201" x2="211.50536934555" y1="431.12886093249" y2="436.51750834584" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="200.72437098111" x2="206.11487016333" y1="487.23005063518" y2="461.87377949051" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="206.11487016333" x2="211.50536934555" y1="461.87377949051" y2="436.51750834584" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="251.44061680819" x2="226.08249389465" y1="498.01475253736" y2="492.62240158627" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="226.08249389465" x2="200.72437098111" y1="492.62240158627" y2="487.23005063518" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="189.94337261667" x2="195.33387179889" y1="537.95" y2="512.59002531759" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="195.33387179889" x2="200.72437098111" y1="512.59002531759" y2="487.23005063518" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<line x1="150.00812515403" x2="175.36624806757" y1="476.45275580848" y2="481.84140322183" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #00bc00" />
<line x1="175.36624806757" x2="200.72437098111" y1="481.84140322183" y2="487.23005063518" style="stroke-opacity:1; stroke-width: 2.1831393046364; stroke: #000000" />
<ellipse cx="344.71051128089" cy="420.4960040777" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="344.71051128089" y="432.5032702532"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">N</text>
<ellipse cx="302.76424282482" cy="450.97241614949" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="302.76424282482" y="462.97968232499"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">N</text>
<ellipse cx="359.16541908453" cy="329.23713059844" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="359.16541908453" y="341.24439677394"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">N</text>
<ellipse cx="411.0149474604" cy="329.23713059844" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="411.0149474604" y="341.24439677394"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">N</text>
<ellipse cx="295.28309658773" cy="42.05" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="295.28309658773" y="54.0572661755"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">O</text>
<ellipse cx="250.37770147649" cy="119.8242925638" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="250.37770147649" y="131.8315587393"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">N</text>
<ellipse cx="178.63647189299" cy="194.06541012256" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="178.63647189299" y="206.07267629806"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">N</text>
<ellipse cx="385.09018327247" cy="42.05" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="385.09018327247" y="54.0572661755"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">Cl</text>
<ellipse cx="288.30933502117" cy="298.76071852665" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="288.30933502117" y="310.76798470215"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="215.88295095557" cy="287.28715860462" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="215.88295095557" y="299.29442478012"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="204.41679810902" cy="359.70983913248" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="204.41679810902" y="371.71710530798"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="195.48386507741" cy="387.20490332265" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="195.48386507741" y="399.21216949815"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="160.78912351847" cy="425.74021351914" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="160.78912351847" y="437.74747969464"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="251.44061680819" cy="498.01475253736" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="251.44061680819" y="510.02201871286"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="189.94337261667" cy="537.95" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="189.94337261667" y="549.9572661755"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
<ellipse cx="150.00812515403" cy="476.45275580848" rx="14.190405480136" ry="14.190405480136" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="150.00812515403" y="488.46002198398"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:27.289241307954px">F</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 119👍, 0💬