Collections:
Molecule FYI-1000199
Molecule Summary:
ID: FYI-1000199
SMILES: N[C@H]1CCN(Cc2ccn3ncncc23)C[C@H]1O
Received at FYIcenter.com on: 2020-12-07
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000199 FYIcenter.com 35 37 0 0 1 0 0 0 0 0999 V2000 8.9030 -0.8150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.9245 -0.6088 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3385 -0.1473 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6138 0.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6353 0.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9674 -0.1964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.9889 0.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 0.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2619 1.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 2.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 2.2651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 2.7651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 2.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 1.2651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 0.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 1.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2781 -1.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2566 -1.3531 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8425 -1.8146 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5673 -2.3036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3170 -0.3536 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0956 -1.4044 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2276 0.4291 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6344 0.9614 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8665 1.1232 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1089 0.8756 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3751 -0.0775 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9684 -0.6098 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8819 1.7651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8709 3.1592 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4631 2.5751 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 0.1451 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6643 -1.2342 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2575 -1.7666 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1532 -2.7651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 6 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 15 16 1 0 0 0 0 8 16 2 0 0 0 0 11 16 1 0 0 0 0 6 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 2 18 1 0 0 0 0 18 20 1 6 0 0 0 1 21 1 0 0 0 0 1 22 1 0 0 0 0 4 23 1 0 0 0 0 4 24 1 0 0 0 0 5 25 1 0 0 0 0 5 26 1 0 0 0 0 7 27 1 0 0 0 0 7 28 1 0 0 0 0 9 29 1 0 0 0 0 10 30 1 0 0 0 0 13 31 1 0 0 0 0 15 32 1 0 0 0 0 17 33 1 0 0 0 0 17 34 1 0 0 0 0 20 35 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 451,240 514,236 510,217" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="450.02670711366" x2="440.21781407963" y1="239.11814321547" y2="269.12571588637" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="440.21781407963" x2="430.4089210456" y1="269.12571588637" y2="299.13328855728" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="430.4089210456" x2="399.51737990043" y1="299.13328855728" y2="305.64308496416" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="399.51737990043" x2="368.62583875527" y1="305.64308496416" y2="312.15288137104" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="368.62583875527" x2="347.54003361387" y1="312.15288137104" y2="288.65510510702" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="347.54003361387" x2="326.45422847248" y1="288.65510510702" y2="265.157328843" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="326.45422847248" x2="295.56268732732" y1="265.157328843" y2="271.66712524988" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="295.56268732732" x2="264.67114618215" y1="271.66712524988" y2="278.17692165676" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="264.67114618215" x2="254.86541017838" y1="278.17692165676" y2="308.18765135792" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="254.86541017838" x2="245.05967417461" y1="308.18765135792" y2="338.19838105909" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="245.05967417461" x2="263.48410280243" y1="338.19838105909" y2="363.60300360331" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="263.48410280243" x2="281.90853143024" y1="363.60300360331" y2="389.00762614752" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="280" x2="261.5" y1="388" y2="413" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="261.5" x2="243" y1="413" y2="438" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="285" x2="266.5" y1="391" y2="416.5" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="266.5" x2="248" y1="416.5" y2="442" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="245.05967417461" x2="215.18785380512" y1="439.81687123595" y2="430.19740001783" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="215.18785380512" x2="185.31603343562" y1="430.19740001783" y2="420.5779287997" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="185.31603343562" x2="157.97299430856" y1="420.5779287997" y2="436.3630801258" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="157.97299430856" x2="130.6299551815" y1="436.3630801258" y2="452.14823145189" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="133" x2="105.5" y1="450" y2="434" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="105.5" x2="78" y1="434" y2="418" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="129" x2="102" y1="456" y2="440" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="102" x2="75" y1="440" y2="424" