Molecule FYI-1000175

A

Molecule Summary:

ID: FYI-1000175
SMILES: C#Cc1ccc(C(=O)CCCC(C)(C)N)cc1

Received at FYIcenter.com on: 2020-10-13

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000175
FYIcenter.com

 17 17  0  0  0  0  0  0  0  0999 V2000
    0.0000    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5747    0.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9747    0.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  3  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  8  1  0  0  0  0
 11  8  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 14  1  0  0  0  0
 17 16  2  0  0  0  0
 17 11  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="89" x2="64.5" y1="285" y2="299.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="64.5" x2="40" y1="299.5" y2="314" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="95" x2="70.5" y1="296" y2="310" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="70.5" x2="46" y1="310" y2="324" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="91.642454059582" x2="66.846227029791" y1="290" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="66.846227029791" x2="42.05" y1="304.31534756359" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="141.23081801986" x2="116.43663603972" y1="261.36930487282" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="116.43663603972" x2="91.642454059582" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="139" x2="139" y1="205" y2="233.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #ff0000" />
<line x1="139" x2="139" y1="233.5" y2="262" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="145" x2="145" y1="205" y2="233.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #ff0000" />
<line x1="145" x2="145" y1="233.5" y2="262" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="190.81918198014" x2="166.025" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="166.025" x2="141.23081801986" y1="275.68465243641" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="240.41163603972" x2="215.61540900993" y1="261.36930487282" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="215.61540900993" x2="190.81918198014" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="290" x2="265.20581801986" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="265.20581801986" x2="240.41163603972" y1="275.68465243641" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="339.59245405958" x2="314.79622702979" y1="261.36930487282" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="314.79622702979" x2="290" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="310.9617589324" x2="325.27710649599" y1="211.78094091254" y2="236.57512289268" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="325.27710649599" x2="339.59245405958" y1="236.57512289268" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="368.22314918676" x2="353.90780162317" y1="211.78094091254" y2="236.57512289268" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="353.90780162317" x2="339.59245405958" y1="236.57512289268" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="389.18081801986" x2="364.38663603972" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="364.38663603972" x2="339.59245405958" y1="275.68465243641" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="438" x2="413" y1="259" y2="273.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="413" x2="388" y1="273.5" y2="288" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="441" x2="416" y1="264" y2="278.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="416" x2="391" y1="278.5" y2="293" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="488.36163603972" x2="463.56540900993" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="463.56540900993" x2="438.76918198014" y1="275.68465243641" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="492" x2="492" y1="348" y2="319" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="492" x2="492" y1="319" y2="290" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="486" x2="486" y1="348" y2="319" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="486" x2="486" y1="319" y2="290" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="537.95" x2="513.15581801986" y1="375.89208538154" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #0000ff" />
<line x1="513.15581801986" x2="488.36163603972" y1="361.57673781795" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="438.76918198014" x2="463.56540900993" y1="375.89208538154" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="463.56540900993" x2="488.36163603972" y1="361.57673781795" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="388" x2="413" y1="350" y2="364.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="413" x2="438" y1="364.5" y2="379" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="391" x2="416" y1="345" y2="359.5" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="416" x2="441" y1="359.5" y2="374" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="389.18081801986" x2="389.18081801986" y1="347.26139025436" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<line x1="389.18081801986" x2="389.18081801986" y1="318.63069512718" y2="290" style="stroke-opacity:1; stroke-width: 2.4110096493471; stroke: #000000" />
<ellipse cx="141.23081801986" cy="204.10791461846" rx="15.671562720756" ry="15.671562720756" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="141.23081801986" y="217.36846768986"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137620616839px">O</text>
<ellipse cx="537.95" cy="375.89208538154" rx="15.671562720756" ry="15.671562720756" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="389.15263845295"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137620616839px">N</text>
</g></svg>

✍: FYIcenter.com

2020-10-26, 131👍, 0💬