Molecule FYI-1000995

A

Molecule Summary:

ID: FYI-1000995
SMILES: Cc1cccc(-c2ccccc2-c2ccc3ncc(C(=O)O)n3c2)n1

Received at FYIcenter.com on: 2021-09-14

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000995
FYIcenter.com

 25 28  0  0  0  0  0  0  0  0999 V2000
    0.0000    5.9081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3694    5.6170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3062    6.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6756    6.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1083    5.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1715    3.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6041    2.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6673    1.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0999    0.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4693    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4061    1.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9735    2.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9103    3.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4777    4.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4144    5.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7838    5.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9164    6.3160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0490    5.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6164    4.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4394    3.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8317    3.1753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8699    1.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2164    4.1617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2796    3.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8020    4.2855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 12  7  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 20  1  0  0  0  0
 23 19  1  0  0  0  0
 23 16  1  0  0  0  0
 24 23  1  0  0  0  0
 24 13  2  0  0  0  0
 25  6  2  0  0  0  0
 25  2  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="99.445425847511" x2="70.747712923756" y1="385.90912294936" y2="392.00953497807" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="70.747712923756" x2="42.05" y1="392.00953497807" y2="398.10994700677" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="142" x2="122" y1="428" y2="406" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="122" x2="102" y1="406" y2="384" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="137" x2="117.5" y1="432" y2="410" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="117.5" x2="98" y1="410" y2="388" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="196.10478840741" x2="167.40707548366" y1="417.31859580618" y2="423.41691219351" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="167.40707548366" x2="138.7093625599" y1="423.41691219351" y2="429.51522858085" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="212" x2="203" y1="361" y2="389" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="203" x2="194" y1="389" y2="417" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="218" x2="209" y1="363" y2="391" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="209" x2="200" y1="391" y2="419" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="174.97653211288" x2="194.60850046908" y1="317.90556048581" y2="339.70861330155" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="194.60850046908" x2="214.24046882527" y1="339.70861330155" y2="361.5116661173" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="193.108021248" x2="184.04227668044" y1="262.09863079693" y2="290.00209564137" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="184.04227668044" x2="174.97653211288" y1="290.00209564137" y2="317.90556048581" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="152" x2="171.5" y1="221" y2="243" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="171.5" x2="191" y1="243" y2="265" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="157" x2="176.5" y1="217" y2="239" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="176.5" x2="196" y1="239" y2="261" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="171.97557367073" x2="162.90982910317" y1="162.68559547656" y2="190.58696467963" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="162.90982910317" x2="153.84408453561" y1="190.58696467963" y2="218.4883338827" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="229" x2="200.5" y1="148" y2="154" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="200.5" x2="172" y1="154" y2="160" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="231" x2="202" y1="154" y2="160" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="202" x2="173" y1="160" y2="166" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="268.63493623063" x2="249.00296787444" y1="194.09087705064" y2="172.28782423489" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="249.00296787444" x2="229.37099951824" y1="172.28782423489" y2="150.48477141915" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="254" x2="263" y1="251" y2="223.5" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="263" x2="272" y1="223.5" y2="196" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="248" x2="257" y1="249" y2="221.5" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="257" x2="266" y1="221.5" y2="194" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="250.50344709551" x2="221.80573417176" y1="249.89780673952" y2="255.99821876822" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="221.80573417176" x2="193.108021248" y1="255.99821876822" y2="262.09863079693" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="289.76738380791" x2="270.13541545171" y1="293.503912371" y2="271.70085955526" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="270.13541545171" x2="250.50344709551" y1="271.70085955526" y2="249.89780673952" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="271.63589467279" x2="280.70163924035" y1="349.31084205989" y2="321.40737721545" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="280.70163924035" x2="289.76738380791" y1="321.40737721545" y2="293.503912371" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="314" x2="294" y1="391" y2="369.5" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="294" x2="274" y1="369.