Collections:
Molecule FYI-1000196
Molecule Summary:
ID: FYI-1000196
SMILES: O=C(N(C(C(OC(=O)CCCCC(=O)OC)([H])[H])([H])[H])[H])C2=C([N]1C(=NC(=C1C([H])([H])[H])C([H])([H])[H])C(=C2[H])N(C(C3=C(C(=C(C(=C3C([H])([H])[H])[H])[H])[H])C([H])([H])[H])([H])[H])[H])[H].[H]
Received at FYIcenter.com on: 2020-12-04
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000196 FYIcenter.com 74 75 0 0 0 0 0 0 0 0999 V2000 7.3655 6.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2316 7.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2316 8.1200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.3655 8.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3655 9.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4995 10.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4995 11.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3655 11.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6335 11.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6335 12.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7675 13.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7675 14.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9014 14.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0354 14.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9014 15.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0354 16.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9761 9.5123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5776 10.2026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7550 8.7277 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1535 8.0374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7685 8.4300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0976 6.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9636 7.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8296 6.6200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.8296 5.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7759 5.3153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.3595 6.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7759 6.9247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0865 7.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6759 7.6826 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2791 8.4646 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4972 8.0679 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3595 6.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3595 5.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9795 6.1200 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3595 6.7400 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9636 5.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0976 5.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5607 5.3100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9636 4.1200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.0976 3.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0976 2.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2316 2.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2316 1.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0976 0.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9636 1.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9636 2.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8296 2.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1396 2.0831 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3666 2.9300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5196 3.1569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5006 0.8100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0976 0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6946 0.8100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3655 2.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6755 3.1569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8286 2.9300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0555 2.0831 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8855 4.2026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4870 3.5123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5006 3.8100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9636 7.7400 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 8.0786 0.0000 H 0 4 0 0 0 0 0 0 0 0 0 0 5.0229 11.7277 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4214 11.0374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2441 12.5123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8455 13.2026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1569 13.2277 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5554 12.5374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3780 14.0123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9795 14.7026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3454 16.6569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4985 16.4300 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7254 15.5831 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 2 0 0 0 0 13 15 1 0 0 0 0 15 16 1 0 0 0 0 5 17 1 0 0 0 0 5 18 1 0 0 0 0 4 19 1 0 0 0 0 4 20 1 0 0 0 0 3 21 1 0 0 0 0 2 22 1 0 0 0 0 22 23 2 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 2 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 24 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 29 32 1 0 0 0 0 27 33 1 0 0 0 0 33 34 1 0 0 0 0 33 35 1 0 0 0 0 33 36 1 0 0 0 0 25 37 1 0 0 0 0 37 38 2 0 0 0 0 22 38 1 0 0 0 0 38 39 1 0 0 0 0 37 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 45 46 1 0 0 0 0 46 47 2 0 0 0 0 42 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 50 1 0 0 0 0 48 51 1 0 0 0 0 46 52 1 0 0 0 0 45 53 1 0 0 0 0 44 54 1 0 0 0 0 43 55 1 0 0 0 0 55 56 1 0 0 0 0 55 57 1 0 0 0 0 55 58 1 0 0 0 0 41 59 1 0 0 0 0 41 60 1 0 0 0 0 40 61 1 0 0 0 0 23 62 1 0 0 0 0 9 64 1 0 0 0 0 9 65 1 0 0 0 0 10 66 1 0 0 0 0 10 67 1 0 0 0 0 11 68 1 0 0 0 0 11 69 1 0 0 0 0 12 70 1 0 0 0 0 12 71 1 0 0 0 0 16 72 1 0 0 0 0 16 73 1 0 0 0 0 16 74 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="301" x2="314" y1="241" y2="248.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="314" x2="327" y1="248.5" y2="256" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="302" x2="315" y1="238" y2="245.