Molecule FYI-1000196


Molecule Summary:

ID: FYI-1000196
SMILES: O=C(N(C(C(OC(=O)CCCCC(=O)OC)([H])[H])([H])[H])[H])C2=C([N]1C(=NC(=C1C([H])([H])[H])C([H])([H])[H])C(=C2[H])N(C(C3=C(C(=C(C(=C3C([H])([H])[H])[H])[H])[H])C([H])([H])[H])([H])[H])[H])[H].[H]

Received at on: 2020-12-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 74 75  0  0  0  0  0  0  0  0999 V2000
    7.3655    6.6200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2316    7.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2316    8.1200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3655    8.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3655    9.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4995   10.1200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4995   11.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3655   11.6200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6335   11.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6335   12.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7675   13.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7675   14.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9014   14.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0354   14.1200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9014   15.6200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0354   16.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9761    9.5123    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5776   10.2026    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7550    8.7277    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1535    8.0374    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7685    8.4300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    6.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9636    7.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8296    6.6200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8296    5.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7759    5.3153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3595    6.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7759    6.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0865    7.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6759    7.6826    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2791    8.4646    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4972    8.0679    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3595    6.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3595    5.5000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.9795    6.1200    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3595    6.7400    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9636    5.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    5.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5607    5.3100    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9636    4.1200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    3.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    2.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2316    2.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2316    1.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    0.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9636    1.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9636    2.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8296    2.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1396    2.0831    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3666    2.9300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5196    3.1569    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5006    0.8100    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0976    0.0000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6946    0.8100    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3655    2.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6755    3.1569    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8286    2.9300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0555    2.0831    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8855    4.2026    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    3.5123    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5006    3.8100    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9636    7.7400    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    8.0786    0.0000 H   0  4  0  0  0  0  0  0  0  0  0  0
    5.0229   11.7277    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4214   11.0374    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2441   12.5123    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8455   13.2026    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1569   13.2277    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5554   12.5374    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3780   14.0123    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9795   14.7026    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3454   16.6569    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4985   16.4300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254   15.5831    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  7  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  2  0  0  0  0
 13 15  1  0  0  0  0
 15 16  1  0  0  0  0
  5 17  1  0  0  0  0
  5 18  1  0  0  0  0
  4 19  1  0  0  0  0
  4 20  1  0  0  0  0
  3 21  1  0  0  0  0
  2 22  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  1  0  0  0  0
 27 28  2  0  0  0  0
 24 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 29 31  1  0  0  0  0
 29 32  1  0  0  0  0
 27 33  1  0  0  0  0
 33 34  1  0  0  0  0
 33 35  1  0  0  0  0
 33 36  1  0  0  0  0
 25 37  1  0  0  0  0
 37 38  2  0  0  0  0
 22 38  1  0  0  0  0
 38 39  1  0  0  0  0
 37 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  2  0  0  0  0
 43 44  1  0  0  0  0
 44 45  2  0  0  0  0
 45 46  1  0  0  0  0
 46 47  2  0  0  0  0
 42 47  1  0  0  0  0
 47 48  1  0  0  0  0
 48 49  1  0  0  0  0
 48 50  1  0  0  0  0
 48 51  1  0  0  0  0
 46 52  1  0  0  0  0
 45 53  1  0  0  0  0
 44 54  1  0  0  0  0
 43 55  1  0  0  0  0
 55 56  1  0  0  0  0
 55 57  1  0  0  0  0
 55 58  1  0  0  0  0
 41 59  1  0  0  0  0
 41 60  1  0  0  0  0
 40 61  1  0  0  0  0
 23 62  1  0  0  0  0
  9 64  1  0  0  0  0
  9 65  1  0  0  0  0
 10 66  1  0  0  0  0
 10 67  1  0  0  0  0
 11 68  1  0  0  0  0
 11 69  1  0  0  0  0
 12 70  1  0  0  0  0
 12 71  1  0  0  0  0
 16 72  1  0  0  0  0
 16 73  1  0  0  0  0
