Molecule FYI-1000386

A

Molecule Summary:

ID: FYI-1000386
SMILES: CCOC(=O)C2CC[NH+](Cc1ccccc1)CC2=O

Received at FYIcenter.com on: 2021-04-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000386
FYIcenter.com

 19 20  0  0  0  0  0  0  0  0999 V2000
    3.6373    5.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    7.2944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    5.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.4944    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
    2.3849    3.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4946    2.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3102    0.8536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4199    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7140    0.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8983    1.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7886    2.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.2944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    8.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3824    9.7157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0967    9.1371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7748    9.8608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4894   11.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  1  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
  8 13  1  0  0  0  0
  8  9  2  0  0  0  0
  4 14  2  0  0  0  0
  3 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 17  2  0  0  0  0
 16 18  1  0  0  0  0
 18 19  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="320.84136947798" x2="320.84136947798" y1="274.85158339961" y2="306.22404381462" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="320.84136947798" x2="320.84136947798" y1="306.22404381462" y2="337.59650422963" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="320.84136947798" x2="293.67281875859" y1="337.59650422963" y2="353.28273443713" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="293.67281875859" x2="266.50426803919" y1="353.28273443713" y2="368.96896464464" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="266.50426803919" x2="239.33347642976" y1="368.96896464464" y2="353.28273443713" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="239.33347642976" x2="212.16268482033" y1="353.28273443713" y2="337.59650422963" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="212.16268482033" x2="212.16268482033" y1="337.59650422963" y2="306.22404381462" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="212.16268482033" x2="212.16268482033" y1="306.22404381462" y2="274.85158339961" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="212.16268482033" x2="239.33347642976" y1="274.85158339961" y2="259.1653531921" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="239.33347642976" x2="266.50426803919" y1="259.1653531921" y2="243.4791229846" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #0000ff" />
<line x1="266.50426803919" x2="293.67281875859" y1="243.4791229846" y2="259.1653531921" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #0000ff" />
<line x1="293.67281875859" x2="320.84136947798" y1="259.1653531921" y2="274.85158339961" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="266.50426803919" x2="265.60791202733" y1="243.4791229846" y2="212.11786701974" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #0000ff" />
<line x1="265.60791202733" x2="264.71155601547" y1="212.11786701974" y2="180.75661105488" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="264.71155601547" x2="289.57871267443" y1="180.75661105488" y2="161.63061465187" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="289.57871267443" x2="314.44586933338" y1="161.63061465187" y2="142.50461824886" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="306.18146690406" x2="331.04862356301" y1="80.306474586075" y2="61.178237293037" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="331.04862356301" x2="355.91578022197" y1="61.178237293037" y2="42.05" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="355" x2="384" y1="46" y2="58" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="384" x2="413" y1="58" y2="70" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="358" x2="387" y1="39" y2="51" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="387" x2="416" y1="51" y2="63" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="413.9144959692" x2="418.04445629383" y1="65.991669076712" y2="97.092981798135" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="418.04445629383" x2="422.17441661847" y1="97.092981798135" y2="128.19429451956" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="421" x2="396" y1="126" y2="145" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="396" x2="371" y1="145" y2="164" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="425" x2="400" y1="131" y2="150.5" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="400" x2="375" y1="150.5" y2="170" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="314.44586933338" x2="343.44298631697" y1="142.50461824886" y2="154.47545278722" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="343.44298631697" x2="372.44010330056" y1="154.47545278722" y2="166.44628732557" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="318" x2="314" y1="143" y2="111.5" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="314" x2="310" y1="111.5" y2="80" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="312" x2="307.5" y1="143" y2="112" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="307.5" x2="303" y1="112" y2="81" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="211" x2="184" y1="335" y2="351" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="184" x2="157" y1="351" y2="367" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #ff0000" />
<line x1="214" x2="187" y1="341" y2="356.5" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="187" x2="160" y1="356.5" y2="372" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #ff0000" />
<line x1="266.50426803919" x2="266.50426803919" y1="368.96896464464" y2="400.34142505965" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="266.50426803919" x2="266.50426803919" y1="400.34142505965" y2="431.71388547466" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="266.50426803919" x2="287.96079007302" y1="431.71388547466" y2="454.60009534741" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="287.96079007302" x2="309.41731210686" y1="454.60009534741" y2="477.48630522016" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #ff0000" />
<line x1="266" x2="236" y1="429" y2="439" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="236" x2="206" y1="439" y2="449" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #ff0000" />
<line x1="268" x2="238.5" y1="435" y2="445" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="238.5" x2="209" y1="445" y2="455" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #ff0000" />
<line x1="309.41731210686" x2="340.61946487962" y1="477.48630522016" y2="480.73783665317" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #ff0000" />
<line x1="340.61946487962" x2="371.82161765238" y1="480.73783665317" y2="483.98936808618" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="371.82161765238" x2="387.83501780421" y1="483.98936808618" y2="510.96968404309" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<line x1="387.83501780421" x2="403.84841795604" y1="510.96968404309" y2="537.95" style="stroke-opacity:1; stroke-width: 2.6419066482184; stroke: #000000" />
<ellipse cx="266.50426803919" cy="243.4791229846" rx="17.17239321342" ry="17.17239321342" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="266.50426803919" y="258.0096095498"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.02383310273px">N<tspan baseline-shift='super' font-size='16.511916551365'>+</tspan></text>
<ellipse cx="157.82558338153" cy="368.96896464464" rx="17.17239321342" ry="17.17239321342" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="157.82558338153" y="383.49945120984"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.02383310273px">O</text>
<ellipse cx="309.41731210686" cy="477.48630522016" rx="17.17239321342" ry="17.17239321342" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="309.41731210686" y="492.01679178536"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.02383310273px">O</text>
<ellipse cx="206.97726529174" cy="451.55472579712" rx="17.17239321342" ry="17.17239321342" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="206.97726529174" y="466.08521236232"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.02383310273px">O</text>
</g></svg>

✍: FYIcenter.com

2021-10-10, 184👍, 0💬