Molecule FYI-1000274

A

Molecule Summary:

ID: FYI-1000274
SMILES: N[C@@H](CCCCNOC(=O)[C@@H](N)CCC(=O)O)C(=O)O

Received at FYIcenter.com on: 2021-02-27

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000274
FYIcenter.com

 20 19  0  0  1  0  0  0  0  0999 V2000
    2.4249    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 11 12  1  6  0  0  0
 13 11  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 18  2  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 113,280 120,239 107,239" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="148.31407703501" x2="130.60388444748" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="130.60388444748" x2="112.89369185995" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="183.73446221007" x2="166.02426962254" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="166.02426962254" x2="148.31407703501" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="219.15484738513" x2="201.4446547976" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="201.4446547976" x2="183.73446221007" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="254.58107557985" x2="236.86796148249" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="236.86796148249" x2="219.15484738513" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="290.00146075491" x2="272.29126816738" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #0000ff" />
<line x1="272.29126816738" x2="254.58107557985" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="325.42184592998" x2="307.71165334245" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="307.71165334245" x2="290.00146075491" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #0000ff" />
<line x1="360.84223110504" x2="343.13203851751" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="343.13203851751" x2="325.42184592998" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="363" x2="363" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="363" x2="363" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="359" x2="359" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="359" x2="359" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="396.26553778993" x2="378.55388444748" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="378.55388444748" x2="360.84223110504" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<polygon points=" 397,280 403,239 391,239" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="431.68592296499" x2="413.97573037746" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="413.97573037746" x2="396.26553778993" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="467.10630814005" x2="449.39611555252" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="449.39611555252" x2="431.68592296499" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="502.52669331511" x2="484.81650072758" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="484.81650072758" x2="467.10630814005" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="537" x2="519.5" y1="278" y2="288.5" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="519.5" x2="502" y1="288.5" y2="299" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="540" x2="522" y1="282" y2="292.5" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="522" x2="504" y1="292.5" y2="303" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="502.52669331511" x2="502.52669331511" y1="341.12642201943" y2="320.67585321166" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="502.52669331511" x2="502.52669331511" y1="320.67585321166" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="77.470385175061" x2="95.182038517506" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="95.182038517506" x2="112.89369185995" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="80" x2="80" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="80" x2="80" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="76" x2="76" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="76" x2="76" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<line x1="42.05" x2="59.76019258753" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #ff0000" />
<line x1="59.76019258753" x2="77.470385175061" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221626222913; stroke: #000000" />
<ellipse cx="112.89369185995" cy="238.87357798057" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="112.89369185995" y="248.34547240317"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">N</text>
<ellipse cx="290.00146075491" cy="300.22528440389" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00146075491" y="309.69717882649"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">N</text>
<ellipse cx="325.42184592998" cy="279.77471559611" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.42184592998" y="289.24661001872"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">O</text>
<ellipse cx="360.84223110504" cy="341.12642201943" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.84223110504" y="350.59831644203"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">O</text>
<ellipse cx="396.26553778993" cy="238.87357798057" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="396.26553778993" y="248.34547240317"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">N</text>
<ellipse cx="537.95" cy="279.77471559611" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="289.24661001872"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">O</text>
<ellipse cx="502.52669331511" cy="341.12642201943" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="502.52669331511" y="350.59831644203"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">O</text>
<ellipse cx="77.470385175061" cy="341.12642201943" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="77.470385175061" y="350.59831644203"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">O</text>
<ellipse cx="42.05" cy="279.77471559611" rx="11.194057044893" ry="11.194057044893" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="289.24661001872"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.527032778641px">O</text>
</g></svg>

✍: FYIcenter.com

2021-04-15, 197👍, 0💬