Collections:
Molecule FYI-1000204
Molecule Summary:
ID: FYI-1000204
SMILES: CC1=CC(=C(C=C1)OP(=O)(OC2=C(C=C(C=C2)C)C)OC3=C(C=C(C=C3)C)C)C
Received at FYIcenter.com on: 2020-12-12
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000204 FYIcenter.com 29 31 0 0 0 0 0 0 0 0999 V2000 7.2746 10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 4.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 4.2000 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 2.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9119 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 4.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 2 0 0 0 0 4 3 1 0 0 0 0 5 4 2 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 7 2 1 0 0 0 0 8 5 1 0 0 0 0 9 8 1 0 0 0 0 10 9 2 0 0 0 0 11 9 1 0 0 0 0 12 11 1 0 0 0 0 13 12 2 0 0 0 0 14 13 1 0 0 0 0 15 14 2 0 0 0 0 16 15 1 0 0 0 0 17 16 2 0 0 0 0 17 12 1 0 0 0 0 18 15 1 0 0 0 0 19 13 1 0 0 0 0 20 9 1 0 0 0 0 21 20 1 0 0 0 0 22 21 2 0 0 0 0 23 22 1 0 0 0 0 24 23 2 0 0 0 0 25 24 1 0 0 0 0 26 25 2 0 0 0 0 26 21 1 0 0 0 0 27 24 1 0 0 0 0 28 22 1 0 0 0 0 29 4 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="372.65" x2="372.65" y1="464.9663211723" y2="496.77837956726" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="372.65" x2="372.65" y1="496.77837956726" y2="528.59043796222" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="316" x2="343.5" y1="437" y2="452.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="343.5" x2="371" y1="452.5" y2="468" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="320" x2="347.5" y1="431" y2="447" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="347.5" x2="375" y1="447" y2="463" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="317.55151485992" x2="317.55151485992" y1="369.53014598741" y2="401.34220438237" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="317.55151485992" x2="317.55151485992" y1="401.34220438237" y2="433.15426277733" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="371" x2="343.5" y1="335" y2="351" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="343.5" x2="316" y1="351" y2="367" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="375" x2="347.5" y1="341" y2="357" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="347.5" x2="320" y1="357" y2="373" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="427.75302971985" x2="400.20151485992" y1="369.53014598741" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="400.20151485992" x2="372.65" y1="353.62411678993" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="432" x2="432" y1="434" y2="402" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="432" x2="432" y1="402" y2="370" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="425" x2="425" y1="434" y2="402" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="425" x2="425" y1="402" y2="370" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="427.75302971985" x2="400.20151485992" y1="433.15426277733" y2="449.06029197482" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="400.20151485992" x2="372.65" y1="449.06029197482" y2="464.9663211723" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="372.65" x2="372.65" y1="274.09397080252" y2="305.90602919748" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="372.65" x2="372.65" y1="305.90602919748" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="317.55151485992" x2="345.10075742996" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" /> <line x1="345.10075742996" x2="372.65" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="371" x2="343.5" y1="208" y2="224" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="343.5" x2="316" y1="224" y2="240" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" /> <line x1="375" x2="347.5" y1="214" y2="230" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="347.5" x2="320" y1="230" y2="246" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" /> <line x1="317.55151485992" x2="317.55151485992" y1="178.65779561763" y2="210.46985401259" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="317.55151485992" x2="317.55151485992" y1="210.46985401259" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" /> <line x1="372.65" x2="345.10075742996" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="345.10075742996" x2="317.55151485992" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="370" x2="370" y1="84" y2="115.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="370" x2="370" y1="115.5" y2="147" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="376" x2="376" y1="84" y2="115.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="376" x2="376" y1="115.5" y2="147" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="427.75302971985" x2="400.20151485992" y1="51.409562037775" y2="67.315591235257" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="400.20151485992" x2="372.65" y1="67.315591235257" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="485" x2="457.5" y1="81" y2="65" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="457.5" x2="430" y1="65" y2="49" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="482" x2="454.5" y1="87" y2="71" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="454.5" x2="427" y1="71" y2="55" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="482.85151485992" x2="482.85151485992" y1="146.84573722267" y2="115.0336788277" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="482.85151485992" x2="482.85151485992" y1="115.0336788277" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="430" x2="457.5" y1="182" y2="166" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="457.5" x2="485" y1="166" y2="150" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="427" x2="454.5" y1="176" y2="160" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="454.5" x2="482" y1="160" y2="144" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="427.75302971985" x2="400.20151485992" y1="178.65779561763" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="400.20151485992" x2="372.65" y1="162.75176642015" y2="146.84573722267" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="537.95" x2="510.40075742996" y1="51.409562037775" y2="67.315591235257" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="510.40075742996" x2="482.85151485992" y1="67.315591235257" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="317.55151485992" x2="345.10075742996" y1="51.409562037775" y2="67.315591235257" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="345.10075742996" x2="372.65" y1="67.315591235257" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="262.44848514008" x2="290" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="290" x2="317.55151485992" y1="258.18794160504" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" /> <line x1="207.35" x2="234.89924257004" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="234.89924257004" x2="262.44848514008" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" /> <line x1="205" x2="205" y1="179" y2="211" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="205" x2="205" y1="211" y2="243" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="211" x2="211" y1="179" y2="211" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="211" x2="211" y1="211" y2="243" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="152.25151485992" x2="179.80075742996" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="179.80075742996" x2="207.35" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="99" x2="126.5" y1="182" y2="166" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="126.5" x2="154" y1="166" y2="150" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="96" x2="123.5" y1="176" y2="160" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="123.5" x2="151" y1="160" y2="144" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="97.148485140076" x2="97.148485140076" y1="242.28191240756" y2="210.46985401259" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="97.148485140076" x2="97.148485140076" y1="210.46985401259" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="154" x2="126.5" y1="272" y2="256" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="126.5" x2="99" y1="256" y2="240" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="151" x2="123.5" y1="277" y2="261.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="123.5" x2="96" y1="261.5" y2="246" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="152.25151485992" x2="179.80075742996" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="179.80075742996" x2="207.35" y1="258.18794160504" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="42.05" x2="69.599242570038" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="69.599242570038" x2="97.148485140076" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="262.44848514008" x2="234.89924257004" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="234.89924257004" x2="207.35" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="262.44848514008" x2="290" y1="337.71808759244" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <line x1="290" x2="317.55151485992" y1="353.62411678993" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" /> <ellipse cx="372.65" cy="274.09397080252" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65" y="288.82801302314" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:33.486459592314px">O</text> <ellipse cx="317.55151485992" cy="242.28191240756" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="317.55151485992" y="257.01595462817" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:33.486459592314px">P</text> <ellipse cx="372.65" cy="210.46985401259" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65" y="225.20389623321" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:33.486459592314px">O</text> <ellipse cx="317.55151485992" cy="178.65779561763" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="317.55151485992" y="193.39183783825" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:33.486459592314px">O</text> <ellipse cx="262.44848514008" cy="274.09397080252" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.44848514008" y="288.82801302314" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:33.486459592314px">O</text> </g></svg>
✍: FYIcenter.com
2021-02-04, 311👍, 0💬
Popular Posts:
How to create a molecule structure with custom wedge/hash bonds? I don't like the default presentati...
How to Install Open Babel binary package on macOS computers? The easiest option to install Open Babe...
What are tools that support the SDF/Mol V3000 file format? There are a number of online or standalon...
What is chem.nlm.nih.gov ChemIDplus Database? chem.nlm.nih.gov ChemIDplus Database contains over 108...
What is molview.org? molview.org is a Website that offers MolView as an open source web application,...