Molecule FYI-1000209

A

Molecule Summary:

ID: FYI-1000209
SMILES: CC1=NC(NC2=NC=C(S2)C(=O)NC3=C(Cl)C=CC=C3C)=CC(=N1)N4CCN(CCO)CC4

Received at FYIcenter.com on: 2020-12-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000209
FYIcenter.com

 33 36  0  0  0  0  0  0  0  0999 V2000
   13.5939    6.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2016    6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6320    7.7820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2397    7.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6704    9.2074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2781    9.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5781   10.5661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2086   10.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    8.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3412    8.3133    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    8.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    6.7827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    8.8827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    8.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    8.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   10.2827    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    8.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    6.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4168    6.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9863    5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3786    5.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1634    4.3842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7711    4.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9482    3.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5176    2.1189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6947    0.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3024    1.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4794    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9099    1.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7328    3.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 10  6  1  0  0  0  0
 11  9  1  0  0  0  0
 12 11  2  0  0  0  0
 13 11  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 15  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20 14  1  0  0  0  0
 21 20  1  0  0  0  0
 22  4  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 24  2  1  0  0  0  0
 25 23  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 28  1  0  0  0  0
 33 32  1  0  0  0  0
 33 25  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="487.15945644738" x2="512.55472822369" y1="334.50693288902" y2="331.83662635447" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="512.55472822369" x2="537.95" y1="331.83662635447" y2="329.16631981992" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="469" x2="479.5" y1="383" y2="359.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="479.5" x2="490" y1="359.5" y2="336" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="464" x2="474.5" y1="381" y2="357.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="474.5" x2="485" y1="357.5" y2="334" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="415.59013417783" x2="440.98540595414" y1="386.49765519829" y2="383.82917264361" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="440.98540595414" x2="466.38067773045" y1="383.82917264361" y2="381.16069008894" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="394.82229934015" x2="405.20621675899" y1="433.1587083177" y2="409.82818175799" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="405.20621675899" x2="415.59013417783" y1="409.82818175799" y2="386.49765519829" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="344.03175578752" x2="369.42702756383" y1="438.49567342705" y2="435.82719087238" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="369.42702756383" x2="394.82229934015" y1="435.82719087238" y2="433.1587083177" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="321" x2="334" y1="485" y2="462.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="334" x2="347" y1="462.5" y2="440" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="317" x2="329.5" y1="482" y2="460" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="329.5" x2="342" y1="460" y2="438" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="268.53722883058" x2="293.51663319577" y1="472.10432657295" y2="477.4139319842" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="293.51663319577" x2="318.49603756096" y1="477.4139319842" y2="482.72353739545" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="261" x2="263.5" y1="422" y2="447.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="263.5" x2="266" y1="447.5" y2="473" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="266" x2="269" y1="422" y2="447" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="269" x2="272" y1="447" y2="472" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="309.85402092115" x2="286.52714232119" y1="400.54230022289" y2="410.92804162161" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #c8aa1a" />
<line x1="286.52714232119" x2="263.20026372123" y1="410.92804162161" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="309.85402092115" x2="326.94288835434" y1="400.54230022289" y2="419.51898682497" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #c8aa1a" />
<line x1="326.94288835434" x2="344.03175578752" y1="419.51898682497" y2="438.49567342705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="218.97239975283" x2="241.08633173703" y1="395.77806479377" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="241.08633173703" x2="263.20026372123" y1="408.54592390705" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="217" x2="217" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #ff0000" />
<line x1="217" x2="217" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="222" x2="222" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #ff0000" />
<line x1="222" x2="222" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="174.73723986494" x2="196.85481980888" y1="421.31378302033" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="196.85481980888" x2="218.97239975283" y1="408.54592390705" y2="395.77806479377" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="130.50937589654" x2="152.62330788074" y1="395.77806479377" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="152.62330788074" x2="174.73723986494" y1="408.54592390705" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="88" x2="110" y1="424" y2="411.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="110" x2="132" y1="411.5" y2="399" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="85" x2="107.5" y1="419" y2="406.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="107.5" x2="130" y1="406.5" y2="394" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="86.281511928144" x2="86.281511928144" y1="472.38521947344" y2="446.84950124688" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #00bc00" />
