Collections:
Molecule FYI-1000209
Molecule Summary:
ID: FYI-1000209
SMILES: CC1=NC(NC2=NC=C(S2)C(=O)NC3=C(Cl)C=CC=C3C)=CC(=N1)N4CCN(CCO)CC4
Received at FYIcenter.com on: 2020-12-22
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000209 FYIcenter.com 33 36 0 0 0 0 0 0 0 0999 V2000 13.5939 6.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2016 6.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6320 7.7820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.2397 7.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6704 9.2074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.2781 9.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5781 10.5661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.2086 10.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0623 8.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3412 8.3133 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 4.8499 8.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8499 6.7827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 8.8827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 8.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 8.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 10.2827 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 8.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 6.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 6.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 6.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 6.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4168 6.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9863 5.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3786 5.3704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.1634 4.3842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.7711 4.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9482 3.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5176 2.1189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6947 0.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3024 1.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4794 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9099 1.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7328 3.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 2 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 10 9 1 0 0 0 0 10 6 1 0 0 0 0 11 9 1 0 0 0 0 12 11 2 0 0 0 0 13 11 1 0 0 0 0 14 13 1 0 0 0 0 15 14 2 0 0 0 0 16 15 1 0 0 0 0 17 15 1 0 0 0 0 18 17 2 0 0 0 0 19 18 1 0 0 0 0 20 19 2 0 0 0 0 20 14 1 0 0 0 0 21 20 1 0 0 0 0 22 4 2 0 0 0 0 23 22 1 0 0 0 0 24 23 2 0 0 0 0 24 2 1 0 0 0 0 25 23 1 0 0 0 0 26 25 1 0 0 0 0 27 26 1 0 0 0 0 28 27 1 0 0 0 0 29 28 1 0 0 0 0 30 29 1 0 0 0 0 31 30 1 0 0 0 0 32 28 1 0 0 0 0 33 32 1 0 0 0 0 33 25 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="487.15945644738" x2="512.55472822369" y1="334.50693288902" y2="331.83662635447" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="512.55472822369" x2="537.95" y1="331.83662635447" y2="329.16631981992" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="469" x2="479.5" y1="383" y2="359.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="479.5" x2="490" y1="359.5" y2="336" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="464" x2="474.5" y1="381" y2="357.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="474.5" x2="485" y1="357.5" y2="334" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="415.59013417783" x2="440.98540595414" y1="386.49765519829" y2="383.82917264361" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="440.98540595414" x2="466.38067773045" y1="383.82917264361" y2="381.16069008894" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="394.82229934015" x2="405.20621675899" y1="433.1587083177" y2="409.82818175799" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="405.20621675899" x2="415.59013417783" y1="409.82818175799" y2="386.49765519829" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="344.03175578752" x2="369.42702756383" y1="438.49567342705" y2="435.82719087238" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="369.42702756383" x2="394.82229934015" y1="435.82719087238" y2="433.1587083177" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="321" x2="334" y1="485" y2="462.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="334" x2="347" y1="462.5" y2="440" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="317" x2="329.5" y1="482" y2="460" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="329.5" x2="342" y1="460" y2="438" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="268.53722883058" x2="293.51663319577" y1="472.10432657295" y2="477.4139319842" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="293.51663319577" x2="318.49603756096" y1="477.4139319842" y2="482.72353739545" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="261" x2="263.5" y1="422" y2="447.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="263.5" x2="266" y1="447.5" y2="473" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="266" x2="269" y1="422" y2="447" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="269" x2="272" y1="447" y2="472" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="309.85402092115" x2="286.52714232119" y1="400.54230022289" y2="410.92804162161" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #c8aa1a" /> <line x1="286.52714232119" x2="263.20026372123" y1="410.92804162161" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="309.85402092115" x2="326.94288835434" y1="400.54230022289" y2="419.51898682497" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #c8aa1a" /> <line x1="326.94288835434" x2="344.03175578752" y1="419.51898682497" y2="438.49567342705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="218.97239975283" x2="241.08633173703" y1="395.77806479377" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="241.08633173703" x2="263.20026372123" y1="408.54592390705" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="217" x2="217" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #ff0000" /> <line x1="217" x2="217" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="222" x2="222" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #ff0000" /> <line x1="222" x2="222" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="174.73723986494" x2="196.85481980888" y1="421.31378302033" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="196.85481980888" x2="218.97239975283" y1="408.54592390705" y2="395.77806479377" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="130.50937589654" x2="152.62330788074" y1="395.77806479377" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="152.62330788074" x2="174.73723986494" y1="408.54592390705" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="88" x2="110" y1="424" y2="411.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="110" x2="132" y1="411.5" y2="399" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="85" x2="107.5" y1="419" y2="406.