Molecule FYI-1000200


Molecule Summary:

ID: FYI-1000200
SMILES: COc1cccc(Nc2ncnn3ccc(CN4CC[C@@H](N)[C@H](O)C4)c23)c1

Received at on: 2020-12-07

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 51 54  0  0  1  0  0  0  0  0999 V2000
    6.6209    3.2225   -0.5209 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2145    2.9992   -0.4023 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8137    1.7369   -0.0978 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7560    0.7337    0.0828 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3502   -0.5505    0.3919 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0057   -0.8404    0.5221 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0581    0.1596    0.3429 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6978   -0.1334    0.4750 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2180   -1.3717    0.0950 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0514   -2.3212   -0.2973 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6147   -3.5234   -0.6686 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3481   -3.8358   -0.6686 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6079   -2.8917   -0.2679 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9497   -2.9255   -0.1671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3928   -1.7206    0.2793 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2817   -0.8968    0.4661 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2928    0.5298    0.9517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6166    1.1190    0.7100 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6037    0.6065    1.6689 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9301    1.3465    1.4822 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4276    1.1388    0.0491 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.6129    0.0784   -0.1221 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6716    1.8935   -0.1530 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3608    1.6364   -0.9302 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.2037    2.7052   -0.7850 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7941    1.3957   -2.2705 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0508    0.8880   -0.6736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1694   -1.6419    0.1261 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4644    1.4517    0.0379 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1082    2.9803    0.4235 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0240    2.5888   -1.3108 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8033    4.2688   -0.7660 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8077    0.9571   -0.0186 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0854   -1.3291    0.5316 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6911   -1.8451    0.7630 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0908    0.5328    0.8334 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3344   -4.2655   -0.9810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5743   -3.7743   -0.4034 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4227   -1.4487    0.4579 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0746    0.5519    2.0194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5367    1.1024    0.4144 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7555   -0.4595    1.4991 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2396    0.7641    2.6841 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6671    0.9550    2.1835 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7820    2.4107    1.6654 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3892    1.5854    0.4858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5109    2.8857   -0.0652 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1656    1.6867   -2.9453 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2852    1.2501   -1.3598 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2052   -0.1793   -0.8324 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7300    2.2310   -0.1020 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 11 12  2  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 23  1  0  0  0  0
 21 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 26  1  0  0  0  0
 24 27  1  0  0  0  0
 18 27  1  0  0  0  0
 16 28  2  0  0  0  0
  9 28  1  0  0  0  0
 13 28  1  0  0  0  0
  7 29  1  0  0  0  0
  3 29  2  0  0  0  0
  1 30  1  0  0  0  0
  1 31  1  0  0  0  0
  1 32  1  0  0  0  0
  4 33  1  0  0  0  0
  5 34  1  0  0  0  0
  6 35  1  0  0  0  0
  8 36  1  0  0  0  0
 11 37  1  0  0  0  0
 14 38  1  0  0  0  0
 15 39  1  0  0  0  0
 17 40  1  0  0  0  0
 17 41  1  0  0  0  0
 19 42  1  0  0  0  0
 19 43  1  0  0  0  0
 20 44  1  0  0  0  0
 20 45  1  0  0  0  0
 23 46  1  0  0  0  0
 23 47  1  0  0  0  0
 26 48  1  0  0  0  0
 27 49  1  0  0  0  0
 27 50  1  0  0  0  0
 29 51  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="521.28135113882" x2="497.22759805206" y1="400.17282512726" y2="396.35371032047" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="497.22759805206" x2="473.1738449653" y1="396.35371032047" y2="392.53459551368" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" />
<line x1="473.1738449653" x2="466.31893580918" y1="392.53459551368" y2="370.94539434657" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" />
