Molecule FYI-1000178

A

Molecule Summary:

ID: FYI-1000178
SMILES: CNC[C@H](O)c1ccc(O)c(O)c1

Received at FYIcenter.com on: 2020-10-16

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000178
FYIcenter.com

 13 13  0  0  1  0  0  0  0  0999 V2000
    8.4871    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  4  5  1  1  0  0  0
  6  4  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 11  2  0  0  0  0
 13  6  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="467.10380400844" x2="502.52690200422" y1="371.80179330985" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #0000ff" />
<line x1="502.52690200422" x2="537.95" y1="351.35134498239" y2="330.90089665492" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="396.26345100211" x2="431.68362750527" y1="330.90089665492" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="431.68362750527" x2="467.10380400844" y1="351.35134498239" y2="371.80179330985" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #0000ff" />
<line x1="325.41725501055" x2="360.84035300633" y1="371.80179330985" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="360.84035300633" x2="396.26345100211" y1="351.35134498239" y2="330.90089665492" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<polygon points=" 326,372 314,454 338,454" fill-opacity="1"  style="fill:#000000" />
<line x1="254.57690200422" x2="289.99707850738" y1="330.90089665492" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="289.99707850738" x2="325.41725501055" y1="351.35134498239" y2="371.80179330985" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="186" x2="221.5" y1="376" y2="355.5" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="221.5" x2="257" y1="355.5" y2="335" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="182" x2="217.5" y1="369" y2="348.5" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="217.5" x2="253" y1="348.5" y2="328" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="112.89035300633" x2="148.31345100211" y1="330.90089665492" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="148.31345100211" x2="183.73654899789" y1="351.35134498239" y2="371.80179330985" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="109" x2="109" y1="250" y2="290.5" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="109" x2="109" y1="290.5" y2="331" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="118" x2="118" y1="250" y2="290.5" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="118" x2="118" y1="290.5" y2="331" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="42.05" x2="77.470176503164" y1="208.19820669015" y2="228.64865501761" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #ff0000" />
<line x1="77.470176503164" x2="112.89035300633" y1="228.64865501761" y2="249.09910334508" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="183.73654899789" x2="148.31345100211" y1="208.19820669015" y2="228.64865501761" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="148.31345100211" x2="112.89035300633" y1="228.64865501761" y2="249.09910334508" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="183.73654899789" x2="183.73654899789" y1="126.39641338031" y2="167.29731003523" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #ff0000" />
<line x1="183.73654899789" x2="183.73654899789" y1="167.29731003523" y2="208.19820669015" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="257" x2="221.5" y1="246" y2="225.5" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="221.5" x2="186" y1="225.5" y2="205" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="253" x2="217.5" y1="253" y2="232.5" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="217.5" x2="182" y1="232.5" y2="212" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="254.57690200422" x2="254.57690200422" y1="249.09910334508" y2="290" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<line x1="254.57690200422" x2="254.57690200422" y1="290" y2="330.90089665492" style="stroke-opacity:1; stroke-width: 3.4443091004705; stroke: #000000" />
<ellipse cx="467.10380400844" cy="371.80179330985" rx="22.388009153059" ry="22.388009153059" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.10380400844" y="390.74549336243"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:43.053863755882px">N</text>
<ellipse cx="325.41725501055" cy="453.60358661969" rx="22.388009153059" ry="22.388009153059" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.41725501055" y="472.54728667228"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.053863755882px">O</text>
<ellipse cx="42.05" cy="208.19820669015" rx="22.388009153059" ry="22.388009153059" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="227.14190674274"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.053863755882px">O</text>
<ellipse cx="183.73654899789" cy="126.39641338031" rx="22.388009153059" ry="22.388009153059" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.73654899789" y="145.34011343289"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.053863755882px">O</text>
</g></svg>

✍: FYIcenter.com

2020-11-11, 115👍, 0💬