Collections:
Molecule FYI-1000202
Molecule Summary:
ID: FYI-1000202
SMILES: CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC
Received at FYIcenter.com on: 2020-12-12
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000202 FYIcenter.com 24 24 0 0 0 0 0 0 0 0999 V2000 12.1244 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 5.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 2.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 7 6 1 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 10 8 1 0 0 0 0 11 10 2 0 0 0 0 12 11 1 0 0 0 0 13 12 2 0 0 0 0 14 13 1 0 0 0 0 15 14 2 0 0 0 0 15 10 1 0 0 0 0 16 15 1 0 0 0 0 17 16 2 0 0 0 0 18 16 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 21 1 0 0 0 0 23 22 1 0 0 0 0 24 23 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.36163603972" x2="513.15581801986" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="513.15581801986" x2="537.95" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="438.76918198014" x2="463.56540900993" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="463.56540900993" x2="488.36163603972" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="389.18081801986" x2="413.975" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="413.975" x2="438.76918198014" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="339.59245405958" x2="364.38663603972" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="364.38663603972" x2="389.18081801986" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="290" x2="314.79622702979" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="314.79622702979" x2="339.59245405958" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="240.41163603972" x2="265.20581801986" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="265.20581801986" x2="290" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="190.81918198014" x2="215.61540900993" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="215.61540900993" x2="240.41163603972" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="194" x2="194" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="194" x2="194" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="188" x2="188" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="188" x2="188" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="141.23081801986" x2="166.025" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="166.025" x2="190.81918198014" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="94" x2="118.5" y1="350" y2="336" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="118.5" x2="143" y1="336" y2="322" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="91" x2="115.5" y1="345" y2="331" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="115.5" x2="140" y1="331" y2="317" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="42.05" x2="66.846227029791" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="66.846227029791" x2="91.642454059582" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="40" x2="40" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="40" x2="40" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="46" x2="46" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="46" x2="46" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="91.642454059582" x2="66.846227029791" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="66.846227029791" x2="42.05" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="143" x2="118.5" y1="259" y2="245" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="118.5" x2="94" y1="245" y2="231" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="140" x2="115.5" y1="264" y2="250" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="115.5" x2="91" y1="250" y2="236" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="141.23081801986" x2="141.23081801986" y1="261.36930487282" y2="290" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="141.23081801986" x2="141.23081801986" y1="290" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="190.81918198014" x2="166.025" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="166.025" x2="141.23081801986" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="188" x2="188" y1="176" y2="204.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="188" x2="188" y1="204.5" y2="233" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="194" x2="194" y1="176" y2="204.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="194" x2="194" y1="204.5" y2="233" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="240.41163603972" x2="215.61540900993" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="215.61540900993" x2="190.81918198014" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="290" x2="265.20581801986" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="265.20581801986" x2="240.41163603972" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" /> <line x1="339.59245405958" x2="314.79622702979" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="314.79622702979" x2="290" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="389.18081801986" x2="364.38663603972" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="364.38663603972" x2="339.59245405958" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="438.76918198014" x2="413.975" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="413.975" x2="389.18081801986" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="488.36163603972" x2="463.56540900993" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="463.56540900993" x2="438.76918198014" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="537.95" x2="513.15581801986" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <line x1="513.15581801986" x2="488.36163603972" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" /> <ellipse cx="240.41163603972" cy="318.63069512718" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="331.89124171559" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:30.137605882752px">O</text> <ellipse cx="190.81918198014" cy="404.52278050873" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.81918198014" y="417.78332709714" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:30.137605882752px">O</text> <ellipse cx="190.81918198014" cy="175.47721949127" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.81918198014" y="188.73776607968" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:30.137605882752px">O</text> <ellipse cx="240.41163603972" cy="261.36930487282" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="274.62985146123" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:30.137605882752px">O</text> </g></svg>
✍: FYIcenter.com
2021-02-04, 336👍, 0💬
Popular Posts:
What is chemdb.niaid.nih.gov's Molecule Compounds Against HIV? chemdb.niaid.nih.gov offers a searcha...
How to view the molecule structure specified in a SDF/Mol file? To help you to view the molecule str...
What Is Atomic Bond? Atomic Bond is a physical process that ties atoms together to form a molecule. ...
What is pubchem.ncbi.nlm.nih.gov Molecule Database? pubchem.ncbi.nlm.nih.gov Molecule Database is th...
What is cactus.nci.nih.gov/trans lateSDF translator? pubcactus.nci.nih.gov/tr anslateSDF translator ...