Collections:
Molecule FYI-1000200
Molecule Summary:
ID: FYI-1000200
SMILES: COc1cccc(Nc2ncnn3ccc(CN4CC[C@@H](N)[C@H](O)C4)c23)c1
Received at FYIcenter.com on: 2020-12-07
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000200 FYIcenter.com 51 54 0 0 1 0 0 0 0 0999 V2000 6.6209 3.2225 -0.5209 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2145 2.9992 -0.4023 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8137 1.7369 -0.0978 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7560 0.7337 0.0828 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3502 -0.5505 0.3919 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0057 -0.8404 0.5221 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0581 0.1596 0.3429 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6978 -0.1334 0.4750 N 0 0 0 0 0 0 0 0 0 0 0 0 1.2180 -1.3717 0.0950 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0514 -2.3212 -0.2973 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6147 -3.5234 -0.6686 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3481 -3.8358 -0.6686 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6079 -2.8917 -0.2679 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.9497 -2.9255 -0.1671 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3928 -1.7206 0.2793 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2817 -0.8968 0.4661 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2928 0.5298 0.9517 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6166 1.1190 0.7100 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.6037 0.6065 1.6689 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9301 1.3465 1.4822 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4276 1.1388 0.0491 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6129 0.0784 -0.1221 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6716 1.8935 -0.1530 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.3608 1.6364 -0.9302 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2037 2.7052 -0.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7941 1.3957 -2.2705 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0508 0.8880 -0.6736 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1694 -1.6419 0.1261 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4644 1.4517 0.0379 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1082 2.9803 0.4235 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0240 2.5888 -1.3108 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8033 4.2688 -0.7660 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8077 0.9571 -0.0186 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0854 -1.3291 0.5316 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6911 -1.8451 0.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0908 0.5328 0.8334 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3344 -4.2655 -0.9810 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5743 -3.7743 -0.4034 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4227 -1.4487 0.4579 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0746 0.5519 2.0194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5367 1.1024 0.4144 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7555 -0.4595 1.4991 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2396 0.7641 2.6841 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6671 0.9550 2.1835 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7820 2.4107 1.6654 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3892 1.5854 0.4858 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5109 2.8857 -0.0652 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1656 1.6867 -2.9453 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2852 1.2501 -1.3598 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2052 -0.1793 -0.8324 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7300 2.2310 -0.1020 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 21 23 1 0 0 0 0 21 24 1 0 0 0 0 24 25 1 0 0 0 0 24 26 1 0 0 0 0 24 27 1 0 0 0 0 18 27 1 0 0 0 0 16 28 2 0 0 0 0 9 28 1 0 0 0 0 13 28 1 0 0 0 0 7 29 1 0 0 0 0 3 29 2 0 0 0 0 1 30 1 0 0 0 0 1 31 1 0 0 0 0 1 32 1 0 0 0 0 4 33 1 0 0 0 0 5 34 1 0 0 0 0 6 35 1 0 0 0 0 8 36 1 0 0 0 0 11 37 1 0 0 0 0 14 38 1 0 0 0 0 15 39 1 0 0 0 0 17 40 1 0 0 0 0 17 41 1 0 0 0 0 19 42 1 0 0 0 0 19 43 1 0 0 0 0 20 44 1 0 0 0 0 20 45 1 0 0 0 0 23 46 1 0 0 0 0 23 47 1 0 0 0 0 26 48 1 0 0 0 0 27 49 1 0 0 0 0 27 50 1 0 0 0 0 29 51 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="521.28135113882" x2="497.22759805206" y1="400.17282512726" y2="396.35371032047" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="497.22759805206" x2="473.1738449653" y1="396.35371032047" y2="392.53459551368" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" /> <line x1="473.1738449653" x2="466.31893580918" y1="392.53459551368" y2="370.94539434657" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" /> <line x1="466.31893580918" x2="459.46402665306" y1="370.94539434657" y2="349.35619317947" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="459.46402665306" x2="475.58024645799" y1="349.35619317947" y2="332.19839660905" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="475.58024645799" x2="491.69646626292" y1="332.19839660905" y2="315.04060003863" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="494" x2="487.5" y1="315" y2="293" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="487.5" x2="481" y1="293" y2="271" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="490" x2="483" y1="316" y2="294" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="483" x2="476" y1="294" y2="272" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="477.8156172831" x2="454.82054402858" y1="271.11308338047" y2="266.15490432767" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="454.82054402858" x2="431.82547077407" y1="266.15490432767" y2="261.19672527488" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="431" x2="414.5" y1="260" y2="277" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="414.5" x2="398" y1="277" y2="294" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="434" x2="418" y1="263" y2="280.