Collections:
Molecule FYI-1000188
Molecule Summary:
ID: FYI-1000188
SMILES: Cl.CC1(C)N=C(N)N=C(N)N1OCCCc1ccccc1
Received at FYIcenter.com on: 2020-11-09
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000188 FYIcenter.com 43 43 0 0 0 0 0 0 0 0999 V2000 -14.6532 -2.8009 -0.3246 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -0.4918 1.9288 -2.0346 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1076 2.4845 -0.6618 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1441 3.3550 -0.7898 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2142 3.2851 -0.1249 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.1102 2.7359 0.6512 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1649 3.5030 1.1031 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.0361 1.4464 1.0226 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.9325 0.7476 0.8314 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8707 -0.5709 1.1864 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1535 1.3741 0.2671 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4749 0.9646 0.5691 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9846 -0.0450 -0.3043 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4109 -0.4082 0.1133 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9566 -1.4892 -0.8219 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3615 -1.8469 -0.4105 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5768 -2.8582 0.5071 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8655 -3.1863 0.8845 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9390 -2.5034 0.3440 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7238 -1.4928 -0.5743 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4353 -1.1676 -0.9549 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.4593 -3.4709 -0.3762 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3285 1.3269 -2.4255 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3836 1.3095 -1.9393 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6940 2.7544 -2.7171 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9434 4.1819 -1.4710 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4145 3.7488 0.1899 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9660 2.7544 -1.1795 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2327 4.4353 0.8437 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8384 3.1099 1.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6431 -1.0029 1.5836 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0545 -1.0745 1.0413 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3518 -0.9305 -0.2443 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9899 0.3291 -1.3281 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0437 0.4773 0.0534 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4056 -0.7823 1.1371 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3238 -2.3747 -0.7619 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9619 -1.1151 -1.8456 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7380 -3.3917 0.9294 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0336 -3.9759 1.6019 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9458 -2.7593 0.6393 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5625 -0.9591 -0.9964 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2672 -0.3780 -1.6724 H 0 0 0 0 0 0 0 0 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 5 6 2 0 0 0 0 6 7 1 0 0 0 0 6 8 1 0 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 3 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 2 0 0 0 0 18 19 1 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 16 21 2 0 0 0 0 1 22 1 0 0 0 0 2 23 1 0 0 0 0 2 24 1 0 0 0 0 2 25 1 0 0 0 0 4 26 1 0 0 0 0 4 27 1 0 0 0 0 4 28 1 0 0 0 0 7 29 1 0 0 0 0 7 30 1 0 0 0 0 10 31 1 0 0 0 0 10 32 1 0 0 0 0 13 33 1 0 0 0 0 13 34 1 0 0 0 0 14 35 1 0 0 0 0 14 36 1 0 0 0 0 15 37 1 0 0 0 0 15 38 1 0 0 0 0 17 39 1 0 0 0 0 18 40 1 0 0 0 0 19 41 1 0 0 0 0 20 42 1 0 0 0 0 21 43 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="339.63202720454" x2="343.66874020086" y1="325.70421161914" y2="331.54284101021" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="343.66874020086" x2="347.70545319717" y1="331.54284101021" y2="337.38147040129" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="347.70545319717" x2="360.85681617865" y1="337.38147040129" y2="346.52764078986" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="360.85681617865" x2="374.00817916013" y1="346.52764078986" y2="355.67381117844" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="347.70545319717" x2="336.07862706047" y1="337.38147040129" y2="345.79321539048" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="336.07862706047" x2="324.45180092377" y1="345.79321539048" y2="354.20496037968" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="326" x2="316.5" y1="354" y2="348" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="316.5" x2="307" y1="348" y2="342" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="324" x2="314.5" y1="356" y2="350" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="314.5" x2="305" y1="350" y2="344" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="305.6236132887" x2="294.54209013094" y1="342.66429001229" y2="350.72405716344" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="294.54209013094" x2="283.46056697318" y1="350.72405716344" y2="358.78382431459" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="305.6236132887" x2="306.40216725285" y1="342.66429001229" y2="329.11576994788" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="306.40216725285" x2="307.180721217" y1="329.11576994788" y2="315.56724988347" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="308" x2="320" y1="317" y2="310" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="320" x2="332" y1="310" y2="303" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="307" x2="318.5" y1="315" y2="307.5" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="318.5" x2="330" y1="307.5" y2="300" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="330.37133268359" x2="331.02065299377" y1="300.8829446163" y2="287.02972731895" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="331.02065299377" x2="331.66997330395" y1="287.02972731895" y2="273.17651002161" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="330.37133268359" x2="341.78171871689" y1="300.8829446163" y2="307.46545552778" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="341.78171871689" x2="353.1921047502" y1="307.46545552778" y2="314.04796643926" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="347.70545319717" x2="350.44877897369" y1="337.38147040129" y2="325.71471842027" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="350.44877897369" x2="353.1921047502" y1="325.71471842027" y2="314.04796643926" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="353.1921047502" x2="367.07579177084" y1="314.04796643926" y2="309.74543137421" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="367.07579177084" x2="380.95947879147" y1="309.74543137421" y2="305.44289630917" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #ff0000" /> <line x1="380.95947879147" x2="386.31479533031" y1="305.44289630917" y2="294.83522988262" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #ff0000" /> <line