Molecule FYI-1001622

A

Molecule Summary:

ID: FYI-1001622
SMILES: O=C1N([N-]C=C1n2ccnn2)c3cc(ncn3)N4CCOCC4.[Na+]

Received at FYIcenter.com on: 2022-10-06

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001622
FYIcenter.com

 24 26  0  0  0  0  0  0  0  0999 V2000
    5.7219    4.3466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3432    4.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7295    5.8481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3430    5.6532    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0
    2.1000    4.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3361    3.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5309    2.2309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5239    1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1377    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5240    0.1949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7671    1.5736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3868    7.0841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7859    7.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4432    8.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7012    9.5564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3021    9.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6449    8.2715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8422    8.4181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5842    7.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9834    7.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6406    8.5158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8987    9.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4995    9.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.6532    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  2  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  7  1  0  0  0  0
 12  3  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 17 12  1  0  0  0  0
 18 14  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 23 18  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="246" x2="278" y1="282" y2="276" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="278" x2="310" y1="276" y2="270" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #ff0000" />
<line x1="244" x2="276.5" y1="275" y2="269.5" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="276.5" x2="309" y1="269.5" y2="264" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #ff0000" />
<line x1="215.8615378832" x2="230.16213324437" y1="336.44605943274" y2="307.12482895701" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="230.16213324437" x2="244.46272860553" y1="307.12482895701" y2="277.80359848129" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="151.24437813657" x2="183.55295800989" y1="327.36283950153" y2="331.90444946714" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="183.55295800989" x2="215.8615378832" y1="331.90444946714" y2="336.44605943274" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="139.9194810443" x2="145.58192959044" y1="263.10919497021" y2="295.23601723587" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="145.58192959044" x2="151.24437813657" y1="295.23601723587" y2="327.36283950153" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="196" x2="167.5" y1="230" y2="245.5" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="167.5" x2="139" y1="245.5" y2="261" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="200" x2="171" y1="236" y2="251.5" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="171" x2="142" y1="251.5" y2="267" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="197.52732176757" x2="220.99502518655" y1="232.47604740334" y2="255.13982294232" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="220.99502518655" x2="244.46272860553" y1="255.13982294232" y2="277.80359848129" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="206.6058812473" x2="202.06660150743" y1="167.86820855967" y2="200.1721279815" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="202.06660150743" x2="197.52732176757" y1="200.1721279815" y2="232.47604740334" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="159.67513486082" x2="183.14050805406" y1="122.54065748172" y2="145.20443302069" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="183.14050805406" x2="206.6058812473" y1="145.20443302069" y2="167.86820855967" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="186" x2="171.5" y1="63" y2="92.5" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="171.5" x2="157" y1="92.5" y2="122" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="192" x2="177.5" y1="66" y2="95.5" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="177.5" x2="163" y1="95.5" y2="125" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="252.8888248783" x2="220.58490545646" y1="72.981416461478" y2="68.439806495874" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="220.58490545646" x2="188.28098603462" y1="68.439806495874" y2="63.898196530271" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="268" x2="262.5" y1="137" y2="105" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="262.5" x2="257" y1="105" y2="73" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="261" x2="255.5" y1="138" y2="106" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="255.5" x2="250" y1="106" y2="74" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="264.21838242204" x2="235.41213183467" y1="137.2350609928" y2="152.55163477623" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="235.41213183467" x2="206.6058812473" y1="152.55163477623" y2="167.86820855967" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="246.49468545007" x2="231.17811166664" y1="394.04923970453" y2="365.24764956863" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="231.17811166664" x2="215.8615378832" y1="365.24764956863" y2="336.44605943274" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="312" x2="279.5" y1="393" y2="392" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