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="315" x2="328" y1="245.5" y2="253" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="326.9716702988" x2="326.9716702988" y1="254.02269599986" y2="268.90841903355" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="326.9716702988" x2="326.9716702988" y1="268.90841903355" y2="283.79414206725" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="326.9716702988" x2="314.07914557931" y1="283.79414206725" y2="291.2370035841" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="314.07914557931" x2="301.18662085982" y1="291.2370035841" y2="298.67986510095" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="301.18662085982" x2="301.18662085982" y1="298.67986510095" y2="313.56558813465" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="301.18662085982" x2="301.18662085982" y1="313.56558813465" y2="328.45131116834" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="301.18662085982" x2="288.29558471264" y1="328.45131116834" y2="335.89417268519" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="288.29558471264" x2="275.40454856546" y1="335.89417268519" y2="343.33703420204" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="275.40454856546" x2="275.40454856546" y1="343.33703420204" y2="358.22275723574" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="275.40454856546" x2="275.40454856546" y1="358.22275723574" y2="373.10848026944" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="275" x2="288" y1="375" y2="382.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="288" x2="301" y1="382.5" y2="390" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="277" x2="289.5" y1="372" y2="379.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="289.5" x2="302" y1="379.5" y2="387" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="275.40454856546" x2="262.51351241828" y1="373.10848026944" y2="380.55134178629" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="262.51351241828" x2="249.62247627109" y1="380.55134178629" y2="387.99420330314" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="249.62247627109" x2="249.62247627109" y1="387.99420330314" y2="402.87992633683" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="249.62247627109" x2="249.62247627109" y1="402.87992633683" y2="417.76564937053" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="249.62247627109" x2="236.73144012391" y1="417.76564937053" y2="425.20851088738" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="236.73144012391" x2="223.84040397673" y1="425.20851088738" y2="432.65137240423" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="223.84040397673" x2="223.84040397673" y1="432.65137240423" y2="447.53709543793" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="223.84040397673" x2="223.84040397673" y1="447.53709543793" y2="462.42281847162" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="223.84040397673" x2="210.94787925724" y1="462.42281847162" y2="469.86567998847" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="210.94787925724" x2="198.05535453776" y1="469.86567998847" y2="477.30854150532" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="199" x2="186.5" y1="476" y2="469" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="186.5" x2="174" y1="469" y2="462" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="198" x2="185" y1="479" y2="471.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="185" x2="172" y1="471.5" y2="464" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="198.05535453776" x2="198.05535453776" y1="477.30854150532" y2="492.19426453902" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="198.05535453776" x2="198.05535453776" y1="492.19426453902" y2="507.07998757272" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="198.05535453776" x2="185.16431839058" y1="507.07998757272" y2="514.52284908957" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" /> <line x1="185.16431839058" x2="172.27328224339" y1="514.52284908957" y2="521.96571060642" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="326.9716702988" x2="334.96381499559" y1="283.79414206725" y2="288.4087162077" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="334.96381499559" x2="342.95595969238" y1="288.4087162077" y2="293.02329034814" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #a4a4a4" /> <line x1="326.9716702988" x2="339.86270644598" y1="254.02269599986" y2="246.57983448301" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="339.86270644598" x2="352.75374259316" y1="246.57983448301" y2="239.13697296616" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352" x2="365" y1="241" y2="248.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="365" x2="378" y1="248.5" y2="256" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="354" x2="367" y1="238" y2="245.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="367" x2="380" y1="245.5" y2="253" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="378.53581488752" x2="391.42685103471" y1="254.02269599986" y2="246.57983448301" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="391.42685103471" x2="404.31788718189" y1="246.57983448301" y2="239.13697296616" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="404.31788718189" x2="404.31788718189" y1="239.13697296616" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="404.31788718189" x2="404.31788718189" y1="224.25124993246" y2="209.36552689876" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="405" x2="419" y1="211" y2="206.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="419" x2="433" y1="206.5" y2="202" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="404" x2="418.5" y1="208" y2="203.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="418.5" x2="433" y1="203.5" y2="199" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="432.49060659546" x2="441.17791455793" y1="200.29416728203" y2="212.27270860724" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="441.17791455793" x2="449.8652225204" y1="212.27270860724" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="449" x2="440.5" y1="224" y2="236" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="440.5" x2="432" y1="236" y2="248" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="452" x2="443" y1="226" y2="238" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="443" x2="434" y1="238" y2="250" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="404.31788718189" x2="418.40424688868" y1="239.13697296616" y2="243.67265277453" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="418.40424688868" x2="432.49060659546" y1="243.67265277453" y2="248.20833258289" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="432.49060659546" x2="437.11411216973" y1="248.20833258289" y2="262.35870089873" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="437.11411216973" x2="441.737617744" y1="262.35870089873" y2="276.50906921456" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="449.8652225204" x2="464.75094555409" y1="224.25124993246" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="464.75094555409" x2="479.63666858779" y1="224.25124993246" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="404.31788718189" x2="391.42685103471" y1="209.36552689876" y2="201.92266538191" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="391.42685103471" x2="378.53581488752" y1="201.92266538191" y2="194.47980386506" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="378" x2="365" y1="194" y2="201.