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="418" x2="402" y1="280.5" y2="298" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="399.41173865659" x2="376.14643694731" y1="295.40285878847" y2="290.39166022873" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="376.14643694731" x2="352.88113523804" y1="290.39166022873" y2="285.38046166899" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="352.88113523804" x2="344.67508380813" y1="285.38046166899" y2="264.20173410405" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="344.67508380813" x2="336.46903237822" y1="264.20173410405" y2="243.0230065391" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="339" x2="353" y1="245" y2="229" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="353" x2="367" y1="229" y2="213" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="335" x2="349.5" y1="242" y2="225.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="349.5" x2="364" y1="225.5" y2="209" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="364.97642404845" x2="357.50751479576" y1="210.54428276794" y2="189.98297591292" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="357.50751479576" x2="350.03860554306" y1="189.98297591292" y2="169.4216690579" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="351" x2="329.5" y1="168" y2="162.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="329.5" x2="308" y1="162.5" y2="157" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="350" x2="328.5" y1="172" y2="167" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="328.5" x2="307" y1="167" y2="162" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="306.71311683474" x2="290.36258501524" y1="158.73567294825" y2="174.88267827335" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="290.36258501524" x2="274.01205319575" y1="174.88267827335" y2="191.02968359844" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="274.01205319575" x2="251.06315822147" y1="191.02968359844" y2="190.45159994206" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="251.06315822147" x2="228.1142632472" y1="190.45159994206" y2="189.87351628568" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="226" x2="218.5" y1="190" y2="210.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="218.5" x2="211" y1="210.5" y2="231" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="231" x2="223.5" y1="191" y2="211.5" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="223.5" x2="216" y1="211.5" y2="232" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="212.95752548733" x2="231.96074296081" y1="231.08848655621" y2="245.17799295046" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="231.96074296081" x2="250.96396043428" y1="245.17799295046" y2="259.26749934471" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="250.96396043428" x2="250.77411639328" y1="259.26749934471" y2="283.66673437996" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="250.77411639328" x2="250.58427235228" y1="283.66673437996" y2="308.06596941521" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="250.58427235228" x2="227.94323257963" y1="308.06596941521" y2="318.14309634831" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="227.94323257963" x2="205.30219280699" y1="318.14309634831" y2="328.22022328142" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="205.30219280699" x2="188.41975561135" y1="328.22022328142" y2="319.45490156856" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="188.41975561135" x2="171.53731841572" y1="319.45490156856" y2="310.6895798557" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="171.53731841572" x2="148.8518106695" y1="310.6895798557" y2="323.34584925573" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="148.8518106695" x2="126.16630292328" y1="323.34584925573" y2="336.00211865576" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="126.16630292328" x2="117.65752721178" y1="336.00211865576" y2="332.44981169037" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="117.65752721178" x2="109.14875150027" y1="332.44981169037" y2="328.89750472499" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="109.14875150027" x2="87.872536454813" y1="328.89750472499" y2="341.80518920634" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="87.872536454813" x2="66.596321409356" y1="341.80518920634" y2="354.7128736877" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="109.14875150027" x2="127.39430311642" y1="328.89750472499" y2="337.40799074317" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="127.39430311642" x2="145.63985473257" y1="337.40799074317" y2="345.91847676135" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="145.63985473257" x2="138.22909590685" y1="345.91847676135" y2="341.80176859299" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="138.22909590685" x2="130.81833708113" y1="341.80176859299" y2="337.68506042463" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" /> <line