Collections:
Molecule FYI-1000172
Molecule Summary:
ID: FYI-1000172
SMILES: COc1cc(/C=C/c2cc(/C=C/c3ccc(O)c(OC)c3)[nH]n2)ccc1O
Received at FYIcenter.com on: 2020-10-06
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000172 FYIcenter.com 27 29 0 0 0 0 0 0 0 0999 V2000 15.8090 7.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5966 6.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5966 5.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3842 4.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3842 2.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1718 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9592 2.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7468 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4679 2.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5310 1.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1387 1.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5694 3.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1769 3.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6075 4.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2152 4.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3923 3.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.8370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9617 2.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1389 1.2790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7083 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3541 2.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2310 0.6139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.6005 0.9050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.5966 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8090 2.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8090 4.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0215 5.0973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 2 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 8 1 0 0 0 0 10 9 2 0 0 0 0 11 10 1 0 0 0 0 12 11 2 0 0 0 0 13 12 1 0 0 0 0 14 13 2 0 0 0 0 15 14 1 0 0 0 0 16 15 2 0 0 0 0 17 16 1 0 0 0 0 18 16 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 18 2 0 0 0 0 21 13 1 0 0 0 0 22 10 1 0 0 0 0 23 22 1 0 0 0 0 23 8 2 0 0 0 0 24 5 2 0 0 0 0 25 24 1 0 0 0 0 26 25 2 0 0 0 0 26 3 1 0 0 0 0 27 26 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="467.30358752166" x2="484.96446229768" y1="374.44852304439" y2="384.64533296125" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" /> <line x1="484.96446229768" x2="502.6253370737" y1="384.64533296125" y2="394.84214287812" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="467.30358752166" x2="467.30358752166" y1="333.66128337691" y2="354.05490321065" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="467.30358752166" x2="467.30358752166" y1="354.05490321065" y2="374.44852304439" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" /> <line x1="431" x2="449" y1="316" y2="326" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="449" x2="467" y1="326" y2="336" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="434" x2="451.5" y1="312" y2="322" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="451.5" x2="469" y1="322" y2="332" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="431.98183796963" x2="431.98183796963" y1="272.48042387569" y2="292.87404370943" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="431.98183796963" x2="431.98183796963" y1="292.87404370943" y2="313.26766354317" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="396.66008841759" x2="414.32096319361" y1="252.08680404195" y2="262.28361395882" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="414.32096319361" x2="431.98183796963" y1="262.28361395882" y2="272.48042387569" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="363" x2="380.5" y1="275" y2="264.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="380.5" x2="398" y1="264.5" y2="254" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="361" x2="378.5" y1="271" y2="261" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="378.5" x2="396" y1="261" y2="251" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="326.01076256499" x2="343.67163734101" y1="252.08680404195" y2="262.28361395882" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="343.67163734101" x2="361.33251211703" y1="262.28361395882" y2="272.48042387569" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="288.75161912875" x2="307.38119084687" y1="268.6726437153" y2="260.37972387862" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="307.38119084687" x2="326.01076256499" y1="260.37972387862" y2="252.08680404195" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="260" x2="274" y1="240" y2="255.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="274" x2="288" y1="255.5" y2="271" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="264" x2="277.5" y1="237" y2="252.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="277.5" x2="291" y1="252.5" y2="268" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="220.89330581911" x2="241.17476074377" y1="242.62707781335" y2="240.49594454073" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="241.17476074377" x2="261.45621566842" y1="240.49594454073" y2="238.3648112681" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="207" x2="215" y1="281" y2="262.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="215" x2="223" y1="262.5" y2="244" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="203" x2="211" y1="280" y2="261" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="211" x2="219" y1="261" y2="242" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="163.73872954792" x2="184.02309784684" y1="284.15140116911" y2="282.02026789648" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="184.02309784684" x2="204.30746614576" y1="282.02026789648" y2="279.88913462386" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="150" x2="158" y1="323" y2="304.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="158" x2="166" y1="304.5" y2="286" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="146" x2="154" y1="321" y2="302.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="154" x2="162" y1="302.5" y2="284" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="106.587066651" x2="126.86852157565" y1="325.67863789913" y2="323.54604793937" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="126.86852157565" x2="147.14997650031" y1="323.54604793937" y2="321.41345797961" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="81" x2="93" y1="294" y2="310.