Molecule FYI-1000205

A

Molecule Summary:

ID: FYI-1000205
SMILES: CCC(C)C1=C(C(=CC(=C1)C(C)(C)C)N2N=C3C=CC=CC3=N2)O

Received at FYIcenter.com on: 2020-12-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000205
FYIcenter.com

 24 26  0  0  0  0  0  0  0  0999 V2000
   11.5904    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3780    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1655    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1655    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9531    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5281    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5281    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9531    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1407    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3407    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3158    5.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1695    6.9923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    7.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    8.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    8.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    6.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    6.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0369    5.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  3  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 10  5  1  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 11  1  0  0  0  0
 14 11  1  0  0  0  0
 15  7  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 22 17  1  0  0  0  0
 23 22  2  0  0  0  0
 23 15  1  0  0  0  0
 24  6  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="486.07697059636" x2="512.01348529818" y1="317.89822568678" y2="332.87311870168" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="512.01348529818" x2="537.95" y1="332.87311870168" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="434.19966265185" x2="460.1383166241" y1="347.84801171659" y2="332.87311870168" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="460.1383166241" x2="486.07697059636" y1="332.87311870168" y2="317.89822568678" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="434.19966265185" x2="434.19966265185" y1="407.74758377623" y2="377.79779774641" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="434.19966265185" x2="434.19966265185" y1="377.79779774641" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="382.32663324821" x2="408.26314795003" y1="317.89822568678" y2="332.87311870168" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="408.26314795003" x2="434.19966265185" y1="332.87311870168" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="333" x2="358.5" y1="351" y2="336" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="358.5" x2="384" y1="336" y2="321" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="329" x2="355" y1="346" y2="331" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="355" x2="381" y1="331" y2="316" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="278.57201735919" x2="304.51281060188" y1="317.89822568678" y2="332.87311870168" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="304.51281060188" x2="330.45360384456" y1="332.87311870168" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="276" x2="276" y1="258" y2="288" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="276" x2="276" y1="288" y2="318" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="282" x2="282" y1="258" y2="288" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="282" x2="282" y1="288" y2="318" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="330.45360384456" x2="304.51281060188" y1="228.04886759732" y2="243.02376061223" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="304.51281060188" x2="278.57201735919" y1="243.02376061223" y2="257.99865362714" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="384" x2="358.5" y1="256" y2="241" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="358.5" x2="333" y1="241" y2="226" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="381" x2="355" y1="261" y2="246" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="355" x2="329" y1="246" y2="231" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="382.32663324821" x2="382.32663324821" y1="257.99865362714" y2="287.94843965696" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="382.32663324821" x2="382.32663324821" y1="287.94843965696" y2="317.89822568678" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="330.45360384456" x2="330.45360384456" y1="168.14929553769" y2="198.0990815675" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="330.45360384456" x2="330.45360384456" y1="198.0990815675" y2="228.04886759732" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="390.3531759042" x2="360.40338987438" y1="168.14929553769" y2="168.14929553769" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="360.40338987438" x2="330.45360384456" y1="168.14929553769" y2="168.14929553769" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="330.45360384456" x2="330.45360384456" y1="108.24972347805" y2="138.19950950787" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="330.45360384456" x2="330.45360384456" y1="138.19950950787" y2="168.14929553769" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="270.55403178493" x2="300.50381781474" y1="168.14929553769" y2="168.14929553769" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="300.50381781474" x2="330.45360384456" y1="168.14929553769" y2="168.14929553769" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="226.70326649641" x2="252.6376419278" y1="347.84801171659" y2="332.87311870168" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="252.6376419278" x2="278.57201735919" y1="332.87311870168" y2="317.89822568678" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="220.44376121618" x2="223.57351385629" y1="407.4181361299" y2="377.63307392325" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="223.57351385629" x2="226.70326649641" y1="377.63307392325" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="163" x2="192.5" y1="423" y2="417" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="192.5" x2="222" y1="417" y2="411" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="162" x2="191" y1="417" y2="411" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="191" x2="220" y1="411" y2="405" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="131.89935808945" x2="146.87425110436" y1="471.75027652195" y2="445.80948327927" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="146.87425110436" x2="161.84914411927" y1="445.80948327927" y2="419.86869003658" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="72" x2="102" y1="475" y2="475" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="102" x2="132" y1="475" y2="475" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="72" x2="102" y1="469" y2="469" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="102" x2="132" y1="469" y2="469" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="42.05" x2="57.024893014909" y1="419.86869003658" y2="445.80948327927" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="57.024893014909" x2="71.999786029818" y1="445.80948327927" y2="471.75027652195" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="70" x2="55" y1="367" y2="393" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="55" x2="40" y1="393" y2="419" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="75" x2="60" y1="370" y2="396" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="60" x2="45" y1="396" y2="422" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="131.89935808945" x2="101.94957205964" y1="367.99566063294" y2="367.99566063294" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="101.94957205964" x2="71.999786029818" y1="367.99566063294" y2="367.99566063294" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="131.89935808945" x2="146.87425110436" y1="367.99566063294" y2="393.93217533476" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="146.87425110436" x2="161.84914411927" y1="393.93217533476" y2="419.86869003658" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="170" x2="150" y1="322" y2="344" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="150" x2="130" y1="344" y2="366" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="175" x2="155" y1="326" y2="348.5" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="155" x2="135" y1="348.5" y2="371" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<line x1="171.98500741993" x2="199.34413695817" y1="323.48600005177" y2="335.66700588418" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="199.34413695817" x2="226.70326649641" y1="335.66700588418" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #0000ff" />
<line x1="330.45360384456" x2="330.45360384456" y1="407.74758377623" y2="377.79779774641" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #ff0000" />
<line x1="330.45360384456" x2="330.45360384456" y1="377.79779774641" y2="347.84801171659" style="stroke-opacity:1; stroke-width: 2.5221269340365; stroke: #000000" />
<ellipse cx="226.70326649641" cy="347.84801171659" rx="16.393825071237" ry="16.393825071237" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="226.70326649641" y="361.71970985379"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:31.526586675456px">N</text>
<ellipse cx="220.44376121618" cy="407.4181361299" rx="16.393825071237" ry="16.393825071237" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="220.44376121618" y="421.2898342671"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:31.526586675456px">N</text>
<ellipse cx="171.98500741993" cy="323.48600005177" rx="16.393825071237" ry="16.393825071237" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="171.98500741993" y="337.35769818897"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:31.526586675456px">N</text>
<ellipse cx="330.45360384456" cy="407.74758377623" rx="16.393825071237" ry="16.393825071237" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.45360384456" y="421.61928191343"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.526586675456px">O</text>
</g></svg>

✍: FYIcenter.com

2021-07-19, 191👍, 0💬