Molecule FYI-1000208


Molecule Summary:

ID: FYI-1000208
SMILES: Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5

Received at on: 2020-12-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 37 41  0  0  0  0  0  0  0  0999 V2000
   23.0363    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8238    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8238    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9740    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9740    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    0.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 12  7  1  0  0  0  0
 13 10  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 25 20  1  0  0  0  0
 26 22  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  2  0  0  0  0
 30 29  1  0  0  0  0
 31 30  2  0  0  0  0
 31 26  1  0  0  0  0
 32 18  2  0  0  0  0
 33 32  1  0  0  0  0
 34 32  1  0  0  0  0
 35 34  2  0  0  0  0
 35 16  1  0  0  0  0
 36  5  1  0  0  0  0
 37 36  1  0  0  0  0
 37  2  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="511.84864040666" x2="524.89932020333" y1="297.53441307849" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="524.89932020333" x2="537.95" y1="290" y2="282.46558692151" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="511.84864040666" x2="511.84864040666" y1="327.67206539245" y2="312.60323923547" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="511.84864040666" x2="511.84864040666" y1="312.60323923547" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="485.74943350278" x2="498.79903695472" y1="342.74089154942" y2="335.20647847093" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="498.79903695472" x2="511.84864040666" y1="335.20647847093" y2="327.67206539245" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="459.65022659889" x2="472.69983005083" y1="327.67206539245" y2="335.20647847093" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="472.69983005083" x2="485.74943350278" y1="335.20647847093" y2="342.74089154942" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="433.551019695" x2="446.60062314695" y1="342.74089154942" y2="335.20647847093" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="446.60062314695" x2="459.65022659889" y1="335.20647847093" y2="327.67206539245" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="407.44750741221" x2="420.49926355361" y1="327.67206539245" y2="335.20647847093" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="420.49926355361" x2="433.551019695" y1="335.20647847093" y2="342.74089154942" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="383" x2="396" y1="345" y2="337.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="396" x2="409" y1="337.5" y2="330" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="381" x2="394" y1="342" y2="334.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="394" x2="407" y1="334.5" y2="327" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="355.24909360444" x2="368.29869705638" y1="327.67206539245" y2="335.20647847093" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="368.29869705638" x2="381.34830050833" y1="335.20647847093" y2="342.74089154942" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="354" x2="354" y1="298" y2="313" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="354" x2="354" y1="313" y2="328" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="357" x2="357" y1="298" y2="313" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="357" x2="357" y1="313" y2="328" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="381.34830050833" x2="368.29869705638" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="368.29869705638" x2="355.24909360444" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="409" x2="396" y1="297" y2="289.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="396" x2="383" y1="289.5" y2="282" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="407" x2="394" y1="299" y2="291.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="394" x2="381" y1="291.5" y2="284" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="407.44750741221" x2="407.44750741221" y1="297.53441307849" y2="312.60323923547" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="407.44750741221" x2="407.44750741221" y1="312.60323923547" y2="327.67206539245" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="329.14988670056" x2="342.1994901525" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="342.1994901525" x2="355.24909360444" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="328" x2="328" y1="253" y2="268" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #ff0000" />
<line x1="328" x2="328" y1="268" y2="283" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="331" x2="331" y1="253" y2="268" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #ff0000" />
<line x1="331" x2="331" y1="268" y2="283" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="303.04852710722" x2="316.09920690389" y1="297.53441307849" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="316.09920690389" x2="329.14988670056" y1="290" y2="282.46558692151" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="276.94932020333" x2="289.99892365527" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="289.99892365527" x2="303.04852710722" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="252" x2="265" y1="299" y2="291.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="265" x2="278" y1="291.5" y2="284" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="251" x2="264" y1="297" y2="289.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="264" x2="277" y1="289.5" y2="282" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="224.74875370611" x2="237.79943350278" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="237.79943350278" x2="250.85011329944" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="198.64739411277" x2="211.69807390944" y1="297.53441307849" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="211.69807390944" x2="224.74875370611" y1="290" y2="282.46558692151" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="172.54818720888" x2="185.59779066083" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="185.59779066083" x2="198.64739411277" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="148" x2="161" y1="299" y2="291.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="161" x2="174" y1="291.5" y2="284" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="146" x2="159" y1="297" y2="289.