<line x1="466.31893580918" x2="459.46402665306" y1="370.94539434657" y2="349.35619317947" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="459.46402665306" x2="475.58024645799" y1="349.35619317947" y2="332.19839660905" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="475.58024645799" x2="491.69646626292" y1="332.19839660905" y2="315.04060003863" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="494" x2="487.5" y1="315" y2="293" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="487.5" x2="481" y1="293" y2="271" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="490" x2="483" y1="316" y2="294" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="483" x2="476" y1="294" y2="272" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="477.8156172831" x2="454.82054402858" y1="271.11308338047" y2="266.15490432767" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="454.82054402858" x2="431.82547077407" y1="266.15490432767" y2="261.19672527488" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="431" x2="414.5" y1="260" y2="277" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="414.5" x2="398" y1="277" y2="294" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="434" x2="418" y1="263" y2="280.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="418" x2="402" y1="280.5" y2="298" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="399.41173865659" x2="376.14643694731" y1="295.40285878847" y2="290.39166022873" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="376.14643694731" x2="352.88113523804" y1="290.39166022873" y2="285.38046166899" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="352.88113523804" x2="344.67508380813" y1="285.38046166899" y2="264.20173410405" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="344.67508380813" x2="336.46903237822" y1="264.20173410405" y2="243.0230065391" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="339" x2="353" y1="245" y2="229" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="353" x2="367" y1="229" y2="213" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="335" x2="349.5" y1="242" y2="225.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="349.5" x2="364" y1="225.5" y2="209" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="364.97642404845" x2="357.50751479576" y1="210.54428276794" y2="189.98297591292" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="357.50751479576" x2="350.03860554306" y1="189.98297591292" y2="169.4216690579" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="351" x2="329.5" y1="168" y2="162.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="329.5" x2="308" y1="162.5" y2="157" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="350" x2="328.5" y1="172" y2="167" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="328.5" x2="307" y1="167" y2="162" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="306.71311683474" x2="290.36258501524" y1="158.73567294825" y2="174.88267827335" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="290.36258501524" x2="274.01205319575" y1="174.88267827335" y2="191.02968359844" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="274.01205319575" x2="251.06315822147" y1="191.02968359844" y2="190.45159994206" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="251.06315822147" x2="228.1142632472" y1="190.45159994206" y2="189.87351628568" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="226" x2="218.5" y1="190" y2="210.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="218.5" x2="211" y1="210.5" y2="231" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="231" x2="223.5" y1="191" y2="211.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="223.5" x2="216" y1="211.5" y2="232" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="212.95752548733" x2="231.96074296081" y1="231.08848655621" y2="245.17799295046" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="231.96074296081" x2="250.96396043428" y1="245.17799295046" y2="259.26749934471" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="250.96396043428" x2="250.77411639328" y1="259.26749934471" y2="283.66673437996" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="250.77411639328" x2="250.58427235228" y1="283.66673437996" y2="308.06596941521" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="250.58427235228" x2="227.94323257963" y1="308.06596941521" y2="318.14309634831" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="227.94323257963" x2="205.30219280699" y1="318.14309634831" y2="328.22022328142" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="205.30219280699" x2="188.41975561135" y1="328.22022328142" y2="319.45490156856" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="188.41975561135" x2="171.53731841572" y1="319.45490156856" y2="310.6895798557" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="171.53731841572" x2="148.8518106695" y1="310.6895798557" y2="323.34584925573" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="148.8518106695" x2="126.16630292328" y1="323.34584925573" y2="336.00211865576" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="126.16630292328" x2="117.65752721178" y1="336.00211865576" y2="332.44981169037" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="117.65752721178" x2="109.14875150027" y1="332.44981169037" y2="328.89750472499" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="109.14875150027" x2="87.872536454813" y1="328.89750472499" y2="341.80518920634" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="87.872536454813" x2="66.596321409356" y1="341.80518920634" y2="354.7128736877" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="109.14875150027" x2="127.39430311642" y1="328.89750472499" y2="337.40799074317" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="127.39430311642" x2="145.63985473257" y1="337.40799074317" y2="345.91847676135" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="145.63985473257" x2="138.22909590685" y1="345.91847676135" y2="341.80176859299" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="138.22909590685" x2="130.81833708113" y1="341.80176859299" y2="337.68506042463" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" />
