Collections:
Molecule FYI-1000201
Molecule Summary:
ID: FYI-1000201
SMILES: CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(OC(=O)CCC)C(=O)OCCCCCC
Received at FYIcenter.com on: 2020-12-12
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000201 FYIcenter.com 36 35 0 0 0 0 0 0 0 0999 V2000 12.2507 9.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2507 8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0257 7.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0257 6.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8006 5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8006 4.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7357 3.4614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5755 2.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8006 1.4146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3504 1.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1254 2.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9003 1.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6752 2.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4501 1.4146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6752 3.5364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4501 4.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4501 5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2251 6.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2251 7.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 9.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1254 3.5364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3504 4.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2553 3.6866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3504 5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1254 6.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9003 5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1254 0.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9003 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3504 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5755 0.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8006 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0257 0.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2507 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4758 0.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7009 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 7 6 1 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 10 8 1 0 0 0 0 11 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 14 13 2 0 0 0 0 15 13 1 0 0 0 0 16 15 1 0 0 0 0 17 16 1 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 11 1 0 0 0 0 23 22 1 0 0 0 0 24 23 2 0 0 0 0 25 23 1 0 0 0 0 26 25 1 0 0 0 0 27 26 1 0 0 0 0 28 11 1 0 0 0 0 29 28 2 0 0 0 0 30 28 1 0 0 0 0 31 30 1 0 0 0 0 32 31 1 0 0 0 0 33 32 1 0 0 0 0 34 33 1 0 0 0 0 35 34 1 0 0 0 0 36 35 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="455.29831336857" x2="455.29831336857" y1="409.29375446401" y2="433.1528426831" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="455.29831336857" x2="455.29831336857" y1="433.1528426831" y2="457.01193090219" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="413.97584331572" x2="434.63707834214" y1="385.43466624492" y2="397.36421035447" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="434.63707834214" x2="455.29831336857" y1="397.36421035447" y2="409.29375446401" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="413.97584331572" x2="413.97584331572" y1="337.71648980675" y2="361.57557802584" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="413.97584331572" x2="413.97584331572" y1="361.57557802584" y2="385.43466624492" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="372.65" x2="393.31292165786" y1="313.86077485052" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="393.31292165786" x2="413.97584331572" y1="325.78863232863" y2="337.71648980675" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="372.65" x2="372.65" y1="266.13922514948" y2="290" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="372.65" x2="372.65" y1="290" y2="313.86077485052" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="336.72812378834" x2="354.68906189417" y1="239.7501897843" y2="252.94470746689" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="354.68906189417" x2="372.65" y1="252.94470746689" y2="266.13922514948" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="331.32415668428" x2="334.02614023631" y1="194.56196049221" y2="217.15607513826" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="334.02614023631" x2="336.72812378834" y1="217.15607513826" y2="239.7501897843" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="372" x2="351.5" y1="169" y2="181" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="351.5" x2="331" y1="181" y2="193" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="374" x2="353.5" y1="173" y2="185" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="353.5" x2="333" y1="185" y2="197" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="289.99831336857" x2="310.66123502643" y1="170.70624553599" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="310.66123502643" x2="331.32415668428" y1="182.6341030141" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="248.67584331572" x2="269.33707834214" y1="194.56196049221" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="269.33707834214" x2="289.99831336857" y1="182.6341030141" y2="170.70624553599" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="207.35" x2="228.01292165786" y1="170.70624553599" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="228.01292165786" x2="248.67584331572" y1="182.6341030141" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="166.02415668428" x2="186.68707834214" y1="194.56196049221" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="186.68707834214" x2="207.35" y1="182.6341030141" y2="170.70624553599" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="124" x2="144.5" y1="173" y2="185" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="144.5" x2="165" y1="185" y2="197" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="126" x2="147" y1="169" y2="181" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="147" x2="168" y1="181" y2="193" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="166.02415668428" x2="166.02415668428" y1="242.28013693039" y2="218.4210487113" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="166.02415668428" x2="166.02415668428" y1="218.4210487113" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="124.69831336857" x2="145.36123502643" y1="266.13922514948" y2="254.20968103994" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="145.36123502643" x2="166.02415668428" y1="254.20968103994" y2="242.28013693039" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="124.69831336857" x2="124.69831336