Molecule FYI-1000172


Molecule Summary:

ID: FYI-1000172
SMILES: COc1cc(/C=C/c2cc(/C=C/c3ccc(O)c(OC)c3)[nH]n2)ccc1O

Received at on: 2020-10-06

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 27 29  0  0  0  0  0  0  0  0999 V2000
   15.8090    7.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5966    6.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5966    5.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3842    4.3973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3842    2.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1718    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9592    2.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7468    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4679    2.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5310    1.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1387    1.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5694    3.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1769    3.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6075    4.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    4.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3923    3.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.8370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9617    2.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1389    1.2790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7083    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3541    2.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2310    0.6139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6005    0.9050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5966    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8090    2.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8090    4.3973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0215    5.0973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 18  2  0  0  0  0
 21 13  1  0  0  0  0
 22 10  1  0  0  0  0
 23 22  1  0  0  0  0
 23  8  2  0  0  0  0
 24  5  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 26  3  1  0  0  0  0
 27 26  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="467.30358752166" x2="484.96446229768" y1="374.44852304439" y2="384.64533296125" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" />
<line x1="484.96446229768" x2="502.6253370737" y1="384.64533296125" y2="394.84214287812" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="467.30358752166" x2="467.30358752166" y1="333.66128337691" y2="354.05490321065" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="467.30358752166" x2="467.30358752166" y1="354.05490321065" y2="374.44852304439" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" />
<line x1="431" x2="449" y1="316" y2="326" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="449" x2="467" y1="326" y2="336" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="434" x2="451.5" y1="312" y2="322" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="451.5" x2="469" y1="322" y2="332" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="431.98183796963" x2="431.98183796963" y1="272.48042387569" y2="292.87404370943" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="431.98183796963" x2="431.98183796963" y1="292.87404370943" y2="313.26766354317" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="396.66008841759" x2="414.32096319361" y1="252.08680404195" y2="262.28361395882" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="414.32096319361" x2="431.98183796963" y1="262.28361395882" y2="272.48042387569" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="363" x2="380.5" y1="275" y2="264.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="380.5" x2="398" y1="264.5" y2="254" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="361" x2="378.5" y1="271" y2="261" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="378.5" x2="396" y1="261" y2="251" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="326.01076256499" x2="343.67163734101" y1="252.08680404195" y2="262.28361395882" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="343.67163734101" x2="361.33251211703" y1="262.28361395882" y2="272.48042387569" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="288.75161912875" x2="307.38119084687" y1="268.6726437153" y2="260.37972387862" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="307.38119084687" x2="326.01076256499" y1="260.37972387862" y2="252.08680404195" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="260" x2="274" y1="240" y2="255.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="274" x2="288" y1="255.5" y2="271" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="264" x2="277.5" y1="237" y2="252.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="277.5" x2="291" y1="252.5" y2="268" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="220.89330581911" x2="241.17476074377" y1="242.62707781335" y2="240.49594454073" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="241.17476074377" x2="261.45621566842" y1="240.49594454073" y2="238.3648112681" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="207" x2="215" y1="281" y2="262.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="215" x2="223" y1="262.5" y2="244" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="203" x2="211" y1="280" y2="261" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="211" x2="219" y1="261" y2="242" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="163.73872954792" x2="184.02309784684" y1="284.15140116911" y2="282.02026789648" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="184.02309784684" x2="204.30746614576" y1="282.02026789648" y2="279.88913462386" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="150" x2="158" y1="323" y2="304.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="158" x2="166" y1="304.5" y2="286" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="146" x2="154" y1="321" y2="302.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="154" x2="162" y1="302.5" y2="284" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="106.587066651" x2="126.86852157565" y1="325.67863789913" y2="323.54604793937" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="126.86852157565" x2="147.14997650031" y1="323.54604793937" y2="321.41345797961" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="81" x2="93" y1="294" y2="310.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="93" x2="105" y1="310.5" y2="327" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="85" x2="97" y1="292" y2="308.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="97" x2="109" y1="308.5" y2="325" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="42.05" x2="62.331454924654" y1="296.94402755339" y2="294.81289428076" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" />