x1="386.31479533031" x2="391.67011186915" y1="294.83522988262" y2="284.22756345608" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="391.67011186915" x2="406.65596232891" y1="284.22756345608" y2="280.41149328361" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="406.65596232891" x2="421.64181278868" y1="280.41149328361" y2="276.59542311115" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="421.64181278868" x2="427.3753741684" y1="276.59542311115" y2="265.23757108352" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="427.3753741684" x2="433.10893554812" y1="265.23757108352" y2="253.87971905589" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="433.10893554812" x2="447.86994046358" y1="253.87971905589" y2="250.12143628967" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="447.86994046358" x2="462.63094537904" y1="250.12143628967" y2="246.36315352345" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="462.63094537904" x2="464.89305966355" y1="246.36315352345" y2="235.73762553498" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="464.89305966355" x2="467.15517394805" y1="235.73762553498" y2="225.11209754651" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="468" x2="481.5" y1="227" y2="223.5" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="481.5" x2="495" y1="223.5" y2="220" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="467" x2="480.5" y1="224" y2="220.5" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="480.5" x2="494" y1="220.5" y2="217" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="494.23540319505" x2="505.51445421416" y1="218.2175346413" y2="225.39262913683" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="505.51445421416" x2="516.79350523327" y1="225.39262913683" y2="232.56772363236" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="516" x2="513.5" y1="233" y2="243.5" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="513.5" x2="511" y1="243.5" y2="254" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="519" x2="516.5" y1="233" y2="244" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="516.5" x2="514" y1="244" y2="255" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="512.27137802449" x2="498.73336476122" y1="253.80407008772" y2="257.22088181703" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="498.73336476122" x2="485.19535149794" y1="257.22088181703" y2="260.63769354634" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="462" x2="473.5" y1="248" y2="255" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="473.5" x2="485" y1="255" y2="262" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="464" x2="475" y1="246" y2="253" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="475" x2="486" y1="253" y2="260" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #000000" /> <line x1="42.05" x2="54.594069875842" y1="226.31617695665" y2="219.27662019577" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #00bc00" /> <line x1="54.594069875842" x2="67.138139751684" y1="219.27662019577" y2="212.23706343489" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #a4a4a4" /> <line x1="283.46056697318" x2="282.74820585618" y1="358.78382431459" y2="368.57931501335" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="282.74820585618" x2="282.03584473918" y1="368.57931501335" y2="378.37480571211" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #a4a4a4" /> <line x1="283.46056697318" x2="276.38423640832" y1="358.78382431459" y2="354.65360078817" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="276.38423640832" x2="269.30790584347" y1="354.65360078817" y2="350.52337726175" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #a4a4a4" /> <line x1="331.66997330395" x2="323.55452010678" y1="273.17651002161" y2="268.63757193101" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="323.55452010678" x2="315.43906690961" y1="268.63757193101" y2="264.09863384042" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #a4a4a4" /> <line x1="331.66997330395" x2="340.24562439086" y1="273.17651002161" y2="267.8852849697" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #0000ff" /> <line x1="340.24562439086" x2="348.82127547777" y1="267.8852849697" y2="262.59405991779" style="stroke-opacity:1; stroke-width: 1.0940392112513; stroke: #a4a4a4" /> <ellipse cx="42.05" cy="226.31617695665" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="232.33339261853" fill="#00bc00" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">Cl</text> <ellipse cx="324.45180092377" cy="354.20496037968" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="324.45180092377" y="360.22217604156" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">N</text> <ellipse cx="283.46056697318" cy="358.78382431459" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="283.46056697318" y="364.80103997647" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">N</text> <ellipse cx="307.180721217" cy="315.56724988347" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="307.180721217" y="321.58446554535" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">N</text> <ellipse cx="331.66997330395" cy="273.17651002161" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.66997330395" y="279.19372568349" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">N</text> <ellipse cx="353.1921047502" cy="314.04796643926" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="353.1921047502" y="320.06518210114" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">N</text> <ellipse cx="380.95947879147" cy="305.44289630917" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="380.95947879147" y="311.46011197105" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">O</text> <ellipse cx="67.138139751684" cy="212.23706343489" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="67.138139751684" y="218.25427909677" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">H</text> <ellipse cx="282.03584473918" cy="378.37480571211" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="282.03584473918" y="384.39202137399" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">H</text> <ellipse cx="269.30790584347" cy="350.52337726175" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.30790584347" y="356.54059292363" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">H</text> <ellipse cx="315.43906690961" cy="264.09863384042" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="315.43906690961" y="270.1158495023" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">H</text> <ellipse cx="348.82127547777" cy="262.59405991779" rx="7.1112548731331" ry="7.1112548731331" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="348.82127547777" y="268.61127557968" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:13.675490140641px">H</text> </g></svg>
✍: FYIcenter.com
2020-12-15, 339👍, 0💬
Popular Posts:
How many command line tools are provided in the Open Babel package? By default, Open Babel package p...
Where to find FAQ (Frequently Asked Questions) on JSME, Molecule Editor in JavaScript? I want to lea...
Molecule Summary: ID: FYI-1000043 SMILES: CC1=CC=C(C=C1)C(=O)O Received at FYIcenter.com on: 2020-04...
What IS JSME, Molecule Editor in JavaScript? JSME, Molecule Editor in JavaScript is a free molecule ...
Molecule Summary: ID: FYI-1000040 SMILES: c1ccccc1 Received at FYIcenter.com on: 2020-04-21