Molecule FYI-1015565

A

Molecule Summary:

ID: FYI-1015565
Names:
InChIKey: TWLBYQJSUUFFEB-HPOLAVBOSA-N
SMILES: CC[C@H](C)[C@H](N)C(=O)NCC(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)NC(CCC(=O)O)C(=O)O)C(C)C)C(C)C)C(C)C)[C@@H](C)O)[C@@H](C)CC

Received at FYIcenter.com on: 2025-09-08

Molecule ID: FYI-1015565 Edit

Molecule Structure InChIKey: TWLBYQJSUUFFEB-HPOLAVBOSA-N

Molecule Structure SMILES String: CC[C@H](C)[C@H](N)C(=O)NCC(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)NC(CCC(=O)O)C(=O)O)C(C)C)C(C)C)C(C)C)[C@@H](C)O)[C@@H](C)CC

Download SDF Download SVG Structure in 2D SDF:

FYI-1015565
FYIcenter.com

 88 88  0  0  1  0  0  0  0  0999 V2000
   35.5044   21.1818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7169   20.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9945    2.0915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9293   21.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3663    2.5957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9293   22.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1417   23.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1417   20.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7169   19.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9293   18.3818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5044   18.3818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5044   16.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2920   16.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0795   16.9818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2920   14.8818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0795   14.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0795   12.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2920   12.0818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8671   12.0818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8671   10.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0349    3.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0795    9.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2920   10.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5044    9.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0795    8.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6547    9.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4422   10.6818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6547    8.5818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4422    7.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4422    6.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6547    5.7818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2298    5.7818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2298    4.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7494    5.6956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4422    3.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0405    4.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6547    4.3818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4422    2.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0174    3.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0174    2.2818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.8049    4.3818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5925    3.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3719    3.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5925    2.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3801    1.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8049    1.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3801    4.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3801    5.7818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1677    3.6818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8887    4.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4124    4.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9519    3.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6519    1.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0213    2.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5976    5.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6380    6.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2661    6.0533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9751    7.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7438    4.3978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0155    8.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7244    9.7289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3470    7.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6436    7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3525    9.2247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6032    6.9185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2717    7.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2313    6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5224    5.0449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8999    6.8470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8595    5.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7842    5.3345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1505    4.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4820    4.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7731    2.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1046    2.3062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3956    0.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3552    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7271    0.5041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5280    6.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2369    7.7122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4876    5.4060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1561    5.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4067    3.5325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8650    7.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9054    8.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5335    7.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1157    4.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1  0  0  0
  3 21  1  0  0  0  0
  4  2  1  0  0  0  0
  5 21  2  0  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  4  8  1  6  0  0  0
  9  2  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 17  1  0  0  0  0
 20 19  1  1  0  0  0
 21 60  1  0  0  0  0
 22 20  1  0  0  0  0
 23 37  1  0  0  0  0
 24 22  1  0  0  0  0
 25 24  1  0  0  0  0
 22 26  1  6  0  0  0
 27 20  1  0  0  0  0
 28 27  2  0  0  0  0
 29 27  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 33 31  1  0  0  0  0
 34 33  1  1  0  0  0
 35 37  2  0  0  0  0
 36 34  1  0  0  0  0
 37 44  1  0  0  0  0
 36 38  1  6  0  0  0
 39 36  1  0  0  0  0
 40 34  1  0  0  0  0
 41 40  2  0  0  0  0
 42 40  1  0  0  0  0
 43 42  1  1  0  0  0
 44 52  1  0  0  0  0
 45 43  1  0  0  0  0
 46 45  1  0  0  0  0
 47 45  1  0  0  0  0
 48 43  1  0  0  0  0
 49 48  2  0  0  0  0
 50 48  1  0  0  0  0
 51 50  1  0  0  0  0
 52 60  1  0  0  0  0
 53 51  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  1  0  0  0  0
 55 50  1  0  0  0  0
 51 56  1  1  0  0  0
 57 56  2  0  0  0  0
 58 56  1  0  0  0  0
 59 58  1  6  0  0  0
 60 72  1  0  0  0  0
 61 59  1  0  0  0  0
 62 61  1  0  0  0  0
 63 61  1  0  0  0  0
 64 59  1  0  0  0  0
 65 64  2  0  0  0  0
 66 64  1  0  0  0  0
 67 66  1  0  0  0  0
 68 67  1  0  0  0  0
 69 68  2  0  0  0  0
 70 68  1  0  0  0  0
 71 70  1  1  0  0  0
 72 88  1  0  0  0  0
 73 71  1  0  0  0  0
 74 73  1  0  0  0  0
 75 74  1  0  0  0  0
 76 75  1  0  0  0  0
 77 76  1  0  0  0  0
 78 77  2  0  0  0  0
 79 77  1  0  0  0  0
 80 71  1  0  0  0  0
 81 80  2  0  0  0  0
 82 80  1  0  0  0  0
 83 82  1  6  0  0  0
 84 88  2  0  0  0  0
 85 83  1  0  0  0  0
 86 85  1  0  0  0  0
 87 85  1  0  0  0  0
 88 83  1  0  0  0  0
M  END
$$$$