="279.5" x2="247" y1="392" y2="391" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="312" x2="279.5" y1="400" y2="399" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="279.5" x2="247" y1="399" y2="398" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="342.33220964983" x2="327.0156358664" y1="453.94070165216" y2="425.13445106479" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="327.0156358664" x2="311.69906208297" y1="425.13445106479" y2="396.32820047742" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="311" x2="328.5" y1="512" y2="484" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="328.5" x2="346" y1="484" y2="456" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="305" x2="322.5" y1="508" y2="480.5" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="322.5" x2="340" y1="480.5" y2="453" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="242.54728304795" x2="275.1494713644" y1="506.99062082965" y2="508.1301012161" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="275.1494713644" x2="307.75165968085" y1="508.1301012161" y2="509.26958160254" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="209" x2="224.5" y1="451" y2="480" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="224.5" x2="240" y1="480" y2="509" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="215" x2="230.5" y1="448" y2="477" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="230.5" x2="246" y1="477" y2="506" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="211.91879593256" x2="229.20674069131" y1="449.38744055786" y2="421.7183401312" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="229.20674069131" x2="246.49468545007" y1="421.7183401312" y2="394.04923970453" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="407.53192583125" x2="374.93206774054" y1="456.21966242505" y2="455.08018203861" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="374.93206774054" x2="342.33220964983" y1="455.08018203861" y2="453.94070165216" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="442.11247580024" x2="424.82220081574" y1="400.88146157172" y2="428.55056199838" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="424.82220081574" x2="407.53192583125" y1="428.55056199838" y2="456.21966242505" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<line x1="507.32151288461" x2="474.71699434242" y1="403.1604223446" y2="402.02094195816" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="474.71699434242" x2="442.11247580024" y1="402.02094195816" y2="400.88146157172" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="537.95" x2="522.63575644231" y1="460.77292351935" y2="431.96667293198" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #ff0000" />
<line x1="522.63575644231" x2="507.32151288461" y1="431.96667293198" y2="403.1604223446" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="503.37411048249" x2="520.66205524125" y1="516.10180346973" y2="488.43736349454" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="520.66205524125" x2="537.95" y1="488.43736349454" y2="460.77292351935" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #ff0000" />
<line x1="438.16507339812" x2="470.7695919403" y1="513.82284269684" y2="514.96232308328" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="470.7695919403" x2="503.37411048249" y1="514.96232308328" y2="516.10180346973" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="438.16507339812" x2="422.84849961468" y1="513.82284269684" y2="485.02125256095" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #000000" />
<line x1="422.84849961468" x2="407.53192583125" y1="485.02125256095" y2="456.21966242505" style="stroke-opacity:1; stroke-width: 2.7472802239699; stroke: #0000ff" />
<ellipse cx="308.71637313685" cy="266.46938048606" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="308.71637313685" y="281.5794217179"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">O</text>
<ellipse cx="215.8615378832" cy="336.44605943274" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="215.8615378832" y="351.55610066457"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="151.24437813657" cy="327.36283950153" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="151.24437813657" y="342.47288073337"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N<tspan baseline-shift='super' font-size='17.170501399812'>-</tspan></text>
<ellipse cx="206.6058812473" cy="167.86820855967" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="206.6058812473" y="182.9782497915"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="252.8888248783" cy="72.981416461478" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="252.8888248783" y="88.091457693312"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="264.21838242204" cy="137.2350609928" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="264.21838242204" y="152.34510222464"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="307.75165968085" cy="509.26958160254" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="307.75165968085" y="524.37962283438"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="211.91879593256" cy="449.38744055786" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="211.91879593256" y="464.4974817897"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="407.53192583125" cy="456.21966242505" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="407.53192583125" y="471.32970365689"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">N</text>
<ellipse cx="537.95" cy="460.77292351935" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="475.88296475118"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">O</text>
<ellipse cx="42.05" cy="327.36283950153" rx="17.857321455804" ry="17.857321455804" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="342.47288073337"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.341002799624px">Na<tspan baseline-shift='super' font-size='17.170501399812'>+</tspan></text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 118👍, 0💬