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="309" x2="289.5" y1="395" y2="373.5" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="289.5" x2="270" y1="373.5" y2="352" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="368.29106594995" x2="339.59335302619" y1="380.71612363397" y2="386.81653566267" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="339.59335302619" x2="310.89564010244" y1="386.81653566267" y2="392.91694769137" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="418" x2="394.5" y1="413" y2="396" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="394.5" x2="371" y1="396" y2="379" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="414" x2="390.5" y1="418" y2="401" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="390.5" x2="367" y1="401" y2="384" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="463.23200258627" x2="439.49676842719" y1="380.71612363397" y2="397.96115646948" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="439.49676842719" x2="415.76153426811" y1="397.96115646948" y2="415.206189305" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="443" x2="452" y1="326" y2="354" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="452" x2="461" y1="354" y2="382" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="449" x2="458" y1="324" y2="352" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="458" x2="467" y1="352" y2="380" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="479.59477040493" x2="462.34764192804" y1="277.43872562692" y2="301.17605542737" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="462.34764192804" x2="445.10051345115" y1="301.17605542737" y2="324.91338522782" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="539" x2="509.5" y1="281" y2="278" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #ff0000" />
<line x1="509.5" x2="480" y1="278" y2="275" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="538" x2="509" y1="287" y2="284" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #ff0000" />
<line x1="509" x2="480" y1="284" y2="281" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="455.72541519815" x2="467.66009280154" y1="223.83221937676" y2="250.63547250184" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #ff0000" />
<line x1="467.66009280154" x2="479.59477040493" y1="250.63547250184" y2="277.43872562692" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="386.42255508507" x2="415.76153426811" y1="324.91338522782" y2="324.91338522782" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="415.76153426811" x2="445.10051345115" y1="324.91338522782" y2="324.91338522782" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="386.42255508507" x2="377.35681051751" y1="324.91338522782" y2="352.81475443089" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="377.35681051751" x2="368.29106594995" y1="352.81475443089" y2="380.71612363397" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="347.15861837268" x2="366.79058672887" y1="281.3030883136" y2="303.10823677071" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="366.79058672887" x2="386.42255508507" y1="303.10823677071" y2="324.91338522782" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="347" x2="318.5" y1="279" y2="285" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="318.5" x2="290" y1="285" y2="291" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="348" x2="319.5" y1="285" y2="291" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="319.5" x2="291" y1="291" y2="297" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="119" x2="147.5" y1="334" y2="327.5" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="147.5" x2="176" y1="327.5" y2="321" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="117" x2="146" y1="328" y2="321.5" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="146" x2="175" y1="321.5" y2="315" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<line x1="117.57691498263" x2="108.51117041507" y1="330.10219326048" y2="358.00565810492" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #0000ff" />
<line x1="108.51117041507" x2="99.445425847511" y1="358.00565810492" y2="385.90912294936" style="stroke-opacity:1; stroke-width: 2.4706483153162; stroke: #000000" />
<ellipse cx="415.76153426811" cy="415.206189305" rx="16.059214049555" ry="16.059214049555" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="415.76153426811" y="428.79475503924"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.883103941452px">N</text>
<ellipse cx="537.95" cy="283.57057227617" rx="16.059214049555" ry="16.059214049555" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="297.15913801041"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.883103941452px">O</text>
<ellipse cx="455.72541519815" cy="223.83221937676" rx="16.059214049555" ry="16.059214049555" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="455.72541519815" y="237.420785111"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.883103941452px">O</text>
<ellipse cx="386.42255508507" cy="324.91338522782" rx="16.059214049555" ry="16.059214049555" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="386.42255508507" y="338.50195096206"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.883103941452px">N</text>
<ellipse cx="117.57691498263" cy="330.10219326048" rx="16.059214049555" ry="16.059214049555" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="117.57691498263" y="343.69075899472"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.883103941452px">N</text>
</g></svg>

✍: FYIcenter.com

2021-12-28, 186👍, 0💬