Download SDF Structure in 3D SDF:

FYI-1015565-3D
FYIcenter.com


<head>
<title>NCBI - WWW Error 803 Diagnostic</title>
<meta http-equiv="Content-Type" content="application/xhtml+xml; charset=utf-8" />
<meta http-equiv="pragma" content="no-cache" />
<meta http-equiv="cache-control" content="no-cache" />
<meta name="robots" content="noarchive,none" />

<style type="text/css">
body {
min-width: 950px;
_width: 950px;
}
h1.error {color: red; font-size: 40pt}

#mainContent {
padding: 1em 2em;
}

dl#diags {
padding: 0.5em 0.5em 1.5em 0.5em;
padding-left: 2em;
border: solid 1px #888;
border-left: none;
border-right: none;
margin-bottom:0;
background-color:#eeeeee;
color:#666;
font-size: 80%;
_font-size: 70%;
font-family: Verdana, sans-serif;
}

dl#diags dt {
float: left;
font-weight: bold;
width: auto;
}

dl#diags dd {
margin-left:1em;
float: left;
margin-right: 2em;
}

#footer span {
float: left;
color: #888;
font-size: 80%;
}

#footer {
text-align: right;
padding: 0 0.5em;
clear: left;
}

#footer img {
border: none;
}

.ncbi {
margin: 0;
padding:0;
font-size:240%;
font-weight: bold;
font-family: Times, serif;
color: #336699;
float: left;
display: inline;
}

.ncbi a {
text-decoration: none;
color: #336699;
}

.ncbi a:visited {
text-decoration: none;
color: #336699;
}

.ncbi a:hover {
text-decoration: underline;
}

.message {
font-family: Verdana, sans-serif;
background-color: #336699;
color: white;
padding: .35em;
margin-left: 7em;
margin-top: .67em;
_margin-top: 0.5em;
font-weight: bold;
font-size: 100%;
margin-bottom: 0;
}

h1 {
clear: left;
font-size: 110%;
font-family: Verdana, sans-serif;
}


body.denied {
background-color: black;
color: white;
}

body.denied h1 {
color: red;
}

body.denied a {
color: green;
}

body.denied #footer, body.denied #diags {
color: black;
}

#searchme:focus {
background-color: #ffa;
}

.errurl {
letter-spacing: 0;
margin: 0 1em;
padding: 0.25em;
background-color: #fff0f0;
color: #c00;
font-family: "Courier New", Courier, monospace;
font-size: 90%;
_font-size: 80%;
}

body.denied .errurl {
background-color: black;
color: yellow;
}

span.x {
display: none;
}

</style>

<!--[if IE]>
<script type="text/javascript">
/* <![CDATA[ */
_isIE=1;
/* ]]> */
</script>
<![endif]-->

<script type="text/javascript">
/* <![CDATA[ */
addEvent = function(obj, type, fn, b) {
    if (obj.attachEvent) {
        var name = "" + type + fn; 
        name = name.substring(0, name.indexOf("\n"));
        obj["e" + name] = fn;
        obj[name] = function(){ obj["e" + name](window.event);}
        obj.attachEvent("on" + type, obj[name]);
    } else {
        obj.addEventListener(type, fn, b);
        return true;
    }
}

fixlink = function() {
   var ie = typeof(_isIE) != 'undefined';
   var v = document.getElementById("mlink");

   if (v) {
      var ieHACK = v.innerHTML;
      var newText;

      newText = "%3E%20REQUEST_URI%3D" + document.REQUEST_URI + "%0D" +
                "%3E%20HTTP_HOST%3D" + document.HTTP_HOST + "%0D" +
                "%3E%20REMOTE_ADDR%3D" + document.REMOTE_ADDR + "%0D" +
                "%3E%20REQUEST_METHOD%3D" + document.REQUEST_METHOD + "%0D";

      var href = v.getAttribute("href");
      newText = newText.replace(/'/g, "%27");
      newText = newText.replace(/\?/g, "%3F");

