Molecule FYI-1000199

A

Molecule Summary:

ID: FYI-1000199
SMILES: N[C@H]1CCN(Cc2ccn3ncncc23)C[C@H]1O

Received at FYIcenter.com on: 2020-12-07

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000199
FYIcenter.com

 35 37  0  0  1  0  0  0  0  0999 V2000
    8.9030   -0.8150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9245   -0.6088    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    8.3385   -0.1473    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6138    0.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6353    0.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9674   -0.1964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9889    0.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6783    0.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2619    1.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6783    2.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    2.2651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    2.7651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    2.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    1.2651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    0.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2781   -1.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2566   -1.3531    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.8425   -1.8146    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5673   -2.3036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3170   -0.3536    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0956   -1.4044    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2276    0.4291    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6344    0.9614    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8665    1.1232    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1089    0.8756    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3751   -0.0775    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9684   -0.6098    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8819    1.7651    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8709    3.1592    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4631    2.5751    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    0.1451    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6643   -1.2342    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2575   -1.7666    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1532   -2.7651    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
  8 16  2  0  0  0  0
 11 16  1  0  0  0  0
  6 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
  2 18  1  0  0  0  0
 18 20  1  6  0  0  0
  1 21  1  0  0  0  0
  1 22  1  0  0  0  0
  4 23  1  0  0  0  0
  4 24  1  0  0  0  0
  5 25  1  0  0  0  0
  5 26  1  0  0  0  0
  7 27  1  0  0  0  0
  7 28  1  0  0  0  0
  9 29  1  0  0  0  0
 10 30  1  0  0  0  0
 13 31  1  0  0  0  0
 15 32  1  0  0  0  0
 17 33  1  0  0  0  0
 17 34  1  0  0  0  0
 20 35  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 451,240 514,236 510,217" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="450.02670711366" x2="440.21781407963" y1="239.11814321547" y2="269.12571588637" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="440.21781407963" x2="430.4089210456" y1="269.12571588637" y2="299.13328855728" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="430.4089210456" x2="399.51737990043" y1="299.13328855728" y2="305.64308496416" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="399.51737990043" x2="368.62583875527" y1="305.64308496416" y2="312.15288137104" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="368.62583875527" x2="347.54003361387" y1="312.15288137104" y2="288.65510510702" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="347.54003361387" x2="326.45422847248" y1="288.65510510702" y2="265.157328843" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="326.45422847248" x2="295.56268732732" y1="265.157328843" y2="271.66712524988" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="295.56268732732" x2="264.67114618215" y1="271.66712524988" y2="278.17692165676" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="264.67114618215" x2="254.86541017838" y1="278.17692165676" y2="308.18765135792" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="254.86541017838" x2="245.05967417461" y1="308.18765135792" y2="338.19838105909" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="245.05967417461" x2="263.48410280243" y1="338.19838105909" y2="363.60300360331" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="263.48410280243" x2="281.90853143024" y1="363.60300360331" y2="389.00762614752" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="280" x2="261.5" y1="388" y2="413" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="261.5" x2="243" y1="413" y2="438" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="285" x2="266.5" y1="391" y2="416.5" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="266.5" x2="248" y1="416.5" y2="442" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="245.05967417461" x2="215.18785380512" y1="439.81687123595" y2="430.19740001783" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="215.18785380512" x2="185.31603343562" y1="430.19740001783" y2="420.5779287997" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="185.31603343562" x2="157.97299430856" y1="420.5779287997" y2="436.3630801258" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="157.97299430856" x2="130.6299551815" y1="436.3630801258" y2="452.14823145189" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="133" x2="105.5" y1="450" y2="434" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="105.5" x2="78" y1="434" y2="418" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="129" x2="102" y1="456" y2="440" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="102" x2="75" y1="440" y2="424" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="75.950190987917" x2="75.950190987917" y1="420.5779287997" y2="389.00762614752" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="75.950190987917" x2="75.950190987917" y1="389.00762614752" y2="357.43732349533" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="78" x2="105.5" y1="361" y2="345" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="105.5" x2="133" y1="345" y2="329" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="75" x2="102" y1="355" y2="339" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="102" x2="129" y1="339" y2="323" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="130.6299551815" x2="157.97299430856" y1="325.86702084315" y2="341.65217216924" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="157.97299430856" x2="185.31603343562" y1="341.65217216924" y2="357.43732349533" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="245" x2="215" y1="336" y2="345.5" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="215" x2="185" y1="345.5" y2="355" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="247" x2="217" y1="342" y2="351.5" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="217" x2="187" y1="351.5" y2="361" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="185.31603343562" x2="185.31603343562" y1="420.5779287997" y2="389.00762614752" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="185.31603343562" x2="185.31603343562" y1="389.00762614752" y2="357.43732349533" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="326.45422847248" x2="336.26312150651" y1="265.157328843" y2="235.14975617209" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="336.26312150651" x2="346.07201454055" y1="235.14975617209" y2="205.14218350119" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="346.07201454055" x2="376.96355568571" y1="205.14218350119" y2="198.63238709431" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="376.96355568571" x2="407.85509683087" y1="198.63238709431" y2="192.12259068743" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="450.02670711366" x2="428.94090197227" y1="239.11814321547" y2="215.62036695145" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<line x1="428.94090197227" x2="407.85509683087" y1="215.62036695145" y2="192.12259068743" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" />
<polygon points=" 408,193 437,136 419,130" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="511.80978940399" x2="524.879894702" y1="226.09855040171" y2="240.66508804543" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="524.879894702" x2="537.95" y1="240.66508804543" y2="255.23162568915" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #a4a4a4" />
<line x1="511.80978940399" x2="517.8902296948" y1="226.09855040171" y2="207.49101401851" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" />
<line x1="517.8902296948" x2="523.97066998561" y1="207.49101401851" y2="188.88347763531" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #a4a4a4" />
<line x1="427.47288289894" x2="414.39962057067" y1="132.10744534562" y2="117.53775067164" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #ff0000" />
<line x1="414.39962057067" x2="401.3263582424" y1="117.53775067164" y2="102.96805599766" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #a4a4a4" />
<ellipse cx="511.80978940399" cy="226.09855040171" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="511.80978940399" y="240.69179072438"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">N</text>
<ellipse cx="326.45422847248" cy="265.157328843" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.45422847248" y="279.75056916566"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">N</text>
<ellipse cx="185.31603343562" cy="420.5779287997" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="185.31603343562" y="435.17116912237"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">N</text>
<ellipse cx="130.6299551815" cy="452.14823145189" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="130.6299551815" y="466.74147177456"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">N</text>
<ellipse cx="75.950190987917" cy="357.43732349533" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.950190987917" y="372.030563818"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">N</text>
<ellipse cx="427.47288289894" cy="132.10744534562" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="427.47288289894" y="146.70068566829"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">O</text>
<ellipse cx="537.95" cy="255.23162568915" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="269.82486601181"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">H</text>
<ellipse cx="523.97066998561" cy="188.88347763531" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="523.97066998561" y="203.47671795798"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">H</text>
<ellipse cx="401.3263582424" cy="102.96805599766" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="401.3263582424" y="117.56129632032"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:33.166455278786px">H</text>
</g></svg>

✍: FYIcenter.com

2021-02-04, 121👍, 0💬