Molecule FYI-1000173


Molecule Summary:

ID: FYI-1000173
SMILES: CC(C)N(C)C(=O)c2ccc(C#CCCc1ccc(Cl)cc1)cc2

Received at on: 2020-10-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 23 24  0  0  0  0  0  0  0  0999 V2000
    1.2124    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   10.5000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 14  1  0  0  0  0
 18 17  2  0  0  0  0
 18 11  1  0  0  0  0
 19  7  1  0  0  0  0
 20 19  1  0  0  0  0
 21 19  1  0  0  0  0
 22  6  1  0  0  0  0
 23 22  2  0  0  0  0
 23  3  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="175.47779857143" x2="146.84547714286" y1="75.11" y2="58.58" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="146.84547714286" x2="118.21315571429" y1="58.58" y2="42.05" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="175.47779857143" x2="175.47779857143" y1="141.23" y2="108.17" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="175.47779857143" x2="175.47779857143" y1="108.17" y2="75.11" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="235" x2="206.5" y1="172" y2="155.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="206.5" x2="178" y1="155.5" y2="139" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="231" x2="202.5" y1="178" y2="161.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="202.5" x2="174" y1="161.5" y2="145" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="232.73771857143" x2="232.73771857143" y1="240.41" y2="207.35" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="232.73771857143" x2="232.73771857143" y1="207.35" y2="174.29" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="178" x2="206.5" y1="277" y2="260.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="206.5" x2="235" y1="260.5" y2="244" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="174" x2="202.5" y1="271" y2="254.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="202.5" x2="231" y1="254.5" y2="238" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="175.47779857143" x2="175.47779857143" y1="339.59" y2="306.53" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #0000ff" />
<line x1="175.47779857143" x2="175.47779857143" y1="306.53" y2="273.47" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="232.73771857143" x2="204.10775857143" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="204.10775857143" x2="175.47779857143" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #0000ff" />
<line x1="237" x2="237" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #ff0000" />
<line x1="237" x2="237" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="230" x2="230" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #ff0000" />
<line x1="230" x2="230" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="290.00236142857" x2="261.37004" y1="339.59" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="261.37004" x2="232.73771857143" y1="356.12" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="347.26228142857" x2="318.63232142857" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="318.63232142857" x2="290.00236142857" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="403" x2="374.5" y1="337" y2="353.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="374.5" x2="346" y1="353.5" y2="370" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="407" x2="378.5" y1="343" y2="359.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="378.5" x2="350" y1="359.5" y2="376" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="461.78684428571" x2="433.15452285714" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="433.15452285714" x2="404.52220142857" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="466" x2="466" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="466" x2="466" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="459" x2="459" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="459" x2="459" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="519.04676428571" x2="490.41680428571" y1="471.83" y2="455.3" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="490.41680428571" x2="461.78684428571" y1="455.3" y2="438.77" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="519.04676428571" x2="519.04676428571" y1="537.95" y2="504.89" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #db8802" />
<line x1="519.04676428571" x2="519.04676428571" y1="504.89" y2="471.83" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="404.52220142857" x2="433.15452285714" y1="471.83" y2="455.3" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="433.15452285714" x2="461.78684428571" y1="455.3" y2="438.77" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="346" x2="374.5" y1="442" y2="458.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="374.5" x2="403" y1="458.5" y2="475" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="350" x2="378.5" y1="436" y2="452.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="378.5" x2="407" y1="452.5" y2="469" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="347.26228142857" x2="347.26228142857" y1="438.77" y2="405.71" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="347.26228142857" x2="347.26228142857" y1="405.71" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="118.21315571429" x2="146.84547714286" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="146.84547714286" x2="175.47779857143" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #0000ff" />
<line x1="118.21315571429" x2="118.21315571429" y1="438.77" y2="405.71" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="118.21315571429" x2="118.21315571429" y1="405.71" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="60.953235714286" x2="89.583195714286" y1="339.59" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="89.583195714286" x2="118.21315571429" y1="356.12" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="118.21315571429" x2="146.84547714286" y1="240.41" y2="256.94" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="146.84547714286" x2="175.47779857143" y1="256.94" y2="273.47" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="115" x2="115" y1="175" y2="208" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="115" x2="115" y1="208" y2="241" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="122" x2="122" y1="175" y2="208" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="122" x2="122" y1="208" y2="241" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="118.21315571429" x2="146.84547714286" y1="174.29" y2="157.76" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<line x1="146.84547714286" x2="175.47779857143" y1="157.76" y2="141.23" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" />
<ellipse cx="175.47779857143" cy="339.59" rx="18.096081100275" ry="18.096081100275" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="175.47779857143" y="354.90206862331"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.800155962067px">N</text>
<ellipse cx="232.73771857143" cy="438.77" rx="18.096081100275" ry="18.096081100275" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="232.73771857143" y="454.08206862331"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.800155962067px">O</text>
<ellipse cx="519.04676428571" cy="537.95" rx="18.096081100275" ry="18.096081100275" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="519.04676428571" y="553.26206862331"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:34.800155962067px">Br</text>


2020-10-20, 457👍, 0💬