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="365" x2="352" y1="201.5" y2="209" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="380" x2="367" y1="196" y2="203.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="367" x2="354" y1="203.5" y2="211" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352.75374259316" x2="352.75374259316" y1="239.13697296616" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352.75374259316" x2="352.75374259316" y1="224.25124993246" y2="209.36552689876" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="378.53581488752" x2="378.53581488752" y1="194.47980386506" y2="179.59408083137" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="378.53581488752" x2="378.53581488752" y1="179.59408083137" y2="164.70835779767" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="378.53581488752" x2="365.64477874034" y1="164.70835779767" y2="157.26549628082" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="365.64477874034" x2="352.75374259316" y1="157.26549628082" y2="149.82263476397" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352.75374259316" x2="352.75374259316" y1="149.82263476397" y2="134.93691173027" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352.75374259316" x2="352.75374259316" y1="134.93691173027" y2="120.05118869658" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="354" x2="341" y1="119" y2="111.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="341" x2="328" y1="111.5" y2="104" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352" x2="339.5" y1="122" y2="114.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="339.5" x2="327" y1="114.5" y2="107" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="326.9716702988" x2="326.9716702988" y1="105.16546566288" y2="90.279742629181" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="326.9716702988" x2="326.9716702988" y1="90.279742629181" y2="75.394019595483" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="328" x2="341" y1="77" y2="69.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="341" x2="354" y1="69.5" y2="62" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="327" x2="339.5" y1="75" y2="67.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="339.5" x2="352" y1="67.5" y2="60" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352.75374259316" x2="365.64477874034" y1="60.508296561785" y2="67.951158078634" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="365.64477874034" x2="378.53581488752" y1="67.951158078634" y2="75.394019595483" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="377" x2="377" y1="76" y2="91" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="377" x2="377" y1="91" y2="106" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="381" x2="381" y1="76" y2="91" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="381" x2="381" y1="91" y2="106" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="352.75374259316" x2="365.64477874034" y1="120.05118869658" y2="112.60832717973" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="365.64477874034" x2="378.53581488752" y1="112.60832717973" y2="105.16546566288" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="378.53581488752" x2="391.42685103471" y1="105.16546566288" y2="112.60832717973" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="391.42685103471" x2="404.31788718189" y1="112.60832717973" y2="120.05118869658" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="326.9716702988" x2="314.07914557931" y1="105.16546566288" y2="112.60832717973" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="314.07914557931" x2="301.18662085982" y1="112.60832717973" y2="120.05118869658" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" /> <line x1="378.53581488752" x2="386.52944815662" y1="164.70835779767" y2="160.09378365722" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" /> <line x1="386.52944815662" x2="394.52308142572" y1="160.09378365722" y2="155.47920951678" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #a4a4a4" /> <ellipse cx="301.18662085982" cy="239.13697296616" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.18662085982" y="246.02961197225" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">O</text> <ellipse cx="326.9716702988" cy="283.79414206725" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.9716702988" y="290.68678107335" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">N</text> <ellipse cx="275.40454856546" cy="343.33703420204" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="275.40454856546" y="350.22967320814" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">O</text> <ellipse cx="301.18662085982" cy="387.99420330314" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.18662085982" y="394.88684230923" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">O</text> <ellipse cx="172.27328224339" cy="462.42281847162" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.27328224339" y="469.31545747772" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">O</text> <ellipse cx="198.05535453776" cy="507.07998757272" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.05535453776" y="513.97262657881" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">O</text> <ellipse cx="342.95595969238" cy="293.02329034814" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="342.95595969238" y="299.91592935424" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">H</text> <ellipse cx="404.31788718189" cy="239.13697296616" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="404.31788718189" y="246.02961197225" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">N</text> <ellipse cx="432.49060659546" cy="200.29416728203" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="432.49060659546" y="207.18680628812" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">N</text> <ellipse cx="378.53581488752" cy="164.70835779767" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="378.53581488752" y="171.60099680377" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">N</text> <ellipse cx="394.52308142572" cy="155.47920951678" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="394.52308142572" y="162.37184852287" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:15.665088650218px">H</text> </g></svg>
✍: FYIcenter.com
2021-01-09, 307👍, 0💬
Popular Posts:
What are examples of Enantiomers Isomers? The picture below gives an example of Enantiomers Isomers:...
What Is Atomic Bond? Atomic Bond is a physical process that ties atoms together to form a molecule. ...
How to download and install Open Babel library RPM package for CentOS computers? Open Babel library ...
What information is displayed in each area on PyMol Screen? Once PyMol is started, you should see tw...
What Are CTfile (Chemical Table File) and CTAB (Connection Table)? CTfile (Chemical Table File) refe...