Collections:
Molecule FYI-1000042
Molecule Summary:
ID: FYI-1000042
SMILES: CC(=O)OC1CC2CCC1(C2(C)C)C
Received at FYIcenter.com on: 2020-04-21
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000042 FYIcenter.com 34 35 0 0 0 0 0 0 0 0999 V2000 3.9050 -0.8669 -0.2640 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7501 0.0611 0.0115 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9569 1.2244 0.2646 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4916 -0.4045 -0.0242 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4290 0.5459 0.2512 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0689 1.1929 -1.0614 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5722 0.7894 -1.1543 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2666 1.6079 -0.0232 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7687 0.9609 1.2894 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8203 -0.1875 0.8278 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5311 -0.6356 -0.4978 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9340 -1.1884 -0.2381 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6760 -1.6147 -1.3048 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5371 -1.2779 1.8631 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8413 -0.3137 -0.1903 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9028 -1.6763 0.4661 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8062 -1.2820 -1.2670 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7758 1.3120 0.9447 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0312 2.2772 -1.0125 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4840 0.7975 -1.9135 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0252 0.8635 -2.1429 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9635 2.6538 -0.0702 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3503 1.5215 -0.1022 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2208 1.6888 1.8878 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6076 0.5564 1.8558 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5461 -0.4192 0.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3880 -1.4859 -1.1833 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8672 -2.0538 0.4212 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4801 -2.5045 -0.7064 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2074 -1.8976 -2.2134 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2686 -1.1395 -1.5693 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4749 -1.7433 2.1665 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1182 -2.0317 1.4269 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0528 -0.8353 2.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 5 10 1 0 0 0 0 10 11 1 0 0 0 0 7 11 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 0 0 0 0 10 14 1 0 0 0 0 1 15 1 0 0 0 0 1 16 1 0 0 0 0 1 17 1 0 0 0 0 5 18 1 0 0 0 0 6 19 1 0 0 0 0 6 20 1 0 0 0 0 7 21 1 0 0 0 0 8 22 1 0 0 0 0 8 23 1 0 0 0 0 9 24 1 0 0 0 0 9 25 1 0 0 0 0 12 26 1 0 0 0 0 12 27 1 0 0 0 0 12 28 1 0 0 0 0 13 29 1 0 0 0 0 13 30 1 0 0 0 0 13 31 1 0 0 0 0 14 32 1 0 0 0 0 14 33 1 0 0 0 0 14 34 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="482.59182344946" x2="448.45043815724" y1="234.3314203448" y2="261.76514235639" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="448.45043815724" x2="414.30905286501" y1="261.76514235639" y2="289.19886436798" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="411" x2="417" y1="290" y2="324.5" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="417" x2="423" y1="324.5" y2="359" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" /> <line x1="419" x2="425" y1="289" y2="323.5" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="425" x2="431" y1="323.5" y2="358" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" /> <line x1="414.30905286501" x2="377.10502360684" y1="289.19886436798" y2="275.43470384148" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="377.10502360684" x2="339.90099434867" y1="275.43470384148" y2="261.67054331497" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" /> <line x1="339.90099434867" x2="308.48820015738" y1="261.67054331497" y2="289.7664586165" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #ff0000" /> <line x1="308.48820015738" x2="277.07540596609" y1="289.7664586165" y2="317.86237391802" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="277.07540596609" x2="262.35638636526" y1="317.86237391802" y2="336.98911760498" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="262.35638636526" x2="247.63736676443" y1="336.98911760498" y2="356.11586129194" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="247.63736676443" x2="203.19651083769" y1="356.11586129194" y2="344.18751341298" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="203.19651083769" x2="158.75565491094" y1="344.18751341298" y2="332.25916553402" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="158.75565491094" x2="138.22766292296" y1="332.25916553402" y2="356.45582659704" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="138.22766292296" x2="117.69967093497" y1="356.45582659704" y2="380.65248766006" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="117.69967093497" x2="132.4186905358" y1="380.65248766006" y2="361.5257439731" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="132.4186905358" x2="147.13771013663" y1="361.5257439731" y2="342.39900028614" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="147.13771013663" x2="175.17450103727" y1="342.39900028614" y2="308.4497692968" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="175.17450103727" x2="203.21129193791" y1="308.4497692968" y2="274.50053830746" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="277.07540596609" x2="240.143348952" y1="317.86237391802" y2="296.18145611274" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="240.143348952" x2="203.21129193791" y1="296.18145611274" y2="274.50053830746" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="203.21129193791" x2="182.19847986265" y1="274.50053830746" y2="261.25371628872" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="182.19847986265" x2="161.1856677874" y1="261.25371628872" y2="248.00689426998" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="158.75565491094" x2="159.97066134917" y1="332.25916553402" y2="290.133029902" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="159.97066134917" x2="161.1856677874" y1="290.133029902" y2="248.00689426998" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="161.1856677874" x2="119.71285678518" y1="248.00689426998" y2="231.6649098648" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="119.71285678518" x2="78.24004578296" y1="231.6649098648" y2="215.32292545962" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="161.1856677874" x2="186.46430538665" y1="248.00689426998" y2="219.06254381572" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="186.46430538665" x2="211.74294298591" y1="219.06254381572" y2="190.11819336147" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="203.21129193791" x2="211.58330710351" y1="274.50053830746" y2="242.26591494384" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <line x1="211.58330710351" x2="219.95532226912" y1="242.26591494384" y2="210.03129158023" style="stroke-opacity:1; stroke-width: 3.0874421707754; stroke: #000000" /> <ellipse cx="426.53597896845" cy="357.97827991988" rx="20.06837411004" ry="20.06837411004" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="426.53597896845" y="374.95921185914" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:38.593027134692px">O</text> <ellipse cx="339.90099434867" cy="261.67054331497" rx="20.06837411004" ry="20.06837411004" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.90099434867" y="278.65147525424" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:38.593027134692px">O</text> </g></svg>
✍: FYIcetner.com
2020-04-21, 533👍, 0💬
Popular Posts:
What is cactus.nci.nih.gov/trans lateSDF translator? pubcactus.nci.nih.gov/tr anslateSDF translator ...
How to create and edit a molecule structure with JSME molecule editor? To help you to create and edi...
What Are Valence Electrons of an Atom? Valence Electrons of an Atom are electrons located on the mos...
Where to find FAQ (Frequently Asked Questions) on JSME, Molecule Editor in JavaScript? I want to lea...
How to create a molecule structure with custom atom positions? You can create a molecule structure w...