<line x1="86.281511928144" x2="86.281511928144" y1="446.84950124688" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="42.05" x2="64.165755964072" y1="395.77806479377" y2="408.54592390705" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="64.165755964072" x2="86.281511928144" y1="408.54592390705" y2="421.31378302033" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="40" x2="40" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="40" x2="40" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="45" x2="45" y1="345" y2="370.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="45" x2="45" y1="370.5" y2="396" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="86.281511928144" x2="64.165755964072" y1="319.1709101141" y2="331.93876922737" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="64.165755964072" x2="42.05" y1="331.93876922737" y2="344.70662834065" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="132" x2="110" y1="343" y2="330" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="110" x2="88" y1="330" y2="317" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="130" x2="107.5" y1="348" y2="335" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="107.5" x2="85" y1="335" y2="322" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="130.50937589654" x2="130.50937589654" y1="344.70662834065" y2="370.24234656721" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="130.50937589654" x2="130.50937589654" y1="370.24234656721" y2="395.77806479377" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="174.73723986494" x2="152.62330788074" y1="319.1709101141" y2="331.93876922737" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="152.62330788074" x2="130.50937589654" y1="331.93876922737" y2="344.70662834065" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="384" x2="399" y1="347" y2="368" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="399" x2="414" y1="368" y2="389" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="388" x2="403" y1="344" y2="364.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="403" x2="418" y1="364.5" y2="385" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="406.34620417982" x2="395.95863880123" y1="298.5271059078" y2="321.85398450776" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="395.95863880123" x2="385.57107342264" y1="321.85398450776" y2="345.18086310772" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="457" x2="432" y1="291" y2="293.5" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="432" x2="407" y1="293.5" y2="296" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="458" x2="432.5" y1="296" y2="299" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="432.5" x2="407" y1="299" y2="302" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="457.13674773244" x2="472.14810208991" y1="293.1864928387" y2="313.84671286386" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="472.14810208991" x2="487.15945644738" y1="313.84671286386" y2="334.50693288902" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="376.32714342462" x2="391.33667380222" y1="257.21031381723" y2="277.86870986251" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="391.33667380222" x2="406.34620417982" y1="277.86870986251" y2="298.5271059078" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="325.536599872" x2="350.93187164831" y1="262.54727892658" y2="259.8787963719" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="350.93187164831" x2="376.32714342462" y1="259.8787963719" y2="257.21031381723" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="295.51753911681" x2="310.52706949441" y1="221.23048683601" y2="241.88888288129" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="310.52706949441" x2="325.536599872" y1="241.88888288129" y2="262.54727892658" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="316.28902191424" x2="305.90328051553" y1="174.57308167634" y2="197.90178425617" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="305.90328051553" x2="295.51753911681" y1="197.90178425617" y2="221.23048683601" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="286.26996115905" x2="301.27949153665" y1="133.25628958577" y2="153.91468563106" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="301.27949153665" x2="316.28902191424" y1="153.91468563106" y2="174.57308167634" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="235.47941760643" x2="260.87468938274" y1="138.59325469512" y2="135.92477214045" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="260.87468938274" x2="286.26996115905" y1="135.92477214045" y2="133.25628958577" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="205.45670889149" x2="220.46806324896" y1="97.276462604551" y2="117.93485864984" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #ff0000" />
<line x1="220.46806324896" x2="235.47941760643" y1="117.93485864984" y2="138.59325469512" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="367.07956546686" x2="341.68429369055" y1="169.23611656699" y2="171.90459912166" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="341.68429369055" x2="316.28902191424" y1="171.90459912166" y2="174.57308167634" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<line x1="397.09862622206" x2="382.08909584446" y1="210.55290865756" y2="189.89451261227" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="382.08909584446" x2="367.07956546686" y1="189.89451261227" y2="169.23611656699" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="397.09862622206" x2="386.71288482334" y1="210.55290865756" y2="233.88161123739" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #000000" />
<line x1="386.71288482334" x2="376.32714342462" y1="233.88161123739" y2="257.21031381723" style="stroke-opacity:1; stroke-width: 2.1503566222816; stroke: #0000ff" />
<ellipse cx="466.38067773045" cy="381.16069008894" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="466.38067773045" y="392.98765151149"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="394.82229934015" cy="433.1587083177" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="394.82229934015" y="444.98566974025"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="318.49603756096" cy="482.72353739545" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="318.49603756096" y="494.550498818"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="309.85402092115" cy="400.54230022289" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="309.85402092115" y="412.36926164544"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">S</text>
<ellipse cx="218.97239975283" cy="344.70662834065" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="218.97239975283" y="356.5335897632"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">O</text>
<ellipse cx="174.73723986494" cy="421.31378302033" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="174.73723986494" y="433.14074444287"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="86.281511928144" cy="472.38521947344" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="86.281511928144" y="484.21218089599"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">Cl</text>
<ellipse cx="457.13674773244" cy="293.1864928387" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.13674773244" y="305.01345426125"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="376.32714342462" cy="257.21031381723" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="376.32714342462" y="269.03727523978"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="316.28902191424" cy="174.57308167634" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="316.28902191424" y="186.40004309889"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">N</text>
<ellipse cx="205.45670889149" cy="97.276462604551" rx="13.977318044831" ry="13.977318044831" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="205.45670889149" y="109.1034240271"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.87945777852px">O</text>
</g></svg>

✍: FYIcenter.com

2021-08-01, 170👍, 0💬