Molecule FYI-1000302

A

Molecule Summary:

ID: FYI-1000302
SMILES: O=C(OCC(CN=[N+]=[N-])(CN=[N+]=[N-])COC(CCC)=O)CCC

Received at FYIcenter.com on: 2021-03-29

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000302
FYIcenter.com

 23 22  0  0  0  0  0  0  0  0999 V2000
    3.6373    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    1.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    1.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  3  0  0  0  0
 10  5  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  3  0  0  0  0
 14  5  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 16  2  0  0  0  0
 21  2  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="164" x2="164" y1="362" y2="386" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="164" x2="164" y1="386" y2="410" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="169" x2="169" y1="362" y2="386" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="169" x2="169" y1="386" y2="410" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="207.34886385506" x2="186.68693192753" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="186.68693192753" x2="166.025" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="248.67272771011" x2="228.01079578259" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="228.01079578259" x2="207.34886385506" y1="349.64760949056" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="290.00340843483" x2="269.33806807247" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="269.33806807247" x2="248.67272771011" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="290.00340843483" x2="290.00340843483" y1="290" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="290.00340843483" x2="290.00340843483" y1="313.85904379622" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="248.67272771011" x2="269.33806807247" y1="266.14095620378" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="269.33806807247" x2="290.00340843483" y1="278.07047810189" y2="290" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="247" x2="247" y1="219" y2="243" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="247" x2="247" y1="243" y2="267" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="252" x2="252" y1="219" y2="243" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="252" x2="252" y1="243" y2="267" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="244" x2="244" y1="171" y2="195" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="244" x2="244" y1="195" y2="219" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="254" x2="254" y1="171" y2="195" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="254" x2="254" y1="195" y2="219" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="248.67272771011" x2="248.67272771011" y1="170.70478101889" y2="194.56382481511" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="248.67272771011" x2="248.67272771011" y1="194.56382481511" y2="218.42286861133" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="331.32727228989" x2="310.66534036236" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="310.66534036236" x2="290.00340843483" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="331.32727228989" x2="331.32727228989" y1="266.14095620378" y2="290" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="331.32727228989" x2="331.32727228989" y1="290" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="372" x2="351.5" y1="241" y2="252.5" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="351.5" x2="331" y1="252.5" y2="264" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="374" x2="353.5" y1="245" y2="257" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="353.5" x2="333" y1="257" y2="269" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="412" x2="391.5" y1="215" y2="226.5" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="391.5" x2="371" y1="226.5" y2="238" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="417" x2="396.5" y1="223" y2="235" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="396.5" x2="376" y1="235" y2="247" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="413.975" x2="393.31306807247" y1="218.42286861133" y2="230.35239050944" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="393.31306807247" x2="372.65113614494" y1="230.35239050944" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #0000ff" />
<line x1="331.32727228989" x2="310.66534036236" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="310.66534036236" x2="290.00340843483" y1="349.64760949056" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="372.65113614494" x2="351.98920421741" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="351.98920421741" x2="331.32727228989" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="413.975" x2="393.31306807247" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="393.31306807247" x2="372.65113614494" y1="349.64760949056" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="455.30227228989" x2="434.63863614494" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="434.63863614494" x2="413.975" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="496.62613614494" x2="475.96420421741" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="475.96420421741" x2="455.30227228989" y1="349.64760949056" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="537.95" x2="517.28806807247" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="517.28806807247" x2="496.62613614494" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="417" x2="417" y1="410" y2="386" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="417" x2="417" y1="386" y2="362" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="412" x2="412" y1="410" y2="386" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #ff0000" />
<line x1="412" x2="412" y1="386" y2="362" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="124.70113614494" x2="145.36306807247" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="145.36306807247" x2="166.025" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="83.373863855057" x2="104.0375" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="104.0375" x2="124.70113614494" y1="349.64760949056" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="42.05" x2="62.711931927529" y1="337.71808759244" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<line x1="62.711931927529" x2="83.373863855057" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.009192567999; stroke: #000000" />
<ellipse cx="166.025" cy="409.29521898111" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.025" y="420.34577810511"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">O</text>
<ellipse cx="207.34886385506" cy="337.71808759244" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.34886385506" y="348.76864671644"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">O</text>
<ellipse cx="248.67272771011" cy="266.14095620378" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67272771011" y="277.19151532777"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">N</text>
<ellipse cx="248.67272771011" cy="218.42286861133" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67272771011" y="229.47342773533"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">N</text>
<ellipse cx="248.67272771011" cy="170.70478101889" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67272771011" y="181.75534014288"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">N</text>
<ellipse cx="331.32727228989" cy="266.14095620378" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.32727228989" y="277.19151532777"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">N</text>
<ellipse cx="372.65113614494" cy="242.28191240756" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65113614494" y="253.33247153155"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">N</text>
<ellipse cx="413.975" cy="218.42286861133" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.975" y="229.47342773533"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">N</text>
<ellipse cx="372.65113614494" cy="337.71808759244" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65113614494" y="348.76864671644"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">O</text>
<ellipse cx="413.975" cy="409.29521898111" rx="13.059751691994" ry="13.059751691994" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.975" y="420.34577810511"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114907099988px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-31, 145👍, 0💬