Molecule FYI-1000210


Molecule Summary:

ID: FYI-1000210
SMILES: CC1=CN(C=N1)C2=CC(=CC(NC(=O)C3=CC=C(C)C(NC4=NC=CC(=N4)C5=CC=CN=C5)=C3)=C2)C(F)(F)F

Received at on: 2020-12-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 39 43  0  0  0  0  0  0  0  0999 V2000
   14.5201    5.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1277    5.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1910    6.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0584    4.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4277    4.6167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0871   10.5000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   11.9000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.8871   10.5000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  2  1  0  0  0  0
  7  4  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 27 22  1  0  0  0  0
 28 26  1  0  0  0  0
 29 28  2  0  0  0  0
 30 29  1  0  0  0  0
 31 30  2  0  0  0  0
 32 31  1  0  0  0  0
 33 32  2  0  0  0  0
 33 28  1  0  0  0  0
 34 20  2  0  0  0  0
 34 15  1  0  0  0  0
 35 11  2  0  0  0  0
 35  7  1  0  0  0  0
 36  9  1  0  0  0  0
 37 36  1  0  0  0  0
 38 36  1  0  0  0  0
 39 36  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="490.39583990468" x2="514.17291995234" y1="285.87094372628" y2="288.3692106115" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="514.17291995234" x2="537.95" y1="288.3692106115" y2="290.86747749671" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="461" x2="477" y1="324" y2="306" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="477" x2="493" y1="306" y2="288" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="457" x2="473" y1="320" y2="302.5" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="473" x2="489" y1="302.5" y2="285" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="414.72379701242" x2="436.56442138828" y1="301.9534300728" y2="311.67669162058" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="436.56442138828" x2="458.40504576415" y1="311.67669162058" y2="321.39995316837" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="419.72374604858" x2="417.2237715305" y1="254.40268524321" y2="278.17805765801" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="417.2237715305" x2="414.72379701242" y1="278.17805765801" y2="301.9534300728" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="466" x2="443" y1="243" y2="247.5" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="443" x2="420" y1="247.5" y2="252" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="468" x2="444.5" y1="247" y2="252" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="444.5" x2="421" y1="252" y2="257" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="466.48897975909" x2="478.44240983189" y1="244.46426195412" y2="265.1676028402" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="478.44240983189" x2="490.39583990468" y1="265.1676028402" y2="285.87094372628" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="373.31369997452" x2="394.01874849347" y1="325.86029021839" y2="313.90686014559" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="394.01874849347" x2="414.72379701242" y1="313.90686014559" y2="301.9534300728" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="376" x2="376" y1="374" y2="350" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="376" x2="376" y1="350" y2="326" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="371" x2="371" y1="374" y2="350" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="371" x2="371" y1="350" y2="326" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331.90701820235" x2="352.61035908844" y1="397.58087065516" y2="385.62744058237" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="352.61035908844" x2="373.31369997452" y1="385.62744058237" y2="373.67401050957" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="290" x2="310.5" y1="376" y2="388" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="310.5" x2="331" y1="388" y2="400" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="292" x2="313" y1="372" y2="384" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="313" x2="334" y1="384" y2="396" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="290.50033643019" x2="290.50033643019" y1="325.86029021839" y2="349.76715036398" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="290.50033643019" x2="290.50033643019" y1="349.76715036398" y2="373.67401050957" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="249.09365465803" x2="269.79699554411" y1="301.9534300728" y2="313.90686014559" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="269.79699554411" x2="290.50033643019" y1="313.90686014559" y2="325.86029021839" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="207.68355762013" x2="228.38860613908" y1="325.86029021839" y2="313.90686014559" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="228.38860613908" x2="249.09365465803" y1="313.90686014559" y2="301.9534300728" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="211" x2="211" y1="374" y2="350" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #ff0000" />
<line x1="211" x2="211" y1="350" y2="326" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="206" x2="206" y1="374" y2="350" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #ff0000" />
<line x1="206" x2="206" y1="350" y2="326" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="166.27346058223" x2="186.97850910118" y1="301.9534300728" y2="313.90686014559" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="186.97850910118" x2="207.68355762013" y1="313.90686014559" y2="325.86029021839" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="127" x2="147.5" y1="329" y2="317" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="147.5" x2="168" y1="317" y2="305" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="124" x2="145" y1="324" y2="312" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="145" x2="166" y1="312" y2="300" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="83.456681772164" x2="104.16173029111" y1="301.9534300728" y2="313.90686014559" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="104.16173029111" x2="124.86677881006" y1="313.90686014559" y2="325.86029021839" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="81" x2="81" y1="255" y2="278.5" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="81" x2="81" y1="278.5" y2="302" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="86" x2="86" y1="255" y2="278.5" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="86" x2="86" y1="278.5" y2="302" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="42.05" x2="62.753340886082" y1="230.23284963602" y2="242.18627970882" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="62.753340886082" x2="83.456681772164" y1="242.18627970882" y2="254.13970978161" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="124.86677881006" x2="104.16173029111" y1="230.23284963602" y2="242.18627970882" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="104.16173029111" x2="83.456681772164" y1="242.18627970882" y2="254.13970978161" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="124.86677881006" x2="124.86677881006" y1="182.41912934484" y2="206.32598949043" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="124.86677881006" x2="124.86677881006" y1="206.32598949043" y2="230.23284963602" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="166.27346058223" x2="145.57011969615" y1="158.51226919925" y2="170.46569927204" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="145.57011969615" x2="124.86677881006" y1="170.46569927204" y2="182.41912934484" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="164" x2="164" y1="111" y2="135" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="164" x2="164" y1="135" y2="159" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="169" x2="169" y1="111" y2="135" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="169" x2="169" y1="135" y2="159" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="207.68355762013" x2="186.97850910118" y1="86.791688762474" y2