 16 74  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="301" x2="314" y1="241" y2="248.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="314" x2="327" y1="248.5" y2="256" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="302" x2="315" y1="238" y2="245.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="315" x2="328" y1="245.5" y2="253" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="326.9716702988" x2="326.9716702988" y1="254.02269599986" y2="268.90841903355" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="326.9716702988" x2="326.9716702988" y1="268.90841903355" y2="283.79414206725" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="326.9716702988" x2="314.07914557931" y1="283.79414206725" y2="291.2370035841" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="314.07914557931" x2="301.18662085982" y1="291.2370035841" y2="298.67986510095" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="301.18662085982" x2="301.18662085982" y1="298.67986510095" y2="313.56558813465" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="301.18662085982" x2="301.18662085982" y1="313.56558813465" y2="328.45131116834" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="301.18662085982" x2="288.29558471264" y1="328.45131116834" y2="335.89417268519" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="288.29558471264" x2="275.40454856546" y1="335.89417268519" y2="343.33703420204" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="275.40454856546" x2="275.40454856546" y1="343.33703420204" y2="358.22275723574" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="275.40454856546" x2="275.40454856546" y1="358.22275723574" y2="373.10848026944" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="275" x2="288" y1="375" y2="382.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="288" x2="301" y1="382.5" y2="390" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="277" x2="289.5" y1="372" y2="379.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="289.5" x2="302" y1="379.5" y2="387" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="275.40454856546" x2="262.51351241828" y1="373.10848026944" y2="380.55134178629" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="262.51351241828" x2="249.62247627109" y1="380.55134178629" y2="387.99420330314" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="249.62247627109" x2="249.62247627109" y1="387.99420330314" y2="402.87992633683" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="249.62247627109" x2="249.62247627109" y1="402.87992633683" y2="417.76564937053" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="249.62247627109" x2="236.73144012391" y1="417.76564937053" y2="425.20851088738" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="236.73144012391" x2="223.84040397673" y1="425.20851088738" y2="432.65137240423" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="223.84040397673" x2="223.84040397673" y1="432.65137240423" y2="447.53709543793" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="223.84040397673" x2="223.84040397673" y1="447.53709543793" y2="462.42281847162" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="223.84040397673" x2="210.94787925724" y1="462.42281847162" y2="469.86567998847" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="210.94787925724" x2="198.05535453776" y1="469.86567998847" y2="477.30854150532" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="199" x2="186.5" y1="476" y2="469" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="186.5" x2="174" y1="469" y2="462" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="198" x2="185" y1="479" y2="471.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="185" x2="172" y1="471.5" y2="464" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="198.05535453776" x2="198.05535453776" y1="477.30854150532" y2="492.19426453902" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="198.05535453776" x2="198.05535453776" y1="492.19426453902" y2="507.07998757272" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="198.05535453776" x2="185.16431839058" y1="507.07998757272" y2="514.52284908957" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #ff0000" />
<line x1="185.16431839058" x2="172.27328224339" y1="514.52284908957" y2="521.96571060642" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="326.9716702988" x2="334.96381499559" y1="283.79414206725" y2="288.4087162077" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="334.96381499559" x2="342.95595969238" y1="288.4087162077" y2="293.02329034814" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #a4a4a4" />
<line x1="326.9716702988" x2="339.86270644598" y1="254.02269599986" y2="246.57983448301" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="339.86270644598" x2="352.75374259316" y1="246.57983448301" y2="239.13697296616" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352" x2="365" y1="241" y2="248.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="365" x2="378" y1="248.5" y2="256" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="354" x2="367" y1="238" y2="245.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="367" x2="380" y1="245.5" y2="253" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="378.53581488752" x2="391.42685103471" y1="254.02269599986" y2="246.57983448301" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="391.42685103471" x2="404.31788718189" y1="246.57983448301" y2="239.13697296616" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="404.31788718189" x2="404.31788718189" y1="239.13697296616" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="404.31788718189" x2="404.31788718189" y1="224.25124993246" y2="209.36552689876" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="405" x2="419" y1="211" y2="206.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="419" x2="433" y1="206.5" y2="202" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="404" x2="418.5" y1="208" y2="203.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="418.5" x2="433" y1="203.5" y2="199" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="432.49060659546" x2="441.17791455793" y1="200.29416728203" y2="212.27270860724" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="441.17791455793" x2="449.8652225204" y1="212.27270860724" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="449" x2="440.5" y1="224" y2="236" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="440.5" x2="432" y1="236" y2="248" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="452" x2="443" y1="226" y2="238" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="443" x2="434" y1="238" y2="250" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="404.31788718189" x2="418.40424688868" y1="239.13697296616" y2="243.67265277453" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="418.40424688868" x2="432.49060659546" y1="243.67265277453" y2="248.20833258289" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="432.49060659546" x2="437.11411216973" y1="248.20833258289" y2="262.35870089873" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="437.11411216973" x2="441.737617744" y1="262.35870089873" y2="276.50906921456" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="449.8652225204" x2="464.75094555409" y1="224.25124993246" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="464.75094555409" x2="479.63666858779" y1="224.25124993246" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="404.31788718189" x2="391.42685103471" y1="209.36552689876" y2="201.92266538191" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="391.42685103471" x2="378.53581488752" y1="201.92266538191" y2="194.47980386506" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="378" x2="365" y1="194" y2="201.