Molecule FYI-1000202

A

Molecule Summary:

ID: FYI-1000202
SMILES: CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC

Received at FYIcenter.com on: 2020-12-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000202
FYIcenter.com

 24 24  0  0  0  0  0  0  0  0999 V2000
   12.1244    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 15 10  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.36163603972" x2="513.15581801986" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="513.15581801986" x2="537.95" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="438.76918198014" x2="463.56540900993" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="463.56540900993" x2="488.36163603972" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="389.18081801986" x2="413.975" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="413.975" x2="438.76918198014" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="339.59245405958" x2="364.38663603972" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="364.38663603972" x2="389.18081801986" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="290" x2="314.79622702979" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="314.79622702979" x2="339.59245405958" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="240.41163603972" x2="265.20581801986" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="265.20581801986" x2="290" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="190.81918198014" x2="215.61540900993" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="215.61540900993" x2="240.41163603972" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="194" x2="194" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="194" x2="194" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="188" x2="188" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="188" x2="188" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="141.23081801986" x2="166.025" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="166.025" x2="190.81918198014" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="94" x2="118.5" y1="350" y2="336" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="118.5" x2="143" y1="336" y2="322" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="91" x2="115.5" y1="345" y2="331" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="115.5" x2="140" y1="331" y2="317" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="42.05" x2="66.846227029791" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="66.846227029791" x2="91.642454059582" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="40" x2="40" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="40" x2="40" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="46" x2="46" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="46" x2="46" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="91.642454059582" x2="66.846227029791" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="66.846227029791" x2="42.05" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="143" x2="118.5" y1="259" y2="245" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="118.5" x2="94" y1="245" y2="231" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="140" x2="115.5" y1="264" y2="250" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="115.5" x2="91" y1="250" y2="236" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="141.23081801986" x2="141.23081801986" y1="261.36930487282" y2="290" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="141.23081801986" x2="141.23081801986" y1="290" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="190.81918198014" x2="166.025" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="166.025" x2="141.23081801986" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="188" x2="188" y1="176" y2="204.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="188" x2="188" y1="204.5" y2="233" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="194" x2="194" y1="176" y2="204.5" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="194" x2="194" y1="204.5" y2="233" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="240.41163603972" x2="215.61540900993" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="215.61540900993" x2="190.81918198014" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="290" x2="265.20581801986" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="265.20581801986" x2="240.41163603972" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #ff0000" />
<line x1="339.59245405958" x2="314.79622702979" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="314.79622702979" x2="290" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="389.18081801986" x2="364.38663603972" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="364.38663603972" x2="339.59245405958" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="438.76918198014" x2="413.975" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="413.975" x2="389.18081801986" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="488.36163603972" x2="463.56540900993" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="463.56540900993" x2="438.76918198014" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="537.95" x2="513.15581801986" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<line x1="513.15581801986" x2="488.36163603972" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110084706201; stroke: #000000" />
<ellipse cx="240.41163603972" cy="318.63069512718" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="331.89124171559"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137605882752px">O</text>
<ellipse cx="190.81918198014" cy="404.52278050873" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.81918198014" y="417.78332709714"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137605882752px">O</text>
<ellipse cx="190.81918198014" cy="175.47721949127" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.81918198014" y="188.73776607968"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137605882752px">O</text>
<ellipse cx="240.41163603972" cy="261.36930487282" rx="15.671555059031" ry="15.671555059031" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="274.62985146123"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137605882752px">O</text>
</g></svg>

✍: FYIcenter.com

2021-02-04, 121👍, 0💬