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="75.950190987917" x2="75.950190987917" y1="420.5779287997" y2="389.00762614752" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="75.950190987917" x2="75.950190987917" y1="389.00762614752" y2="357.43732349533" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="78" x2="105.5" y1="361" y2="345" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="105.5" x2="133" y1="345" y2="329" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="75" x2="102" y1="355" y2="339" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="102" x2="129" y1="339" y2="323" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="130.6299551815" x2="157.97299430856" y1="325.86702084315" y2="341.65217216924" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="157.97299430856" x2="185.31603343562" y1="341.65217216924" y2="357.43732349533" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="245" x2="215" y1="336" y2="345.5" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="215" x2="185" y1="345.5" y2="355" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="247" x2="217" y1="342" y2="351.5" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="217" x2="187" y1="351.5" y2="361" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="185.31603343562" x2="185.31603343562" y1="420.5779287997" y2="389.00762614752" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="185.31603343562" x2="185.31603343562" y1="389.00762614752" y2="357.43732349533" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="326.45422847248" x2="336.26312150651" y1="265.157328843" y2="235.14975617209" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="336.26312150651" x2="346.07201454055" y1="235.14975617209" y2="205.14218350119" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="346.07201454055" x2="376.96355568571" y1="205.14218350119" y2="198.63238709431" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="376.96355568571" x2="407.85509683087" y1="198.63238709431" y2="192.12259068743" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="450.02670711366" x2="428.94090197227" y1="239.11814321547" y2="215.62036695145" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <line x1="428.94090197227" x2="407.85509683087" y1="215.62036695145" y2="192.12259068743" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #000000" /> <polygon points=" 408,193 437,136 419,130" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="511.80978940399" x2="524.879894702" y1="226.09855040171" y2="240.66508804543" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="524.879894702" x2="537.95" y1="240.66508804543" y2="255.23162568915" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #a4a4a4" /> <line x1="511.80978940399" x2="517.8902296948" y1="226.09855040171" y2="207.49101401851" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #0000ff" /> <line x1="517.8902296948" x2="523.97066998561" y1="207.49101401851" y2="188.88347763531" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #a4a4a4" /> <line x1="427.47288289894" x2="414.39962057067" y1="132.10744534562" y2="117.53775067164" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #ff0000" /> <line x1="414.39962057067" x2="401.3263582424" y1="117.53775067164" y2="102.96805599766" style="stroke-opacity:1; stroke-width: 2.6533164223029; stroke: #a4a4a4" /> <ellipse cx="511.80978940399" cy="226.09855040171" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="511.80978940399" y="240.69179072438" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">N</text> <ellipse cx="326.45422847248" cy="265.157328843" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.45422847248" y="279.75056916566" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">N</text> <ellipse cx="185.31603343562" cy="420.5779287997" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="185.31603343562" y="435.17116912237" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">N</text> <ellipse cx="130.6299551815" cy="452.14823145189" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="130.6299551815" y="466.74147177456" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">N</text> <ellipse cx="75.950190987917" cy="357.43732349533" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.950190987917" y="372.030563818" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">N</text> <ellipse cx="427.47288289894" cy="132.10744534562" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="427.47288289894" y="146.70068566829" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">O</text> <ellipse cx="537.95" cy="255.23162568915" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="269.82486601181" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">H</text> <ellipse cx="523.97066998561" cy="188.88347763531" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="523.97066998561" y="203.47671795798" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">H</text> <ellipse cx="401.3263582424" cy="102.96805599766" rx="17.246556744969" ry="17.246556744969" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="401.3263582424" y="117.56129632032" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:33.166455278786px">H</text> </g></svg>
✍: FYIcenter.com
2021-02-04, 121👍, 0💬
Popular Posts:
How to generate the molecule structure in SDF format from a SMILES string? To help you to generate t...
What are SDF (Structural Data File) format specifications? Here is summary of SDF (Structural Data F...
Where to find tutorials on molecule visualization software PyMol? I want to know how to use PyMol. H...
What is chem.nlm.nih.gov ChemIDplus Database? chem.nlm.nih.gov ChemIDplus Database contains over 108...
What are SDF (Structural Data File) format specifications? Here is summary of SDF (Structural Data F...