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="159" x2="172" y1="289.5" y2="282" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="120.34762071166" x2="133.39830050833" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="133.39830050833" x2="146.448980305" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="119" x2="119" y1="253" y2="268" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="119" x2="119" y1="268" y2="283" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="122" x2="122" y1="253" y2="268" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="122" x2="122" y1="268" y2="283" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="146.448980305" x2="133.39830050833" y1="237.25910845058" y2="244.79352152906" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="133.39830050833" x2="120.34762071166" y1="244.79352152906" y2="252.32793460755" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="174" x2="161" y1="251" y2="243.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="161" x2="148" y1="243.5" y2="236" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="172" x2="159" y1="254" y2="246.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="159" x2="146" y1="246.5" y2="239" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="172.54818720888" x2="172.54818720888" y1="252.32793460755" y2="267.39676076453" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="172.54818720888" x2="172.54818720888" y1="267.39676076453" y2="282.46558692151" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="94.248413807773" x2="107.29801725972" y1="297.53441307849" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="107.29801725972" x2="120.34762071166" y1="290" y2="282.46558692151" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="96" x2="96" y1="328" y2="313" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="96" x2="96" y1="313" y2="298" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="93" x2="93" y1="328" y2="313" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="93" x2="93" y1="313" y2="298" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="68.149206903886" x2="81.19881035583" y1="342.74089154942" y2="335.20647847093" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="81.19881035583" x2="94.248413807773" y1="335.20647847093" y2="327.67206539245" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="42" x2="55" y1="330" y2="337.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="55" x2="68" y1="337.5" y2="345" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="43" x2="56" y1="327" y2="334.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="56" x2="69" y1="334.5" y2="342" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="297.53441307849" y2="312.60323923547" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="42.05" x2="42.05" y1="312.60323923547" y2="327.67206539245" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="68" x2="55" y1="282" y2="289.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="55" x2="42" y1="289.5" y2="297" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="69" x2="56" y1="284" y2="291.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="56" x2="43" y1="291.5" y2="299" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="68.149206903886" x2="81.19881035583" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="81.19881035583" x2="94.248413807773" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="224" x2="224" y1="253" y2="268" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="224" x2="224" y1="268" y2="283" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="227" x2="227" y1="253" y2="268" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="227" x2="227" y1="268" y2="283" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="198.64739411277" x2="211.69807390944" y1="237.25910845058" y2="244.79352152906" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="211.69807390944" x2="224.74875370611" y1="244.79352152906" y2="252.32793460755" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="250.85011329944" x2="237.79943350278" y1="237.25910845058" y2="244.79352152906" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="237.79943350278" x2="224.74875370611" y1="244.79352152906" y2="252.32793460755" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="278" x2="265" y1="251" y2="243.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="265" x2="252" y1="243.5" y2="236" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="277" x2="264" y1="254" y2="246.5" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="264" x2="251" y1="246.5" y2="239" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="276.94932020333" x2="276.94932020333" y1="252.32793460755" y2="267.39676076453" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="276.94932020333" x2="276.94932020333" y1="267.39676076453" y2="282.46558692151" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="459.65022659889" x2="459.65022659889" y1="297.53441307849" y2="312.60323923547" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="459.65022659889" x2="459.65022659889" y1="312.60323923547" y2="327.67206539245" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<line x1="485.74943350278" x2="472.69983005083" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="472.69983005083" x2="459.65022659889" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="485.74943350278" x2="498.79903695472" y1="282.46558692151" y2="290" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #000000" />
<line x1="498.79903695472" x2="511.84864040666" y1="290" y2="297.53441307849" style="stroke-opacity:1; stroke-width: 1.2689524678379; stroke: #0000ff" />
<ellipse cx="511.84864040666" cy="297.53441307849" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="511.84864040666" y="304.5136516516"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>
<ellipse cx="459.65022659889" cy="327.67206539245" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="459.65022659889" y="334.65130396555"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>
<ellipse cx="329.14988670056" cy="252.32793460755" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="329.14988670056" y="259.30717318066"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">O</text>
<ellipse cx="303.04852710722" cy="297.53441307849" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="303.04852710722" y="304.5136516516"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>
<ellipse cx="198.64739411277" cy="297.53441307849" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.64739411277" y="304.5136516516"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>
<ellipse cx="146.448980305" cy="297.53441307849" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="146.448980305" y="304.5136516516"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>
<ellipse cx="172.54818720888" cy="252.32793460755" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.54818720888" y="259.30717318066"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>
<ellipse cx="42.05" cy="297.53441307849" rx="8.2481910409463" ry="8.2481910409463" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="304.5136516516"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.861905847974px">N</text>


2021-07-25, 339👍, 0💬