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="107.5" x2="130" y1="406.5" y2="394" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="86.281511928144" x2="86.281511928144" y1="472.38521947344" y2="446.84950124688" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #00bc00" /> <line x1="86.281511928144" x2="86.281511928144" y1="446.84950124688" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="42.05" x2="64.165755964072" y1="395.77806479377" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="64.165755964072" x2="86.281511928144" y1="408.54592390705" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="40" x2="40" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="40" x2="40" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="45" x2="45" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="45" x2="45" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="86.281511928144" x2="64.165755964072" y1="319.1709101141" y2="331.93876922737" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="64.165755964072" x2="42.05" y1="331.93876922737" y2="344.70662834065" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="132" x2="110" y1="343" y2="330" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="110" x2="88" y1="330" y2="317" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="130" x2="107.5" y1="348" y2="335" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="107.5" x2="85" y1="335" y2="322" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="130.50937589654" x2="130.50937589654" y1="344.70662834065" y2="370.24234656721" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="130.50937589654" x2="130.50937589654" y1="370.24234656721" y2="395.77806479377" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="174.73723986494" x2="152.62330788074" y1="319.1709101141" y2="331.93876922737" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="152.62330788074" x2="130.50937589654" y1="331.93876922737" y2="344.70662834065" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="384" x2="399" y1="347" y2="368" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="399" x2="414" y1="368" y2="389" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="388" x2="403" y1="344" y2="364.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="403" x2="418" y1="364.5" y2="385" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="406.34620417982" x2="395.95863880123" y1="298.5271059078" y2="321.85398450776" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="395.95863880123" x2="385.57107342264" y1="321.85398450776" y2="345.18086310772" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="457" x2="432" y1="291" y2="293.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="432" x2="407" y1="293.5" y2="296" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="458" x2="432.5" y1="296" y2="299" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="432.5" x2="407" y1="299" y2="302" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="457.13674773244" x2="472.14810208991" y1="293.1864928387" y2="313.84671286386" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="472.14810208991" x2="487.15945644738" y1="313.84671286386" y2="334.50693288902" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="376.32714342462" x2="391.33667380222" y1="257.21031381723" y2="277.86870986251" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="391.33667380222" x2="406.34620417982" y1="277.86870986251" y2="298.5271059078" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="325.536599872" x2="350.93187164831" y1="262.54727892658" y2="259.8787963719" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="350.93187164831" x2="376.32714342462" y1="259.8787963719" y2="257.21031381723" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="295.51753911681" x2="310.52706949441" y1="221.23048683601" y2="241.88888288129" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="310.52706949441" x2="325.536599872" y1="241.88888288129" y2="262.54727892658" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="316.28902191424" x2="305.90328051553" y1="174.57308167634" y2="197.90178425617" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="305.90328051553" x2="295.51753911681" y1="197.90178425617" y2="221.23048683601" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="286.26996115905" x2="301.27949153665" y1="133.25628958577" y2="153.91468563106" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="301.27949153665" x2="316.28902191424" y1="153.91468563106" y2="174.57308167634" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="235.47941760643" x2="260.87468938274" y1="138.59325469512" y2="135.92477214045" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="260.87468938274" x2="286.26996115905" y1="135.92477214045" y2="133.25628958577" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="205.45670889149" x2="220.46806324896" y1="97.276462604551" y2="117.93485864984" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #ff0000" /> <line x1="220.46806324896" x2="235.47941760643" y1="117.93485864984" y2="138.59325469512" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="367.07956546686" x2="341.68429369055" y1="169.23611656699" y2="171.90459912166" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="341.68429369055" x2="316.28902191424" y1="171.90459912166" y2="174.57308167634" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <line x1="397.09862622206" x2="382.08909584446" y1="210.55290865756" y2="189.89451261227" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="382.08909584446" x2="367.07956546686" y1="189.89451261227" y2="169.23611656699" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="397.09862622206" x2="386.71288482334" y1="210.55290865756" y2="233.88161123739" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" /> <line x1="386.71288482334" x2="376.32714342462" y1="233.88161123739" y2="257.21031381723" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" /> <ellipse cx="466.38067773045" cy="381.16069008894" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="466.38067773045" y="392.98765151149" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="394.82229934015" cy="433.1587083177" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="394.82229934015" y="444.98566974025" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="318.49603756096" cy="482.72353739545" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="318.49603756096" y="494.550498818" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="309.85402092115" cy="400.54230022289" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="309.85402092115" y="412.36926164544" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">S</text> <ellipse cx="218.97239975283" cy="344.70662834065" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="218.97239975283" y="356.5335897632" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">O</text> <ellipse cx="174.73723986494" cy="421.31378302033" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="174.73723986494" y="433.14074444287" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="86.281511928144" cy="472.38521947344" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="86.281511928144" y="484.21218089599" fill="#00bc00" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">Cl</text> <ellipse cx="457.13674773244" cy="293.1864928387" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.13674773244" y="305.01345426125" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="376.32714342462" cy="257.21031381723" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="376.32714342462" y="269.03727523978" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="316.28902191424" cy="174.57308167634" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="316.28902191424" y="186.40004309889" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">N</text> <ellipse cx="205.45670889149" cy="97.276462604551" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="205.45670889149" y="109.1034240271" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:26.87945777852px">O</text> </g></svg>
✍: FYIcenter.com
2021-08-01, 398👍, 0💬
Popular Posts:
How to download and install PyMol Open Source edition on macOS? If you want to try the open source e...
How to add hydrogen atoms to molecule data during data conversion? Most molecules contains many hydr...
Can I load JSME JavaScript code in HTML "body" element instead of "head"? Yes, you can load JSME Jav...
What information is displayed in each area on PyMol Screen? Once PyMol is started, you should see tw...
How to Install Open Babel binary package on Windows computers? The easiest option to install Open Ba...