      // IE bugfixes
      if (ie) {
          var m = /(.*)\?(.*)/.exec(href);
          if (m) {
             href = m[1] + "?" + escape(m[2]);
          }
          href = href.replace(/(.*)(%0D-----%0D.*)/m, "$1" + newText + "$2");
          href = href.replace(/subject%3D/, "subject=");
          href = href.replace(/%26body%3D/, "&body=");
          href=href.replace(/%0D/mg, "%0A");
      } else {
          href = href.replace(/(.*)(%0D-----%0D.*)/m, "$1" + newText + "$2");
      }
      v.setAttribute("href", href);
      v.innerHTML = ieHACK;  // I can't believe this...
   }  
   v = document.getElementById("searchme");
   if (v) { v.focus(); }
}


addEvent(window, "load", fixlink, false);
/* ]]> */
</script>


</head>

<body>

<div id='header'>
<a href="#mainContent" title="Skip to main content" />
<p class="ncbi"><a href="http://www.ncbi.nlm.nih.gov">NCBI</a></p>
<p class="message">Error</p>
</div>

<div id='mainContent'>
<h1>Temporarily Unavailable</h1>

<p class='errurl'>
<script type="text/javascript">
/* <![CDATA[ */
  document.REQUEST_URI = "/rest/pug/compound/inchikey/TWLBYQJSUUFFEB-HPOLAVBOSA-N/SDF%3frecord_type=3d";
  document.HTTP_HOST = "pubchem.ncbi.nlm.nih.gov";
  document.REMOTE_ADDR = "10.6.6.7";
  document.REQUEST_METHOD = "GET";

  var p = "http://" + document.HTTP_HOST + document.REQUEST_URI;
  p = p.replace(/(.)/g, "<span class=\"x\"> </span>$1");
  p = p.replace(/'/g, "'");
  document.write(p);
//  document.write(p.replace(/[^A-Za-z0-9\#\;\:\.\/\?&\=\_\- ]*/g, "<span class='x'> </span>"));
/* ]]> */
</script>
</p>

<p>The server is temporarily unable to service your request.
Please try again.  If you continue to receive this error, please contact
<a id='mlink'
href="mailto:info@ncbi.nlm.nih.gov?subject=NCBI%20Web%20site%20error%20803&body=%3E%20Error%3D803%0D%3E%20Server%3D10.6.6.7%0D%3E%20Client%3D10.6.6.7%0D%3E%20Time%3DWednesday, 24-Jun-2026 00:25:25 EDT%0D%0D-----%0DPlease%20enter%20comments%20below:%0D%0D">info@ncbi.nlm.nih.gov</a>. 
</p>


<form method="post" action="http://www.ncbi.nlm.nih.gov/gquery/gquery.fcgi"
     enctype="application/x-www-form-urlencoded">
<p>
<strong>Search NCBI</strong>
<input name="term" size="40" style="margin-left: 1em; border: solid 1px #336699;" id="searchme"/>
<input type="submit" value="Go" />
</p>
</form>


</div>

<dl id="diags">
   <dt>Error</dt><dd>803</dd>
   <dt>Server</dt><dd>10.6.6.7</dd>
   <dt>Client</dt><dd>10.6.6.7</dd>
   <dt>Time</dt><dd>Wednesday, 24-Jun-2026 00:25:25 EDT</dd>
</dl>

<p id='footer'>

<span id='rev'>Rev. 25 Feb 2026 18:02:15 EST</span>
<!-- <a href="http://validator.w3.org/check?uri=referer"><img src="http://www.w3.org/Icons/valid-xhtml11" alt="Valid XHTML 1.1!" /></a> -->
</p>
<p><a href="https://www.hhs.gov/vulnerability-disclosure-policy/index.html">HHS Vulnerability Disclosure</a></p>

</body>
</html>

M  END
$$$$

✍: FYIcenter.com

2025-09-24, 916👍, 0💬