Collections:
Molecule FYI-1000195
Molecule Summary:
ID: FYI-1000195
SMILES: c1c(ccc(c1)CCC(CC(=O)CCc1ccc(cc1)O)OC)O
Received at FYIcenter.com on: 2020-12-02
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000195 FYIcenter.com 24 25 0 0 0 0 0 0 0 0999 V2000 14.5492 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7617 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7617 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5492 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3368 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3368 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6994 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4870 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 4.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0623 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6994 4.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4870 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9741 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 2 0 0 0 0 3 2 1 0 0 0 0 4 3 2 0 0 0 0 5 4 1 0 0 0 0 6 5 2 0 0 0 0 6 1 1 0 0 0 0 7 5 1 0 0 0 0 8 7 1 0 0 0 0 9 8 1 0 0 0 0 10 9 1 0 0 0 0 11 10 1 0 0 0 0 12 11 2 0 0 0 0 13 11 1 0 0 0 0 14 13 1 0 0 0 0 15 14 1 0 0 0 0 16 15 2 0 0 0 0 17 16 1 0 0 0 0 18 17 2 0 0 0 0 19 18 1 0 0 0 0 20 19 2 0 0 0 0 20 15 1 0 0 0 0 21 18 1 0 0 0 0 22 9 1 0 0 0 0 23 22 1 0 0 0 0 24 2 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="504" x2="486.5" y1="238" y2="227.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="486.5" x2="469" y1="227.5" y2="217" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="502" x2="484.5" y1="241" y2="231" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="484.5" x2="467" y1="231" y2="221" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="502.52961482494" x2="502.52961482494" y1="279.77471559611" y2="259.32414678834" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="502.52961482494" x2="502.52961482494" y1="259.32414678834" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="469" x2="486.5" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="486.5" x2="504" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="467" x2="484.5" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="484.5" x2="502" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="431.68592296499" x2="449.39611555252" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="449.39611555252" x2="467.10630814005" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="430" x2="430" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="430" x2="430" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="434" x2="434" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="434" x2="434" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="431.68592296499" x2="449.39611555252" y1="238.87357798057" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="449.39611555252" x2="467.10630814005" y1="228.64829357668" y2="218.4230091728" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="396.26553778993" x2="413.97573037746" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="413.97573037746" x2="431.68592296499" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="360.84515261487" x2="378.5553452024" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="378.5553452024" x2="396.26553778993" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="325.41892442015" x2="343.13203851751" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="343.13203851751" x2="360.84515261487" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="289.99853924509" x2="307.70873183262" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="307.70873183262" x2="325.41892442015" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="254.58107557985" x2="272.28980741247" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="272.28980741247" x2="289.99853924509" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="257" x2="257" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" /> <line x1="257" x2="257" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="253" x2="253" y1="342" y2="321.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" /> <line x1="253" x2="253" y1="321.5" y2="301" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="219.16069040479" x2="236.87088299232" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="236.87088299232" x2="254.58107557985" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="183.73446221007" x2="201.44757630743" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="201.44757630743" x2="219.16069040479" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="148.31407703501" x2="166.02426962254" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="166.02426962254" x2="183.73446221007" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="114" x2="132" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="132" x2="150" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="112" x2="130" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="130" x2="148" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="77.470385175061" x2="95.182038517506" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="95.182038517506" x2="112.89369185995" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="76" x2="76" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="76" x2="76" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="80" x2="80" y1="239" y2="259.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="80" x2="80" y1="259.5" y2="280" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="112.89369185995" x2="95.182038517506" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="95.182038517506" x2="77.470385175061" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="150" x2="132" y1="238" y2="227.5" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="132" x2="114" y1="227.5" y2="217" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="148" x2="130" y1="241" y2="231" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="130" x2="112" y1="231" y2="221" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="148.31407703501" x2="148.31407703501" y1="238.87357798057" y2="259.32414678834" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="148.31407703501" x2="148.31407703501" y1="259.32414678834" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="42.05" x2="59.76019258753" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" /> <line x1="59.76019258753" x2="77.470385175061" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="325.41892442015" x2="325.41892442015" y1="341.12642201943" y2="320.67585321166" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" /> <line x1="325.41892442015" x2="325.41892442015" y1="320.67585321166" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="289.99853924509" x2="307.70873183262" y1="361.5769908272" y2="351.35170642332" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <line x1="307.70873183262" x2="325.41892442015" y1="351.35170642332" y2="341.12642201943" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" /> <line x1="537.95" x2="520.23980741247" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #ff0000" /> <line x1="520.23980741247" x2="502.52961482494" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221601386808; stroke: #000000" /> <ellipse cx="254.58107557985" cy="341.12642201943" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.58107557985" y="350.59830278217" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.52700173351px">O</text> <ellipse cx="42.05" cy="218.4230091728" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="227.89488993554" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.52700173351px">O</text> <ellipse cx="325.41892442015" cy="341.12642201943" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.41892442015" y="350.59830278217" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.52700173351px">O</text> <ellipse cx="537.95" cy="218.4230091728" rx="11.194040901425" ry="11.194040901425" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="227.89488993554" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.52700173351px">O</text> </g></svg>
✍: FYIcenter.com
2020-12-26, 113👍, 0💬
Popular Posts:
Where to find tutorials on molecule visualization software PyMol? I want to know how to use PyMol. H...
How to generate the molecule structure in SDF format from a SMILES string? To help you to generate t...
What Is SDF/Mol file format? SDF (Structural Data File), also call Mol file, is a text file to repre...
What is chem.nlm.nih.gov ChemIDplus Database? chem.nlm.nih.gov ChemIDplus Database contains over 108...
What Is SDF/Mol file format? SDF (Structural Data File), also call Mol file, is a text file to repre...