<line x1="145.63985473257" x2="168.04487218398" y1="345.91847676135" y2="333.11854160056" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="168.04487218398" x2="190.44988963538" y1="333.11854160056" y2="320.31860643978" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="205.30219280699" x2="197.87604122118" y1="328.22022328142" y2="324.2694148606" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="197.87604122118" x2="190.44988963538" y1="324.2694148606" y2="320.31860643978" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="253" x2="272" y1="262" y2="249" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="272" x2="291" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="250" x2="269" y1="258" y2="245" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="269" x2="288" y1="245" y2="232" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="336.46903237822" x2="312.74023755984" y1="243.0230065391" y2="238.40175790142" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="312.74023755984" x2="289.01144274146" y1="238.40175790142" y2="233.78050926373" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="274.01205319575" x2="281.5117479686" y1="191.02968359844" y2="212.40509643108" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="281.5117479686" x2="289.01144274146" y1="212.40509643108" y2="233.78050926373" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="399.41173865659" x2="406.36071467987" y1="295.40285878847" y2="317.50173134493" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="406.36071467987" x2="413.30969070316" y1="317.50173134493" y2="339.60060390139" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="460" x2="437" y1="348" y2="343" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="437" x2="414" y1="343" y2="338" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="459" x2="436" y1="352" y2="347" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="436" x2="413" y1="347" y2="342" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" />
<line x1="352.88113523804" x2="342.49957371667" y1="285.38046166899" y2="296.77452474237" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="342.49957371667" x2="332.11801219529" y1="296.77452474237" y2="308.16858781575" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" />
<line x1="66.596321409356" x2="54.323160704678" y1="354.7128736877" y2="349.44341881993" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="54.323160704678" x2="42.05" y1="349.44341881993" y2="344.17396395216" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" />
<line x1="66.596321409356" x2="69.344784237173" y1="354.7128736877" y2="371.68253652379" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" />
<line x1="69.344784237173" x2="72.093247064991" y1="371.68253652379" y2="388.65219935989" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" />
<line x1="130.81833708113" x2="141.56761453778" y1="337.68506042463" y2="342.66205285086" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" />
<line x1="141.56761453778" x2="152.31689199443" y1="342.66205285086" y2="347.63904527708" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" />
<ellipse cx="473.1738449653" cy="392.53459551368" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="473.1738449653" y="402.9906044438"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">O</text>
<ellipse cx="352.88113523804" cy="285.38046166899" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="352.88113523804" y="295.83647059911"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">N</text>
<ellipse cx="364.97642404845" cy="210.54428276794" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.97642404845" y="221.00029169806"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">N</text>
<ellipse cx="306.71311683474" cy="158.73567294825" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.71311683474" y="169.19168187837"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">N</text>
<ellipse cx="274.01205319575" cy="191.02968359844" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="274.01205319575" y="201.48569252856"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">N</text>
<ellipse cx="205.30219280699" cy="328.22022328142" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="205.30219280699" y="338.67623221154"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">N</text>
<ellipse cx="66.596321409356" cy="354.7128736877" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="66.596321409356" y="365.16888261782"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">N</text>
<ellipse cx="130.81833708113" cy="337.68506042463" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="130.81833708113" y="348.14106935475"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">O</text>
<ellipse cx="332.11801219529" cy="308.16858781575" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.11801219529" y="318.62459674587"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">H</text>
<ellipse cx="42.05" cy="344.17396395216" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="354.62997288228"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">H</text>
<ellipse cx="72.093247064991" cy="388.65219935989" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="72.093247064991" y="399.10820829001"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">H</text>
<ellipse cx="152.31689199443" cy="347.63904527708" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="152.31689199443" y="358.0950542072"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:23.763656659364px">H</text>


2021-02-04, 315👍, 0💬