Molecule FYI-1000201

A

Molecule Summary:

ID: FYI-1000201
SMILES: CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(OC(=O)CCC)C(=O)OCCCCCC

Received at FYIcenter.com on: 2020-12-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000201
FYIcenter.com

 36 35  0  0  0  0  0  0  0  0999 V2000
   12.2507    9.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2507    8.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0257    7.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0257    6.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8006    5.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8006    4.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7357    3.4614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5755    2.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8006    1.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3504    1.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1254    2.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9003    1.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6752    2.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4501    1.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6752    3.5364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4501    4.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4501    5.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2251    6.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2251    7.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    8.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    9.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1254    3.5364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3504    4.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2553    3.6866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3504    5.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1254    6.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9003    5.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1254    0.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9003    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3504    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5755    0.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8006    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0257    0.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2507    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4758    0.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7009    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 11  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 23  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 11  1  0  0  0  0
 29 28  2  0  0  0  0
 30 28  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="455.29831336857" x2="455.29831336857" y1="409.29375446401" y2="433.1528426831" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="455.29831336857" x2="455.29831336857" y1="433.1528426831" y2="457.01193090219" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="413.97584331572" x2="434.63707834214" y1="385.43466624492" y2="397.36421035447" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="434.63707834214" x2="455.29831336857" y1="397.36421035447" y2="409.29375446401" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="413.97584331572" x2="413.97584331572" y1="337.71648980675" y2="361.57557802584" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="413.97584331572" x2="413.97584331572" y1="361.57557802584" y2="385.43466624492" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="372.65" x2="393.31292165786" y1="313.86077485052" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="393.31292165786" x2="413.97584331572" y1="325.78863232863" y2="337.71648980675" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="372.65" x2="372.65" y1="266.13922514948" y2="290" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="372.65" x2="372.65" y1="290" y2="313.86077485052" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="336.72812378834" x2="354.68906189417" y1="239.7501897843" y2="252.94470746689" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="354.68906189417" x2="372.65" y1="252.94470746689" y2="266.13922514948" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="331.32415668428" x2="334.02614023631" y1="194.56196049221" y2="217.15607513826" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="334.02614023631" x2="336.72812378834" y1="217.15607513826" y2="239.7501897843" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="372" x2="351.5" y1="169" y2="181" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="351.5" x2="331" y1="181" y2="193" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="374" x2="353.5" y1="173" y2="185" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="353.5" x2="333" y1="185" y2="197" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="289.99831336857" x2="310.66123502643" y1="170.70624553599" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="310.66123502643" x2="331.32415668428" y1="182.6341030141" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="248.67584331572" x2="269.33707834214" y1="194.56196049221" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="269.33707834214" x2="289.99831336857" y1="182.6341030141" y2="170.70624553599" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="207.35" x2="228.01292165786" y1="170.70624553599" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="228.01292165786" x2="248.67584331572" y1="182.6341030141" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="166.02415668428" x2="186.68707834214" y1="194.56196049221" y2="182.6341030141" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="186.68707834214" x2="207.35" y1="182.6341030141" y2="170.70624553599" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="124" x2="144.5" y1="173" y2="185" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="144.5" x2="165" y1="185" y2="197" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="126" x2="147" y1="169" y2="181" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="147" x2="168" y1="181" y2="193" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="166.02415668428" x2="166.02415668428" y1="242.28013693039" y2="218.4210487113" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="166.02415668428" x2="166.02415668428" y1="218.4210487113" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="124.69831336857" x2="145.36123502643" y1="266.13922514948" y2="254.20968103994" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="145.36123502643" x2="166.02415668428" y1="254.20968103994" y2="242.28013693039" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="124.69831336857" x2="124.69831336857" y1="313.86077485052" y2="290" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="124.69831336857" x2="124.69831336857" y1="290" y2="266.13922514948" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="83.375843315715" x2="104.03707834214" y1="337.71648980675" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="104.03707834214" x2="124.69831336857" y1="325.78863232863" y2="313.86077485052" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="83.375843315715" x2="83.375843315715" y1="385.43466624492" y2="361.57557802584" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="83.375843315715" x2="83.375843315715" y1="361.57557802584" y2="337.71648980675" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="42.05" x2="62.712921657858" y1="409.29375446401" y2="397.36421035447" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="62.712921657858" x2="83.375843315715" y1="397.36421035447" y2="385.43466624492" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="457.01193090219" y2="433.1528426831" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="433.1528426831" y2="409.29375446401" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="248.67584331572" x2="248.67584331572" y1="242.28013693039" y2="218.4210487113" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="248.67584331572" x2="248.67584331572" y1="218.4210487113" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="289.99831336857" x2="269.33707834214" y1="266.13922514948" y2="254.20968103994" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="269.33707834214" x2="248.67584331572" y1="254.20968103994" y2="242.28013693039" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="320" x2="304.5" y1="246" y2="255.5" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="304.5" x2="289" y1="255.5" y2="265" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="322" x2="307" y1="250" y2="259.5" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="307" x2="292" y1="259.5" y2="269" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="289.99831336857" x2="289.99831336857" y1="313.86077485052" y2="290" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="289.99831336857" x2="289.99831336857" y1="290" y2="266.13922514948" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="248.67584331572" x2="269.33707834214" y1="337.71648980675" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="269.33707834214" x2="289.99831336857" y1="325.78863232863" y2="313.86077485052" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="207.35" x2="228.01292165786" y1="313.86077485052" y2="325.78863232863" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="228.01292165786" x2="248.67584331572" y1="325.78863232863" y2="337.71648980675" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="248.67584331572" x2="248.67584331572" y1="146.8471573169" y2="170.70455890456" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="248.67584331572" x2="248.67584331572" y1="170.70455890456" y2="194.56196049221" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="207" x2="227.5" y1="126" y2="138" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="227.5" x2="248" y1="138" y2="150" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="209" x2="229.5" y1="121" y2="133" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="229.5" x2="250" y1="133" y2="145" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="289.99831336857" x2="269.33707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="269.33707834214" x2="248.67584331572" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="331.32415668428" x2="310.66123502643" y1="146.8471573169" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="310.66123502643" x2="289.99831336857" y1="134.91761320735" y2="122.98806909781" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #ff0000" />
<line x1="372.65" x2="351.98707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="351.98707834214" x2="331.32415668428" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="413.97584331572" x2="393.31292165786" y1="146.8471573169" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="393.31292165786" x2="372.65" y1="134.91761320735" y2="122.98806909781" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="455.29831336857" x2="434.63707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="434.63707834214" x2="413.97584331572" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="496.62415668428" x2="475.96123502643" y1="146.8471573169" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="475.96123502643" x2="455.29831336857" y1="134.91761320735" y2="122.98806909781" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="537.95" x2="517.28707834214" y1="122.98806909781" y2="134.91761320735" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<line x1="517.28707834214" x2="496.62415668428" y1="134.91761320735" y2="146.8471573169" style="stroke-opacity:1; stroke-width: 2.0091637030865; stroke: #000000" />
<ellipse cx="336.72812378834" cy="239.7501897843" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="336.72812378834" y="250.80059015127"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="372.65" cy="170.70624553599" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65" y="181.75664590296"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="124.69831336857" cy="170.70624553599" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.69831336857" y="181.75664590296"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="166.02415668428" cy="242.28013693039" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.02415668428" y="253.33053729737"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="248.67584331572" cy="242.28013693039" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67584331572" y="253.33053729737"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="320.5229690019" cy="247.3467777483" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.5229690019" y="258.39717811528"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="207.35" cy="122.98806909781" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.35" y="134.03846946479"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
<ellipse cx="289.99831336857" cy="122.98806909781" rx="13.059564070062" ry="13.059564070062" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="289.99831336857" y="134.03846946479"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114546288582px">O</text>
</g></svg>

✍: FYIcenter.com

2021-02-04, 124👍, 0💬