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="365" x2="352" y1="201.5" y2="209" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="380" x2="367" y1="196" y2="203.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="367" x2="354" y1="203.5" y2="211" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352.75374259316" x2="352.75374259316" y1="239.13697296616" y2="224.25124993246" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352.75374259316" x2="352.75374259316" y1="224.25124993246" y2="209.36552689876" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="378.53581488752" x2="378.53581488752" y1="194.47980386506" y2="179.59408083137" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="378.53581488752" x2="378.53581488752" y1="179.59408083137" y2="164.70835779767" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="378.53581488752" x2="365.64477874034" y1="164.70835779767" y2="157.26549628082" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="365.64477874034" x2="352.75374259316" y1="157.26549628082" y2="149.82263476397" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352.75374259316" x2="352.75374259316" y1="149.82263476397" y2="134.93691173027" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352.75374259316" x2="352.75374259316" y1="134.93691173027" y2="120.05118869658" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="354" x2="341" y1="119" y2="111.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="341" x2="328" y1="111.5" y2="104" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352" x2="339.5" y1="122" y2="114.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="339.5" x2="327" y1="114.5" y2="107" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="326.9716702988" x2="326.9716702988" y1="105.16546566288" y2="90.279742629181" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="326.9716702988" x2="326.9716702988" y1="90.279742629181" y2="75.394019595483" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="328" x2="341" y1="77" y2="69.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="341" x2="354" y1="69.5" y2="62" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="327" x2="339.5" y1="75" y2="67.5" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="339.5" x2="352" y1="67.5" y2="60" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352.75374259316" x2="365.64477874034" y1="60.508296561785" y2="67.951158078634" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="365.64477874034" x2="378.53581488752" y1="67.951158078634" y2="75.394019595483" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="377" x2="377" y1="76" y2="91" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="377" x2="377" y1="91" y2="106" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="381" x2="381" y1="76" y2="91" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="381" x2="381" y1="91" y2="106" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="352.75374259316" x2="365.64477874034" y1="120.05118869658" y2="112.60832717973" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="365.64477874034" x2="378.53581488752" y1="112.60832717973" y2="105.16546566288" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="378.53581488752" x2="391.42685103471" y1="105.16546566288" y2="112.60832717973" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="391.42685103471" x2="404.31788718189" y1="112.60832717973" y2="120.05118869658" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="326.9716702988" x2="314.07914557931" y1="105.16546566288" y2="112.60832717973" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="314.07914557931" x2="301.18662085982" y1="112.60832717973" y2="120.05118869658" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #000000" />
<line x1="378.53581488752" x2="386.52944815662" y1="164.70835779767" y2="160.09378365722" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #0000ff" />
<line x1="386.52944815662" x2="394.52308142572" y1="160.09378365722" y2="155.47920951678" style="stroke-opacity:1; stroke-width: 1.2532070920174; stroke: #a4a4a4" />
<ellipse cx="301.18662085982" cy="239.13697296616" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.18662085982" y="246.02961197225"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">O</text>
<ellipse cx="326.9716702988" cy="283.79414206725" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.9716702988" y="290.68678107335"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">N</text>
<ellipse cx="275.40454856546" cy="343.33703420204" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="275.40454856546" y="350.22967320814"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">O</text>
<ellipse cx="301.18662085982" cy="387.99420330314" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.18662085982" y="394.88684230923"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">O</text>
<ellipse cx="172.27328224339" cy="462.42281847162" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.27328224339" y="469.31545747772"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">O</text>
<ellipse cx="198.05535453776" cy="507.07998757272" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.05535453776" y="513.97262657881"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">O</text>
<ellipse cx="342.95595969238" cy="293.02329034814" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="342.95595969238" y="299.91592935424"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">H</text>
<ellipse cx="404.31788718189" cy="239.13697296616" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="404.31788718189" y="246.02961197225"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">N</text>
<ellipse cx="432.49060659546" cy="200.29416728203" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="432.49060659546" y="207.18680628812"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">N</text>
<ellipse cx="378.53581488752" cy="164.70835779767" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="378.53581488752" y="171.60099680377"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">N</text>
<ellipse cx="394.52308142572" cy="155.47920951678" rx="8.1458460981132" ry="8.1458460981132" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="394.52308142572" y="162.37184852287"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:15.665088650218px">H</text>


2021-01-09, 336👍, 0💬