<line x1="62.331454924654" x2="82.612909849308" y1="294.81289428076" y2="292.68176100814" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="99.201662896925" x2="90.907286373116" y1="255.41679082337" y2="274.04927591575" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="90.907286373116" x2="82.612909849308" y1="274.04927591575" y2="292.68176100814" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="75.230419469495" x2="87.21604118321" y1="222.41991393238" y2="238.91835237788" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" />
<line x1="87.21604118321" x2="99.201662896925" y1="238.91835237788" y2="255.41679082337" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="91.819172517111" x2="83.524795993303" y1="185.15785712188" y2="203.78888552713" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="83.524795993303" x2="75.230419469495" y1="203.78888552713" y2="222.41991393238" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" />
<line x1="140" x2="119.5" y1="250" y2="252" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="119.5" x2="99" y1="252" y2="254" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="140" x2="120" y1="254" y2="256" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="120" x2="100" y1="256" y2="258" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="139.76748612049" x2="151.75310783421" y1="251.15452427812" y2="267.65296272361" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="151.75310783421" x2="163.73872954792" y1="267.65296272361" y2="284.15140116911" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="281.84983550216" x2="271.65302558529" y1="203.04306171606" y2="220.70393649208" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" />
<line x1="271.65302558529" x2="261.45621566842" y1="220.70393649208" y2="238.3648112681" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="321.74849601974" x2="301.79916576095" y1="211.52389419264" y2="207.28347795435" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" />
<line x1="301.79916576095" x2="281.84983550216" y1="207.28347795435" y2="203.04306171606" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" />
<line x1="320" x2="322" y1="212" y2="232.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" />
<line x1="322" x2="324" y1="232.5" y2="253" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="324" x2="326.5" y1="212" y2="232" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" />
<line x1="326.5" x2="329" y1="232" y2="252" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="467" x2="449" y1="251" y2="261" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="449" x2="431" y1="261" y2="271" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="469" x2="451.5" y1="254" y2="264.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="451.5" x2="434" y1="264.5" y2="275" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="502.6253370737" x2="484.96446229768" y1="272.48042387569" y2="262.28361395882" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="484.96446229768" x2="467.30358752166" y1="262.28361395882" y2="252.08680404195" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="505" x2="505" y1="314" y2="293.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="505" x2="505" y1="293.5" y2="273" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="501" x2="501" y1="314" y2="293.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="501" x2="501" y1="293.5" y2="273" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="502.6253370737" x2="484.96446229768" y1="313.26766354317" y2="323.46447346004" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="484.96446229768" x2="467.30358752166" y1="323.46447346004" y2="333.66128337691" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<line x1="537.95" x2="520.28766853685" y1="333.66128337691" y2="323.46447346004" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" />
<line x1="520.28766853685" x2="502.6253370737" y1="323.46447346004" y2="313.26766354317" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" />
<ellipse cx="467.30358752166" cy="374.44852304439" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.30358752166" y="383.89400052273"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.466994268963px">O</text>
<ellipse cx="42.05" cy="296.94402755339" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="306.38950503173"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.466994268963px">O</text>
<ellipse cx="75.230419469495" cy="222.41991393238" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.230419469495" y="231.86539141072"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.466994268963px">O</text>
<ellipse cx="281.84983550216" cy="203.04306171606" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="281.84983550216" y="212.48853919441"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.466994268963px">N</text>
<ellipse cx="321.74849601974" cy="211.52389419264" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="321.74849601974" y="220.96937167098"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.466994268963px">N</text>
<ellipse cx="537.95" cy="333.66128337691" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="343.10676085525"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.466994268963px">O</text>


2020-10-10, 560👍, 0💬