Collections:
Molecule FYI-1000173
Molecule Summary:
ID: FYI-1000173
SMILES: CC(C)N(C)C(=O)c2ccc(C#CCCc1ccc(Cl)cc1)cc2
Received at FYIcenter.com on: 2020-10-12
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000173 FYIcenter.com 23 24 0 0 0 0 0 0 0 0999 V2000 1.2124 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 8.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 10.5000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 2 0 0 0 0 5 4 1 0 0 0 0 6 5 2 0 0 0 0 7 6 1 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 10 8 1 0 0 0 0 11 10 1 0 0 0 0 12 11 2 0 0 0 0 13 12 1 0 0 0 0 14 13 2 0 0 0 0 15 14 1 0 0 0 0 16 15 1 0 0 0 0 17 14 1 0 0 0 0 18 17 2 0 0 0 0 18 11 1 0 0 0 0 19 7 1 0 0 0 0 20 19 1 0 0 0 0 21 19 1 0 0 0 0 22 6 1 0 0 0 0 23 22 2 0 0 0 0 23 3 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="175.47779857143" x2="146.84547714286" y1="75.11" y2="58.58" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="146.84547714286" x2="118.21315571429" y1="58.58" y2="42.05" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="175.47779857143" x2="175.47779857143" y1="141.23" y2="108.17" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="175.47779857143" x2="175.47779857143" y1="108.17" y2="75.11" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="235" x2="206.5" y1="172" y2="155.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="206.5" x2="178" y1="155.5" y2="139" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="231" x2="202.5" y1="178" y2="161.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="202.5" x2="174" y1="161.5" y2="145" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="232.73771857143" x2="232.73771857143" y1="240.41" y2="207.35" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="232.73771857143" x2="232.73771857143" y1="207.35" y2="174.29" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="178" x2="206.5" y1="277" y2="260.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="206.5" x2="235" y1="260.5" y2="244" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="174" x2="202.5" y1="271" y2="254.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="202.5" x2="231" y1="254.5" y2="238" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="175.47779857143" x2="175.47779857143" y1="339.59" y2="306.53" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #0000ff" /> <line x1="175.47779857143" x2="175.47779857143" y1="306.53" y2="273.47" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="232.73771857143" x2="204.10775857143" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="204.10775857143" x2="175.47779857143" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #0000ff" /> <line x1="237" x2="237" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #ff0000" /> <line x1="237" x2="237" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="230" x2="230" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #ff0000" /> <line x1="230" x2="230" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="290.00236142857" x2="261.37004" y1="339.59" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="261.37004" x2="232.73771857143" y1="356.12" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="347.26228142857" x2="318.63232142857" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="318.63232142857" x2="290.00236142857" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="403" x2="374.5" y1="337" y2="353.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="374.5" x2="346" y1="353.5" y2="370" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="407" x2="378.5" y1="343" y2="359.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="378.5" x2="350" y1="359.5" y2="376" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="461.78684428571" x2="433.15452285714" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="433.15452285714" x2="404.52220142857" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="466" x2="466" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="466" x2="466" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="459" x2="459" y1="439" y2="406" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="459" x2="459" y1="406" y2="373" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="519.04676428571" x2="490.41680428571" y1="471.83" y2="455.3" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="490.41680428571" x2="461.78684428571" y1="455.3" y2="438.77" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="519.04676428571" x2="519.04676428571" y1="537.95" y2="504.89" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #db8802" /> <line x1="519.04676428571" x2="519.04676428571" y1="504.89" y2="471.83" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="404.52220142857" x2="433.15452285714" y1="471.83" y2="455.3" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="433.15452285714" x2="461.78684428571" y1="455.3" y2="438.77" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="346" x2="374.5" y1="442" y2="458.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="374.5" x2="403" y1="458.5" y2="475" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="350" x2="378.5" y1="436" y2="452.5" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="378.5" x2="407" y1="452.5" y2="469" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="347.26228142857" x2="347.26228142857" y1="438.77" y2="405.71" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="347.26228142857" x2="347.26228142857" y1="405.71" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="118.21315571429" x2="146.84547714286" y1="372.65" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="146.84547714286" x2="175.47779857143" y1="356.12" y2="339.59" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #0000ff" /> <line x1="118.21315571429" x2="118.21315571429" y1="438.77" y2="405.71" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="118.21315571429" x2="118.21315571429" y1="405.71" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="60.953235714286" x2="89.583195714286" y1="339.59" y2="356.12" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="89.583195714286" x2="118.21315571429" y1="356.12" y2="372.65" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="118.21315571429" x2="146.84547714286" y1="240.41" y2="256.94" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="146.84547714286" x2="175.47779857143" y1="256.94" y2="273.47" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="115" x2="115" y1="175" y2="208" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="115" x2="115" y1="208" y2="241" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="122" x2="122" y1="175" y2="208" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="122" x2="122" y1="208" y2="241" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="118.21315571429" x2="146.84547714286" y1="174.29" y2="157.76" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <line x1="146.84547714286" x2="175.47779857143" y1="157.76" y2="141.23" style="stroke-opacity:1; stroke-width: 2.7840124769653; stroke: #000000" /> <ellipse cx="175.47779857143" cy="339.59" rx="18.096081100275" ry="18.096081100275" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="175.47779857143" y="354.90206862331" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:34.800155962067px">N</text> <ellipse cx="232.73771857143" cy="438.77" rx="18.096081100275" ry="18.096081100275" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="232.73771857143" y="454.08206862331" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:34.800155962067px">O</text> <ellipse cx="519.04676428571" cy="537.95" rx="18.096081100275" ry="18.096081100275" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="519.04676428571" y="553.26206862331" fill="#db8802" style="text-anchor:middle; font-family:sans-serif;font-size:34.800155962067px">Br</text> </g></svg>
✍: FYIcenter.com
2020-10-20, 457👍, 0💬
Popular Posts:
What is Formal Charge of an atom in a molecule? And what is the total formal charge of a molecule? T...
What information is displayed in each area on PyMol Screen? Once PyMol is started, you should see tw...
How to view the molecule structure specified in a SDF/Mol file? To help you to view the molecule str...
How to split a file with a large number of molecules? You can split a file with a large number of mo...
How to create a molecule structure with custom wedge/hash bonds? I don't like the default presentati...