Molecule FYI-1000042

A

Molecule Summary:

ID: FYI-1000042
SMILES: CC(=O)OC1CC2CCC1(C2(C)C)C

Received at FYIcenter.com on: 2020-04-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000042
FYIcenter.com

 34 35  0  0  0  0  0  0  0  0999 V2000
    3.9050   -0.8669   -0.2640 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7501    0.0611    0.0115 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9569    1.2244    0.2646 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4916   -0.4045   -0.0242 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4290    0.5459    0.2512 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0689    1.1929   -1.0614 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5722    0.7894   -1.1543 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2666    1.6079   -0.0232 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7687    0.9609    1.2894 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8203   -0.1875    0.8278 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5311   -0.6356   -0.4978 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9340   -1.1884   -0.2381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6760   -1.6147   -1.3048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5371   -1.2779    1.8631 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8413   -0.3137   -0.1903 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9028   -1.6763    0.4661 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8062   -1.2820   -1.2670 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7758    1.3120    0.9447 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0312    2.2772   -1.0125 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4840    0.7975   -1.9135 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0252    0.8635   -2.1429 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9635    2.6538   -0.0702 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3503    1.5215   -0.1022 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2208    1.6888    1.8878 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6076    0.5564    1.8558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5461   -0.4192    0.2328 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3880   -1.4859   -1.1833 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8672   -2.0538    0.4212 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4801   -2.5045   -0.7064 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2074   -1.8976   -2.2134 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2686   -1.1395   -1.5693 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4749   -1.7433    2.1665 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1182   -2.0317    1.4269 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0528   -0.8353    2.7336 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  5 10  1  0  0  0  0
 10 11  1  0  0  0  0
  7 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 10 14  1  0  0  0  0
  1 15  1  0  0  0  0
  1 16  1  0  0  0  0
  1 17  1  0  0  0  0
  5 18  1  0  0  0  0
  6 19  1  0  0  0  0
  6 20  1  0  0  0  0
  7 21  1  0  0  0  0
  8 22  1  0  0  0  0
  8 23  1  0  0  0  0
  9 24  1  0  0  0  0
  9 25  1  0  0  0  0
 12 26  1  0  0  0  0
 12 27  1  0  0  0  0
 12 28  1  0  0  0  0
 13 29  1  0  0  0  0
 13 30  1  0  0  0  0
 13 31  1  0  0  0  0
 14 32  1  0  0  0  0
 14 33  1  0  0  0  0
 14 34  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="482.59182344946" x2="448.45043815724" y1="234.3314203448" y2="261.76514235639" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="448.45043815724" x2="414.30905286501" y1="261.76514235639" y2="289.19886436798" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="411" x2="417" y1="290" y2="324.5" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="417" x2="423" y1="324.5" y2="359" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" />
<line x1="419" x2="425" y1="289" y2="323.5" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="425" x2="431" y1="323.5" y2="358" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" />
<line x1="414.30905286501" x2="377.10502360684" y1="289.19886436798" y2="275.43470384148" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="377.10502360684" x2="339.90099434867" y1="275.43470384148" y2="261.67054331497" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" />
<line x1="339.90099434867" x2="308.48820015738" y1="261.67054331497" y2="289.7664586165" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" />
<line x1="308.48820015738" x2="277.07540596609" y1="289.7664586165" y2="317.86237391802" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="277.07540596609" x2="262.35638636526" y1="317.86237391802" y2="336.98911760498" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="262.35638636526" x2="247.63736676443" y1="336.98911760498" y2="356.11586129194" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="247.63736676443" x2="203.19651083769" y1="356.11586129194" y2="344.18751341298" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="203.19651083769" x2="158.75565491094" y1="344.18751341298" y2="332.25916553402" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="158.75565491094" x2="138.22766292296" y1="332.25916553402" y2="356.45582659704" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="138.22766292296" x2="117.69967093497" y1="356.45582659704" y2="380.65248766006" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="117.69967093497" x2="132.4186905358" y1="380.65248766006" y2="361.5257439731" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="132.4186905358" x2="147.13771013663" y1="361.5257439731" y2="342.39900028614" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="147.13771013663" x2="175.17450103727" y1="342.39900028614" y2="308.4497692968" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="175.17450103727" x2="203.21129193791" y1="308.4497692968" y2="274.50053830746" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="277.07540596609" x2="240.143348952" y1="317.86237391802" y2="296.18145611274" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="240.143348952" x2="203.21129193791" y1="296.18145611274" y2="274.50053830746" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="203.21129193791" x2="182.19847986265" y1="274.50053830746" y2="261.25371628872" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="182.19847986265" x2="161.1856677874" y1="261.25371628872" y2="248.00689426998" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="158.75565491094" x2="159.97066134917" y1="332.25916553402" y2="290.133029902" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="159.97066134917" x2="161.1856677874" y1="290.133029902" y2="248.00689426998" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="161.1856677874" x2="119.71285678518" y1="248.00689426998" y2="231.6649098648" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="119.71285678518" x2="78.24004578296" y1="231.6649098648" y2="215.32292545962" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="161.1856677874" x2="186.46430538665" y1="248.00689426998" y2="219.06254381572" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="186.46430538665" x2="211.74294298591" y1="219.06254381572" y2="190.11819336147" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="203.21129193791" x2="211.58330710351" y1="274.50053830746" y2="242.26591494384" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<line x1="211.58330710351" x2="219.95532226912" y1="242.26591494384" y2="210.03129158023" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" />
<ellipse cx="426.53597896845" cy="357.97827991988" rx="20.06837411004" ry="20.06837411004" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="426.53597896845" y="374.95921185914"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:38.593027134692px">O</text>
<ellipse cx="339.90099434867" cy="261.67054331497" rx="20.06837411004" ry="20.06837411004" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.90099434867" y="278.65147525424"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:38.593027134692px">O</text>
</g></svg>

✍: FYIcetner.com

2020-04-21, 445👍, 0💬