Molecule FYI-1000204

A

Molecule Summary:

ID: FYI-1000204
SMILES: CC1=CC(=C(C=C1)OP(=O)(OC2=C(C=C(C=C2)C)C)OC3=C(C=C(C=C3)C)C)C

Received at FYIcenter.com on: 2020-12-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000204
FYIcenter.com

 29 31  0  0  0  0  0  0  0  0999 V2000
    7.2746   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  7  2  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 17 12  1  0  0  0  0
 18 15  1  0  0  0  0
 19 13  1  0  0  0  0
 20  9  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 26 21  1  0  0  0  0
 27 24  1  0  0  0  0
 28 22  1  0  0  0  0
 29  4  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="372.65" x2="372.65" y1="464.9663211723" y2="496.77837956726" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="372.65" x2="372.65" y1="496.77837956726" y2="528.59043796222" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="316" x2="343.5" y1="437" y2="452.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="343.5" x2="371" y1="452.5" y2="468" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="320" x2="347.5" y1="431" y2="447" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="347.5" x2="375" y1="447" y2="463" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="317.55151485992" x2="317.55151485992" y1="369.53014598741" y2="401.34220438237" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="317.55151485992" x2="317.55151485992" y1="401.34220438237" y2="433.15426277733" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="371" x2="343.5" y1="335" y2="351" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="343.5" x2="316" y1="351" y2="367" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="375" x2="347.5" y1="341" y2="357" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="347.5" x2="320" y1="357" y2="373" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="427.75302971985" x2="400.20151485992" y1="369.53014598741" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="400.20151485992" x2="372.65" y1="353.62411678993" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="432" x2="432" y1="434" y2="402" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="432" x2="432" y1="402" y2="370" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="425" x2="425" y1="434" y2="402" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="425" x2="425" y1="402" y2="370" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="427.75302971985" x2="400.20151485992" y1="433.15426277733" y2="449.06029197482" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="400.20151485992" x2="372.65" y1="449.06029197482" y2="464.9663211723" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="372.65" x2="372.65" y1="274.09397080252" y2="305.90602919748" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="372.65" x2="372.65" y1="305.90602919748" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="317.55151485992" x2="345.10075742996" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" />
<line x1="345.10075742996" x2="372.65" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="371" x2="343.5" y1="208" y2="224" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="343.5" x2="316" y1="224" y2="240" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" />
<line x1="375" x2="347.5" y1="214" y2="230" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="347.5" x2="320" y1="230" y2="246" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" />
<line x1="317.55151485992" x2="317.55151485992" y1="178.65779561763" y2="210.46985401259" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="317.55151485992" x2="317.55151485992" y1="210.46985401259" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" />
<line x1="372.65" x2="345.10075742996" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="345.10075742996" x2="317.55151485992" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="370" x2="370" y1="84" y2="115.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="370" x2="370" y1="115.5" y2="147" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="376" x2="376" y1="84" y2="115.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="376" x2="376" y1="115.5" y2="147" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="427.75302971985" x2="400.20151485992" y1="51.409562037775" y2="67.315591235257" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="400.20151485992" x2="372.65" y1="67.315591235257" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="485" x2="457.5" y1="81" y2="65" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="457.5" x2="430" y1="65" y2="49" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="482" x2="454.5" y1="87" y2="71" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="454.5" x2="427" y1="71" y2="55" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="482.85151485992" x2="482.85151485992" y1="146.84573722267" y2="115.0336788277" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="482.85151485992" x2="482.85151485992" y1="115.0336788277" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="430" x2="457.5" y1="182" y2="166" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="457.5" x2="485" y1="166" y2="150" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="427" x2="454.5" y1="176" y2="160" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="454.5" x2="482" y1="160" y2="144" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="427.75302971985" x2="400.20151485992" y1="178.65779561763" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="400.20151485992" x2="372.65" y1="162.75176642015" y2="146.84573722267" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="537.95" x2="510.40075742996" y1="51.409562037775" y2="67.315591235257" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="510.40075742996" x2="482.85151485992" y1="67.315591235257" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="317.55151485992" x2="345.10075742996" y1="51.409562037775" y2="67.315591235257" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="345.10075742996" x2="372.65" y1="67.315591235257" y2="83.221620432739" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="262.44848514008" x2="290" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="290" x2="317.55151485992" y1="258.18794160504" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #c8aa1a" />
<line x1="207.35" x2="234.89924257004" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="234.89924257004" x2="262.44848514008" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #ff0000" />
<line x1="205" x2="205" y1="179" y2="211" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="205" x2="205" y1="211" y2="243" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="211" x2="211" y1="179" y2="211" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="211" x2="211" y1="211" y2="243" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="152.25151485992" x2="179.80075742996" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="179.80075742996" x2="207.35" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="99" x2="126.5" y1="182" y2="166" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="126.5" x2="154" y1="166" y2="150" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="96" x2="123.5" y1="176" y2="160" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="123.5" x2="151" y1="160" y2="144" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="97.148485140076" x2="97.148485140076" y1="242.28191240756" y2="210.46985401259" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="97.148485140076" x2="97.148485140076" y1="210.46985401259" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="154" x2="126.5" y1="272" y2="256" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="126.5" x2="99" y1="256" y2="240" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="151" x2="123.5" y1="277" y2="261.5" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="123.5" x2="96" y1="261.5" y2="246" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="152.25151485992" x2="179.80075742996" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="179.80075742996" x2="207.35" y1="258.18794160504" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="42.05" x2="69.599242570038" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="69.599242570038" x2="97.148485140076" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="262.44848514008" x2="234.89924257004" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="234.89924257004" x2="207.35" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="262.44848514008" x2="290" y1="337.71808759244" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<line x1="290" x2="317.55151485992" y1="353.62411678993" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789167673851; stroke: #000000" />
<ellipse cx="372.65" cy="274.09397080252" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65" y="288.82801302314"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486459592314px">O</text>
<ellipse cx="317.55151485992" cy="242.28191240756" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="317.55151485992" y="257.01595462817"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486459592314px">P</text>
<ellipse cx="372.65" cy="210.46985401259" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65" y="225.20389623321"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486459592314px">O</text>
<ellipse cx="317.55151485992" cy="178.65779561763" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="317.55151485992" y="193.39183783825"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486459592314px">O</text>
<ellipse cx="262.44848514008" cy="274.09397080252" rx="17.412958988003" ry="17.412958988003" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.44848514008" y="288.82801302314"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486459592314px">O</text>
</g></svg>

✍: FYIcenter.com

2021-02-04, 243👍, 0💬