="98.74511883527" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="186.97850910118" x2="166.27346058223" y1="98.74511883527" y2="110.69854890807" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="251" x2="230" y1="109" y2="97" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="230" x2="209" y1="97" y2="85" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="248" x2="227.5" y1="113" y2="101" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="227.5" x2="207" y1="101" y2="89" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="249.09365465803" x2="249.09365465803" y1="158.51226919925" y2="134.60540905366" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="249.09365465803" x2="249.09365465803" y1="134.60540905366" y2="110.69854890807" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="209" x2="230" y1="185" y2="173" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="230" x2="251" y1="173" y2="161" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="207" x2="227.5" y1="181" y2="169" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="227.5" x2="248" y1="169" y2="157" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="207.68355762013" x2="186.97850910118" y1="182.41912934484" y2="170.46569927204" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="186.97850910118" x2="166.27346058223" y1="170.46569927204" y2="158.51226919925" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="290.50033643019" x2="269.79699554411" y1="182.41912934484" y2="170.46569927204" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="269.79699554411" x2="249.09365465803" y1="170.46569927204" y2="158.51226919925" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331" x2="310.5" y1="157" y2="169" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="310.5" x2="290" y1="169" y2="181" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="334" x2="313" y1="161" y2="173" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="313" x2="292" y1="173" y2="185" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="373.31369997452" x2="352.61035908844" y1="182.41912934484" y2="170.46569927204" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="352.61035908844" x2="331.90701820235" y1="170.46569927204" y2="158.51226919925" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="376" x2="376" y1="231" y2="207" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="376" x2="376" y1="207" y2="183" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="371" x2="371" y1="231" y2="207" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="371" x2="371" y1="207" y2="183" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331.90701820235" x2="352.61035908844" y1="254.13970978161" y2="242.18627970882" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="352.61035908844" x2="373.31369997452" y1="242.18627970882" y2="230.23284963602" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="290" x2="310.5" y1="233" y2="245" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="310.5" x2="331" y1="245" y2="257" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="292" x2="313" y1="229" y2="240.5" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="313" x2="334" y1="240.5" y2="252" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #0000ff" />
<line x1="290.50033643019" x2="290.50033643019" y1="230.23284963602" y2="206.32598949043" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="290.50033643019" x2="290.50033643019" y1="206.32598949043" y2="182.41912934484" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="168" x2="147.5" y1="252" y2="240.5" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="147.5" x2="127" y1="240.5" y2="229" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="166" x2="145" y1="257" y2="245" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="145" x2="124" y1="245" y2="233" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="166.27346058223" x2="166.27346058223" y1="254.13970978161" y2="278.0465699272" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="166.27346058223" x2="166.27346058223" y1="278.0465699272" y2="301.9534300728" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331" x2="310.5" y1="300" y2="312" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="310.5" x2="290" y1="312" y2="324" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="334" x2="313" y1="305" y2="317" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="313" x2="292" y1="317" y2="329" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331.90701820235" x2="352.61035908844" y1="301.9534300728" y2="313.90686014559" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="352.61035908844" x2="373.31369997452" y1="313.90686014559" y2="325.86029021839" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331.90701820235" x2="331.90701820235" y1="445.39459094634" y2="421.48773080075" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331.90701820235" x2="331.90701820235" y1="421.48773080075" y2="397.58087065516" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="284.09329791117" x2="308.00015805676" y1="445.39459094634" y2="445.39459094634" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #00bc00" />
<line x1="308.00015805676" x2="331.90701820235" y1="445.39459094634" y2="445.39459094634" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="331.90701820235" x2="331.90701820235" y1="493.20831123753" y2="469.30145109193" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #00bc00" />
<line x1="331.90701820235" x2="331.90701820235" y1="469.30145109193" y2="445.39459094634" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<line x1="379.72073849354" x2="355.81387834795" y1="445.39459094634" y2="445.39459094634" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #00bc00" />
<line x1="355.81387834795" x2="331.90701820235" y1="445.39459094634" y2="445.39459094634" style="stroke-opacity:1; stroke-width: 2.0132001805931; stroke: #000000" />
<ellipse cx="414.72379701242" cy="301.9534300728" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="414.72379701242" y="313.02603106606"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="466.48897975909" cy="244.46426195412" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="466.48897975909" y="255.53686294738"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="249.09365465803" cy="301.9534300728" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="249.09365465803" y="313.02603106606"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="207.68355762013" cy="373.67401050957" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.68355762013" y="384.74661150283"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">O</text>
<ellipse cx="124.86677881006" cy="182.41912934484" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.86677881006" y="193.4917303381"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="166.27346058223" cy="110.69854890807" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.27346058223" y="121.77114990133"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="207.68355762013" cy="182.41912934484" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.68355762013" y="193.4917303381"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="331.90701820235" cy="254.13970978161" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.90701820235" y="265.21231077488"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">N</text>
<ellipse cx="284.09329791117" cy="445.39459094634" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="284.09329791117" y="456.46719193961"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">F</text>
<ellipse cx="331.90701820235" cy="493.20831123753" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.90701820235" y="504.28091223079"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">F</text>
<ellipse cx="379.72073849354" cy="445.39459094634" rx="13.085801173855" ry="13.085801173855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="379.72073849354" y="456.46719193961"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:25.165002257414px">F</text>


2021-08-01, 352👍, 0💬