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="93" x2="105" y1="310.5" y2="327" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="85" x2="97" y1="292" y2="308.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="97" x2="109" y1="308.5" y2="325" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="42.05" x2="62.331454924654" y1="296.94402755339" y2="294.81289428076" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" /> <line x1="62.331454924654" x2="82.612909849308" y1="294.81289428076" y2="292.68176100814" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="99.201662896925" x2="90.907286373116" y1="255.41679082337" y2="274.04927591575" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="90.907286373116" x2="82.612909849308" y1="274.04927591575" y2="292.68176100814" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="75.230419469495" x2="87.21604118321" y1="222.41991393238" y2="238.91835237788" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" /> <line x1="87.21604118321" x2="99.201662896925" y1="238.91835237788" y2="255.41679082337" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="91.819172517111" x2="83.524795993303" y1="185.15785712188" y2="203.78888552713" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="83.524795993303" x2="75.230419469495" y1="203.78888552713" y2="222.41991393238" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" /> <line x1="140" x2="119.5" y1="250" y2="252" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="119.5" x2="99" y1="252" y2="254" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="140" x2="120" y1="254" y2="256" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="120" x2="100" y1="256" y2="258" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="139.76748612049" x2="151.75310783421" y1="251.15452427812" y2="267.65296272361" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="151.75310783421" x2="163.73872954792" y1="267.65296272361" y2="284.15140116911" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="281.84983550216" x2="271.65302558529" y1="203.04306171606" y2="220.70393649208" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" /> <line x1="271.65302558529" x2="261.45621566842" y1="220.70393649208" y2="238.3648112681" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="321.74849601974" x2="301.79916576095" y1="211.52389419264" y2="207.28347795435" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" /> <line x1="301.79916576095" x2="281.84983550216" y1="207.28347795435" y2="203.04306171606" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" /> <line x1="320" x2="322" y1="212" y2="232.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" /> <line x1="322" x2="324" y1="232.5" y2="253" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="324" x2="326.5" y1="212" y2="232" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #0000ff" /> <line x1="326.5" x2="329" y1="232" y2="252" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="467" x2="449" y1="251" y2="261" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="449" x2="431" y1="261" y2="271" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="469" x2="451.5" y1="254" y2="264.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="451.5" x2="434" y1="264.5" y2="275" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="502.6253370737" x2="484.96446229768" y1="272.48042387569" y2="262.28361395882" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="484.96446229768" x2="467.30358752166" y1="262.28361395882" y2="252.08680404195" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="505" x2="505" y1="314" y2="293.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="505" x2="505" y1="293.5" y2="273" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="501" x2="501" y1="314" y2="293.5" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="501" x2="501" y1="293.5" y2="273" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="502.6253370737" x2="484.96446229768" y1="313.26766354317" y2="323.46447346004" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="484.96446229768" x2="467.30358752166" y1="323.46447346004" y2="333.66128337691" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <line x1="537.95" x2="520.28766853685" y1="333.66128337691" y2="323.46447346004" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #ff0000" /> <line x1="520.28766853685" x2="502.6253370737" y1="323.46447346004" y2="313.26766354317" style="stroke-opacity:1; stroke-width: 1.717359541517; stroke: #000000" /> <ellipse cx="467.30358752166" cy="374.44852304439" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.30358752166" y="383.89400052273" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.466994268963px">O</text> <ellipse cx="42.05" cy="296.94402755339" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="306.38950503173" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.466994268963px">O</text> <ellipse cx="75.230419469495" cy="222.41991393238" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.230419469495" y="231.86539141072" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.466994268963px">O</text> <ellipse cx="281.84983550216" cy="203.04306171606" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="281.84983550216" y="212.48853919441" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:21.466994268963px">N</text> <ellipse cx="321.74849601974" cy="211.52389419264" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="321.74849601974" y="220.96937167098" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:21.466994268963px">N</text> <ellipse cx="537.95" cy="333.66128337691" rx="11.162837019861" ry="11.162837019861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="343.10676085525" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.466994268963px">O</text> </g></svg>
✍: FYIcenter.com
2020-10-10, 560👍, 0💬
Popular Posts:
Where to find tutorials on molecule visualization software PyMol? I want to know how to use PyMol. H...
Where to find FAQ (Frequently Asked Questions) on running Open Babel on macOS? Here is a list of tut...
How to run OpenBabelGUI on Windows computers? Open Babel GUI is the graphical user interface for Ope...
What JSME Molecule Editor Options? JSME Molecule Editor Options are parameters that can be passed to...
What is Formal Charge of an atom in a molecule? And what is the total formal charge of a molecule? T...