Collections:
Molecule FYI-1000190
Molecule Summary:
ID: FYI-1000190
SMILES: Cc1cc(C)n2nc(C(=O)N/N=C/c3ccc4c(c3)OCO4)nc2n1
Received at FYIcenter.com on: 2020-11-11
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000190 FYIcenter.com 25 28 0 0 0 0 0 0 0 0999 V2000 16.3572 4.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9572 4.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2572 5.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8572 5.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1572 6.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1572 4.4835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.7878 4.1924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.6414 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4290 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4290 0.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2165 2.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.0041 2.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.7916 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5792 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5792 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3668 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1543 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1543 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3668 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8228 2.5326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8228 0.2674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9204 2.2306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.8572 3.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2572 3.2710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 2 0 0 0 0 5 4 1 0 0 0 0 6 4 1 0 0 0 0 7 6 1 0 0 0 0 8 7 2 0 0 0 0 9 8 1 0 0 0 0 10 9 2 0 0 0 0 11 9 1 0 0 0 0 12 11 1 0 0 0 0 13 12 2 0 0 0 0 14 13 1 0 0 0 0 15 14 2 0 0 0 0 16 15 1 0 0 0 0 17 16 2 0 0 0 0 18 17 1 0 0 0 0 19 18 2 0 0 0 0 19 14 1 0 0 0 0 20 18 1 0 0 0 0 21 20 1 0 0 0 0 22 21 1 0 0 0 0 22 17 1 0 0 0 0 23 8 1 0 0 0 0 24 23 2 0 0 0 0 24 6 1 0 0 0 0 25 24 1 0 0 0 0 25 2 2 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="495.50630548016" x2="516.72815274008" y1="321.20672639572" y2="321.20672639572" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="516.72815274008" x2="537.95" y1="321.20672639572" y2="321.20672639572" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="474.28445822023" x2="484.89538185019" y1="357.9629658499" y2="339.58484612281" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="484.89538185019" x2="495.50630548016" y1="339.58484612281" y2="321.20672639572" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="432" x2="453.5" y1="361" y2="361" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="453.5" x2="475" y1="361" y2="361" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="432" x2="453.5" y1="356" y2="356" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="453.5" x2="475" y1="356" y2="356" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="410.61891644047" x2="421.22984007043" y1="394.71920530409" y2="376.34108557699" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="421.22984007043" x2="431.84076370039" y1="376.34108557699" y2="357.9629658499" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="410.61891644047" x2="421.22984007043" y1="321.20672639572" y2="339.58484612281" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="421.22984007043" x2="431.84076370039" y1="339.58484612281" y2="357.9629658499" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="369.10291981513" x2="389.8609181278" y1="312.38146962805" y2="316.79409801188" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="389.8609181278" x2="410.61891644047" y1="316.79409801188" y2="321.20672639572" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="363" x2="365" y1="271" y2="292" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="365" x2="367" y1="292" y2="313" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="367" x2="369.5" y1="270" y2="291.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="369.5" x2="372" y1="291.5" y2="313" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="327.90828259115" x2="346.28640231825" y1="248.94633647568" y2="259.55726010564" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="346.28640231825" x2="364.66452204534" y1="259.55726010564" y2="270.1681837356" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="326" x2="326" y1="207" y2="228" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #ff0000" /> <line x1="326" x2="326" y1="228" y2="249" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="331" x2="331" y1="207" y2="228" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #ff0000" /> <line x1="331" x2="331" y1="228" y2="249" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="291.1490114445" x2="309.52864701783" y1="270.1681837356" y2="259.55726010564" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="309.52864701783" x2="327.90828259115" y1="259.55726010564" y2="248.94633647568" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="254.39277199032" x2="272.77089171741" y1="248.94633647568" y2="259.55726010564" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="272.77089171741" x2="291.1490114445" y1="259.55726010564" y2="270.1681837356" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="219" x2="237.5" y1="273" y2="262" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="237.5" x2="256" y1="262" y2="251" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="217" x2="235.5" y1="269" y2="258.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="235.5" x2="254" y1="258.5" y2="248" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="180.87726138948" x2="199.25538111657" y1="248.94633647568" y2="259.55726010564" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="199.25538111657" x2="217.63350084367" y1="259.55726010564" y2="270.1681837356" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="179" x2="179" y1="207" y2="228" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="179" x2="179" y1="228" y2="249" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="184" x2="184" y1="207" y2="228" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="184" x2="184" y1="228" y2="249" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="144.12102193529" x2="162.49914166239" y1="185.28079469591" y2="195.89171832587" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="162.49914166239" x2="180.87726138948" y1="195.89171832587" y2="206.50264195584" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="109" x2="127.5" y1="209" y2="198.