857" y1="313.86077485052" y2="290" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="124.69831336857" x2="124.69831336857" y1="290" y2="266.13922514948" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="83.375843315715" x2="104.03707834214" y1="337.71648980675" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="104.03707834214" x2="124.69831336857" y1="325.78863232863" y2="313.86077485052" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="83.375843315715" x2="83.375843315715" y1="385.43466624492" y2="361.57557802584" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="83.375843315715" x2="83.375843315715" y1="361.57557802584" y2="337.71648980675" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="42.05" x2="62.712921657858" y1="409.29375446401" y2="397.36421035447" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="62.712921657858" x2="83.375843315715" y1="397.36421035447" y2="385.43466624492" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="42.05" x2="42.05" y1="457.01193090219" y2="433.1528426831" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="42.05" x2="42.05" y1="433.1528426831" y2="409.29375446401" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="248.67584331572" x2="248.67584331572" y1="242.28013693039" y2="218.4210487113" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="248.67584331572" x2="248.67584331572" y1="218.4210487113" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="289.99831336857" x2="269.33707834214" y1="266.13922514948" y2="254.20968103994" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="269.33707834214" x2="248.67584331572" y1="254.20968103994" y2="242.28013693039" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="320" x2="304.5" y1="246" y2="255.5" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="304.5" x2="289" y1="255.5" y2="265" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="322" x2="307" y1="250" y2="259.5" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="307" x2="292" y1="259.5" y2="269" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="289.99831336857" x2="289.99831336857" y1="313.86077485052" y2="290" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="289.99831336857" x2="289.99831336857" y1="290" y2="266.13922514948" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="248.67584331572" x2="269.33707834214" y1="337.71648980675" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="269.33707834214" x2="289.99831336857" y1="325.78863232863" y2="313.86077485052" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="207.35" x2="228.01292165786" y1="313.86077485052" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="228.01292165786" x2="248.67584331572" y1="325.78863232863" y2="337.71648980675" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="248.67584331572" x2="248.67584331572" y1="146.8471573169" y2="170.70455890456" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="248.67584331572" x2="248.67584331572" y1="170.70455890456" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="207" x2="227.5" y1="126" y2="138" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="227.5" x2="248" y1="138" y2="150" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="209" x2="229.5" y1="121" y2="133" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="229.5" x2="250" y1="133" y2="145" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="289.99831336857" x2="269.33707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="269.33707834214" x2="248.67584331572" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="331.32415668428" x2="310.66123502643" y1="146.8471573169" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="310.66123502643" x2="289.99831336857" y1="134.91761320735" y2="122.98806909781" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" /> <line x1="372.65" x2="351.98707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="351.98707834214" x2="331.32415668428" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="413.97584331572" x2="393.31292165786" y1="146.8471573169" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="393.31292165786" x2="372.65" y1="134.91761320735" y2="122.98806909781" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="455.29831336857" x2="434.63707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="434.63707834214" x2="413.97584331572" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="496.62415668428" x2="475.96123502643" y1="146.8471573169" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="475.96123502643" x2="455.29831336857" y1="134.91761320735" y2="122.98806909781" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="537.95" x2="517.28707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <line x1="517.28707834214" x2="496.62415668428" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" /> <ellipse cx="336.72812378834" cy="239.7501897843" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="336.72812378834" y="250.80059015127" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="372.65" cy="170.70624553599" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65" y="181.75664590296" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="124.69831336857" cy="170.70624553599" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.69831336857" y="181.75664590296" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="166.02415668428" cy="242.28013693039" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.02415668428" y="253.33053729737" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="248.67584331572" cy="242.28013693039" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67584331572" y="253.33053729737" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="320.5229690019" cy="247.3467777483" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.5229690019" y="258.39717811528" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="207.35" cy="122.98806909781" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.35" y="134.03846946479" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> <ellipse cx="289.99831336857" cy="122.98806909781" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="289.99831336857" y="134.03846946479" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:25.114546288582px">O</text> </g></svg>
✍: FYIcenter.com
2021-02-04, 325👍, 0💬
Popular Posts:
How to perform exact match in fastsearch index file using a "babel" command? If you want to perform ...
What are examples of Constitutional Isomers? The picture below gives an example of Constitutional Is...
What is chemwriter.com? chemwriter.com is a Website that offers ChemWriter as commercial software an...
How to create a molecule structure with custom wedge/hash bonds? I don't like the default presentati...
Why "babel ... -o svg -xP300" command is not able scale a molecule SVG image? The "babel ... -o svg ...