Molecule FYI-1000183

A

Molecule Summary:

ID: FYI-1000183
SMILES: C[C@H]1CCO[C@H](C1)C=C(C)C

Received at FYIcenter.com on: 2020-11-09

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000183
FYIcenter.com

 29 29  0  0  1  0  0  0  0  0999 V2000
    4.5981    2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981    1.2500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.1350    1.5600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.2500    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.7321   -0.8700    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -1.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2181    2.2500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981    2.8700    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9781    2.2500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0747    0.6423    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6762    1.3326    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6762   -0.8326    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0747   -0.1423    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5200    1.3326    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1215    0.6423    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3291   -0.4400    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6900   -1.7131    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4631   -2.5600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3100   -2.7869    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4221   -2.7869    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -2.5600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0421   -1.7131    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7  9  1  0  0  0  0
  2  9  1  0  0  0  0
  7 10  1  1  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
  1 14  1  0  0  0  0
  1 15  1  0  0  0  0
  1 16  1  0  0  0  0
  4 17  1  0  0  0  0
  4 18  1  0  0  0  0
  5 19  1  0  0  0  0
  5 20  1  0  0  0  0
  9 21  1  0  0  0  0
  9 22  1  0  0  0  0
 10 23  1  0  0  0  0
 12 24  1  0  0  0  0
 12 25  1  0  0  0  0
 12 26  1  0  0  0  0
 13 27  1  0  0  0  0
 13 28  1  0  0  0  0
 13 29  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 363,396 350,484 376,484" fill-opacity="1"  style="fill:#000000" />
<line x1="362.69003871378" x2="400.6480545882" y1="395.93617617423" y2="374.02046262087" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="400.6480545882" x2="438.60607046262" y1="374.02046262087" y2="352.10474906751" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="438.60607046262" x2="438.60607046262" y1="352.10474906751" y2="308.27332196079" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="438.60607046262" x2="438.60607046262" y1="308.27332196079" y2="264.44189485407" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="438.60607046262" x2="400.6480545882" y1="264.44189485407" y2="242.52618130071" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="400.6480545882" x2="362.69003871378" y1="242.52618130071" y2="220.61046774735" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #ff0000" />
<line x1="362.69003871378" x2="324.73202283936" y1="220.61046774735" y2="242.52618130071" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #ff0000" />
<line x1="324.73202283936" x2="286.77400696495" y1="242.52618130071" y2="264.44189485407" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="286.77400696495" x2="286.77400696495" y1="264.44189485407" y2="308.27332196079" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="286.77400696495" x2="286.77400696495" y1="308.27332196079" y2="352.10474906751" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="362.69003871378" x2="324.73202283936" y1="395.93617617423" y2="374.02046262087" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="324.73202283936" x2="286.77400696495" y1="374.02046262087" y2="352.10474906751" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<polygon points=" 287,265 218,210 205,233" fill-opacity="1"  style="fill:#000000" />
<line x1="216" x2="216" y1="221" y2="177" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="216" x2="216" y1="177" y2="133" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="207" x2="207" y1="221" y2="177" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="207" x2="207" y1="177" y2="133" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="210.84920893069" x2="172.89119305627" y1="132.94761353391" y2="111.03189998055" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="172.89119305627" x2="134.93317718185" y1="111.03189998055" y2="89.116186427195" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="210.84920893069" x2="248.81160794782" y1="132.94761353391" y2="111.03189998055" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<line x1="248.81160794782" x2="286.77400696495" y1="111.03189998055" y2="89.116186427195" style="stroke-opacity:1; stroke-width: 3.6910934674173; stroke: #000000" />
<ellipse cx="362.69003871378" cy="220.61046774735" rx="23.992107538213" ry="23.992107538213" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="362.69003871378" y="240.91148181815"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:46.138668342716px">O</text>
</g></svg>

✍: FYIcenter.com

2020-11-22, 356👍, 0💬