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="127.5" x2="146" y1="198.5" y2="188" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="107" x2="125.5" y1="205" y2="194.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="125.5" x2="144" y1="194.5" y2="184" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="107.36175078864" x2="107.36175078864" y1="248.94633647568" y2="227.72448921576" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="107.36175078864" x2="107.36175078864" y1="227.72448921576" y2="206.50264195584" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="146" x2="127.5" y1="269" y2="258.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="127.5" x2="109" y1="258.5" y2="248" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="144" x2="125.5" y1="273" y2="262" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="125.5" x2="107" y1="262" y2="251" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="144.12102193529" x2="162.49914166239" y1="270.1681837356" y2="259.55726010564" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="162.49914166239" x2="180.87726138948" y1="259.55726010564" y2="248.94633647568" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="66.994765607806" x2="87.178258198225" y1="262.06143808231" y2="255.503887279" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #ff0000" /> <line x1="87.178258198225" x2="107.36175078864" y1="255.503887279" y2="248.94633647568" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="42.05" x2="54.522382803903" y1="227.72448921576" y2="244.89296364904" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="54.522382803903" x2="66.994765607806" y1="244.89296364904" y2="262.06143808231" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #ff0000" /> <line x1="66.994765607806" x2="54.522382803903" y1="193.3875403492" y2="210.55601478248" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #ff0000" /> <line x1="54.522382803903" x2="42.05" y1="210.55601478248" y2="227.72448921576" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="66.994765607806" x2="87.178258198225" y1="193.3875403492" y2="199.94509115252" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #ff0000" /> <line x1="87.178258198225" x2="107.36175078864" y1="199.94509115252" y2="206.50264195584" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="403.43986868168" x2="384.05219536351" y1="252.90572683589" y2="261.53695528575" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="384.05219536351" x2="364.66452204534" y1="261.53695528575" y2="270.1681837356" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="434" x2="420" y1="283" y2="267.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="420" x2="406" y1="267.5" y2="252" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="431" x2="416.5" y1="286" y2="270.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="416.5" x2="402" y1="270.5" y2="255" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="431.84076370039" x2="421.22984007043" y1="284.44745524906" y2="302.82709082239" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="421.22984007043" x2="410.61891644047" y1="302.82709082239" y2="321.20672639572" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="474.28445822023" x2="453.06261096031" y1="284.44745524906" y2="284.44745524906" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="453.06261096031" x2="431.84076370039" y1="284.44745524906" y2="284.44745524906" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="473" x2="483.5" y1="286" y2="304.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="483.5" x2="494" y1="304.5" y2="323" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <line x1="477" x2="487.5" y1="284" y2="302.5" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #0000ff" /> <line x1="487.5" x2="498" y1="302.5" y2="321" style="stroke-opacity:1; stroke-width: 1.7870951407956; stroke: #000000" /> <ellipse cx="410.61891644047" cy="321.20672639572" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="410.61891644047" y="331.03574967009" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">N</text> <ellipse cx="369.10291981513" cy="312.38146962805" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="369.10291981513" y="322.21049290243" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">N</text> <ellipse cx="327.90828259115" cy="206.50264195584" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.90828259115" y="216.33166523021" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">O</text> <ellipse cx="291.1490114445" cy="270.1681837356" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="291.1490114445" y="279.99720700998" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">N</text> <ellipse cx="254.39277199032" cy="248.94633647568" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.39277199032" y="258.77535975006" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">N</text> <ellipse cx="66.994765607806" cy="262.06143808231" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="66.994765607806" y="271.89046135669" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">O</text> <ellipse cx="66.994765607806" cy="193.3875403492" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="66.994765607806" y="203.21656362358" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">O</text> <ellipse cx="403.43986868168" cy="252.90572683589" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="403.43986868168" y="262.73475011026" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">N</text> <ellipse cx="474.28445822023" cy="284.44745524906" rx="11.616118415171" ry="11.616118415171" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="474.28445822023" y="294.27647852344" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:22.338689259945px">N</text> </g></svg>
✍: FYIcenter.com
2020-12-26, 319👍, 0💬
Popular Posts:
How to convert Convert SDF to SVG (Scalable Vector Graphics) using "sdf2svg" PHP script? I want to s...
What JSME Molecule Editor Options? JSME Molecule Editor Options are parameters that can be passed to...
What is the meaning of the <svg viewBox="..." ...> attribute? I want to understand how...
What is Radical Molecule? A Radical molecule, also called free radical, is molecule that has one or ...
How to display the InChi string and InChi Key of the molecule in JSME editor? JSME does not offer an...