x1="145.63985473257" x2="168.04487218398" y1="345.91847676135" y2="333.11854160056" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="168.04487218398" x2="190.44988963538" y1="333.11854160056" y2="320.31860643978" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="205.30219280699" x2="197.87604122118" y1="328.22022328142" y2="324.2694148606" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="197.87604122118" x2="190.44988963538" y1="324.2694148606" y2="320.31860643978" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="253" x2="272" y1="262" y2="249" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="272" x2="291" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="250" x2="269" y1="258" y2="245" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="269" x2="288" y1="245" y2="232" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="336.46903237822" x2="312.74023755984" y1="243.0230065391" y2="238.40175790142" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="312.74023755984" x2="289.01144274146" y1="238.40175790142" y2="233.78050926373" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="274.01205319575" x2="281.5117479686" y1="191.02968359844" y2="212.40509643108" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="281.5117479686" x2="289.01144274146" y1="212.40509643108" y2="233.78050926373" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="399.41173865659" x2="406.36071467987" y1="295.40285878847" y2="317.50173134493" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="406.36071467987" x2="413.30969070316" y1="317.50173134493" y2="339.60060390139" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="460" x2="437" y1="348" y2="343" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="437" x2="414" y1="343" y2="338" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="459" x2="436" y1="352" y2="347" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="436" x2="413" y1="347" y2="342" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #000000" /> <line x1="352.88113523804" x2="342.49957371667" y1="285.38046166899" y2="296.77452474237" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="342.49957371667" x2="332.11801219529" y1="296.77452474237" y2="308.16858781575" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" /> <line x1="66.596321409356" x2="54.323160704678" y1="354.7128736877" y2="349.44341881993" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="54.323160704678" x2="42.05" y1="349.44341881993" y2="344.17396395216" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" /> <line x1="66.596321409356" x2="69.344784237173" y1="354.7128736877" y2="371.68253652379" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #0000ff" /> <line x1="69.344784237173" x2="72.093247064991" y1="371.68253652379" y2="388.65219935989" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" /> <line x1="130.81833708113" x2="141.56761453778" y1="337.68506042463" y2="342.66205285086" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #ff0000" /> <line x1="141.56761453778" x2="152.31689199443" y1="342.66205285086" y2="347.63904527708" style="stroke-opacity:1; stroke-width: 1.9010925327491; stroke: #a4a4a4" /> <ellipse cx="473.1738449653" cy="392.53459551368" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="473.1738449653" y="402.9906044438" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">O</text> <ellipse cx="352.88113523804" cy="285.38046166899" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="352.88113523804" y="295.83647059911" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">N</text> <ellipse cx="364.97642404845" cy="210.54428276794" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.97642404845" y="221.00029169806" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">N</text> <ellipse cx="306.71311683474" cy="158.73567294825" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.71311683474" y="169.19168187837" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">N</text> <ellipse cx="274.01205319575" cy="191.02968359844" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="274.01205319575" y="201.48569252856" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">N</text> <ellipse cx="205.30219280699" cy="328.22022328142" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="205.30219280699" y="338.67623221154" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">N</text> <ellipse cx="66.596321409356" cy="354.7128736877" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="66.596321409356" y="365.16888261782" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">N</text> <ellipse cx="130.81833708113" cy="337.68506042463" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="130.81833708113" y="348.14106935475" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">O</text> <ellipse cx="332.11801219529" cy="308.16858781575" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.11801219529" y="318.62459674587" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">H</text> <ellipse cx="42.05" cy="344.17396395216" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="354.62997288228" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">H</text> <ellipse cx="72.093247064991" cy="388.65219935989" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="72.093247064991" y="399.10820829001" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">H</text> <ellipse cx="152.31689199443" cy="347.63904527708" rx="12.357101462869" ry="12.357101462869" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="152.31689199443" y="358.0950542072" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:23.763656659364px">H</text> </g></svg>
✍: FYIcenter.com
2021-02-04, 118👍, 0💬
Popular Posts:
What are SDF (Structural Data File) format specifications? Here is summary of SDF (Structural Data F...
Collections: Molecule FAQ SDF/Mol File FAQ Open Babel Tutorials PyMol Tutorials JSME Tutorials SMILE...
What Is SDF/Mol file format? SDF (Structural Data File), also call Mol file, is a text file to repre...
biotech.FYIcenter.com is a Website for biotech professionals looking for biotech resources, software...
How to create and edit a molecule structure with JSME molecule editor? To help you to create and edi...