Molecule FYI-1000195


Molecule Summary:

ID: FYI-1000195
SMILES: c1c(ccc(c1)CCC(CC(=O)CCc1ccc(cc1)O)OC)O

Received at on: 2020-12-02

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 24 25  0  0  0  0  0  0  0  0999 V2000
   14.5492    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  5  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 11  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20 15  1  0  0  0  0
 21 18  1  0  0  0  0
 22  9  1  0  0  0  0
 23 22  1  0  0  0  0
 24  2  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="504" x2="486.5" y1="238" y2="227.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="486.5" x2="469" y1="227.5" y2="217" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="502" x2="484.5" y1="241" y2="231" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="484.5" x2="467" y1="231" y2="221" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="502.52961482494" x2="502.52961482494" y1="279.77471559611" y2="259.32414678834" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="502.52961482494" x2="502.52961482494" y1="259.32414678834" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="469" x2="486.5" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="486.5" x2="504" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="467" x2="484.5" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="484.5" x2="502" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="431.68592296499" x2="449.39611555252" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="449.39611555252" x2="467.10630814005" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="430" x2="430" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="430" x2="430" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="434" x2="434" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="434" x2="434" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="431.68592296499" x2="449.39611555252" y1="238.87357798057" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="449.39611555252" x2="467.10630814005" y1="228.64829357668" y2="218.4230091728" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="396.26553778993" x2="413.97573037746" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="413.97573037746" x2="431.68592296499" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="360.84515261487" x2="378.5553452024" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="378.5553452024" x2="396.26553778993" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="325.41892442015" x2="343.13203851751" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="343.13203851751" x2="360.84515261487" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="289.99853924509" x2="307.70873183262" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="307.70873183262" x2="325.41892442015" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="254.58107557985" x2="272.28980741247" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="272.28980741247" x2="289.99853924509" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="257" x2="257" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" />
<line x1="257" x2="257" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="253" x2="253" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" />
<line x1="253" x2="253" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="219.16069040479" x2="236.87088299232" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="236.87088299232" x2="254.58107557985" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="183.73446221007" x2="201.44757630743" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="201.44757630743" x2="219.16069040479" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="148.31407703501" x2="166.02426962254" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="166.02426962254" x2="183.73446221007" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="114" x2="132" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="132" x2="150" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="112" x2="130" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="130" x2="148" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="77.470385175061" x2="95.182038517506" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="95.182038517506" x2="112.89369185995" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="76" x2="76" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="76" x2="76" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="80" x2="80" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="80" x2="80" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="112.89369185995" x2="95.182038517506" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="95.182038517506" x2="77.470385175061" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="150" x2="132" y1="238" y2="227.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="132" x2="114" y1="227.5" y2="217" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="148" x2="130" y1="241" y2="231" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="130" x2="112" y1="231" y2="221" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="148.31407703501" x2="148.31407703501" y1="238.87357798057" y2="259.32414678834" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="148.31407703501" x2="148.31407703501" y1="259.32414678834" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="42.05" x2="59.76019258753" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" />
<line x1="59.76019258753" x2="77.470385175061" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="325.41892442015" x2="325.41892442015" y1="341.12642201943" y2="320.67585321166" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" />
<line x1="325.41892442015" x2="325.41892442015" y1="320.67585321166" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="289.99853924509" x2="307.70873183262" y1="361.5769908272" y2="351.35170642332" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<line x1="307.70873183262" x2="325.41892442015" y1="351.35170642332" y2="341.12642201943" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" />
<line x1="537.95" x2="520.23980741247" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" />
<line x1="520.23980741247" x2="502.52961482494" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" />
<ellipse cx="254.58107557985" cy="341.12642201943" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.58107557985" y="350.59830278217"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52700173351px">O</text>
<ellipse cx="42.05" cy="218.4230091728" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="227.89488993554"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52700173351px">O</text>
<ellipse cx="325.41892442015" cy="341.12642201943" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.41892442015" y="350.59830278217"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52700173351px">O</text>
<ellipse cx="537.95" cy="218.4230091728" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="227.89488993554"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52700173351px">O</text>


2020-12-26, 284👍, 0💬